If someone can help me understand this, thank you
Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
If someone can help me understand this, thank you
Testbank, Question 079 Which of the following...
Can someone help me with both of these, id appreciate it THANK YOU!!!!!! 3. For the...
Can someone help me with both of these, id appreciate it
THANK YOU!!!!!!
3. For the following reaction, please draw the transition state of the rate-limiting step CH2CH3 CH3OH "H H2SO4, 25 °C in the rate- 4. What are the electrophile and the nucleophile limiting step of the following reaction? Lo hamon HCI
Please answer all the questions. Will rate! Testbank, Question 046 Provide the reagent(s) necessary to carry out the following conversion. NO2 NH2 H2 and Ni 2. H20 Fe and HCI Zn and HCI O all o...
Please answer all the questions.
Will rate!
Testbank, Question 046 Provide the reagent(s) necessary to carry out the following conversion. NO2 NH2 H2 and Ni 2. H20 Fe and HCI Zn and HCI O all of these Testbank, Question 057 Predict the product for the following reaction. 1. CH3CH2Br 1. CH3Br NH2 2. -NH4Br 2. -NH4Br Testbank, Question 070 Predict the product for the following reaction NH2 H2SO4 HO NH HN IV C II c IV
Testbank, Question 046 Provide...
Hello! ❤️ I humbly ask that someone please help me with the following question. I thank...
Hello! ❤️ I humbly ask that someone please help me with the
following question. I thank you and I appreciate you. :)
Q: What is the major product formed in each of the following
reactions:
CH3CH=CH2 + HBO CECH HgSO4 H20/ H2SO4 H2SO4 OH ethanol + NaOCH3 OCH stered ОН Na2Cr2O7 H2SO4 (9) CH3NH2 + HBO (10) HBr o ochots Her OCH2CH3
Can someone please help me with these predict the products. Predict the Product. Provide the stable...
Can someone please help me with these predict the
products.
Predict the Product. Provide the stable organic product(s) for the reactions below. 1. Mgº, CH3CH2OCH2CH3 2. CO2 (g) 3. H20, HCI 1. ~ MgBr (xs) 2. H20, HCI 1. K2Cr2O7, H2SO4, H2O 2. CH3MgBr (1 eq.) 3. H20, HCI 1. Mgº, CH3CH2OCH2CH3 2. H20, HCI
Can someone help me understand why this one is wrong? thank you so much. Incorrect Question...
Can someone help me understand why this one is wrong?
thank you so much.
Incorrect Question 2 0/2 pts Calculate the change in internal energy for a system that is giving off 45.0 kJ of heat and is performing 855 J of work on the surrounding. -45.9 kJ 44.1 kJ 9.00 x 10^2 kJ -9.00 x 10^2 kJ
Organic Chemistry question partial step of a synthesis. Can someone explain the mechanism? Thank you. c)...
Organic Chemistry question
partial step of a synthesis. Can someone explain the mechanism?
Thank you.
c) NaOH, H2O O O HCI, H20 d) Heat cyclobutyl methyl ketone
Predict the Products. Can you please show it step by step. It will help me understand...
Predict the Products. Can you please show it step by step. It
will help me understand more. Thank you in advance
2. D2 CH3CH2-C=C-CH3 Indy 3 Lindlar catalyst -C=C-H 1.BH, THF 2.H20, NaOH, H2O KMnO4 H20+ 5. CH3CH2C=CH HgSO4, H2SO4 Н20
Testbank question 166 Which sequence of reagents would be expected to accomplish the synthesis shown? nt...
Testbank question 166 Which sequence of reagents would
be expected to accomplish the synthesis shown?
nt BACK FULL SCREEN PRINTER VERSION Testbank, Question 166 X Your answer is incorrect. Try again Which sequence of reagents would be expected to accomplish the synthesis shown? 1) HBr/ROOR; 2) excess NaNH2 1) HBr; 2) 2 NaNH2 1) Br2, CCI4 2) 2 NaNH2 1) Br2, H20; 2) NaNH2 1) Na, NH3)
Will you help me with the missing products or reagents for these reactions? Thank you. excess...
Will you help me with the missing products or reagents for these
reactions? Thank you.
excess Na2Cr2O7/H2SO4/H20 A. Cl2 hv B. t excess 1. KMnO4/NaOH/H20 2. H307 C.
Hi, Can someone please help me with the following biology question? Thank you! :) ________________ QUESTION...
Hi, Can someone please help me with the following biology question? Thank you! :) ________________ QUESTION 49. You're a college student working a biology laboratory during a summer research internship. In your lab, the enzyme catalase was studied in the presence of two types of enzyme inhibitors. Results are shown in the following table: Average Catalase Rates (in mL O2 / minute) at pH 6.5 Using Two Inhibitors Peroxide Stock (mM) No Inhibitor + Inhibitor A + Inhibitor B 25...
Can someone help me with both of these, id appreciate it
THANK YOU!!!!!!
3. For the following reaction, please draw the transition state of the rate-limiting step CH2CH3 CH3OH "H H2SO4, 25 °C in the rate- 4. What are the electrophile and the nucleophile limiting step of the following reaction? Lo hamon HCI
Please answer all the questions.
Will rate!
Testbank, Question 046 Provide the reagent(s) necessary to carry out the following conversion. NO2 NH2 H2 and Ni 2. H20 Fe and HCI Zn and HCI O all of these Testbank, Question 057 Predict the product for the following reaction. 1. CH3CH2Br 1. CH3Br NH2 2. -NH4Br 2. -NH4Br Testbank, Question 070 Predict the product for the following reaction NH2 H2SO4 HO NH HN IV C II c IV
Testbank, Question 046 Provide...
Hello! ❤️ I humbly ask that someone please help me with the
following question. I thank you and I appreciate you. :)
Q: What is the major product formed in each of the following
reactions:
CH3CH=CH2 + HBO CECH HgSO4 H20/ H2SO4 H2SO4 OH ethanol + NaOCH3 OCH stered ОН Na2Cr2O7 H2SO4 (9) CH3NH2 + HBO (10) HBr o ochots Her OCH2CH3
Can someone please help me with these predict the
products.
Predict the Product. Provide the stable organic product(s) for the reactions below. 1. Mgº, CH3CH2OCH2CH3 2. CO2 (g) 3. H20, HCI 1. ~ MgBr (xs) 2. H20, HCI 1. K2Cr2O7, H2SO4, H2O 2. CH3MgBr (1 eq.) 3. H20, HCI 1. Mgº, CH3CH2OCH2CH3 2. H20, HCI
Can someone help me understand why this one is wrong?
thank you so much.
Incorrect Question 2 0/2 pts Calculate the change in internal energy for a system that is giving off 45.0 kJ of heat and is performing 855 J of work on the surrounding. -45.9 kJ 44.1 kJ 9.00 x 10^2 kJ -9.00 x 10^2 kJ
Organic Chemistry question
partial step of a synthesis. Can someone explain the mechanism?
Thank you.
c) NaOH, H2O O O HCI, H20 d) Heat cyclobutyl methyl ketone
Predict the Products. Can you please show it step by step. It
will help me understand more. Thank you in advance
2. D2 CH3CH2-C=C-CH3 Indy 3 Lindlar catalyst -C=C-H 1.BH, THF 2.H20, NaOH, H2O KMnO4 H20+ 5. CH3CH2C=CH HgSO4, H2SO4 Н20
Testbank question 166 Which sequence of reagents would
be expected to accomplish the synthesis shown?
nt BACK FULL SCREEN PRINTER VERSION Testbank, Question 166 X Your answer is incorrect. Try again Which sequence of reagents would be expected to accomplish the synthesis shown? 1) HBr/ROOR; 2) excess NaNH2 1) HBr; 2) 2 NaNH2 1) Br2, CCI4 2) 2 NaNH2 1) Br2, H20; 2) NaNH2 1) Na, NH3)
Will you help me with the missing products or reagents for these
reactions? Thank you.
excess Na2Cr2O7/H2SO4/H20 A. Cl2 hv B. t excess 1. KMnO4/NaOH/H20 2. H307 C.
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 41 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 4 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 6 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago