Homework Answers
Add Answer to:
Alder Re? 9. Draw the two major products for the following reaction. a. Identify each as...
7-9 please! 4 7. One of the following is much more acidic than the other. Circle...
7-9 please!
4 7. One of the following is much more acidic than the other. Circle the more acidic one, and explain very briefly why? (3 points) H Acidity of one pf the H's shown H H 8. For the reaction show a. Write "1,2" underneath and "1,4" underneath the appropriate products. (1 pt) b. Write "thermodynamic" underneath the appropriate "thermodynamic control" product (1 pt) c. Draw the mechanism for the reaction, using formal arrow pushing. Draw both resonance structures...
7. One of the following is much more acidic than the other. Circle the more acidic...
7. One of the following is much more acidic than the other. Circle the more acidic one, and explain very briefly why? (3 points) Acidity of one pf the it's shown 8. For the reaction show, a. Write "1,2" underneath and "1,4" underneath the appropriate products. (1 pt) b. Write "thermodynamic" underneath the appropriate "thermodynamic control product (1 pt) c. Draw the mechanism for the reaction, using formal arrow pushing. Draw both resonance structures for the intermediate (4 pts) Br...
Draw the two major products obtained in the reaction shown.
Draw the two major products obtained in the reaction shown.Draw the major 1,2- and 1,4-addition products obtained in the reaction shown. Assume that both are derived from the most stable carbocation intermediate.
Draw the major 1.2- and 1,4-addition products obtained in the reaction shown. Assume that both are...
Draw the major 1.2- and 1,4-addition products obtained in the reaction shown. Assume that both are derived from the most stable carbocation intermediate + HBr • You do not have to consider stereochemistry • You do not have to explicitly draw Hatoms • If the 1,2- and 1,4- addition products are the same due to symmetry, only draw one structure. • Draw one structure per sketcher. Add additional sketchers using the drop down menu in the bottom right corner •...
Consider the reaction of 2-methyl-1,3-cyclohexadiene with HCI. Assuming that the reaction takes place at a very...
Consider the reaction of 2-methyl-1,3-cyclohexadiene with HCI. Assuming that the reaction takes place at a very low temperature: (a) draw the intermediate and product structures, indluding any formnal charges. more stable resonance formless stable resonance form HCI CI CI Scroll down for parts (b) and (c) (b) What is the major product of the reaction at very low temperatures? O Both products are formed in equal amounts. O The 1,2-addition product O The 1,4-addition product. (c) Is the reaction under...
draw the structure of the major product of the following diels-alder reaction. clearly indicate relative stereochemistry....
draw the structure of the major product of the following
diels-alder reaction. clearly indicate relative stereochemistry. b)
use resonance hybrid structures for regiochemistry (to explain
it)
What the product of the D-A reaction? Stereochemistry (1enantiome) Explain regiochemistry using resonance hybrid structured
5. a) Draw the major 1,2-addition product and the major 1,4-addition product of each of the...
5. a) Draw the major 1,2-addition product and the major 1,4-addition product of each of the following reactions. Label each product as either the 1,2-addition product or 1,4-addition product and as either the thermodynamic or kinetic product. (12 pts) H" catalyst H catalyst b) Consider the reaction of a nucleophile with conjugated carbonyl. Provide an example of a nucleophile that would favor the 1,2-addition product and explain why. Provide an example of a nucleophile that would favor the 1,4-addition product...
Consider the reaction of 2-methyl-1,3-cyclohexadiene with HCl. Assuming that the reaction takes place at a very...
Consider the reaction of 2-methyl-1,3-cyclohexadiene with HCl. Assuming that the reaction takes place at a very low temperature: (a) draw the intemediate and product structures, including any formal charges. more stable resonance form less stable resonance form НC cr сг Cl Scroll down for parts (b) and (c). Cl Exit Next Try Again Give Up & View Solution Previqus (b) What is the major product of the reaction at very low temperatures? Both products are formed in equal amounts. O...
Draw the major 1,2- and 1,4-addition products obtained in the reaction shown. Assume that both are...
Draw the major 1,2- and 1,4-addition products obtained in the reaction shown. Assume that both are derived from the most stable carbocation intermediate. HCI
[8 marks] 1. In the boxes below, draw the resonance structures of the organic radical intermediate...
[8 marks] 1. In the boxes below, draw the resonance structures of the organic radical intermediate of the given reaction, along with the two different products (constitutional isomers) that would be produced. No electron-flow arrows are required at any time. Stereochemistry is not required. Note: NBS N-bromosuccinimide Organic reaction intermediate NBS hv Product 2 Product 1 [6 marks 2. In the boxes below, draw structures corresponding to the following names. Please use proper line-angle
7-9 please!
4 7. One of the following is much more acidic than the other. Circle the more acidic one, and explain very briefly why? (3 points) H Acidity of one pf the H's shown H H 8. For the reaction show a. Write "1,2" underneath and "1,4" underneath the appropriate products. (1 pt) b. Write "thermodynamic" underneath the appropriate "thermodynamic control" product (1 pt) c. Draw the mechanism for the reaction, using formal arrow pushing. Draw both resonance structures...
7. One of the following is much more acidic than the other. Circle the more acidic one, and explain very briefly why? (3 points) Acidity of one pf the it's shown 8. For the reaction show, a. Write "1,2" underneath and "1,4" underneath the appropriate products. (1 pt) b. Write "thermodynamic" underneath the appropriate "thermodynamic control product (1 pt) c. Draw the mechanism for the reaction, using formal arrow pushing. Draw both resonance structures for the intermediate (4 pts) Br...
Draw the major 1.2- and 1,4-addition products obtained in the reaction shown. Assume that both are derived from the most stable carbocation intermediate + HBr • You do not have to consider stereochemistry • You do not have to explicitly draw Hatoms • If the 1,2- and 1,4- addition products are the same due to symmetry, only draw one structure. • Draw one structure per sketcher. Add additional sketchers using the drop down menu in the bottom right corner •...
Consider the reaction of 2-methyl-1,3-cyclohexadiene with HCI. Assuming that the reaction takes place at a very low temperature: (a) draw the intermediate and product structures, indluding any formnal charges. more stable resonance formless stable resonance form HCI CI CI Scroll down for parts (b) and (c) (b) What is the major product of the reaction at very low temperatures? O Both products are formed in equal amounts. O The 1,2-addition product O The 1,4-addition product. (c) Is the reaction under...
draw the structure of the major product of the following
diels-alder reaction. clearly indicate relative stereochemistry. b)
use resonance hybrid structures for regiochemistry (to explain
it)
What the product of the D-A reaction? Stereochemistry (1enantiome) Explain regiochemistry using resonance hybrid structured
5. a) Draw the major 1,2-addition product and the major 1,4-addition product of each of the following reactions. Label each product as either the 1,2-addition product or 1,4-addition product and as either the thermodynamic or kinetic product. (12 pts) H" catalyst H catalyst b) Consider the reaction of a nucleophile with conjugated carbonyl. Provide an example of a nucleophile that would favor the 1,2-addition product and explain why. Provide an example of a nucleophile that would favor the 1,4-addition product...
Consider the reaction of 2-methyl-1,3-cyclohexadiene with HCl. Assuming that the reaction takes place at a very low temperature: (a) draw the intemediate and product structures, including any formal charges. more stable resonance form less stable resonance form НC cr сг Cl Scroll down for parts (b) and (c). Cl Exit Next Try Again Give Up & View Solution Previqus (b) What is the major product of the reaction at very low temperatures? Both products are formed in equal amounts. O...
Draw the major 1,2- and 1,4-addition products obtained in the reaction shown. Assume that both are derived from the most stable carbocation intermediate. HCI
[8 marks] 1. In the boxes below, draw the resonance structures of the organic radical intermediate of the given reaction, along with the two different products (constitutional isomers) that would be produced. No electron-flow arrows are required at any time. Stereochemistry is not required. Note: NBS N-bromosuccinimide Organic reaction intermediate NBS hv Product 2 Product 1 [6 marks 2. In the boxes below, draw structures corresponding to the following names. Please use proper line-angle
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 20 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago