Homework Answers
Predict the major product from the following reaction: NBS hv
Predict the major product from the following reaction: NBS hv
Write the structural formula for the MAJOR product of the following reaction: NBS hv b) Write...
Write the structural formula for the MAJOR product of the following reaction: NBS hv b) Write the complete reaction mechanism that gives the major product for this reaction.
Write the structural formula for the MAJOR product of the following reaction: NBS hv b) Write...
Write the structural formula for the MAJOR product of the following reaction: NBS hv b) Write the complete reaction mechanism that gives the major product for this reaction.
17. What is the major product of the following reaction? NBS, hv, CCL B. c. D....
17. What is the major product of the following reaction? NBS, hv, CCL B. c. D. A. Br Br Br Br 4. What is the correct IUPAC name for the following structure? a. 3,9-dimethyl-3-decyne b. 3,9-dimethyl-7-decyne c. 2,8-dimethyl-7-decyne d. 2,8-dimethyl-3-decyne PROVIDE MECHANISM for the following: 1. TSOH 2. PhCh Br 3. H30*
18. Provide the organic product(s) and circle the major organic product where applicable CH₂ Br2 hv...
18. Provide the organic product(s) and circle the major organic product where applicable CH₂ Br2 hv 1077 NBS, hv peroxide ch NBS, hv peroxide
1. (2) Predict the major monobrominated product of the reaction below 21. NBS hv (4) The...
1. (2) Predict the major monobrominated product of the reaction below 21. NBS hv (4) The halide product from part a is used to create a Grignard reagent which is further reacted with 2,2-dimethyloxirane (shown below). Show the Grignard and the major organic product of this reaction (following the usual acid workup). b. (4) Draw the ally! anion, showing all atoms, bonds, and lone pair. Then, fill in the pi electrons appropriately in the MO diagram for the allyl anion....
write a major product for each of the following reaction, indicate appropriate stereochemistry 1. NBS, hv,...
write a major product for each of the following reaction,
indicate appropriate stereochemistry
1. NBS, hv, cc14 2. NaOCH3, A 3. ^ CN, toluene, A 4. 03, CH2Cl , -78 °C; Zn, CH3COOH 1. H2SO4, H20 2. H2SO4, A 3. NaOH(aq), CHCl3 (d) a 1. RCO3H 2. H2SO4, H20 3. x's NaNH2; 8 ; H30°x®
11. (6 pts) The major product of the reaction of methylenecycclohexene with NBS is 1- (bromomethylcyclohexene....
11. (6 pts) The major product of the reaction of methylenecycclohexene with NBS is 1- (bromomethylcyclohexene. Explain. NBS, hv NBS - opinie ON NBS = N-bromosuccinimike CCIA (solvent) 1-(bromomethyl)cyclohex-I-ene
5. Predict the major product(s) for each of the reactions shown below. NBS hv Mg (1)...
5. Predict the major product(s) for each of the reactions shown below. NBS hv Mg (1) Chance CH,CH.CH,CI ether -CHI. CHỊ Li, pentane C-H15Br Cul ether (111) HC CH2CH3 Pd(PPh34 -B + - --CH3 CaCO3 THF (iv) Had 6. Fill the reagents to carry out the following conversion. canoa-oh-oh
write a major product for each of the following reaction, indicate appropriate stereochemistry 1. NBS, hv,...
write a major product for each of the following reaction,
indicate appropriate stereochemistry
1. NBS, hv, CC14 Tag 1. Xz; x's NaNH2 2. (CH3)3COK, (CH3)3COH, A 3. OHC = CHO, toluene, A 2. ă Br 3. H2 , Lindlar's catalyst 3. RCOZH; H30°x, H2O 1(x'sNaHz; ~ X (C) = 2. K, NH3(1), CH3CH2OH 3. CH2l2, Zn(Cu)
Predict the major product from the following reaction: NBS hv
Write the structural formula for the MAJOR product of the following reaction: NBS hv b) Write the complete reaction mechanism that gives the major product for this reaction.
Write the structural formula for the MAJOR product of the following reaction: NBS hv b) Write the complete reaction mechanism that gives the major product for this reaction.
17. What is the major product of the following reaction? NBS, hv, CCL B. c. D. A. Br Br Br Br 4. What is the correct IUPAC name for the following structure? a. 3,9-dimethyl-3-decyne b. 3,9-dimethyl-7-decyne c. 2,8-dimethyl-7-decyne d. 2,8-dimethyl-3-decyne PROVIDE MECHANISM for the following: 1. TSOH 2. PhCh Br 3. H30*
18. Provide the organic product(s) and circle the major organic product where applicable CH₂ Br2 hv 1077 NBS, hv peroxide ch NBS, hv peroxide
1. (2) Predict the major monobrominated product of the reaction below 21. NBS hv (4) The halide product from part a is used to create a Grignard reagent which is further reacted with 2,2-dimethyloxirane (shown below). Show the Grignard and the major organic product of this reaction (following the usual acid workup). b. (4) Draw the ally! anion, showing all atoms, bonds, and lone pair. Then, fill in the pi electrons appropriately in the MO diagram for the allyl anion....
write a major product for each of the following reaction,
indicate appropriate stereochemistry
1. NBS, hv, cc14 2. NaOCH3, A 3. ^ CN, toluene, A 4. 03, CH2Cl , -78 °C; Zn, CH3COOH 1. H2SO4, H20 2. H2SO4, A 3. NaOH(aq), CHCl3 (d) a 1. RCO3H 2. H2SO4, H20 3. x's NaNH2; 8 ; H30°x®
11. (6 pts) The major product of the reaction of methylenecycclohexene with NBS is 1- (bromomethylcyclohexene. Explain. NBS, hv NBS - opinie ON NBS = N-bromosuccinimike CCIA (solvent) 1-(bromomethyl)cyclohex-I-ene
5. Predict the major product(s) for each of the reactions shown below. NBS hv Mg (1) Chance CH,CH.CH,CI ether -CHI. CHỊ Li, pentane C-H15Br Cul ether (111) HC CH2CH3 Pd(PPh34 -B + - --CH3 CaCO3 THF (iv) Had 6. Fill the reagents to carry out the following conversion. canoa-oh-oh
write a major product for each of the following reaction,
indicate appropriate stereochemistry
1. NBS, hv, CC14 Tag 1. Xz; x's NaNH2 2. (CH3)3COK, (CH3)3COH, A 3. OHC = CHO, toluene, A 2. ă Br 3. H2 , Lindlar's catalyst 3. RCOZH; H30°x, H2O 1(x'sNaHz; ~ X (C) = 2. K, NH3(1), CH3CH2OH 3. CH2l2, Zn(Cu)
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 2 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 52 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago