Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
help with understanding practice problems
What is the pH of a 0.036 M KOH? a. 0.08...
Pure water will auto-ionize to produce a hydronium ion and a hydroxide ion: 2H2O --> H3O+...
Pure water will auto-ionize to produce a hydronium ion and a hydroxide ion: 2H2O --> H3O+ + OH- comapare the componets within the final reaction mixture. It would contain A) More water molecules because water is turner acid and base than H3O+ and OH- B) More water molecules because water is a weaker acid and use than H3O+ and OH- C) More H3O+ and OH- because the ions are stronger acid and bases than water molecules D) More H3O+ and...
A) Calculate the pH of the following simple solutions: 0.08 M HCl 0.25 M KOH 0.08...
A) Calculate the pH of the following simple solutions: 0.08 M HCl 0.25 M KOH 0.08 M HCl + 0.25 M KOH Is solution “c” a buffer? Why or why not? B) Suppose you dissolve 0.1 moles of formic acid in 1 water. What are all of the molecules and ions you would expect to find? Which one of the above will be found in the greatest total amount? Which of the above will be found in very small amounts?...
help please asap please Question 36 (1 point) What is the pH of a buffer made...
help please asap please
Question 36 (1 point) What is the pH of a buffer made by combining 0.114 M nitrous acid and 0.204 M sodium nitrite? The Ka of nitrous acid, HNO2, is 4.5*10-4 Your Answer: Answer Question 35 (1 point) Which salt produces a basic solution when dissolved in water? FeCl3 NaNO2 NH4Br KCI Question 34 (1 point) Between HCIO3 and HIO3, which is stronger and why? OHCIO3 is stronger because chlorine is more electronegative than iodine. HCIO3...
12. Given that Ka = 1.8 x 10- for acetic acid. in order for an acetic...
12. Given that Ka = 1.8 x 10- for acetic acid. in order for an acetic acid solution to have a pH of 3.50, its molar concentration must be a. 5.7 x 10-3 M b. 5.6 x 10-3M c. 3.2 x 10-4M d. 2.3 x 10-M 13. If enough base is added to a solution to cause the pH to increase from 7.50 to 8.50, this means that А a. [OH-] increases by a factor of 10 b. [H'] increases...
9) What is the H+ ion concentration in a 4.8 x 10–2 M KOH solution? A)...
9) What is the H+ ion concentration in a 4.8 x 10–2 M KOH solution? A) 4.8 x 10–2 M B) 1.0x 10–7 M C) 2.1 x10–13 M D) 4.8 x 10–11 M 10) HA is a weak acid. Which equilibrium corresponds to the equilibrium constant Kb for A-? A) HA (aq) + H2O (l) H2A+ (aq) + OH-(aq) B) A- (aq) + H3O+ (aq) C) HA (aq) + OH- (aq) H2O (l) + H+ (aq) HA (aq) + H2O...
1. Which of the following is NOT acidic? A. Lemons B. Lye C. Vinegar D. Soda...
1. Which of the following is NOT acidic? A. Lemons B. Lye C. Vinegar D. Soda 2. What is the proper name for HNO3? A. Nitrate acid B. Nitric acid C. Nitrous acid D. Hydronitric acid 3. The conjugate acid and base of the ion, H2PO4, are: Conjugate Acid Conjugate Base H30+ OH H30+ PO43- H3PO4 HPO42- H3PO4 PO43- Love 4. What is the H+ concentration in a solution with a pol of 10.25? A. 5.6 x 103 M B....
10. Fill in each blánk with increases or decreases As K, increases, acid strength As Kb...
10. Fill in each blánk with increases or decreases As K, increases, acid strength As Kb increases, base strength As pK, increases, acid strength As pKb increases, base strength As acid strength increases, conjugate base strength The stronger an acid, the the conjugate base. (stronger or weaker) HoCI NH4 11. a) Which is the HS stronger acid? stronger acid? stronger base? stronger base? HF pk-3.14 CH,OH pk, 10.0 b) Which is the c) Which is the d) Which is the...
please show work 11)2SO2(g) + O2(8) 2503(8) For the reaction at equilibrium, ifO2 is removed, the...
please show work
11)2SO2(g) + O2(8) 2503(8) For the reaction at equilibrium, ifO2 is removed, the amount of SO2 present 2 is removed, the amount of SO2 present will 11) A) decrease B) increase C) stay the same 12) According to the Arrhenius concept, if HNOs were dissolved in water, it w A) a source of Hions. B) a source of hydroxide ions. C) an acid. D) a base. E) a proton acceptor. vater, it would act as12) 13) The...
Worksheet Week 10 Name: 1. During strenuous exercise lactic acid builds up in a muscle tissues....
Worksheet Week 10 Name: 1. During strenuous exercise lactic acid builds up in a muscle tissues. In a 1.00 Maqueous solution 2.94% of lactic acid is ionized. What is the value of its ka? 2. At equilibrium of (H') in a 0.250 M solution of an unknown acid is 4.07 x 10 M. Determine the degree of ionization and the Ka of this acid. 3. The venom of biting ants contains formic acid, HCOOH, Ka = 1.8 x 10-Mat 25°C....
A weak acid, HA, is 0.1% ionized in a 0.2 M solution. Answer the following questions:...
A weak acid, HA, is 0.1% ionized in a 0.2 M solution. Answer the following questions: a) What is the equilibrium constant (Ka) for the dissociation of this acid? b) What is the pH of the solution? c) How much ‘weaker’ in active acidity of the HA solution compared to 0.2 M HCl solution? d) How many mls of 0.1 M NaOH would be needed to neutralize completely 250 ml of the 0.2 M HA solution?
help please asap please
Question 36 (1 point) What is the pH of a buffer made by combining 0.114 M nitrous acid and 0.204 M sodium nitrite? The Ka of nitrous acid, HNO2, is 4.5*10-4 Your Answer: Answer Question 35 (1 point) Which salt produces a basic solution when dissolved in water? FeCl3 NaNO2 NH4Br KCI Question 34 (1 point) Between HCIO3 and HIO3, which is stronger and why? OHCIO3 is stronger because chlorine is more electronegative than iodine. HCIO3...
12. Given that Ka = 1.8 x 10- for acetic acid. in order for an acetic acid solution to have a pH of 3.50, its molar concentration must be a. 5.7 x 10-3 M b. 5.6 x 10-3M c. 3.2 x 10-4M d. 2.3 x 10-M 13. If enough base is added to a solution to cause the pH to increase from 7.50 to 8.50, this means that А a. [OH-] increases by a factor of 10 b. [H'] increases...
1. Which of the following is NOT acidic? A. Lemons B. Lye C. Vinegar D. Soda 2. What is the proper name for HNO3? A. Nitrate acid B. Nitric acid C. Nitrous acid D. Hydronitric acid 3. The conjugate acid and base of the ion, H2PO4, are: Conjugate Acid Conjugate Base H30+ OH H30+ PO43- H3PO4 HPO42- H3PO4 PO43- Love 4. What is the H+ concentration in a solution with a pol of 10.25? A. 5.6 x 103 M B....
10. Fill in each blánk with increases or decreases As K, increases, acid strength As Kb increases, base strength As pK, increases, acid strength As pKb increases, base strength As acid strength increases, conjugate base strength The stronger an acid, the the conjugate base. (stronger or weaker) HoCI NH4 11. a) Which is the HS stronger acid? stronger acid? stronger base? stronger base? HF pk-3.14 CH,OH pk, 10.0 b) Which is the c) Which is the d) Which is the...
please show work
11)2SO2(g) + O2(8) 2503(8) For the reaction at equilibrium, ifO2 is removed, the amount of SO2 present 2 is removed, the amount of SO2 present will 11) A) decrease B) increase C) stay the same 12) According to the Arrhenius concept, if HNOs were dissolved in water, it w A) a source of Hions. B) a source of hydroxide ions. C) an acid. D) a base. E) a proton acceptor. vater, it would act as12) 13) The...
Worksheet Week 10 Name: 1. During strenuous exercise lactic acid builds up in a muscle tissues. In a 1.00 Maqueous solution 2.94% of lactic acid is ionized. What is the value of its ka? 2. At equilibrium of (H') in a 0.250 M solution of an unknown acid is 4.07 x 10 M. Determine the degree of ionization and the Ka of this acid. 3. The venom of biting ants contains formic acid, HCOOH, Ka = 1.8 x 10-Mat 25°C....
Most questions answered within 3 hours.
-
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 28 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 1 hour ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 4 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 5 hours ago