please explain what is happening in the reaction for the preperation of cis-alpha-beta-dibenzolystrene usine benzil reacted...
Homework Answers
Add Answer to:
please explain what is happening in the reaction for the
preperation of cis-alpha-beta-dibenzolystrene usine benzil reacted...
For the Aldol Condensation reaction, Acetophenone was reacted with either p-methoxybenzaldehyde, p-cholorobenzaldehye or 3,4-dimethoxybenzaldehyde. Explain the...
For the Aldol Condensation reaction, Acetophenone was reacted with either p-methoxybenzaldehyde, p-cholorobenzaldehye or 3,4-dimethoxybenzaldehyde. Explain the driving force for the condesation reaction. Why is water eliminated so easily?
Can you please provide a reaction mechanism for the following reaction and explain what is happening...
Can you please provide a reaction mechanism for the following
reaction and explain what is happening at each step
A multistep synthesis demonstrating Grignard and Friedel Crafts reactions Part I and II Br MgBr Mg l21 diethyl ether bromobenzene MgBr 1, mix and heat OH 2, H30 benzophenone triphenylmethanol Part IV OCH3 H2so4 OCH3 anisole methoxytetraphenylmethane triphenylmethanol hane from a multistep reaction
Look up the necessary masses and a. Show that 9Be is stable against beta decay but allowed to alpha decay b. What is the reaction for alpha decay? c. What is the energy release in this reaction?...
Look up the necessary masses and a. Show that 9Be is stable against beta decay but allowed to alpha decay b. What is the reaction for alpha decay? c. What is the energy release in this reaction?
Look up the necessary masses and a. Show that 9Be is stable against beta decay but allowed to alpha decay b. What is the reaction for alpha decay? c. What is the energy release in this reaction?
233Pa decays by beta emission. The product of this reaction undergoes alpha decay. What is the...
233Pa decays by beta emission. The product of this reaction undergoes alpha decay. What is the product of the second decay reaction?
*Synthesis of Biodiesel Please check my answer! And please let me know answers of this question!...
*Synthesis of Biodiesel
Please check my answer!
And please let me know answers of this question!
1. The potassium methoxide solution used in this experiment was generated by reaction of KOH with methanol. Give the curved arrow mechanism for the reaction, then briefly explain why the equilibrium largely favors the potassium methoxide. KOH + CH3OH = K + OCH3 + H20
please draw out the mechanisms and explain what's happening in the reaction (f) KMnOд, Нeat ОН...
please draw out the mechanisms and explain what's happening in
the reaction
(f) KMnOд, Нeat ОН Н.-О
Give a balanced equation for the reaction that includes both the oxidizing agent (benzil) and reducing...
Give a balanced equation for the reaction that includes both the oxidizing agent (benzil) and reducing agent (NaBH4). In other words I do not want to see 4 R2C=O. Give a brief definition/explanation of reduction in terms of gain/loss of hydrogens, oxygen, and electrons. Sodium borohydride can be used in ethanol solutions to rapidly reduce aldehydes and ketones at room temperature. Even though lithium aluminum hydride (LiAlH4) is much more reactive than sodium borohydride (NaBH4) it can’t be used to reduce aldehydes...
What is the reaction scheme for the synthesis of beta-D-glucose pentaacetate and alpha-D-glucose pentaacetate? In addition,...
What is the reaction scheme for the synthesis of beta-D-glucose pentaacetate and alpha-D-glucose pentaacetate? In addition, what would the reaction scheme for the isomerization for these two compounds look like?
Please give me the answer and explain why. n Vpsi 2.6V: what, if anything, is happening...
Please give me the answer and explain why.
n Vpsi 2.6V: what, if anything, is happening in the circunt whem So n 5. Rank the brightnesses of the LEDs from brightest to dimmest. Assume all resistances are equal. Brightest to dimmest:Niti
8. With the proportional counter, if we had used an alpha/beta mixed source to develop the counting curve, we woul...
8. With the proportional counter, if we had used an alpha/beta mixed source to develop the counting curve, we would have seen two plateaus. Draw this ideal curve and explain what is happening to produce the plateaus and the general shape of the curve. Which plateau (alpha or beta) occurs first? With some detail, explain why it occurs first. Using a dashed line, plot the general shape of your counting curve and explain any discrepancies from the ideal. Cal bri...
Can you please provide a reaction mechanism for the following
reaction and explain what is happening at each step
A multistep synthesis demonstrating Grignard and Friedel Crafts reactions Part I and II Br MgBr Mg l21 diethyl ether bromobenzene MgBr 1, mix and heat OH 2, H30 benzophenone triphenylmethanol Part IV OCH3 H2so4 OCH3 anisole methoxytetraphenylmethane triphenylmethanol hane from a multistep reaction
Look up the necessary masses and a. Show that 9Be is stable against beta decay but allowed to alpha decay b. What is the reaction for alpha decay? c. What is the energy release in this reaction?
Look up the necessary masses and a. Show that 9Be is stable against beta decay but allowed to alpha decay b. What is the reaction for alpha decay? c. What is the energy release in this reaction?
*Synthesis of Biodiesel
Please check my answer!
And please let me know answers of this question!
1. The potassium methoxide solution used in this experiment was generated by reaction of KOH with methanol. Give the curved arrow mechanism for the reaction, then briefly explain why the equilibrium largely favors the potassium methoxide. KOH + CH3OH = K + OCH3 + H20
please draw out the mechanisms and explain what's happening in
the reaction
(f) KMnOд, Нeat ОН Н.-О
Please give me the answer and explain why.
n Vpsi 2.6V: what, if anything, is happening in the circunt whem So n 5. Rank the brightnesses of the LEDs from brightest to dimmest. Assume all resistances are equal. Brightest to dimmest:Niti
8. With the proportional counter, if we had used an alpha/beta mixed source to develop the counting curve, we would have seen two plateaus. Draw this ideal curve and explain what is happening to produce the plateaus and the general shape of the curve. Which plateau (alpha or beta) occurs first? With some detail, explain why it occurs first. Using a dashed line, plot the general shape of your counting curve and explain any discrepancies from the ideal. Cal bri...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 54 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago