Homework Answers
Add Answer to:
organic chemistry
A carbonyl group, C=O, and an alkene, C=C, double bonds, are both sp2 hybridized....
Organic Chemistry: Vocabulary I.) In general elimination reactions will form the _ stable alkene. a. more...
Organic Chemistry: Vocabulary I.) In general elimination reactions will form the _ stable alkene. a. more b. less This is typically the alkene with: a. more substituents b. less substituents. c. cannot tell The exception is when we have an __ mechanism with a _. a. E1, hindered poor nucleophile b. E1, unhindered poor nucleophile c. E2, hindered strongly basic nucleophile d. E2, unhindered strongly basic nucleophile ________________________________________________________________________________________________ II.) Staggered rotamers have a _________ degree torsional angle. Nucleophiles are ___...
50 Which of the following explains why epoxides are more reactive than ethers? a. The C-O-C...
50 Which of the following explains why epoxides are more reactive than ethers? a. The C-O-C bond angle of an epoxide is 109°, making epoxides have angle strain. b. The oxygen atom of an epoxide is sp2 hybridized. c. The C-O-C bond angle of an epoxide is 120°, making epoxides have angle strain. d. The C-O-C bond angle of an epoxide is 60°, making epoxides have angle strain. e: None of the above is the correct answer.
Exam # 4 in Organic chemistry 252 Student's Name - Answer the following Questions 1. What...
Exam # 4 in Organic chemistry 252 Student's Name - Answer the following Questions 1. What is the correct name for the following compound? Y Y (CH.CHCH.COCH.CH a. 2-methyl-4-hexanone c. 2-methyl-3-hexanone b. 5-methyl-3-hexanone d. ethyl isopropyl ketonel. 2. Which of the following statements is incorrect regarding the compound propanal. a. The carbonyl carbon is sp hybridized b. In solution propanal is in equilibrium with 1-propen-1-ol c. The carbonyl carbon is susceptible to electrophilic attack d. The carbonyl oxygen is readily...
5) Rationalizing the stereochemical outc ome of this reaction requires an understanding of the f borohydride...
5) Rationalizing the stereochemical outc ome of this reaction
requires an understanding of the f borohydride borohydride lcohol.
An three-dimensional structure of benzoin and the general reaction
mechanism o reductions. As shown previously (10-1), the usual mode
of activation tor reduction occurs via an intermolecular H-bond
between the carbonyl group and an a intramolecular H-bond can
stabilize the lowest-energy conformation of benzoin (pre and serve
to activate the carbonyl for reduction, thus generating the
lowest-energyt state. a) Draw the lowest-energy,...
Please Hurry up ?? CHOOSE THE CORRECT ANSWER Q1] Organic chemistry study (a) Properties of organic...
Please Hurry up ??
CHOOSE THE CORRECT ANSWER Q1] Organic chemistry study (a) Properties of organic compounds (b) Reactions of organic compounds (c) syntheses of organic compounds (d) all above Q2] Tertiary Carbon is (a) carbon atom contact with four carbon atoms (b) carbon atom contact with two carbon atoms (c) carbon atom contact with three carbon atoms (d) carbon atom contact with one carbon atom Q3] One of these compounds contain quaternary carbon atom (a) 2,3-dimethylpentane (b) 3-methylhexane (c)...
Q7.14: Triatomic species can take which two structures? Select all that apply? A tetrahedral B bent...
Q7.14: Triatomic species can take which two structures? Select all that apply? A tetrahedral B bent linear D octahedral А Q7.15: Which of the following is predicted to be used by the sulfur atom in SO3 based on valence bond theory? А sap B sp2 Csp3 D sp Q 7.15: Both VSEPR theory and valence bond predict the same geometry for XeO3. А True B False Q 7.15: According to valence bond theory, the structure C2H2 the two carbon atoms...
10) 10) When the carbonyl group of a ketone is protonated A) the resulting species is...
10) 10) When the carbonyl group of a ketone is protonated A) the resulting species is activated toward nucleophilic addition B) the resulting species becomes more electrophilic subsequent nucleophilic addition on the resulting species is said to occur under acid-catalyzed conditions D) the resulting species has a positive charge. E) all of the above 11) What purpose does FeCl3 serve when benzene undergoes an electrophilic aromatic substitution reaction with chlorine? A) It serves as a Lewis base catalyst by reacting...
Chapter 11: 1. What is a prime rule in naming alkenes? a. Find the longest carbon...
Chapter 11: 1. What is a prime rule in naming alkenes? a. Find the longest carbon chain. b.Find the longest carbon chain containing the alkene. c. Find whether the alkene has a cis- or trans- configuration. d.Find how far the alkene functionality is from either end. 2. What is the IUPAC name of the following alkene? a. cis-5-methyl-2-heptene b. trans-2-ethyl-4-hexene c. trans-5-methyl-2-heptene d. trans-3-methyl-5-heptene 3. What is the hybridization, geometry, and bond angle of the carbon marked by an asterisk?...
50 Which of the following explains why epoxides are more reactive than ethers? a. The C-O-C bond angle of an epoxide is 109°, making epoxides have angle strain. b. The oxygen atom of an epoxide is sp2 hybridized. c. The C-O-C bond angle of an epoxide is 120°, making epoxides have angle strain. d. The C-O-C bond angle of an epoxide is 60°, making epoxides have angle strain. e: None of the above is the correct answer.
Exam # 4 in Organic chemistry 252 Student's Name - Answer the following Questions 1. What is the correct name for the following compound? Y Y (CH.CHCH.COCH.CH a. 2-methyl-4-hexanone c. 2-methyl-3-hexanone b. 5-methyl-3-hexanone d. ethyl isopropyl ketonel. 2. Which of the following statements is incorrect regarding the compound propanal. a. The carbonyl carbon is sp hybridized b. In solution propanal is in equilibrium with 1-propen-1-ol c. The carbonyl carbon is susceptible to electrophilic attack d. The carbonyl oxygen is readily...
5) Rationalizing the stereochemical outc ome of this reaction
requires an understanding of the f borohydride borohydride lcohol.
An three-dimensional structure of benzoin and the general reaction
mechanism o reductions. As shown previously (10-1), the usual mode
of activation tor reduction occurs via an intermolecular H-bond
between the carbonyl group and an a intramolecular H-bond can
stabilize the lowest-energy conformation of benzoin (pre and serve
to activate the carbonyl for reduction, thus generating the
lowest-energyt state. a) Draw the lowest-energy,...
Please Hurry up ??
CHOOSE THE CORRECT ANSWER Q1] Organic chemistry study (a) Properties of organic compounds (b) Reactions of organic compounds (c) syntheses of organic compounds (d) all above Q2] Tertiary Carbon is (a) carbon atom contact with four carbon atoms (b) carbon atom contact with two carbon atoms (c) carbon atom contact with three carbon atoms (d) carbon atom contact with one carbon atom Q3] One of these compounds contain quaternary carbon atom (a) 2,3-dimethylpentane (b) 3-methylhexane (c)...
Q7.14: Triatomic species can take which two structures? Select all that apply? A tetrahedral B bent linear D octahedral А Q7.15: Which of the following is predicted to be used by the sulfur atom in SO3 based on valence bond theory? А sap B sp2 Csp3 D sp Q 7.15: Both VSEPR theory and valence bond predict the same geometry for XeO3. А True B False Q 7.15: According to valence bond theory, the structure C2H2 the two carbon atoms...
10) 10) When the carbonyl group of a ketone is protonated A) the resulting species is activated toward nucleophilic addition B) the resulting species becomes more electrophilic subsequent nucleophilic addition on the resulting species is said to occur under acid-catalyzed conditions D) the resulting species has a positive charge. E) all of the above 11) What purpose does FeCl3 serve when benzene undergoes an electrophilic aromatic substitution reaction with chlorine? A) It serves as a Lewis base catalyst by reacting...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 46 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago