An acid-base equilibrium system is created by dissolving 0.50 mol CH3CO2H in water to a volume...
An acid-base equilibrium system is created by dissolving 0.50 mol CH3CO2H in water to a volume of 1.0 L. What is the effect of adding 0.50 mol CH3CO2–(aq) to this solution?
1. The pH of the solution will equal 7.00 because equal concentrations of a weak acid and its conjugate base are present.
2. Some CH3CO2H(aq) will ionize, increasing the concentration of CH3CO2–(aq) and increasing the concentration of H+.
3. Some CH3CO2–(aq) will react with H+, increasing the concentration of CH3CO2H(aq).
Homework Answers
Add Answer to:
An acid-base equilibrium system is created by dissolving 0.50
mol CH3CO2H in water to a volume...
cid-Base Properties of Salts, and Buffers Use the References to access important values if needed for...
cid-Base Properties of Salts, and Buffers Use the References to access important values if needed for this question. An acid-base equilibrium system is created by dissolving 0.50 mol CH3CO,H in water to a volume of 1.0 L. What is the effect of adding 0.50 mol CH3CO2 (aq) to this solution? 1. The pH of the solution will equal 7.00 because equal concentrations of a weak acid and its conjugate base are present. Some CH,CO, H(aq) will ionize, increasing the concentration...
QUESTION 28 What is the concentration of Hg 22+ in a saturated solution of Hg 2012...
QUESTION 28 What is the concentration of Hg 22+ in a saturated solution of Hg 2012 if K sp = 1'10-18? a. 1 10-6 M b.6.10-7M C. 3.10-7M d. 1. 10-9M O e. 2'10-'M QUESTION 29 An acid-base equilibrium system is created by dissolving 0.50 mol CH3CO 2H in water to a volume of 1.0 L. What is the effect of adding 0.50 mol CH3CO 2 (aq) to this solution? 1. The pH of the solution will equal 7.00 because...
W THE PENCERO .99 37. Consider the reaction of acetic acid in water CH3CO2H(aq)+H2O(l) = CH3CO2...
W THE PENCERO .99 37. Consider the reaction of acetic acid in water CH3CO2H(aq)+H2O(l) = CH3CO2 (aq)+H30 (aq) where K=1.8x10-5 Which two bases are competing for the proton? Which is the stronger base? Why do we classify the acetate ion (CH3CO2) as a weak base? Use an appropriate reaction to justify your answer. 38. To summarize, the conjugate base of a weak acid is a weak base and the conjugate acid of a weak base is a weak acid (weak...
a solution is prepared by mixing 2.50 g of acetic acid (CH3CO2H, FW=60g/mol, Ka=1.75x10^(-5) with 4.70...
a solution is prepared by mixing 2.50 g of acetic acid (CH3CO2H, FW=60g/mol, Ka=1.75x10^(-5) with 4.70 g of sodium acetate (CH3CO2Na, FW=82g/mol) and adding water to a 500 mL volume. Note that sodium acetate yields Na+ and CH3COO-, the conjugate base of acetic acid. a.) what is the pH? b.) 15mL of 0.50 M HCl were added to the 500 mL solution, what is the pH after addituon of acid? write answer to 3 sig. figured.
first option conjugate base or weak acid 2nd absorbs or releases 3rd. conjugate bade or weak...
first option conjugate base or weak acid
2nd absorbs or releases
3rd. conjugate bade or weak acid
4th. absorbs or releases
Examine the acetate buffer as it responds to the addition of hydrochloric acid and the addition of sodium hydroxide. CH3CO2H absorbe The buffer can maintain the solution at a steady pH, because when base is added, the conjugate base Hions, and when acid is added, the conjugata base CH3CO2" absorbs Hions.
Assume you dissolve 0.367 g of the weak acid benzoic acid, CH3CO2H, in enough water to...
Assume you dissolve 0.367 g of the weak acid benzoic acid, CH3CO2H, in enough water to make 1.00 x 102 mL of solution and then titrate the solution with 0.101 M NaOH. K, for benzoic acid = 6.3 x 10-5) CH, CO,H(aq) + OH- (aq) = CH,CO, - (aq) + H20(0) a. What was the pH of the original benzoic acid solution? pt pl pH = pt b. What are the concentrations of all of the following ions at the...
1. Identify the Brönsted acid and base in the following reaction, and identify the conjugate base...
1. Identify the Brönsted acid and base in the following reaction, and identify the conjugate base and acid formed. HSO3-(aq) + CH3NH3(aq) ------ H2SO3(aq) + CH3NH2(aq) 2. Write the formulae for the conjugate acids of: 1. a) C2042: the oxalate ion. 2.b) C6H5NH2, aniline. 3.c)NH2OH, hydroxylamine. (Use above question as a guide for where to put the H.) 3. Calculate the molarity of OH' in solutions with the following concentrations of H30*: a) 0.020 mol LP b) 1.0 x 10-5...
what is the ph of a solution prepared by dissolving 0.50 mol of acetic acid and...
what is the ph of a solution prepared by dissolving 0.50 mol of acetic acid and 0.2 mol of sodium acetate in water and adjusting the volume of 0.5L if the pka for acetic acid is 4.75. of 0.010 mol of sodium hydroxide is added to the buffer solution from part (a), determine the ph of the new solution
A buffer is made having a weak acid concentration of 0.50 M and a conjugate base...
A buffer is made having a weak acid concentration of 0.50 M and a conjugate base concentration of 0.67 M. If the weak acid has a Ka of 4.5 x 10-6, what is the pH of the buffer? Answer with 3 sig figs.
A buffer was prepared by dissolving 0.255 mol of the weak acid HA (K_a = 3.90...
A buffer was prepared by dissolving 0.255 mol of the weak acid HA (K_a = 3.90 times 10-^4) plus 0.075 mol of its conjugate base Na^+A^- in 1.00 L. Find the pH. _____________
cid-Base Properties of Salts, and Buffers Use the References to access important values if needed for this question. An acid-base equilibrium system is created by dissolving 0.50 mol CH3CO,H in water to a volume of 1.0 L. What is the effect of adding 0.50 mol CH3CO2 (aq) to this solution? 1. The pH of the solution will equal 7.00 because equal concentrations of a weak acid and its conjugate base are present. Some CH,CO, H(aq) will ionize, increasing the concentration...
QUESTION 28 What is the concentration of Hg 22+ in a saturated solution of Hg 2012 if K sp = 1'10-18? a. 1 10-6 M b.6.10-7M C. 3.10-7M d. 1. 10-9M O e. 2'10-'M QUESTION 29 An acid-base equilibrium system is created by dissolving 0.50 mol CH3CO 2H in water to a volume of 1.0 L. What is the effect of adding 0.50 mol CH3CO 2 (aq) to this solution? 1. The pH of the solution will equal 7.00 because...
W THE PENCERO .99 37. Consider the reaction of acetic acid in water CH3CO2H(aq)+H2O(l) = CH3CO2 (aq)+H30 (aq) where K=1.8x10-5 Which two bases are competing for the proton? Which is the stronger base? Why do we classify the acetate ion (CH3CO2) as a weak base? Use an appropriate reaction to justify your answer. 38. To summarize, the conjugate base of a weak acid is a weak base and the conjugate acid of a weak base is a weak acid (weak...
first option conjugate base or weak acid
2nd absorbs or releases
3rd. conjugate bade or weak acid
4th. absorbs or releases
Examine the acetate buffer as it responds to the addition of hydrochloric acid and the addition of sodium hydroxide. CH3CO2H absorbe The buffer can maintain the solution at a steady pH, because when base is added, the conjugate base Hions, and when acid is added, the conjugata base CH3CO2" absorbs Hions.
Assume you dissolve 0.367 g of the weak acid benzoic acid, CH3CO2H, in enough water to make 1.00 x 102 mL of solution and then titrate the solution with 0.101 M NaOH. K, for benzoic acid = 6.3 x 10-5) CH, CO,H(aq) + OH- (aq) = CH,CO, - (aq) + H20(0) a. What was the pH of the original benzoic acid solution? pt pl pH = pt b. What are the concentrations of all of the following ions at the...
1. Identify the Brönsted acid and base in the following reaction, and identify the conjugate base and acid formed. HSO3-(aq) + CH3NH3(aq) ------ H2SO3(aq) + CH3NH2(aq) 2. Write the formulae for the conjugate acids of: 1. a) C2042: the oxalate ion. 2.b) C6H5NH2, aniline. 3.c)NH2OH, hydroxylamine. (Use above question as a guide for where to put the H.) 3. Calculate the molarity of OH' in solutions with the following concentrations of H30*: a) 0.020 mol LP b) 1.0 x 10-5...
A buffer was prepared by dissolving 0.255 mol of the weak acid HA (K_a = 3.90 times 10-^4) plus 0.075 mol of its conjugate base Na^+A^- in 1.00 L. Find the pH. _____________
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 46 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago