Please explain reasoning behind solution. Show that the Poisson pmf is a pmf.
Please explain reasoning behind solution.
Show that the Poisson pmf is a pmf.
Homework Answers
Vote if this is useful.
Add Answer to:
Please explain reasoning behind solution.
Show that the Poisson pmf is a pmf.
Please explain the reasoning behind the answer. (A) Which of the following molecules behaves as both...
Please explain the reasoning
behind the answer.
(A) Which of the following molecules behaves as both an X- and L-type ligand to a transition metal cation CH3 CEN H3C CH3 (C) Which organic halide shows the largest reactivity towards nucleophilic substitution by ethanol? H Br Br H Br H Br
Please answer and explain the reasoning behind it. PART III: Read Carefully and show all computations...
Please answer and explain the reasoning behind it.
PART III: Read Carefully and show all computations (for partial credit calculations). 26. Record the following transactions for the month of March in the financial statements effects template below. A) Collected $2,000 from a customer for a balance that was due on accounts receivable. B) Services were completed and billed to customers in March in the amount of $1,500 C) Paid $3,000 for rent for the months April, May, and June D)...
Please explain the reasoning behind your answers. Consider the figure to the right where a conductive...
Please explain the reasoning behind your answers.
Consider the figure to the right where a conductive shell of radius a and thickness h (h << a) is placed around the origin. A charge Q is placed a distance L from the center of the shell. What is the electric potential V(x, y) outside the shell? What is V(x, y) outside the shell if the shell is not grounded? What is V(x, y) outside the shell if the shell is charged...
Please rank the stability of 1-butene, trans-2-butene, and cis-2-butene, and explain the reasoning behind the heats...
Please rank the stability of 1-butene, trans-2-butene, and cis-2-butene, and explain the reasoning behind the heats of hydrogenation, as it relates to each molecule. In your own words, explain the difference between 1,2 and 1,4 additions. Please include terms of allylic carbocation, delocalization, and resonance. 3-5 sentences will be sufficient. Please explain, detail, the differences in the hydrohalogenation across the double bond with regards to Markovnikov and Non-Markovnikov this is all one question please type answer i cannot always understand...
Explain the reasoning behind the use of the LRU algorithm for virtual memory page replacement and...
Explain the reasoning behind the use of the LRU algorithm for virtual memory page replacement and file system buffer caches
In this problem we show directly that the sum of independent Poisson random variables is Poisson....
In this problem we show directly that the sum of independent Poisson random variables is Poisson. Let J and K be independent Poisson random variables with expected values α and respectively. Show that Ņ J+K is a Poisson random variable with expected value α+β Hint: Show that 72 Pk (m)P, (n-m and then simplify the summation be extracting the sum of a binomial PMF over al possible values.
In this problem we show directly that the sum of independent Poisson...
Please Show Clear Steps and Reasoning Behind Your Work!! Thank You !! Draw the resonance forms...
Please Show Clear Steps and Reasoning Behind Your Work!! Thank
You !!
Draw the resonance forms of the following molecules (15 points on quiz). Use curved arrow notation to indicate the movement of electrons (5 points on quiz) and circle the dominant contributor to the resonance hybrid. You must state why you chose your answer to get credit!!! (5 points on quiz) a. HO + b. O: C.
Please explain where does the "e^-2" come from Consider a discrete random variable whose PMF is...
Please explain where does the
"e^-2" come from
Consider a discrete random variable whose PMF is given by Px-0.1.2, a) Determine the constant c. What is the class of distribution X belongs to, and what is the parameter of X as a member of that class? Since 00 21 0O thus CO -2 2i Note that P(X-)-e2. f is the PMF of Poisson distribution with parameter 2 3
Please explain your reasoning behind the answers. 2.) Identify each reaction as either an 'oxidation' or...
Please explain your reasoning behind the answers.
2.) Identify each reaction as either an 'oxidation' or a ‘reduction'. RE + TMSN+ TOISO,Na + TsN, 3a Ag3PO4(20 mol %) H2O (2.0 equiv) DMSO. 70 °C, 10 h R NHTS 1 a. J. Am. Chem. Soc. ASAP, Published online January 22, 2019 PdCl(Ph)(PPh3)2 (0.1 mol %) THF/toluene, rt, 1-3 h 0 R1R2 R1SP + BrZ-R2 c. 36 Org. Lett. ASAP, Published online January 18, 2019
Can you please explain the solution and theory/reasoning behind your answer because I would like to...
Can you please explain the solution and theory/reasoning
behind your answer because I would like to learn how to solve this
problem. Thank you so much!
I need help with question 40 but it requires the completion of
questions 38 and 39 :(
38. Suppose that demand for motivational posters is given by Qd = 400 - 10P and supply is given by Qs = 100+ 5P. Additionally, because motivational posters are a horrifying torture devised by middle-managers, they impose...
Please explain the reasoning
behind the answer.
(A) Which of the following molecules behaves as both an X- and L-type ligand to a transition metal cation CH3 CEN H3C CH3 (C) Which organic halide shows the largest reactivity towards nucleophilic substitution by ethanol? H Br Br H Br H Br
Please answer and explain the reasoning behind it.
PART III: Read Carefully and show all computations (for partial credit calculations). 26. Record the following transactions for the month of March in the financial statements effects template below. A) Collected $2,000 from a customer for a balance that was due on accounts receivable. B) Services were completed and billed to customers in March in the amount of $1,500 C) Paid $3,000 for rent for the months April, May, and June D)...
Please explain the reasoning behind your answers.
Consider the figure to the right where a conductive shell of radius a and thickness h (h << a) is placed around the origin. A charge Q is placed a distance L from the center of the shell. What is the electric potential V(x, y) outside the shell? What is V(x, y) outside the shell if the shell is not grounded? What is V(x, y) outside the shell if the shell is charged...
In this problem we show directly that the sum of independent Poisson random variables is Poisson. Let J and K be independent Poisson random variables with expected values α and respectively. Show that Ņ J+K is a Poisson random variable with expected value α+β Hint: Show that 72 Pk (m)P, (n-m and then simplify the summation be extracting the sum of a binomial PMF over al possible values.
In this problem we show directly that the sum of independent Poisson...
Please Show Clear Steps and Reasoning Behind Your Work!! Thank
You !!
Draw the resonance forms of the following molecules (15 points on quiz). Use curved arrow notation to indicate the movement of electrons (5 points on quiz) and circle the dominant contributor to the resonance hybrid. You must state why you chose your answer to get credit!!! (5 points on quiz) a. HO + b. O: C.
Please explain where does the
"e^-2" come from
Consider a discrete random variable whose PMF is given by Px-0.1.2, a) Determine the constant c. What is the class of distribution X belongs to, and what is the parameter of X as a member of that class? Since 00 21 0O thus CO -2 2i Note that P(X-)-e2. f is the PMF of Poisson distribution with parameter 2 3
Please explain your reasoning behind the answers.
2.) Identify each reaction as either an 'oxidation' or a ‘reduction'. RE + TMSN+ TOISO,Na + TsN, 3a Ag3PO4(20 mol %) H2O (2.0 equiv) DMSO. 70 °C, 10 h R NHTS 1 a. J. Am. Chem. Soc. ASAP, Published online January 22, 2019 PdCl(Ph)(PPh3)2 (0.1 mol %) THF/toluene, rt, 1-3 h 0 R1R2 R1SP + BrZ-R2 c. 36 Org. Lett. ASAP, Published online January 18, 2019
Can you please explain the solution and theory/reasoning
behind your answer because I would like to learn how to solve this
problem. Thank you so much!
I need help with question 40 but it requires the completion of
questions 38 and 39 :(
38. Suppose that demand for motivational posters is given by Qd = 400 - 10P and supply is given by Qs = 100+ 5P. Additionally, because motivational posters are a horrifying torture devised by middle-managers, they impose...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 47 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago