Homework Answers
The products of the above given reactions are given in the following picture and the each step is also indicated in the following picture,
Add Answer to:
PROBLEMS 1. Reagents. Give the structures of the major products (A-G) expected from the following reactions....
help please! 1) Reactions. Provide the major product for each reaction sequence, account for stereochemistry. 1)...
help please!
1) Reactions. Provide the major product for each reaction sequence, account for stereochemistry. 1) PCC, CH2Cl2 2) Brz, acetic acid OH 3) KotBu, A 4) NaOEt, EtOH P CO 8 5) H2O+ workup 6) THF, H.CaPPha HCB , cat. PdOAC) cat. PPh3, DMF, EN | CHA 0 нс. CH32) LDA, THF, -78 °C CHICH,then H3O+ workup 4) NaBH4, EtOH, then H3O+ workup 5) cat. TSOH, benzaldehyde 1) cat. H2SO4, A 2) O3. CH2Cl2, then (CH3)2S CH; 3) NaOE,...
1) Reactions. Provide the major products for each reaction sequence, account for stereochemistry 1) KMnO4, A 2) SOCI...
1)
Reactions. Provide the major products for each reaction sequence,
account for stereochemistry
1) KMnO4, A 2) SOCI, CH2Cl2 3) 2 equiv. 1) ethylene oxide, THF 2) H3O+ workup Culi 3) DIBAL-H, THF 4) H3O+ workup 5) cat. TsOH, THF H3CCHE (c) HN COH 1) excess LAH, THE 2) H30+ workup 3) 1 equiv. EtN, DMF 4) pyridine i ( " culi , THF (d) PC Ph 2) H3O+/H2O workup 3) KMnO4, A 4) CH,OH, cat. H2SO4 5) cat. TsOH,...
1) Reactions. Provide the major product for each reaction sequence, account for stereochemistry 1) PCC, CHCI...
1) Reactions. Provide the major product for each reaction sequence, account for stereochemistry 1) PCC, CHCI 2) Bry, acetic acid 3) KOBU, A 4) NaOEI, ETOH, P CO- 5) H30 workup 6) THF, H.COPPA HC CH2 O e .cat. Pd(OAc) cat. PPh. DMF, EIN 2) LDA, THF. -78 °C 3) Chichen H3O* workup 4) NaBH, EtOH, then H3O+ workup 5) cat. TSOH, benzaldehyde (c) L AL SUO TESTE TO 1) cat. H2SO4. A лон 2) O3, CH, Cl, then (CH),...
1. Give the missing reagents, reactants or products for each of the following reactions. KOC(CH3)2 (E2)...
1. Give the missing reagents, reactants or products for each of the following reactions. KOC(CH3)2 (E2) 1. BH3 2. H2O2, NaOH, H2O PCC HBr/ROOR how many stereoisomers? PCC ad Excess H, H CH2Cl2 OT_HBr SN2 give one stereoisomer SN2 NaCN ACN (solvent) KMnO4 H2SO4 NaOEt (E2) mCPBA H2SO4 (cat) don't worry about this reaction ОН PCC CH2Cl2 NaOEt (E2) mCPBA H2SO4 (cat) don't worry about this reaction OH PCC CH2Cl2 HI (SN1)
4. The conversion of 5 to 6 is a reaction called “Sharpless Asymmetric dihydroxylation.” The reagents...
4. The conversion of 5 to 6 is a reaction called “Sharpless Asymmetric dihydroxylation.” The reagents listed for this are: AD-mix-B, CH3SO2NH2, t-BuOH, H20. a) What is compound(s) are described by “AD-mix-B?" (you can simply list them by name). c) What would be different if “AD-mix-a” was used? You don't need to provide a specific structure, but in general what would be different about the compound obtained? OH ОН ma MeO2C Butane-1,4-diol OH OP 2 3 Scheme 1. Sharpless asymmetric...
1. Give the structure(s) of the major product(s) expected from the following reactions. Assume standard aqueous...
1. Give the structure(s) of the major product(s) expected from the following reactions. Assume standard aqueous workup conditions are used for product isolation. (40 points, 4 points for cach). H a) Sia,BH (1.0 eq) THF, 0 °C b) CH-CO-D, 60 °C OTS KOI-Bu -BuOH "Me 1a, LDA (1.0 eq). THF, -78 °C 16. TMSCI 2a, Toluene, heat 2b, H* acequous workup 1a, LDA, THF 2, LDA (1.0 q). THE 10. CH3COCI 2, CH,CH_CH_Br EtOC 1) HCI, MeOHXH, heat 2). Hz,...
