Tartaric acid is a molecule with three stereoisomers, D-(-)-tartaric acid, L-(+)-tartaric acid, and meso-tartaric acid. The...
Tartaric acid is a molecule with three stereoisomers, D-(-)-tartaric acid, L-(+)-tartaric acid, and meso-tartaric acid. The synthetic form of tartaric acid (the product produced in a laboratory) has an optical rotation of 0°. The meso isomer is also optically inactive. But, the melting points of the synthetic tartaric acid and the meso-tartaric acid are very different. (a) Is it possible that the synthetic form of tartaric acid is the meso isomer? Why or why not? (b) Why is the meso isomer optically inactive? (c) If the synthetic form is not the optically inactive meso isomer, why might the synthetic form have an optical rotation of 0°?
Homework Answers
Add Answer to:
Tartaric acid is a molecule with three stereoisomers,
D-(-)-tartaric acid, L-(+)-tartaric acid, and meso-tartaric acid.
The...
3. Diastereomers and Meso Forms. When a molecule has two or more stereogenic centers, stereoisomers that...
3. Diastereomers and Meso Forms. When a molecule has two or more stereogenic centers, stereoisomers that are not mirror images can exist; these are called diastereoisomers. Within this general class, there are special types of stereoisomers that are always optically inactive and are called meso forms. Construct a model with four different colored balls about a carbon center. Construct another identical to the first and verify this by the superimposition test. Now remove the same colored balls, blue (C from...
Challenge Problem 5.52 Tartare od OZCCH(OH)CH(OH)COM) was an important compound in the history of stereochemistry, Two...
Challenge Problem 5.52 Tartare od OZCCH(OH)CH(OH)COM) was an important compound in the history of stereochemistry, Two naturally occurring forms of tartaric acid are optically inactive. One optically nactive form has a melting point of 210-212°C, the other has a melting point of 140°C. The inactive tartanic acid with a melting point of 210-212c can be separated into two optically AR +12 active forms of tartanic acid with the same melting point (168-170°c). One optically active tartani adala -12 h and...
3. Diastereomers and Meso Forms. When a molecule has two or more stereogenic centers, stereoisomers that...
3. Diastereomers and Meso Forms. When a molecule has two or more stereogenic centers, stereoisomers that are not mirror images can exist; these are called diastereoisomers. Within this general class, there are special types of stereoisomers that are always optically inactive and are called meso forms. Construct a model with four different colored balls about a carbon center. Construct another identical to the first and verify this by the superimposition test. Now remove the same colored balls, blue (C from...
Q3. Fill in the following blanks with the correct answer (7 Marks) 1. Which of the...
Q3. Fill in the following blanks with the correct answer (7 Marks) 1. Which of the following process will lead to an optically inactive product A. Racemization B. Emiperization C. Asymmetric synthesis D. None of these 2. Have many optical isomers does tartaric acid have ? A. One B. Two C. three D. Four 3. Which of the following compounds exhibits geometrical isomerism A. Butyne B. 2-butene C. Isobutylene D. None of these 4. Witch of the following object is...
9. C (Z-2-hexene d. They are all of equal stability. Choose the most stable alkene among...
9. C (Z-2-hexene d. They are all of equal stability. Choose the most stable alkene among the following a 1-hexene b. (E)-2-hexene 10. What is the relation between an enantiomer's configuration and its specific rotation? (a) Rcompounds usually are dextrorotatory with few exceptions (b) R compounds always are dextrorotatory. (c) There is no relation. (d) R compounds always are levorotatory 11. How many chiral centers are there in tartaric acid, and how many different stereoisomers exist for this acid? он...
Which of the following structures is most stable? 2) How many stereoisomers does the molecule below...
Which of the following structures is most stable? 2) How many stereoisomers does the molecule below have? (СН), С+ снен снаси сна OH CH₃ br. a) 3 6) 4 c) 6 d) 8 e 9 3) Which of the following molecules below are chiral? 0) to A Boh A MOH HOS DBr e) 1, 2 and 3 a) Only 1 b) 1 and 3 c) 2 and 3 d) 1 and 3 What is the relationship between the following two...
How do I know whether the diol was meso or racemic using the NMR spectrum? Do...
How do I know whether the diol was meso or racemic using the NMR
spectrum? Do we need to see the NMR spectrum of the acetonide
product? How do they different between the compounds from meso and
racemic?
The Synthesis of 2,2-Dimethyl-1,5- Dioxolane; The Acetonide Derivative of a Vicinal Diol PRELAB EXERCISE: Draw the most stable structures of meso- and racemic-1,2-stilbenediol using Newman projections. Draw the same two isomers with the hydroxyl groups eclipsed. In Chapter 55, yellow benzil was...
Hc VCH Draw the organic product formed when CH3CH2CH2OH is treated with each reagent. a H2S04 (180°C) d SOC12, pyri...
Hc VCH Draw the organic product formed when CH3CH2CH2OH is treated with each reagent. a H2S04 (180°C) d SOC12, pyridine Ig 1) NaH; 2) CH3CH2Br b NaH e PBr3 h 1) TSCI, pyridine; 2) NaSH c HBr f TsCl, pyridine 3. Draw the organic product formed when l-methylcyclohexanol is treaded with each reagent. In some cases, no reaction occurs. a KH c HBr Te NaHCO3 b Nacid HCI f 1) KH; 2) CH3CH2Br Draw two different routes to each of...
QUESTION 1 Any reaction involving a carbonyl group and a strong acid begins with the same...
QUESTION 1 Any reaction involving a carbonyl group and a strong acid begins with the same first step, which is __________________ of the carbonyl oxygen. QUESTION 2 Using condensed molecular formulas (C#H#X#Y#) for your answers, predict the products of the reactions of C6H5CH2CHO (phenylacetaldehyde) with these reagents, and identify the functional group produced in the product. Note that the Tx symbol above allows you to do a subscript. a. NaBH4 / CH3OH b. 1. CH3MgBr; 2. H2O c. Ph3P=CHCH3 d....
Compound A Compound B Give the IUPAC name for Compound A. 2. Give the IUPAC name...
Compound A Compound B Give the IUPAC name for Compound A. 2. Give the IUPAC name for Compound B. 3. Which compound from above (Compound A or Compound B) is more soluble in water and why? 4. Which compound can be dehydrated to form a double bond (Compound A or Compound B)? Draw the most likely product of that dehydration. (Insert a picture of your drawing of the molecule or a scan of your drawing of the molecule) 5. Could...
3. Diastereomers and Meso Forms. When a molecule has two or more stereogenic centers, stereoisomers that are not mirror images can exist; these are called diastereoisomers. Within this general class, there are special types of stereoisomers that are always optically inactive and are called meso forms. Construct a model with four different colored balls about a carbon center. Construct another identical to the first and verify this by the superimposition test. Now remove the same colored balls, blue (C from...
Challenge Problem 5.52 Tartare od OZCCH(OH)CH(OH)COM) was an important compound in the history of stereochemistry, Two naturally occurring forms of tartaric acid are optically inactive. One optically nactive form has a melting point of 210-212°C, the other has a melting point of 140°C. The inactive tartanic acid with a melting point of 210-212c can be separated into two optically AR +12 active forms of tartanic acid with the same melting point (168-170°c). One optically active tartani adala -12 h and...
3. Diastereomers and Meso Forms. When a molecule has two or more stereogenic centers, stereoisomers that are not mirror images can exist; these are called diastereoisomers. Within this general class, there are special types of stereoisomers that are always optically inactive and are called meso forms. Construct a model with four different colored balls about a carbon center. Construct another identical to the first and verify this by the superimposition test. Now remove the same colored balls, blue (C from...
Q3. Fill in the following blanks with the correct answer (7 Marks) 1. Which of the following process will lead to an optically inactive product A. Racemization B. Emiperization C. Asymmetric synthesis D. None of these 2. Have many optical isomers does tartaric acid have ? A. One B. Two C. three D. Four 3. Which of the following compounds exhibits geometrical isomerism A. Butyne B. 2-butene C. Isobutylene D. None of these 4. Witch of the following object is...
9. C (Z-2-hexene d. They are all of equal stability. Choose the most stable alkene among the following a 1-hexene b. (E)-2-hexene 10. What is the relation between an enantiomer's configuration and its specific rotation? (a) Rcompounds usually are dextrorotatory with few exceptions (b) R compounds always are dextrorotatory. (c) There is no relation. (d) R compounds always are levorotatory 11. How many chiral centers are there in tartaric acid, and how many different stereoisomers exist for this acid? он...
Which of the following structures is most stable? 2) How many stereoisomers does the molecule below have? (СН), С+ снен снаси сна OH CH₃ br. a) 3 6) 4 c) 6 d) 8 e 9 3) Which of the following molecules below are chiral? 0) to A Boh A MOH HOS DBr e) 1, 2 and 3 a) Only 1 b) 1 and 3 c) 2 and 3 d) 1 and 3 What is the relationship between the following two...
How do I know whether the diol was meso or racemic using the NMR
spectrum? Do we need to see the NMR spectrum of the acetonide
product? How do they different between the compounds from meso and
racemic?
The Synthesis of 2,2-Dimethyl-1,5- Dioxolane; The Acetonide Derivative of a Vicinal Diol PRELAB EXERCISE: Draw the most stable structures of meso- and racemic-1,2-stilbenediol using Newman projections. Draw the same two isomers with the hydroxyl groups eclipsed. In Chapter 55, yellow benzil was...
Hc VCH Draw the organic product formed when CH3CH2CH2OH is treated with each reagent. a H2S04 (180°C) d SOC12, pyridine Ig 1) NaH; 2) CH3CH2Br b NaH e PBr3 h 1) TSCI, pyridine; 2) NaSH c HBr f TsCl, pyridine 3. Draw the organic product formed when l-methylcyclohexanol is treaded with each reagent. In some cases, no reaction occurs. a KH c HBr Te NaHCO3 b Nacid HCI f 1) KH; 2) CH3CH2Br Draw two different routes to each of...
Compound A Compound B Give the IUPAC name for Compound A. 2. Give the IUPAC name for Compound B. 3. Which compound from above (Compound A or Compound B) is more soluble in water and why? 4. Which compound can be dehydrated to form a double bond (Compound A or Compound B)? Draw the most likely product of that dehydration. (Insert a picture of your drawing of the molecule or a scan of your drawing of the molecule) 5. Could...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 36 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago