Homework Answers
ZnCO3 (s) <—> Zn2+(aq) + CO32- (aq) k1 = 1.5*10^-10
HCO3-(aq) <—> CO32- (aq) + H+(aq) k2 = 5.6*10^-11
reverse the 2nd reaction:
ZnCO3 (s) <—> Zn2+(aq) + CO32- (aq) k1 = 1.5*10^-10
CO32- (aq) + H+(aq) <—>HCO3-(aq) k3 = 1/k2
k3= 1/(5.6*10^-11) = 1.79*10^10
now add both reaction:
ZnCO3 (s) + H+(aq) <—> Zn2+(aq) +HCO3-(aq)
this is the required reaction
kc = k1*k3
= (1.5*10^-10)*(1.79*10^10)
= 2.7
Answer: c
Add Answer to:
Given the following information: ZnCO_3(s) Zn^2+ (aq) + CO^2-_3(aq) K_sp = 1.5 times 10^-10 HCO^-_3 (aq)...
Write the equilibrium constant expression for this reaction: H_2CO_3(ag) rightarrow 2H^+ (aq) + CO^2-_3 (aq)
Write the equilibrium constant expression for this reaction: H_2CO_3(ag) rightarrow 2H^+ (aq) + CO^2-_3 (aq)
27. Erik performed the following equilibrium reaction, ZnO(s) + CO(g) = Zn(s) + CO2(g) a. (4...
27. Erik performed the following equilibrium reaction, ZnO(s) + CO(g) = Zn(s) + CO2(g) a. (4 pts) Write the equilibrium-constant expression for this reaction. b. (2 pts) in the forward reaction, is ZnO oxidized, or reduced? 28. Armaria uses significant figures to indicate the uncertainty by means of the number of digits. a. (4 pts) Add the following measured quantities: 11.62 g. 2.1 g, 128.183 g b. (4 pts) Multiply 4.50 x 10 by 1.2 x 10-4
3. Consider the following redox reaction: Zn Zn (s) +Cu2 (aq) (aq)+ Cu (s) 3.a. (10 p) Indicate the line diagram of...
3. Consider the following redox reaction: Zn Zn (s) +Cu2 (aq) (aq)+ Cu (s) 3.a. (10 p) Indicate the line diagram of the galvanic cell that uses the spontaneous redox reaction shown above. 3.b. (5 p) Write the reduction reaction corresponding to each half-cell. 3.c (5p)Calculate the equilibrium constant of the reaction K using the Nemst equation. Refer to Appendix H in the textbook to find the E values.
A solution contains 0.0500 M Co^3+ (aq), 0.0310 M S^2- (aq), and 0.95 M NH_3. Cobalt(III)...
A solution contains 0.0500 M Co^3+ (aq), 0.0310 M S^2- (aq), and 0.95 M NH_3. Cobalt(III) ions in aqueous solutions complex with NH_3 to produce Co(NH_3)_6^3+. (K_f = 5.0 times 10^31) What will be the concentration of Co^3+ (aq) when Co(NH_3)_6^3+ forms? Will CO_2 S_3 precipitate? (K_sp = 4.0 times 10^-21) precipitate forms no precipitate forms
18. Given the following equilibrium constants, K. (HSO4) = 1.2 x 102 K(CHCO2) = 5.6 x...
18. Given the following equilibrium constants, K. (HSO4) = 1.2 x 102 K(CHCO2) = 5.6 x 100 Kw = 1.00 x 10-14 determine the equilibrium constant for the reaction below at 25°C. HSO4 (aq) + CH3CO2 (aq) =30/(aq) + CH3COH(aq) a. 6.7 x 10-12 b. 2.1 x 10-7 c. 1.5 x 10- d. 6.7 x 10 e. 2.1 x 107
Question 7 (1 point) Saved Consider these metal ion/metal standard reduction potentials Cu2(aq)|Cu(s) Ag+1(aq)|Ag(s) Co2(aq)|Co(s) Zn+2(aq)]Zn(s)...
Question 7 (1 point) Saved Consider these metal ion/metal standard reduction potentials Cu2(aq)|Cu(s) Ag+1(aq)|Ag(s) Co2(aq)|Co(s) Zn+2(aq)]Zn(s) +0.34 +0.80 V -0.28 V -0.76 V Based on the data above, which one of the species below is the best oxidizing agent? 0 1 Cols) O2) Zn(s) 3) Cutlaq) 04) Culs) 5) Ag+h(aq)
Quiz 4 10) Predict the products of the following single replacement reaction. Zn(s) + CoCl2(aq) A)...
Quiz 4 10) Predict the products of the following single replacement reaction. Zn(s) + CoCl2(aq) A) No reaction occurs B) ZnCo(aq) + Cl2(g) C) Co(s)+ ZnCl2(aq) D) ZnCoCl2(aq) E) CoCl(aq)+ZnCI(aq) 11) What mass of CoH120s (glucose) is needed to prepare 450.mL of a 0.650 M solution of glucose in water? C) 52.7 g D) 0.293 g E) 125 g A) 0.692 g B) 293 g
6 6. Zinc hydroxide, Zn(OH)2. is practically insoluble in pure water. (Kap 3.0 x 10-16) a) Determine the pH of a saturated aqueous solution of Zn(O1H)2. (You should assume that all hydroxide ions...
6 6. Zinc hydroxide, Zn(OH)2. is practically insoluble in pure water. (Kap 3.0 x 10-16) a) Determine the pH of a saturated aqueous solution of Zn(O1H)2. (You should assume that all hydroxide ions in the solution come from the Zn(OH)2: you can ignore the autoionization of water.) (4 pts) b) Zn(OH)2 is less soluble in even very dilute solutions of Zn(NOs)2 due to the common ion effect. Determine the molar solubility of zine hydroxide in a 1.0 x 10-4 M...
4) Consider the following balanced conventional equation. (21 pts) Zn(s) + H2SO, (aq) → Znso. (aq)...
4) Consider the following balanced conventional equation. (21 pts) Zn(s) + H2SO, (aq) → Znso. (aq) + H2 (9) Individual oxidation numbers: a. Assign oxidation numbers to each element as indicated by the boxes in H SO, Zn in ZnSOS in Znso. O in ZnSO, and H in H2) (6 pts) b. Write the total ionic equation for the reaction above. (9 pts) ndicated by the boxes above. (i.e. Zn in Zn(s), H c. Write the net ionic equation for...
24. Determine A Sºrxn given the following information: Reaction: Zn(s) + 2HCl(aq) → ZnCl2(aq) + H2(9)...
24. Determine A Sºrxn given the following information: Reaction: Zn(s) + 2HCl(aq) → ZnCl2(aq) + H2(9) Substance Zn(s) HCl(aq) H2(g) Zn2+(aq) Cl(aq) Sº (J/mol x K) 60.9 56.5 130.58 -106.5 55.10 A) -39.6 J/mol.K B) O J/mol.K C) +39.6 J/mol.K D) -38.2 J/mol.K E) +38.2 J/mol.K
Write the equilibrium constant expression for this reaction: H_2CO_3(ag) rightarrow 2H^+ (aq) + CO^2-_3 (aq)
27. Erik performed the following equilibrium reaction, ZnO(s) + CO(g) = Zn(s) + CO2(g) a. (4 pts) Write the equilibrium-constant expression for this reaction. b. (2 pts) in the forward reaction, is ZnO oxidized, or reduced? 28. Armaria uses significant figures to indicate the uncertainty by means of the number of digits. a. (4 pts) Add the following measured quantities: 11.62 g. 2.1 g, 128.183 g b. (4 pts) Multiply 4.50 x 10 by 1.2 x 10-4
3. Consider the following redox reaction: Zn Zn (s) +Cu2 (aq) (aq)+ Cu (s) 3.a. (10 p) Indicate the line diagram of the galvanic cell that uses the spontaneous redox reaction shown above. 3.b. (5 p) Write the reduction reaction corresponding to each half-cell. 3.c (5p)Calculate the equilibrium constant of the reaction K using the Nemst equation. Refer to Appendix H in the textbook to find the E values.
A solution contains 0.0500 M Co^3+ (aq), 0.0310 M S^2- (aq), and 0.95 M NH_3. Cobalt(III) ions in aqueous solutions complex with NH_3 to produce Co(NH_3)_6^3+. (K_f = 5.0 times 10^31) What will be the concentration of Co^3+ (aq) when Co(NH_3)_6^3+ forms? Will CO_2 S_3 precipitate? (K_sp = 4.0 times 10^-21) precipitate forms no precipitate forms
18. Given the following equilibrium constants, K. (HSO4) = 1.2 x 102 K(CHCO2) = 5.6 x 100 Kw = 1.00 x 10-14 determine the equilibrium constant for the reaction below at 25°C. HSO4 (aq) + CH3CO2 (aq) =30/(aq) + CH3COH(aq) a. 6.7 x 10-12 b. 2.1 x 10-7 c. 1.5 x 10- d. 6.7 x 10 e. 2.1 x 107
Question 7 (1 point) Saved Consider these metal ion/metal standard reduction potentials Cu2(aq)|Cu(s) Ag+1(aq)|Ag(s) Co2(aq)|Co(s) Zn+2(aq)]Zn(s) +0.34 +0.80 V -0.28 V -0.76 V Based on the data above, which one of the species below is the best oxidizing agent? 0 1 Cols) O2) Zn(s) 3) Cutlaq) 04) Culs) 5) Ag+h(aq)
Quiz 4 10) Predict the products of the following single replacement reaction. Zn(s) + CoCl2(aq) A) No reaction occurs B) ZnCo(aq) + Cl2(g) C) Co(s)+ ZnCl2(aq) D) ZnCoCl2(aq) E) CoCl(aq)+ZnCI(aq) 11) What mass of CoH120s (glucose) is needed to prepare 450.mL of a 0.650 M solution of glucose in water? C) 52.7 g D) 0.293 g E) 125 g A) 0.692 g B) 293 g
6 6. Zinc hydroxide, Zn(OH)2. is practically insoluble in pure water. (Kap 3.0 x 10-16) a) Determine the pH of a saturated aqueous solution of Zn(O1H)2. (You should assume that all hydroxide ions in the solution come from the Zn(OH)2: you can ignore the autoionization of water.) (4 pts) b) Zn(OH)2 is less soluble in even very dilute solutions of Zn(NOs)2 due to the common ion effect. Determine the molar solubility of zine hydroxide in a 1.0 x 10-4 M...
4) Consider the following balanced conventional equation. (21 pts) Zn(s) + H2SO, (aq) → Znso. (aq) + H2 (9) Individual oxidation numbers: a. Assign oxidation numbers to each element as indicated by the boxes in H SO, Zn in ZnSOS in Znso. O in ZnSO, and H in H2) (6 pts) b. Write the total ionic equation for the reaction above. (9 pts) ndicated by the boxes above. (i.e. Zn in Zn(s), H c. Write the net ionic equation for...
24. Determine A Sºrxn given the following information: Reaction: Zn(s) + 2HCl(aq) → ZnCl2(aq) + H2(9) Substance Zn(s) HCl(aq) H2(g) Zn2+(aq) Cl(aq) Sº (J/mol x K) 60.9 56.5 130.58 -106.5 55.10 A) -39.6 J/mol.K B) O J/mol.K C) +39.6 J/mol.K D) -38.2 J/mol.K E) +38.2 J/mol.K
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 18 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 7 hours ago