can someone please walk me
through why these are the correct answers for 1, 2, and 3.
Appreciate it.
Homework Answers
Add Answer to:
can someone please walk me
through why these are the correct answers for 1, 2, and...
2. Consider the reactions 1 and 2 shown below. Indicate how the reaction rate for each of the reactions will change...
2. Consider the reactions 1 and 2 shown below. Indicate how the reaction rate for each of the reactions will change your options are: increase, decrease, does NOT change) when the following modifications to the reactions and conditions are introduced: reaction 1 reaction 2 Br CH30 Na CH3OH CH OH as solvent CH3OH is also solvent A. The reaction temperature for both reactions is increased. B. The concentration of the reagent shown above the arrow is increased. C. The concentration...
18. What is the major organic product of the following reaction? Tips Br a. 1 b.2...
18. What is the major organic product of the following reaction? Tips Br a. 1 b.2 c. 3 d. 4 19. What would be the effect on the following substitution reaction of changing the solvent from methanol to acetone? Br + NaBr + Nal * —- Y - Nile a, the change in reaction rate cannot be predicted without more information b. the reaction rate would stay the same c. the reaction rate would decrease d. the reaction rate would...
the answers i circled are incorrect. can you give me the correct answers and explain why?...
the answers i circled are incorrect. can you give me the
correct answers and explain why?
postural de Pero ss and so Lalash, an walach asymmetric carbon as Ror S. (3) label the How many asymmetric carbon atoms are present in the following compound A) B) 1 D) 3 E) 4 2) Which of the statements below correctly describes an achiral molecule? The molecule has a nonsuperimposable mirror image. B) The molecule exhibits optical activity when it interacts with plane-polarized...
please i need quick help these questions are due so soon and i dont know the answers please help me thanks . Que...
please i need quick help these questions are due so soon and i
dont know the answers please help me thanks .
Question Completion Status: QUESTION Consider the following acid-base reaction. Equilibrium for this reaction lies to the: OH H-CEC + H-CEC-H + A. right. B. Equilibrium favors neither forward nor reverse reaction. O C. left. D. It cannot be determined. QUESTION 2 Does the equilibrium of this reaction lie to the left or right? BF OH BF3 + A,...
I need help solving the problem below if you can explain it to me with the...
I need help solving the problem below if you can explain it to
me with the answer that would be awesome.
Consider the following pair of figures where the dark blue line is the original budget line for a consumer and the light blue line is the new one. In Figure A, the change shown was caused by Figure A O A. a decrease in the consumer's income. O B. a decrease in the price of good Y. O c....
Can someone explain me why these are the answers by solving the problems? - 1 How...
Can someone explain me why these are the answers by
solving the problems?
- 1 How many elements of unsaigion are there in the structure below N-CH.CH CUCH 2 What is the correct IUPAC name for the following structure A) () 4-isopropylhept-4-en-2-yne (D) (2) 4-1 sopropylhept-3-cn..yne None of the above (E) CH, Which hybrid orbitals (L-R) are involved in the formation of the carbon carbon σ bond shown below? (A) sp'-sp (C) sp-s (E) sp-sp Hs sp-sp 4. What is...
Could someone please guide me through these problems? Correct answers are highlighted. 9. Calculate the total...
Could someone please guide me through these problems? Correct
answers are highlighted.
9. Calculate the total vapor pressure (in Torr) at 50°C of an ideal solution of methanol (CH3OH) and propanol (C3H7OH) in which the mass % concentration of methanol is 58.0%. The vapor pressure at 50°C of methanol is 416.3 Torr and that of propanol is 179.3 Torr. d) 315.8 b) 278.8 a) 350.3 c) 300.3 e) 239.8 12. The standard enthalpy of combustion of acetic acid, CH3COOH (1),...
Can someone please walk me through how to do this? Name = deletions 7this tes whether...
Can someone please walk me through how to do this?
Name = deletions 7this tes whether 10. Seven non-reverting mutations at the nii locus of T4 were used to co-infect E.coli strain B at high multiplicity of infection. The lysates from each co-infection were then in spotted onto a lawn of strain K to test whether they could infect and lyse strain K. The results of this test are shown in the following table, where "+" indicates lysis of strain...
Can someone walk me through this? I want to know the right answer and rationale. Which...
Can someone walk me through this? I want to know the right
answer and rationale.
Which of the following salts will be less soluble if the pH of the solution is 9.0? A. Ru(NO3)3 B. Zn(OH)2 C. K3PO4 D. MnCl2
Can someone please help me with this? I already asked this and nobody answered. 1. A...
Can someone please help me with this? I already asked this and
nobody answered.
1. A buffer called "Tris" is widely used in biochemistry. The (neutral) compound "Tris" itself is a weak base, so we'll notate it as "B." The pk, of its conjugate acid (HB) is 8.07. The overall goal of this problem is to calculate the pH change of a Tris buffer upon addition of some strong base. (a) Assume that you have a pH 8.40 Tris buffer...
2. Consider the reactions 1 and 2 shown below. Indicate how the reaction rate for each of the reactions will change your options are: increase, decrease, does NOT change) when the following modifications to the reactions and conditions are introduced: reaction 1 reaction 2 Br CH30 Na CH3OH CH OH as solvent CH3OH is also solvent A. The reaction temperature for both reactions is increased. B. The concentration of the reagent shown above the arrow is increased. C. The concentration...
18. What is the major organic product of the following reaction? Tips Br a. 1 b.2 c. 3 d. 4 19. What would be the effect on the following substitution reaction of changing the solvent from methanol to acetone? Br + NaBr + Nal * —- Y - Nile a, the change in reaction rate cannot be predicted without more information b. the reaction rate would stay the same c. the reaction rate would decrease d. the reaction rate would...
the answers i circled are incorrect. can you give me the
correct answers and explain why?
postural de Pero ss and so Lalash, an walach asymmetric carbon as Ror S. (3) label the How many asymmetric carbon atoms are present in the following compound A) B) 1 D) 3 E) 4 2) Which of the statements below correctly describes an achiral molecule? The molecule has a nonsuperimposable mirror image. B) The molecule exhibits optical activity when it interacts with plane-polarized...
please i need quick help these questions are due so soon and i
dont know the answers please help me thanks .
Question Completion Status: QUESTION Consider the following acid-base reaction. Equilibrium for this reaction lies to the: OH H-CEC + H-CEC-H + A. right. B. Equilibrium favors neither forward nor reverse reaction. O C. left. D. It cannot be determined. QUESTION 2 Does the equilibrium of this reaction lie to the left or right? BF OH BF3 + A,...
I need help solving the problem below if you can explain it to
me with the answer that would be awesome.
Consider the following pair of figures where the dark blue line is the original budget line for a consumer and the light blue line is the new one. In Figure A, the change shown was caused by Figure A O A. a decrease in the consumer's income. O B. a decrease in the price of good Y. O c....
Can someone explain me why these are the answers by
solving the problems?
- 1 How many elements of unsaigion are there in the structure below N-CH.CH CUCH 2 What is the correct IUPAC name for the following structure A) () 4-isopropylhept-4-en-2-yne (D) (2) 4-1 sopropylhept-3-cn..yne None of the above (E) CH, Which hybrid orbitals (L-R) are involved in the formation of the carbon carbon σ bond shown below? (A) sp'-sp (C) sp-s (E) sp-sp Hs sp-sp 4. What is...
Could someone please guide me through these problems? Correct
answers are highlighted.
9. Calculate the total vapor pressure (in Torr) at 50°C of an ideal solution of methanol (CH3OH) and propanol (C3H7OH) in which the mass % concentration of methanol is 58.0%. The vapor pressure at 50°C of methanol is 416.3 Torr and that of propanol is 179.3 Torr. d) 315.8 b) 278.8 a) 350.3 c) 300.3 e) 239.8 12. The standard enthalpy of combustion of acetic acid, CH3COOH (1),...
Can someone please walk me through how to do this?
Name = deletions 7this tes whether 10. Seven non-reverting mutations at the nii locus of T4 were used to co-infect E.coli strain B at high multiplicity of infection. The lysates from each co-infection were then in spotted onto a lawn of strain K to test whether they could infect and lyse strain K. The results of this test are shown in the following table, where "+" indicates lysis of strain...
Can someone walk me through this? I want to know the right
answer and rationale.
Which of the following salts will be less soluble if the pH of the solution is 9.0? A. Ru(NO3)3 B. Zn(OH)2 C. K3PO4 D. MnCl2
Can someone please help me with this? I already asked this and
nobody answered.
1. A buffer called "Tris" is widely used in biochemistry. The (neutral) compound "Tris" itself is a weak base, so we'll notate it as "B." The pk, of its conjugate acid (HB) is 8.07. The overall goal of this problem is to calculate the pH change of a Tris buffer upon addition of some strong base. (a) Assume that you have a pH 8.40 Tris buffer...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 40 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago