Homework Answers
Answer
1 ) Compound 1 & 3 are chiral compounds.
Compound 2 is achiral.
2) Given pair of molecule is diastereomers of each other.Option C is correct.
Add Answer to:
cle the chiral bound(s) below, and indicate each chiral carbon with an asterisk. OH CI (2)...
4. (26 points) Identify each chiral carbon in the molecules below with an asterisk (*) and...
4. (26 points) Identify each chiral carbon in the molecules below with an asterisk (*) and assign R or s absolute configuration to each chiral carbon. Then, state (in the box provided) whether the molecules are enantiomers, identical, diastereomers, or not related. Hint: if it looks like a Fischer projection then it is a Fischer projection. ...1111 O піон аnd and .Ley O Era o C CHO CH,OH C. H oH and OHCH IH Сн,он
1.A. Place an asterisk (*) next to each stereocenter of these four compounds. 1.3. Bubble in...
1.A. Place an asterisk (*) next to each stereocenter of these four compounds. 1.3. Bubble in if the compound is chiral or achiral. 1.C. Determine the stereochemical relationship between each possible pair. Br Br Br Br A B D chiral O achiral OO chiral achiral с Ochiral achiral 8 chiral achiral A and B: 000 identical enantiomers diastereomers none of these A and C: ооо identical enantiomers O diastereomers none of these A and D: оооооо O identical enantiomers diastereomers...
Please indicate the relationship and explain why to me. Thank you! Indicate the relationship between each pair of st...
Please indicate the relationship and explain why to me. Thank
you!
Indicate the relationship between each pair of structures listed below by labeling each as wither the same, constitutional isomers, enantiomers or diastereomers. Relationship Cats CI Pair of structures CH3 COH H+CI H +Br Bru COZH enontioner (afh 1-H OH3C sad b) xy who uk Same OH OH flomers oghanism for the reaction
30 OH OH CI CI Select one: O a. enantiomers O b. conformations c. constitutional isomers...
30
OH OH CI CI Select one: O a. enantiomers O b. conformations c. constitutional isomers d. diastereomers
please help! 1) Which of the following compounds is chiral? CH3-1-ci CH3-1-ci Br -1-ci CH3 CH3-1-Br...
please help!
1) Which of the following compounds is chiral? CH3-1-ci CH3-1-ci Br -1-ci CH3 CH3-1-Br CH3-1-ci CH3 3-1-C CH3 CH3 ci--c1 Br--Br CH3 2) What is the relationship between the structures shown below? H-|-Brand Br- -CH3 CH3 o Constitutional isomers Identical compounds O Diastereomers O Enantiomers O Configurational isomers 4) What is the product of the following reaction? MoBr 2. Fich, o V. HOCHẶCHỌCH-O V. II. CH CHCH-(O) OH CH2OH ON CH3CH II. HOCH2CH2– O III oll ON 01...
5. Assign R or S configuration to each indicated chirality center (carbon A and B) in...
5. Assign R or S configuration to each indicated chirality center (carbon A and B) in the following molecule (vitamin C). Which of the following assignments is correct B но но OH но H se A a. carbon A (S); carbon B (R) b. carbon A (R); carbon B (R) c. carbon A (R); carbon B (S) d. carbon A (S); carbon B (S) 6. Which of the following statement is NOT correct? a Constitutional isomers are compounds whose atoms...
8. Indicate whether each of the following statements is true or false. If a statement is...
8. Indicate whether each of the following statements is true or false. If a statement is false, explain why a) Two structural isomers may be chiral. : True b) A compound must be chiral in order to have an enantiomer. True c) A chiral compound with an asymmetric carbon atom designated always has a positive optical rotation. False (R) as d) Mirror-image molecules are always enantiomers. False chiral. False e) All compounds with asymmetric carbon atoms are f)The relative configuration...
2. For each of the pairs of compounds, indicate if they are identical, enantiomers, diastereomers, constitutional...
2. For each of the pairs of compounds, indicate if they are identical, enantiomers, diastereomers, constitutional isomers or different compounds. Z-bromopropaneitrite Br CN constitutional isomers H2CH... CN CH3 CH3 COH Hanc HC HEN HS o n diastereomers MMCH₂CH₃ CH3 3. Identify the chiral centers in the diastereomers below and label each as Ror S. CHE
please help and shortly explain each answer 27. What is the relationship between the structures below?...
please help and shortly explain each answer
27. What is the relationship between the structures below? Br н,с. Br Time and CH, CI a. Enantiomers c. Same Compound b. Diastereomers d. Constitutional Isomers 28. What is the relationship between the structures below? and a. Enantiomers c. Same Compound b. Diastereomers d. Constitutional Isomers 29. How many stereogenic centers are in the following molecule? a. O b. 1 c. 2 d. 3 e. 4 ords
Please refer to the following structure to answer questions 5-7 CH3 ci Cis 5. What is...
Please refer to the following structure to answer questions 5-7 CH3 ci Cis 5. What is the relationship of the substituents to one another b. Trans c. No Relationship 6. True or False: There are no 1,3-diaxial interactions in the current structure 7. True or False: The other conformation as a result of the ring flip will not have any 1,3-diaxial interactions 8. For each pair of structures shown indicate whether the two structures are constitutional isomers, enantiomers, diastereomers, or...
4. (26 points) Identify each chiral carbon in the molecules below with an asterisk (*) and assign R or s absolute configuration to each chiral carbon. Then, state (in the box provided) whether the molecules are enantiomers, identical, diastereomers, or not related. Hint: if it looks like a Fischer projection then it is a Fischer projection. ...1111 O піон аnd and .Ley O Era o C CHO CH,OH C. H oH and OHCH IH Сн,он
1.A. Place an asterisk (*) next to each stereocenter of these four compounds. 1.3. Bubble in if the compound is chiral or achiral. 1.C. Determine the stereochemical relationship between each possible pair. Br Br Br Br A B D chiral O achiral OO chiral achiral с Ochiral achiral 8 chiral achiral A and B: 000 identical enantiomers diastereomers none of these A and C: ооо identical enantiomers O diastereomers none of these A and D: оооооо O identical enantiomers diastereomers...
Please indicate the relationship and explain why to me. Thank
you!
Indicate the relationship between each pair of structures listed below by labeling each as wither the same, constitutional isomers, enantiomers or diastereomers. Relationship Cats CI Pair of structures CH3 COH H+CI H +Br Bru COZH enontioner (afh 1-H OH3C sad b) xy who uk Same OH OH flomers oghanism for the reaction
30
OH OH CI CI Select one: O a. enantiomers O b. conformations c. constitutional isomers d. diastereomers
please help!
1) Which of the following compounds is chiral? CH3-1-ci CH3-1-ci Br -1-ci CH3 CH3-1-Br CH3-1-ci CH3 3-1-C CH3 CH3 ci--c1 Br--Br CH3 2) What is the relationship between the structures shown below? H-|-Brand Br- -CH3 CH3 o Constitutional isomers Identical compounds O Diastereomers O Enantiomers O Configurational isomers 4) What is the product of the following reaction? MoBr 2. Fich, o V. HOCHẶCHỌCH-O V. II. CH CHCH-(O) OH CH2OH ON CH3CH II. HOCH2CH2– O III oll ON 01...
5. Assign R or S configuration to each indicated chirality center (carbon A and B) in the following molecule (vitamin C). Which of the following assignments is correct B но но OH но H se A a. carbon A (S); carbon B (R) b. carbon A (R); carbon B (R) c. carbon A (R); carbon B (S) d. carbon A (S); carbon B (S) 6. Which of the following statement is NOT correct? a Constitutional isomers are compounds whose atoms...
8. Indicate whether each of the following statements is true or false. If a statement is false, explain why a) Two structural isomers may be chiral. : True b) A compound must be chiral in order to have an enantiomer. True c) A chiral compound with an asymmetric carbon atom designated always has a positive optical rotation. False (R) as d) Mirror-image molecules are always enantiomers. False chiral. False e) All compounds with asymmetric carbon atoms are f)The relative configuration...
2. For each of the pairs of compounds, indicate if they are identical, enantiomers, diastereomers, constitutional isomers or different compounds. Z-bromopropaneitrite Br CN constitutional isomers H2CH... CN CH3 CH3 COH Hanc HC HEN HS o n diastereomers MMCH₂CH₃ CH3 3. Identify the chiral centers in the diastereomers below and label each as Ror S. CHE
please help and shortly explain each answer
27. What is the relationship between the structures below? Br н,с. Br Time and CH, CI a. Enantiomers c. Same Compound b. Diastereomers d. Constitutional Isomers 28. What is the relationship between the structures below? and a. Enantiomers c. Same Compound b. Diastereomers d. Constitutional Isomers 29. How many stereogenic centers are in the following molecule? a. O b. 1 c. 2 d. 3 e. 4 ords
Please refer to the following structure to answer questions 5-7 CH3 ci Cis 5. What is the relationship of the substituents to one another b. Trans c. No Relationship 6. True or False: There are no 1,3-diaxial interactions in the current structure 7. True or False: The other conformation as a result of the ring flip will not have any 1,3-diaxial interactions 8. For each pair of structures shown indicate whether the two structures are constitutional isomers, enantiomers, diastereomers, or...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago