The chief function of the ribosome is to? A Manufacture lipid molecules B provide site for...
The chief function of the ribosome is to?
A Manufacture lipid molecules
B provide site for cellular protein sythesis
C assist in active transport
D Generate forces that produce motion
Homework Answers
The correct option is
B. Provide site for cellular protein synthesis
This is a cell organelle which can be either in free form or bound to endoplasmic reticulum. Helps in synthesis of proteins. The process is called translation as it translates the information present in the messenger RNA into a chain of amino acids. They further organise into various primary, secondary, tertiary and quaternary structures.
This is a brief discussion on the given topic. Hope this helps you out. Please feel free to give a like and contact us if you need further detail explanation. Thank you and have a great day.
Add Answer to:
The chief function of the ribosome is to?
A Manufacture lipid molecules
B provide site for...
The ribosome in a cell is the site of: a. protein synthesis b. ATP formation c....
The ribosome in a cell is the site of: a. protein synthesis b. ATP formation c. lipids and steroid molecule synthesis d. intracellular digestion
15. Diffusion of water through a differentially permeable membrane is called A. active transport. B. energy....
15. Diffusion of water through a differentially permeable membrane is called A. active transport. B. energy. C. osmosis. D. All of these answers are true. 16. What happens when an animal cell is placed into a hypertonic solution? A. plasmolysis B. crenation occurs C. it swells D. it is unchanged 17. The point on the enzyme where the enzyme causes the substrate to change is called the A. attachment site. B. active site. C. binding site. D. enzyme-substrate complex 18....
33.Which organelle is the site of cellular respiration? a. chloroplast b. mitochondria c. golgi body d....
33.Which organelle is the site of cellular respiration? a. chloroplast b. mitochondria c. golgi body d. ribosome 34. Chemiosmosis is involved in making _____. a. H²O b. ADP c. ATP d. glucose 36. starch is a type of ______. a. protein b. lipid c. nucleic acid d. carbohydrate 37. An individual is DDgg. What gametes can it produce? a. Dd and Gg b. DG, Dg. dG and dg c. Dg only d. DD and gg 38. When a "high-energy" bond...
What molecules can pass people? through a lipid membrane? Which molecules are at 4. What technology...
What molecules can pass people? through a lipid membrane? Which molecules are at 4. What technology was used to figure out the fluidity of cell membranesie the membrane pids are mobile? 5. Does the mobily membrane proteins der so why Look at worksheet for das 21 Compare MPL MP2 and MP3 proteins & What is the role of SRP in the rouch ER? 7. Draw apath for a n d protein from gene expression to secretion Nudes where the is...
6. Lipid-soluble signaling molecules, such as testosterone, cross the plasma membranes of all cells A) by...
6. Lipid-soluble signaling molecules, such as testosterone, cross the plasma membranes of all cells A) by diffusion but affect only target cells because only target cells retain the appropriate DNA segments. B) by diffusion but affect only target cells because only target cells have the intracellular receptors for testosterone. C) through hydrophilic channels of transmembrane proteins but affect only target cells because only target cells retain the appropriate DNA segments. D) through hydrophilic channels of transmembrane proteins but affect only...
Of: a) NA as the site s eukaryotic cells become more specialized, the nucleus is NOT important sy...
PLEASE ANSWER ALL
of: a) NA as the site s eukaryotic cells become more specialized, the nucleus is NOT important synthesis. b) Changes in the regulation of genes, c) DNA mutation, d) synthesis of mRNA, e) Golgi apparatus synthesis 4. Which of the following is associated with Co-enzyme A by the membrane of the mitochondrion for use in the Krebs cycle? a) proteins, b) amino acids, c) fatty acids, d) pyruvate e) glycogen 5. Which is NOT a characteristic of...
6. The active site A. is located on an enzyme. B. is rich in amino acids....
6. The active site A. is located on an enzyme. B. is rich in amino acids. C. is located on a substrate. D. A. and B. E. B. and C. 9. Which of the following molecules is the oxidizing agent in cellular respiration? A. H2O B. Glucose C.O2 D. CO2 10. The substrate for glycolysis is A. Glucose. B. Acetyl-coA. C. Pyruvate D. NADH 12.Which of the following is a product of glycolysis? A. FADH2 B. CO2 C. GTP D....
41. An enzyme-substrate complex forms when substrate binds to an enzyme at the enzyme's site. 42....
41. An enzyme-substrate complex forms when substrate binds to an enzyme at the enzyme's site. 42. An inorganic ion such as zinc or manganese that is needed for an enzyme to function is acting as a 43. Competitive inhibition of enzymes occurs when: site A) catalytic B) allosterie C) operative B) cofactor C) apoenzyme D) holoenzyme A) coenzyme A) the inhibitor binds to the active site of the enzyme B) the inhibitor binds to the allosteric site of the enzyme...
Many antimicrobial agents destroy microbes by denaturing proteins. How can these agents disrupt protein function? (PLEASE...
Many antimicrobial agents destroy microbes by denaturing proteins. How can these agents disrupt protein function? (PLEASE HELP I AM VERY CONFUSED, AND EXPLAIN) The answer is not all of them, and there is more than one answer. a. cause proteins to coagulate b. dissolve lipid bilayers c. break bonds between amino acids d. block the active site of the protein
5. Genetics. Please provide complete, correct and verified solution done on computer or by hand. This...
5.
Genetics. Please provide complete, correct and verified solution
done on computer or by hand. This is all the information provided.
Please only provide answers. Thank you very much.
positions would you expecr 16. The figure below shows a replication fork in E. coli.At which of the indicated positions would you expect to see a 3'OH? A. B. D. E. A and B 17. Select the TRUE statement. E. coli mRNA A. is produced from both DNA template strands at...
15. Diffusion of water through a differentially permeable membrane is called A. active transport. B. energy. C. osmosis. D. All of these answers are true. 16. What happens when an animal cell is placed into a hypertonic solution? A. plasmolysis B. crenation occurs C. it swells D. it is unchanged 17. The point on the enzyme where the enzyme causes the substrate to change is called the A. attachment site. B. active site. C. binding site. D. enzyme-substrate complex 18....
What molecules can pass people? through a lipid membrane? Which molecules are at 4. What technology was used to figure out the fluidity of cell membranesie the membrane pids are mobile? 5. Does the mobily membrane proteins der so why Look at worksheet for das 21 Compare MPL MP2 and MP3 proteins & What is the role of SRP in the rouch ER? 7. Draw apath for a n d protein from gene expression to secretion Nudes where the is...
6. Lipid-soluble signaling molecules, such as testosterone, cross the plasma membranes of all cells A) by diffusion but affect only target cells because only target cells retain the appropriate DNA segments. B) by diffusion but affect only target cells because only target cells have the intracellular receptors for testosterone. C) through hydrophilic channels of transmembrane proteins but affect only target cells because only target cells retain the appropriate DNA segments. D) through hydrophilic channels of transmembrane proteins but affect only...
PLEASE ANSWER ALL
of: a) NA as the site s eukaryotic cells become more specialized, the nucleus is NOT important synthesis. b) Changes in the regulation of genes, c) DNA mutation, d) synthesis of mRNA, e) Golgi apparatus synthesis 4. Which of the following is associated with Co-enzyme A by the membrane of the mitochondrion for use in the Krebs cycle? a) proteins, b) amino acids, c) fatty acids, d) pyruvate e) glycogen 5. Which is NOT a characteristic of...
6. The active site A. is located on an enzyme. B. is rich in amino acids. C. is located on a substrate. D. A. and B. E. B. and C. 9. Which of the following molecules is the oxidizing agent in cellular respiration? A. H2O B. Glucose C.O2 D. CO2 10. The substrate for glycolysis is A. Glucose. B. Acetyl-coA. C. Pyruvate D. NADH 12.Which of the following is a product of glycolysis? A. FADH2 B. CO2 C. GTP D....
41. An enzyme-substrate complex forms when substrate binds to an enzyme at the enzyme's site. 42. An inorganic ion such as zinc or manganese that is needed for an enzyme to function is acting as a 43. Competitive inhibition of enzymes occurs when: site A) catalytic B) allosterie C) operative B) cofactor C) apoenzyme D) holoenzyme A) coenzyme A) the inhibitor binds to the active site of the enzyme B) the inhibitor binds to the allosteric site of the enzyme...
5.
Genetics. Please provide complete, correct and verified solution
done on computer or by hand. This is all the information provided.
Please only provide answers. Thank you very much.
positions would you expecr 16. The figure below shows a replication fork in E. coli.At which of the indicated positions would you expect to see a 3'OH? A. B. D. E. A and B 17. Select the TRUE statement. E. coli mRNA A. is produced from both DNA template strands at...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 38 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago