Homework Answers
(7)
(8)
(D) volume of gas decreases with decrease in temperature, keeping pressure constant
(9)
All the gases added together
(11)
KCl is the best conductor because it dissociates to give ions in solution
(12)
(B) Na+ and NO3-, because these ions are present on both the sides of the reaction
Add Answer to:
_________ which one of the following salts is insoluble? NH_aCl Ca(NO_3)_2 NaCO_3 Na_2S zn(CH_3COO)_2 _________ Complete...
Which of the following statements about ideal gases is incorrect? At a constant pressure, when temperature...
Which of the following statements about ideal gases is incorrect? At a constant pressure, when temperature increases, volume increases. O A gas with a larger molar mass will have a higher density Gas pressure is directly proportional to the number of moles of gas. At constant volume, when the temperature increases, pressure decreases. At a constant temperature, when the volume decreases, the pressure increases. Consider the balanced reaction: C3H8 +502—3CO2+ 4H20 How many mol of C3Hg must be consumed via...
Question 37 - Part A Which of the following compounds will behave least like an ideal...
Question 37 - Part A Which of the following compounds will behave least like an ideal ges at low temperatures? O CCH 0 0 OKr OF o Ar SUDAN Request Answer Part B According to the kinetic molecular theory, the pressure of a gas in a container will decrease the the average kinetic energy of gas particles increases number of collisions with the container wall increases O temperature of the gas decreases O volume of the container decreases number of...
Chapter 5 HW 1. Determine whether the following statements are true or false A) Gasses have...
Chapter 5 HW 1. Determine whether the following statements are true or false A) Gasses have a high density B) Neon diffuses faster than argon C) Gas pressure is the result of particles of a gas colliding with each other D) Increased temperature of a gas result in increased gas pressure because particles move faster, collide more often and harder with the wall E) Gases are mostly empty space. F) When the temperature of a gas increases, the volume of...
24) Which of the following represent STP (Standard Temperature and Pressure) conditions? A) T -0 K...
24) Which of the following represent STP (Standard Temperature and Pressure) conditions? A) T -0 K and P = 1 atm B) T=0°C and P 760 atm C) T= 273 K and P = 0 atm D) T-273 K and P-1 atm E) T = 1 K and P = 1 atm 25) Which of the following is TRUE for a liquid that is placed in a sealed container? A) Condensation of the evaporated molecules in the jar can only...
please answer all question and type please Problems and questions 1. Balance the following equations: -...
please answer all question and type please
Problems and questions 1. Balance the following equations: - Na + H₂O NaOH + H2 PbO + _NH Pb + _Ny +_ H_O CH. +_ - _CO+ H2O a) — _NayCO; + _Mg(NO3)2 - > MgCO, + NaNO, 2. Write the correct balanced equation for each of the following reactions. Include the proper subscripts and include the state of matter for all reactants and products. Write the type of reaction on the blank...
What is the coefficient of H.So, when the following equation is properly balanced with the smallest set of w...
What is the coefficient of H.So, when the following equation is properly balanced with the smallest set of whole numbers? __Cas(PO4h + H2SO4 - Caso + HPO. A) 3 B) 8 C) 10 D) 11 2) What is the coefficient of H20 when the following equation is properly balanced with smallest set of whole numbers? ALC + H2O - AM(OH), + CHE A) 3 B) 4 C) 6 D) 12 E) 24 3) of the reactions below, which one is...
1. Which of the following are the sites within the human body where carbon dioxide and...
1. Which of the following are the sites within the human body where carbon dioxide and oxygen are exchanged? A. Alveoli B. Arteries C. Synapses D. Venules 2. Which of the following describes the most important reason for repeating an experimental investigation? A. To verify the validity of the original findings B. To expand upon the original investigation C. To manipulate the independent variable D. To attempt to disprove the hypothesis 3. Lithium has an atomic number of 3 and...
Exam Name MULTIPLE CHOICE. Choose the one alternative that best completes the statement or answers the...
Exam Name MULTIPLE CHOICE. Choose the one alternative that best completes the statement or answers the question. 1) 1) One mole of any substance contains Avogadro's number of particles of that substance. What is the numerical value of Avogadro's number? A) 12.01 23 Avagrans t Male aton 6022 x1o atums B) 6.022 x 1023 C) 6.022 x 10-23 D) 1.661 x10-24 E) 1.00 x10-14 2) What is the mass of 4.00 moles of helium, the gas commonly used to fill...
Which of the following statements about ideal gases is incorrect? At a constant pressure, when temperature increases, volume increases. O A gas with a larger molar mass will have a higher density Gas pressure is directly proportional to the number of moles of gas. At constant volume, when the temperature increases, pressure decreases. At a constant temperature, when the volume decreases, the pressure increases. Consider the balanced reaction: C3H8 +502—3CO2+ 4H20 How many mol of C3Hg must be consumed via...
Question 37 - Part A Which of the following compounds will behave least like an ideal ges at low temperatures? O CCH 0 0 OKr OF o Ar SUDAN Request Answer Part B According to the kinetic molecular theory, the pressure of a gas in a container will decrease the the average kinetic energy of gas particles increases number of collisions with the container wall increases O temperature of the gas decreases O volume of the container decreases number of...
Chapter 5 HW 1. Determine whether the following statements are true or false A) Gasses have a high density B) Neon diffuses faster than argon C) Gas pressure is the result of particles of a gas colliding with each other D) Increased temperature of a gas result in increased gas pressure because particles move faster, collide more often and harder with the wall E) Gases are mostly empty space. F) When the temperature of a gas increases, the volume of...
24) Which of the following represent STP (Standard Temperature and Pressure) conditions? A) T -0 K and P = 1 atm B) T=0°C and P 760 atm C) T= 273 K and P = 0 atm D) T-273 K and P-1 atm E) T = 1 K and P = 1 atm 25) Which of the following is TRUE for a liquid that is placed in a sealed container? A) Condensation of the evaporated molecules in the jar can only...
please answer all question and type please
Problems and questions 1. Balance the following equations: - Na + H₂O NaOH + H2 PbO + _NH Pb + _Ny +_ H_O CH. +_ - _CO+ H2O a) — _NayCO; + _Mg(NO3)2 - > MgCO, + NaNO, 2. Write the correct balanced equation for each of the following reactions. Include the proper subscripts and include the state of matter for all reactants and products. Write the type of reaction on the blank...
What is the coefficient of H.So, when the following equation is properly balanced with the smallest set of whole numbers? __Cas(PO4h + H2SO4 - Caso + HPO. A) 3 B) 8 C) 10 D) 11 2) What is the coefficient of H20 when the following equation is properly balanced with smallest set of whole numbers? ALC + H2O - AM(OH), + CHE A) 3 B) 4 C) 6 D) 12 E) 24 3) of the reactions below, which one is...
Exam Name MULTIPLE CHOICE. Choose the one alternative that best completes the statement or answers the question. 1) 1) One mole of any substance contains Avogadro's number of particles of that substance. What is the numerical value of Avogadro's number? A) 12.01 23 Avagrans t Male aton 6022 x1o atums B) 6.022 x 1023 C) 6.022 x 10-23 D) 1.661 x10-24 E) 1.00 x10-14 2) What is the mass of 4.00 moles of helium, the gas commonly used to fill...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 32 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago