Homework Answers
Add Answer to:
stitution on the following seconday A SN1 B. SN2 unnindcrco to and by the nurschile C....
HWS 5: Due 10/30/2019 15 points total SN1, SN2, Elimination pt 1 1. (10 pts) For...
HWS 5: Due 10/30/2019 15 points total SN1, SN2, Elimination pt 1 1. (10 pts) For the following reactions: a. Label the Nucleophile (Nu) and whether it is strong or weak b. Label the Electrophile (E) and whether it is primary, secondary, or tertiary and circle the leaving group C. Label the Solvent and whether it is polar protic or polar aprotic d. Categorize each as preferring SN1, Preferring SN2, or could do either e. Draw the product of the...
Draw the products of the following reaction and identify the following as SN1, SN2. For letters...
Draw the products of
the following reaction and identify the following as SN1, SN2. For
letters G and H.
NaOH DMSO g. OB Br NaCN h. 2.. Draw the products of the following reaction and label the follow SN2, E1 or E2 reaction. { HEAT FAVORS ELIMINATION}(18 poi 0BN is a bulty hindved proton C 30 carbau so v CH3 CI DBN a. El el Br NaOEt, heat - NaBv Na08t isa protic solvcut ad involee Ad cliuinitiar Readrans b....
please hurry medewes the best leaving group? mist the expected for product of the following reaction...
please hurry
medewes the best leaving group? mist the expected for product of the following reaction sequence? 1. A-BUOK, BUOH Question 23 What type of solvent is ethanol (EtOH)? 4. polar aprotic apolar aprotic polar protic
+ Fit to page Page view 1. (10 pts) For the following reactions: a. Label the...
+ Fit to page Page view 1. (10 pts) For the following reactions: a. Label the Nucleophile (Nu) and whether it is strong or weak b. Label the Electrophile (E) and whether it is primary, secondary, or tertiary and circle the leaving group c. Label the Solvent and whether it is polar protic or polar aprotic d. Categorize each as preferring SN1, Preferring SN2, or could do either e Draw the product of the reaction, based upon your categorization, remember...
2. (a) For the following reaction, what solvent would favor SN2 (protic or aprotic)? Provide one example of...
2. (a) For the following reaction, what solvent would favor SN2 (protic or aprotic)? Provide one example of the appropriate solvent. (b) Please explain why you chose your answer for (a). (CH3)3 + CH31 acetone CI oo. cHS Na DMSO + CHES Na DMSO V + oH Ethanoi NH2 + HOANH, CH31 acetone Өон OH (R)-3-bromo-3-methylhexane Previous Next Dashboard Calendar To Do Notifications
For the chemical reaction answer the following questions: 1. Is the mechanism Sn1 or Sn2? 2....
For the chemical reaction answer the following questions:
1. Is the mechanism Sn1 or Sn2?
2. What kind of substrate reacts in the following reaction? (2 °
, 2 ° allylic , 3 ° )
3. Is the role of the alkyl halide reactant an acid, base,
electrophile, nucleophile , or both a nucleophile and base?
4. Is the role of the reagent KI an acid, base, electrophile,
nucleophile , or both a nucleophile and base?
5. What is the...
a. Label each of the following as a nonpolar, borderline polar, or polar solvent. b. Label...
a. Label each of the following as a nonpolar, borderline polar, or polar solvent. b. Label each solvent as protic or aprotic c. Then, label which reaction the solvent will help promote: SN1, SN2 or neither. HO CI CI dichloromethane moi propanol acetone benzene
For the following two SN2 reactions A and B, indicate which reaction occurs in the protic...
For the following two SN2 reactions A and B, indicate which reaction occurs in the protic solvent and which the aprotic solvent, AND, indicate which reactions would be faster A or B, you do NOT need to give an explanation. A CH30-*Na ~ Cor: Br: - Cho Na> ocH, CH3OH CH3O-+Na BM : CHzo "Na → M ochy CH3CN
Compare and contrast SN1, SN2, E1 and E2 reactions. What are some obvious similarities and differences...
Compare and contrast SN1, SN2, E1 and E2 reactions. What are some obvious similarities and differences between each reaction pathway? What are the requirements for each reaction to work? Discuss why SN2 is in direct competition with E2 while SN1 is in direct competition with the E1 reaction pathway. What is the rate expression for each? Which reactions are concerted? Which reactions are step-wise? Which reactions are stereospecific and what is the stereospecificity of each that are? How do the...
CHM 2210 Homework 18 Not available in stores! t BuOH + Naot Bu -----1. What is...
CHM 2210 Homework 18 Not available in stores! t BuOH + Naot Bu -----1. What is the major organic product from the following reaction? OBU + Naot Bu -2 What is the major organic product from the following reaction? tBuOH B. D. ----3. Which set contains only polar aprotic solvents? A. acetic acid, DMF, toluene C. water, hexane, methanol B. DMSO, ethanol, acetonitrile D. DMF, acetonitrile, DMSO ----4. Which favors elimination over substitution in a reaction with KOCH,? A. bromo...
HWS 5: Due 10/30/2019 15 points total SN1, SN2, Elimination pt 1 1. (10 pts) For the following reactions: a. Label the Nucleophile (Nu) and whether it is strong or weak b. Label the Electrophile (E) and whether it is primary, secondary, or tertiary and circle the leaving group C. Label the Solvent and whether it is polar protic or polar aprotic d. Categorize each as preferring SN1, Preferring SN2, or could do either e. Draw the product of the...
Draw the products of
the following reaction and identify the following as SN1, SN2. For
letters G and H.
NaOH DMSO g. OB Br NaCN h. 2.. Draw the products of the following reaction and label the follow SN2, E1 or E2 reaction. { HEAT FAVORS ELIMINATION}(18 poi 0BN is a bulty hindved proton C 30 carbau so v CH3 CI DBN a. El el Br NaOEt, heat - NaBv Na08t isa protic solvcut ad involee Ad cliuinitiar Readrans b....
please hurry
medewes the best leaving group? mist the expected for product of the following reaction sequence? 1. A-BUOK, BUOH Question 23 What type of solvent is ethanol (EtOH)? 4. polar aprotic apolar aprotic polar protic
+ Fit to page Page view 1. (10 pts) For the following reactions: a. Label the Nucleophile (Nu) and whether it is strong or weak b. Label the Electrophile (E) and whether it is primary, secondary, or tertiary and circle the leaving group c. Label the Solvent and whether it is polar protic or polar aprotic d. Categorize each as preferring SN1, Preferring SN2, or could do either e Draw the product of the reaction, based upon your categorization, remember...
2. (a) For the following reaction, what solvent would favor SN2 (protic or aprotic)? Provide one example of the appropriate solvent. (b) Please explain why you chose your answer for (a). (CH3)3 + CH31 acetone CI oo. cHS Na DMSO + CHES Na DMSO V + oH Ethanoi NH2 + HOANH, CH31 acetone Өон OH (R)-3-bromo-3-methylhexane Previous Next Dashboard Calendar To Do Notifications
For the chemical reaction answer the following questions:
1. Is the mechanism Sn1 or Sn2?
2. What kind of substrate reacts in the following reaction? (2 °
, 2 ° allylic , 3 ° )
3. Is the role of the alkyl halide reactant an acid, base,
electrophile, nucleophile , or both a nucleophile and base?
4. Is the role of the reagent KI an acid, base, electrophile,
nucleophile , or both a nucleophile and base?
5. What is the...
a. Label each of the following as a nonpolar, borderline polar, or polar solvent. b. Label each solvent as protic or aprotic c. Then, label which reaction the solvent will help promote: SN1, SN2 or neither. HO CI CI dichloromethane moi propanol acetone benzene
For the following two SN2 reactions A and B, indicate which reaction occurs in the protic solvent and which the aprotic solvent, AND, indicate which reactions would be faster A or B, you do NOT need to give an explanation. A CH30-*Na ~ Cor: Br: - Cho Na> ocH, CH3OH CH3O-+Na BM : CHzo "Na → M ochy CH3CN
CHM 2210 Homework 18 Not available in stores! t BuOH + Naot Bu -----1. What is the major organic product from the following reaction? OBU + Naot Bu -2 What is the major organic product from the following reaction? tBuOH B. D. ----3. Which set contains only polar aprotic solvents? A. acetic acid, DMF, toluene C. water, hexane, methanol B. DMSO, ethanol, acetonitrile D. DMF, acetonitrile, DMSO ----4. Which favors elimination over substitution in a reaction with KOCH,? A. bromo...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago