IV) Which is the best explanation for the negative sign of ASº in the following reaction?...
Question 1 (1 point) Reaction of chromium metal with phosphoric acid produces chromium(lI) phosphate and hydrogen gas. Select the correct balanced equation O2Cr(s)+2H3PO4laq)-- 2CrPO4(s)+6H(g) O2Cr(s)+2H3PO4laq)--2CrPO4(s)+3H2(g) O3Cr(s)+3H3PO4(aq)--Cr3(PO4]3(s)+3 H2{g) O2Cr(s)+2H3PO3(aq)--2CrPO3(s)+3H2(g) Question 2 (1 point) Methane gas (CH4) reacts with steam (H20 (g)) to produce hydrogen gas and carbon monoxide gas. Select the correct balanced equation. OCHalg) +H20(g) -- 6H(g)+CO(g) O2CH4(8)+H20(g)- 3H2(g)+2CO(g) OCH4(8) +H20(g) - 3H2(g)+CO(g) OCH4(8) +2H208)-- 4H2{g)+CO2{g) Question 3 (1 point) When the following equation is balanced using the smallest possible...
if you can't answer all ,please don't answer 1) of the reactions below, which one is a decomposition reaction? A) Ca(NO3)2 + Na2S -- CdS +2NaNO3 B) NH4Cl- NH3 + HCI C) 2Mg + 02 - 2MgO D) 2N2 + 3H2 → 2NH3 E) 2CH4 + 402 - 2002 + 4H20 miches of - x 1? 2 2) Calculate the percentage by mass of ammonia in cisplatin, PtCl2/NH3 12. A) 12.53 B) 5.68 C) 18.09 D) 11.35 E) 4.67 3)...