1. Give the missing reagents, reactants or products for each of the following reactions. KOC(CH ....
1. Give the missing reagents, reactants or products for each of the following reactions. KOC(CH . (E2) 1.BH 2. H2O NaOH, HÔ PCC HB/ROOR how many stereoisomers? how many stereoisomers? PCC Excess H2O H CH2C12 HB Nal SN2 give one stereoisomer SN2 NaCN ACN (solvent) KMnO4 HO H2SO mCPBA NaOEt (E2) H2SO4 (cat) don't worry about this reaction OH OH KMnO4 H2SO4 NaOEt (E2) mCPBA H2SO4 (cat) don't worry about this reaction OH Рcc CH2C12 HI (SN1)
CI OR C D Glve the proper series of reactions, using reagents from the table below,...
CI OR C D Glve the proper series of reactions, using reagents from the table below, that will carry out the overall transformations shown. (Assume aqueous workup where needed.) 1. Br2 / uv light 2. SOCI2 / THE 3. Mg/Et20 4. Mell/hexane 5. CH3CH2MgCl 6. PhMgBr 7. NaBH4 8. LIAIHA 9. BH3 / ox 10. POCI3/pyridine/ THF 11. CrO3 / THE 12. PCC / CH2Cl2 13. H/H20 14. ELOH/H 15. t-butoxide 16. OH" /H20 17. NH3 18, CO2 19. acetic...
1. PREDICT THE PRODUCT: Provide the structure of the major product expected from the following reactions...
1. PREDICT THE PRODUCT: Provide the structure of the major product expected from the following reactions or reaction sequences. Make sure you account for any regio- and/or stereochemistry! (24 pts.) H2O 1. Hg(OAC), CH, OH 2. NaBH H2SO4 H20 1) BH-THF 2) H202, KOH HBr Bry, H2O HBr ROOR 1. BH3-THF 2. H2O2, NaOH H20, H2SO4 1. NaNH2 H2 H-CEC-CH2 CH2 CH3 2. CH CH Br Lindlar cat 1. Sia BH-THF 2. H2O2, H2O
1. Part 2 white complete structures for the major product(s) resulting from the following reactions. Ao...
1. Part 2 white complete structures for the major product(s) resulting from the following reactions. Ao Propanal + 2,4-dinitrophenylhydrazine --- 2-hexanol + ZnCl2 + HCI ----.. . . isopropyl alcohol + CrO3/H2S04 --- 1-butene + Br2/CH2Cl2 → In the space below, draw structures for the following: a. Bromobenzene b. Butanal Acetophenone Benzaldehyde e. Aniline 3. The following observations are frequently made in the laboratory. In each case below state in The following cheer brief terms, the deduction or deductions which...
help please!
1) Reactions. Provide the major product for each reaction sequence, account for stereochemistry. 1) PCC, CH2Cl2 2) Brz, acetic acid OH 3) KotBu, A 4) NaOEt, EtOH P CO 8 5) H2O+ workup 6) THF, H.CaPPha HCB , cat. PdOAC) cat. PPh3, DMF, EN | CHA 0 нс. CH32) LDA, THF, -78 °C CHICH,then H3O+ workup 4) NaBH4, EtOH, then H3O+ workup 5) cat. TSOH, benzaldehyde 1) cat. H2SO4, A 2) O3. CH2Cl2, then (CH3)2S CH; 3) NaOE,...
1)
Reactions. Provide the major products for each reaction sequence,
account for stereochemistry
1) KMnO4, A 2) SOCI, CH2Cl2 3) 2 equiv. 1) ethylene oxide, THF 2) H3O+ workup Culi 3) DIBAL-H, THF 4) H3O+ workup 5) cat. TsOH, THF H3CCHE (c) HN COH 1) excess LAH, THE 2) H30+ workup 3) 1 equiv. EtN, DMF 4) pyridine i ( " culi , THF (d) PC Ph 2) H3O+/H2O workup 3) KMnO4, A 4) CH,OH, cat. H2SO4 5) cat. TsOH,...
1) Reactions. Provide the major product for each reaction sequence, account for stereochemistry 1) PCC, CHCI 2) Bry, acetic acid 3) KOBU, A 4) NaOEI, ETOH, P CO- 5) H30 workup 6) THF, H.COPPA HC CH2 O e .cat. Pd(OAc) cat. PPh. DMF, EIN 2) LDA, THF. -78 °C 3) Chichen H3O* workup 4) NaBH, EtOH, then H3O+ workup 5) cat. TSOH, benzaldehyde (c) L AL SUO TESTE TO 1) cat. H2SO4. A лон 2) O3, CH, Cl, then (CH),...
1. Give the missing reagents, reactants or products for each of the following reactions. KOC(CH3)2 (E2) 1. BH3 2. H2O2, NaOH, H2O PCC HBr/ROOR how many stereoisomers? PCC ad Excess H, H CH2Cl2 OT_HBr SN2 give one stereoisomer SN2 NaCN ACN (solvent) KMnO4 H2SO4 NaOEt (E2) mCPBA H2SO4 (cat) don't worry about this reaction ОН PCC CH2Cl2 NaOEt (E2) mCPBA H2SO4 (cat) don't worry about this reaction OH PCC CH2Cl2 HI (SN1)
4. The conversion of 5 to 6 is a reaction called “Sharpless Asymmetric dihydroxylation.” The reagents listed for this are: AD-mix-B, CH3SO2NH2, t-BuOH, H20. a) What is compound(s) are described by “AD-mix-B?" (you can simply list them by name). c) What would be different if “AD-mix-a” was used? You don't need to provide a specific structure, but in general what would be different about the compound obtained? OH ОН ma MeO2C Butane-1,4-diol OH OP 2 3 Scheme 1. Sharpless asymmetric...
1. Give the structure(s) of the major product(s) expected from the following reactions. Assume standard aqueous workup conditions are used for product isolation. (40 points, 4 points for cach). H a) Sia,BH (1.0 eq) THF, 0 °C b) CH-CO-D, 60 °C OTS KOI-Bu -BuOH "Me 1a, LDA (1.0 eq). THF, -78 °C 16. TMSCI 2a, Toluene, heat 2b, H* acequous workup 1a, LDA, THF 2, LDA (1.0 q). THE 10. CH3COCI 2, CH,CH_CH_Br EtOC 1) HCI, MeOHXH, heat 2). Hz,...
1. Give the missing reagents, reactants or products for each of the following reactions. KOC(CH . (E2) 1.BH 2. H2O NaOH, HÔ PCC HB/ROOR how many stereoisomers? how many stereoisomers? PCC Excess H2O H CH2C12 HB Nal SN2 give one stereoisomer SN2 NaCN ACN (solvent) KMnO4 HO H2SO mCPBA NaOEt (E2) H2SO4 (cat) don't worry about this reaction OH OH KMnO4 H2SO4 NaOEt (E2) mCPBA H2SO4 (cat) don't worry about this reaction OH Рcc CH2C12 HI (SN1)
CI OR C D Glve the proper series of reactions, using reagents from the table below, that will carry out the overall transformations shown. (Assume aqueous workup where needed.) 1. Br2 / uv light 2. SOCI2 / THE 3. Mg/Et20 4. Mell/hexane 5. CH3CH2MgCl 6. PhMgBr 7. NaBH4 8. LIAIHA 9. BH3 / ox 10. POCI3/pyridine/ THF 11. CrO3 / THE 12. PCC / CH2Cl2 13. H/H20 14. ELOH/H 15. t-butoxide 16. OH" /H20 17. NH3 18, CO2 19. acetic...
1. PREDICT THE PRODUCT: Provide the structure of the major product expected from the following reactions or reaction sequences. Make sure you account for any regio- and/or stereochemistry! (24 pts.) H2O 1. Hg(OAC), CH, OH 2. NaBH H2SO4 H20 1) BH-THF 2) H202, KOH HBr Bry, H2O HBr ROOR 1. BH3-THF 2. H2O2, NaOH H20, H2SO4 1. NaNH2 H2 H-CEC-CH2 CH2 CH3 2. CH CH Br Lindlar cat 1. Sia BH-THF 2. H2O2, H2O
1. Part 2 white complete structures for the major product(s) resulting from the following reactions. Ao Propanal + 2,4-dinitrophenylhydrazine --- 2-hexanol + ZnCl2 + HCI ----.. . . isopropyl alcohol + CrO3/H2S04 --- 1-butene + Br2/CH2Cl2 → In the space below, draw structures for the following: a. Bromobenzene b. Butanal Acetophenone Benzaldehyde e. Aniline 3. The following observations are frequently made in the laboratory. In each case below state in The following cheer brief terms, the deduction or deductions which...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 27 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago