1.) Complete the following conversions using the correct number of significant figures, if applicable. 2 Moles...
1.) Complete the following conversions using the correct number
of significant figures, if applicable.
2 Moles of NaOH into molecules of NaOH
29.3 grams of Mo into moles of Mo
5.6 x 1024 molecules of Ag into grams of Ag
2.)
If you are combusting 2.5 grams of ethane with 2 moles of
O2 in the reaction:
2C2H6 +
7O2 à
4CO2 + 6 H2O
Determine the limiting reagent. For the limiting reagent, determine
the mass of the leftover material. Also, determine the number of
moles of CO2 which would be produced. What would be the
percent yield if only 1.2 x 10-3 moles were
produced?
Homework Answers
Add Answer to:
1.) Complete the following conversions using the correct number
of significant figures, if applicable.
2 Moles...
Calculations: SHOW WORK on separate paper. Use correct number of significant figures and report units with...
Calculations: SHOW WORK on separate paper. Use correct number of significant figures and report units with answers where required. 1. Find the number of moles in 25.0 grams of each of the following: Find the a. Ni b. C.H. c. Ca(OH)2 Find the mass of 0.750 moles of each of the following: Brz b. P.010 CuS 3. Find the number of particles in 35.0 grams of each of the following: a. Ag b. CF4 C. CHO Find the mass of...
Model 4: Using Moles of Limiting Reagent in Stoichiometry The above pictures are not realistic because...
Model 4: Using Moles of Limiting Reagent in Stoichiometry The above pictures are not realistic because they involve so very few molecules. In a "real-world" sample, you are likely to have on the order of 10 molecules. Consider the following: Suppose you have a reaction vessel initially containing 13.5 moles of sulfur dioxide and 11.2 moles of oxygen mol SO, required to react with all O2 = 11.2 mol O2 x 2 mol SO 22.4 mol SO, 1 mol O2...
1) Calculate the number of moles of Cl atoms in 3.01×1024 formula units of magnesium chloride, MgCl2. Express your answer numerically in moles. 2) In the gaseous state, chlorine exists as a diatomic m...
1) Calculate the number of moles of Cl atoms in 3.01×1024 formula units of magnesium chloride, MgCl2. Express your answer numerically in moles. 2) In the gaseous state, chlorine exists as a diatomic molecule Cl2 (Molar mass = 70.9 g/mol). Calculate the number of moles of chlorine present in 100 g of chlorine gas. Express the quantity in moles to three significant figures. 3) Sodium hydroxide, NaOH, is a strong base that is used in industrial synthesis and processes such...
1) Calculate the number of moles of Cl atoms in 3.01×1024 formula units of magnesium chloride,...
1) Calculate the number of moles of Cl atoms in 3.01×1024 formula units of magnesium chloride, MgCl2. Express your answer numerically in moles. 2) In the gaseous state, chlorine exists as a diatomic molecule Cl2 (Molar mass = 70.9 g/mol). Calculate the number of moles of chlorine present in 100 g of chlorine gas. Express the quantity in moles to three significant figures. 3) Sodium hydroxide, NaOH, is a strong base that is used in industrial synthesis and processes such as...
4. From the balanced chemical equation: N2 + 3H2 2 NH3 a) Determine the number moles of NHs produced from the complete reaction of 2.5 moles of H:? [Spts] b) Using the above chemical equation...
4. From the balanced chemical equation: N2 + 3H2 2 NH3 a) Determine the number moles of NHs produced from the complete reaction of 2.5 moles of H:? [Spts] b) Using the above chemical equation determine the number of grams of nitrogen gas (N2) produced when it reacts with 102 g of ammonia (NH3)? [5pts (UPON REQUEST)
4. From the balanced chemical equation: N2 + 3H2 2 NH3 a) Determine the number moles of NHs produced from the complete reaction...
1- Calculate the following: A- Number of moles in 10 gram of Cr(NO3). B- Number of...
1- Calculate the following: A- Number of moles in 10 gram of Cr(NO3). B- Number of Atoms in 10 gram of Cr(NO3). C- Number of molecules in 10 gram of Cr(NO3). D- Number of grams in 10 atoms of Cr(NO3). 2. Find the % composition of all individuals in, KBrO. %K= %Br= %0= 3. How many gram of Oxygen is in 10 gram of C (NO3),? 4- Find the empirical formula of a compound with the following composition Hg33.3% S...
answer please number 1) a and b and 2 and 3 Experiment 4: Limiting reagent Often reactants are added in amounts diff...
answer please number 1) a and b and 2 and 3
Experiment 4: Limiting reagent Often reactants are added in amounts different from the proportions given by the chemical equation in such cases, only one of the reactants may be completely consumed at the end of the reaction, whereas some amounts of other reactants will remain unreacted. The limiting reactant (or limiting reagent) is the reactant that is entirely consumed or converted to product when a reaction goes to completion....
complete the following table Name molar mass (g/mol) 2-bromoheptane 2-bromohen cacluate from the formula / structure...
complete the following table
Name molar mass (g/mol) 2-bromoheptane 2-bromohen cacluate from the formula / structure or look up in the table on page 77 density = ? g/ml from PC table 0.22 mL-?g Alkoxide base cacluate from the formula / structure or look up in the table on page 77 heptene isomers cacluate from the formula / structure or look up in the table on page 77 other you calculate you calculate 7.17 target amount target mmoles (1 mmole...
1. Express the answer to the following problems using the correct number of significant figures a....
1. Express the answer to the following problems using the correct number of significant figures a. 1.144 x 10 20.0 b. 4.77 x 101 -9.16 x 10 2. Express the Boltzmann constant (1.38065 x 102" kg m's K') in units of miles' lb yrK 3. Convert 9.997 x 101 g cm* into kg km 4. The Reynolds number is used to deseribe the conditions of particle settling If the Reynolds number is given by the following equation Where v, is...
in need of everything, take your time 11. 13 Consider the following reaction 2 NO, --->...
in need of everything, take your time
11. 13 Consider the following reaction 2 NO, ---> 2N, + 50, The number of moles of o: obtained from 12 moles of N, O, (a) 30 (b) 4.8 (c) 60 (e) none of the above. (d) 6 Consider the reaction 2 N, 50, ---> 2 N, O, If 4 moles of nitrogen is mixed with 96 g of oxygen, what is the limiting reagent? a) , (b) N (c) there is no...
Calculations: SHOW WORK on separate paper. Use correct number of significant figures and report units with answers where required. 1. Find the number of moles in 25.0 grams of each of the following: Find the a. Ni b. C.H. c. Ca(OH)2 Find the mass of 0.750 moles of each of the following: Brz b. P.010 CuS 3. Find the number of particles in 35.0 grams of each of the following: a. Ag b. CF4 C. CHO Find the mass of...
Model 4: Using Moles of Limiting Reagent in Stoichiometry The above pictures are not realistic because they involve so very few molecules. In a "real-world" sample, you are likely to have on the order of 10 molecules. Consider the following: Suppose you have a reaction vessel initially containing 13.5 moles of sulfur dioxide and 11.2 moles of oxygen mol SO, required to react with all O2 = 11.2 mol O2 x 2 mol SO 22.4 mol SO, 1 mol O2...
4. From the balanced chemical equation: N2 + 3H2 2 NH3 a) Determine the number moles of NHs produced from the complete reaction of 2.5 moles of H:? [Spts] b) Using the above chemical equation determine the number of grams of nitrogen gas (N2) produced when it reacts with 102 g of ammonia (NH3)? [5pts (UPON REQUEST)
4. From the balanced chemical equation: N2 + 3H2 2 NH3 a) Determine the number moles of NHs produced from the complete reaction...
1- Calculate the following: A- Number of moles in 10 gram of Cr(NO3). B- Number of Atoms in 10 gram of Cr(NO3). C- Number of molecules in 10 gram of Cr(NO3). D- Number of grams in 10 atoms of Cr(NO3). 2. Find the % composition of all individuals in, KBrO. %K= %Br= %0= 3. How many gram of Oxygen is in 10 gram of C (NO3),? 4- Find the empirical formula of a compound with the following composition Hg33.3% S...
answer please number 1) a and b and 2 and 3
Experiment 4: Limiting reagent Often reactants are added in amounts different from the proportions given by the chemical equation in such cases, only one of the reactants may be completely consumed at the end of the reaction, whereas some amounts of other reactants will remain unreacted. The limiting reactant (or limiting reagent) is the reactant that is entirely consumed or converted to product when a reaction goes to completion....
complete the following table
Name molar mass (g/mol) 2-bromoheptane 2-bromohen cacluate from the formula / structure or look up in the table on page 77 density = ? g/ml from PC table 0.22 mL-?g Alkoxide base cacluate from the formula / structure or look up in the table on page 77 heptene isomers cacluate from the formula / structure or look up in the table on page 77 other you calculate you calculate 7.17 target amount target mmoles (1 mmole...
1. Express the answer to the following problems using the correct number of significant figures a. 1.144 x 10 20.0 b. 4.77 x 101 -9.16 x 10 2. Express the Boltzmann constant (1.38065 x 102" kg m's K') in units of miles' lb yrK 3. Convert 9.997 x 101 g cm* into kg km 4. The Reynolds number is used to deseribe the conditions of particle settling If the Reynolds number is given by the following equation Where v, is...
in need of everything, take your time
11. 13 Consider the following reaction 2 NO, ---> 2N, + 50, The number of moles of o: obtained from 12 moles of N, O, (a) 30 (b) 4.8 (c) 60 (e) none of the above. (d) 6 Consider the reaction 2 N, 50, ---> 2 N, O, If 4 moles of nitrogen is mixed with 96 g of oxygen, what is the limiting reagent? a) , (b) N (c) there is no...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 19 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 7 hours ago