Homework Answers
Add Answer to:
how to synthesize the following compunds
following compands How to synthesize the CHACHz 1. CH 3...
How would you synthesize the following products? Thank you! Y 3. How would you synthesize the...
How would you synthesize the following products? Thank
you!
Y 3. How would you synthesize the following products? Br HBK HC CH Br
DOME 4. What will be the best way to synthesize the following compound starting from benzene?...
DOME 4. What will be the best way to synthesize the following compound starting from benzene? the o ů na A. 1) CH3CH2CI, AICI3; 2) Cl2, FeCl3 B. 1) CH2=CH2, HF; 2) Cl2, FeCl3; ovods and to none C. 1) CH3CO-O-COCH3, AICI3; 2) Cl2, FeCl3; 3) Zn, HCI; D. 1) CH3CO-O-COCH3, AICI3; 2) Zn, HCI; 3) Cl2, FeCl3; E. none of the above EVE. none droedsw abruogo Oriollot to 8 Smund og tengsmont to 5. What set of reagents will...
1. Which Wittig reagent would be used to synthesize 2 CH-CH=P(CAH) CH=P(CHẠh. P(CH3)3 CH,CH,CH-P(CH3)3 IV 2....
1. Which Wittig reagent would be used to synthesize 2 CH-CH=P(CAH) CH=P(CHẠh. P(CH3)3 CH,CH,CH-P(CH3)3 IV 2. What is the correct IUPAC name for the following compound? 6 eye 3. What is the correct structure for 7-methyl-4-octanone? 3 4. The products, D and E, of the following reaction sequence, S "CN HCI HCN CH.NO H20 heat would be: CH2CH2CN CH,CH,MgBe HO E ? ether Show how you would synthesize the following compound, beginning with 1-butene, Bromobenzene and any necessary additional reagents....
What kind of monomer should be used to synthesize the following polymer: OCH3 OCH3 OCH3 CH2-CH-CH2-CH-CH2-CH...
What kind of monomer should be used to synthesize the following
polymer:
OCH3 OCH3 OCH3 CH2-CH-CH2-CH-CH2-CH CI CI CI CI CI CI CH-CH-CH-CH-CHCH-
les of reagents to synthesize cach of the following compounds List the reagent(s) in order that...
les of reagents to synthesize cach of the following compounds List the reagent(s) in order that will accomplish this transformation, beginning with the number of the starting material. Enter your choices without spaces or punctuation (i.e ledcba). Starting materials C C Н.С OEt EtO OEt 2 Reagents f. EtO Na a. CH Br k. NaOH, H2O b. CH CH Br g. SOC h. NH3 L CH NH HCI, HO, heat I с. Cн,CH,CH,Br d. (CHa)2CHBr e. CH3CH2CH(Br)CH NH(CH) Compound 1:...
4. a. Synthesize cyclopentanecarboxylic acid by alkyl dihalide and CH2(CO2CH3)h b. Synthesize 3-ethyl-2-hexanone by alkylation of...
4. a. Synthesize cyclopentanecarboxylic acid by alkyl dihalide and CH2(CO2CH3)h b. Synthesize 3-ethyl-2-hexanone by alkylation of CH,COCH,CO,CH
Which of the following could be used to synthesize 1-bromopentane? OOOOO CH3CH2CH2CH=CH2 + HBr- CH3CH2CH2CH2CH2OH +...
Which of the following could be used to synthesize 1-bromopentane? OOOOO CH3CH2CH2CH=CH2 + HBr- CH3CH2CH2CH2CH2OH + NaBr CH3CH2CH2CH=CH2 + Br2- CH3CH2CH2CH2CH2OH + PBr3 CH3CH2CH2CH2CH2OH + Brz- In a carbon radical, the carbon possesses how many valence electrons? 0 0 Od 6 0 Heating 2-ethoxyhexanewith one equivalent of concentrated HBr would produce: Oa Ob OC Od Оe CH3CH2OH and CH3CH2CH2CH2CHBCH3 CH2CH2Br and CH3CH2CH2CH2CH(OH)CH3 CH3CH2OCH2CH2CH2CH2CH2CH2Br BrCH2CH2OCH2CH2CH2CH2CH2CH3 CH3CH2Br and CH3CH2CH(OH)CH2CH2CH3
() 1. Which of the following alkyl holides would you expect to be most reactive in a unimolecular reaction? CH3 a)...
() 1. Which of the following alkyl holides would you expect to be most reactive in a unimolecular reaction? CH3 a) CsM , CH, CH, CH, Br b) CEHCH CH BY c) CH, CCH, Br d) CH, CH2 CH CHE сн. он сня Br e) CHICCHE CH3 (4). 2. What would you expect to be the chief organic product(s) when tert-butyl bromide reacts with sodium acetylide, i.e.. CH + - CH3-C-Br + Na CECH ? CH a) 1 b) II...
U > Question 4 US Name the following compound. Br H CH H H CH,CH, 1-bromo-1-methylbutane...
U > Question 4 US Name the following compound. Br H CH H H CH,CH, 1-bromo-1-methylbutane 1-bromo-2-methylbutane 3-bromo-2,4-dimethylhexane BO 4-bromo-2.2.3-trimethylhexane
5. What set of reagents will best accomplish the following transformation? NO2 A. 1) CH3CH2CH=CH2, HF;...
5. What set of reagents will best accomplish the following transformation? NO2 A. 1) CH3CH2CH=CH2, HF; 2) H2SO4; 3) HNO3, H2SO4; 4) H2O, heat; B. 1) CH2CH2CH=CH2, HF; 2) H2SO4; 3) HNO3, H2SO4; c. 1) HNO3, H2SO.; 2) CH3CH2CH=CH2, HF; D. 1) CH,CH,CH=CH2, HF; 2) HNO3, H,SO.; E. none of the above
How would you synthesize the following products? Thank
you!
Y 3. How would you synthesize the following products? Br HBK HC CH Br
DOME 4. What will be the best way to synthesize the following compound starting from benzene? the o ů na A. 1) CH3CH2CI, AICI3; 2) Cl2, FeCl3 B. 1) CH2=CH2, HF; 2) Cl2, FeCl3; ovods and to none C. 1) CH3CO-O-COCH3, AICI3; 2) Cl2, FeCl3; 3) Zn, HCI; D. 1) CH3CO-O-COCH3, AICI3; 2) Zn, HCI; 3) Cl2, FeCl3; E. none of the above EVE. none droedsw abruogo Oriollot to 8 Smund og tengsmont to 5. What set of reagents will...
1. Which Wittig reagent would be used to synthesize 2 CH-CH=P(CAH) CH=P(CHẠh. P(CH3)3 CH,CH,CH-P(CH3)3 IV 2. What is the correct IUPAC name for the following compound? 6 eye 3. What is the correct structure for 7-methyl-4-octanone? 3 4. The products, D and E, of the following reaction sequence, S "CN HCI HCN CH.NO H20 heat would be: CH2CH2CN CH,CH,MgBe HO E ? ether Show how you would synthesize the following compound, beginning with 1-butene, Bromobenzene and any necessary additional reagents....
What kind of monomer should be used to synthesize the following
polymer:
OCH3 OCH3 OCH3 CH2-CH-CH2-CH-CH2-CH CI CI CI CI CI CI CH-CH-CH-CH-CHCH-
les of reagents to synthesize cach of the following compounds List the reagent(s) in order that will accomplish this transformation, beginning with the number of the starting material. Enter your choices without spaces or punctuation (i.e ledcba). Starting materials C C Н.С OEt EtO OEt 2 Reagents f. EtO Na a. CH Br k. NaOH, H2O b. CH CH Br g. SOC h. NH3 L CH NH HCI, HO, heat I с. Cн,CH,CH,Br d. (CHa)2CHBr e. CH3CH2CH(Br)CH NH(CH) Compound 1:...
4. a. Synthesize cyclopentanecarboxylic acid by alkyl dihalide and CH2(CO2CH3)h b. Synthesize 3-ethyl-2-hexanone by alkylation of CH,COCH,CO,CH
Which of the following could be used to synthesize 1-bromopentane? OOOOO CH3CH2CH2CH=CH2 + HBr- CH3CH2CH2CH2CH2OH + NaBr CH3CH2CH2CH=CH2 + Br2- CH3CH2CH2CH2CH2OH + PBr3 CH3CH2CH2CH2CH2OH + Brz- In a carbon radical, the carbon possesses how many valence electrons? 0 0 Od 6 0 Heating 2-ethoxyhexanewith one equivalent of concentrated HBr would produce: Oa Ob OC Od Оe CH3CH2OH and CH3CH2CH2CH2CHBCH3 CH2CH2Br and CH3CH2CH2CH2CH(OH)CH3 CH3CH2OCH2CH2CH2CH2CH2CH2Br BrCH2CH2OCH2CH2CH2CH2CH2CH3 CH3CH2Br and CH3CH2CH(OH)CH2CH2CH3
() 1. Which of the following alkyl holides would you expect to be most reactive in a unimolecular reaction? CH3 a) CsM , CH, CH, CH, Br b) CEHCH CH BY c) CH, CCH, Br d) CH, CH2 CH CHE сн. он сня Br e) CHICCHE CH3 (4). 2. What would you expect to be the chief organic product(s) when tert-butyl bromide reacts with sodium acetylide, i.e.. CH + - CH3-C-Br + Na CECH ? CH a) 1 b) II...
U > Question 4 US Name the following compound. Br H CH H H CH,CH, 1-bromo-1-methylbutane 1-bromo-2-methylbutane 3-bromo-2,4-dimethylhexane BO 4-bromo-2.2.3-trimethylhexane
5. What set of reagents will best accomplish the following transformation? NO2 A. 1) CH3CH2CH=CH2, HF; 2) H2SO4; 3) HNO3, H2SO4; 4) H2O, heat; B. 1) CH2CH2CH=CH2, HF; 2) H2SO4; 3) HNO3, H2SO4; c. 1) HNO3, H2SO.; 2) CH3CH2CH=CH2, HF; D. 1) CH,CH,CH=CH2, HF; 2) HNO3, H,SO.; E. none of the above
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 54 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago