if two trials are done and the concentration for trial 1 is 0.004 M and the...
if two trials are done and the concentration for trial 1 is 0.004 M and the initial rate for trial 1 is 4.025e-3 and trial 2 is 0.002 M and initial rate is 1.224e-3 how do i calculate the k value for rate law and the n value.
Homework Answers
![Rate - k [reaclanl] Yo ; rate convlon), n; orden Jrcial 1 ; 4.025 XC-3 -6 10-0041 Trial-2 ; 1: 224 x 3k [o-002] Divide trial](http://img.homeworklib.com/questions/8194c700-d46e-11ea-9849-73388afe7e37.png?x-oss-process=image/resize,w_560)
Add Answer to:
if two trials are done and the concentration for trial 1 is
0.004 M and the...
The following table has data of three trials. Which two trials show the initial concentration of...
The following table has data of three trials. Which two trials
show the initial concentration of Y changing?
Then substitute values into equation 12-6 for the two trials
mentioned that will allow you to solve for b. Show the steps to
solve that equation. What whole nuber can “b” be rounded to? What
is the order of the reaction with respect to [X]?
Table 12-2 Sample Experiment Initial Concentrations and Rate Experiment # 2 [X] (M) 0.100 0.150 0.150 [Y](M)...
Name 3. O:o N-o он ONPG A scientist wants to measure if a test subject can digest lactose. This time, she uses 0.10...
Name 3. O:o N-o он ONPG A scientist wants to measure if a test subject can digest lactose. This time, she uses 0.100 M ONPG (a harmless lactose alternative), which in the presence of constant (enzyme). forms a yellow product. You allow the reaction to proceed untif the yetlow product is vivid enough to observe, and vou calculate the initial rate. Data Initial rate (not average) 1.64 Mimin 3.66 M/min point ONPG 0200M 0.300 M 0.400 M 0500 м 0...
(1 pts) Concentration of standard HCl solution (M) Table view List view Trial 1 Trial 2...
(1 pts) Concentration of standard HCl solution (M) Table view List view Trial 1 Trial 2 Initial burette reading (ml) Final burette reading (mL) Volume of HCl added (mL) Solution temperature (°C) (1pts) Average volume HCl added (mL) (2pts) Concentration of OH (M) (2pts) Concentration of Ca2+ (M) I (2pts) Value of Ksp for Ca(OH)2 An HCl solution has a concentration of 0.09714 M. Then 10.00 mL of this solution was then diluted to 250.00 mL in a volumetric flask....
6. A) A solution contains 0.002 M sodium chloride and 0.004 M calcium chloride. Calculate (a)...
6. A) A solution contains 0.002 M sodium chloride and 0.004 M calcium chloride. Calculate (a) the ionic strength of this solution and (b) the activity of sodium ion in the solution if the K value at the specified temperature is 0.51?
Volumetric Determination of a Sulfuric Acid Solution Initial concentration: assumed 6M H2SO4 Trial 1 Trial 2...
Volumetric Determination of a Sulfuric Acid Solution Initial concentration: assumed 6M H2SO4 Trial 1 Trial 2 Molarity of NaOH (aq) 0.2053 M 0.2053 M Initial burette reading, mL 18.50 mL 28.30 mL Final burette reading, mL 29.50 mL 39.10 mL a) Moles of NaOH added 2.258 moles 2.217 moles b) Moles of H2SO4 titrated ? ? Trial 1: a) Final Volume - Initial Volume = Volume 29.50 mL - 18.50 mL = 11.00 mL Moles = molarity x volume Moles...
Problem 1 Consider a sequence of n+m independent Bernoulli trials with probability of success p in each trial. Let N be the number of successes in the first n trials and let M be the number of suc...
Problem 1 Consider a sequence of n+m independent Bernoulli trials with probability of success p in each trial. Let N be the number of successes in the first n trials and let M be the number of successes in the remaining m trials. (a) Find the joint PMF of N and M, and the marginal PMFs of N and AM (b) Find the PMF for the total number of successes in the n +m trials.
Problem 1 Consider a sequence...
1. For a first order k = 9.09x10-3 1/s. If the initial concentration is 7.06 M...
1. For a first order k = 9.09x10-3 1/s. If the initial concentration is 7.06 M calculate the concentration after 35.0 s. 2. How long does it take the initial concentration of 0.778 M reduce to 0.453 M when k for the first order reaction is 2.11x10-2 1/min.? 3. The rate constant for a reaction at 25.0 oC is 2.87x10 -2. What is the rate constant at 55.0 oC? E a= 20.5 kJ. 4. The decomposition of a substance is...
Trial Using the given data, calculate the rate constant of this reaction. [B] (M) 0.300 [A]...
Trial Using the given data, calculate the rate constant of this reaction. [B] (M) 0.300 [A] (M) 0.390 0.390 0.663 Rate (M/s) 0.0112 0.0645 0.0190 0.720 A+B +C+D 0.300 STRATEGY 1. Determine the rate law. 2. Solve the rate law for k and calculate the k value. Step 1: The rate law is rate = k[A][B] Step 2: What is the value of k? What are the units of k? k =
Write a rate law for the reaction. The graph below shows a plot of the rate...
Write a rate law for the reaction. The graph below shows a plot of the rate of a reaction versus the concentration of the reactant A for the reaction A products (Figure 1). Rate = k Rate = k[A] Rate = k [A] Rate = k [A] Submit Previous Answers ✓ Correct Figure Part C < 1 of 1 > Estimate the value of k. 0.012 Express your answer using two significant figures. 0.01 0.008 10 AD O ? Rate...
due ASAp. please help 1. 2. 3a. 3b. Which statement accurately describes periodic trends? O As...
due
ASAp. please help
1.
2.
3a.
3b.
Which statement accurately describes periodic trends? O As a trend, elements that are more electronegative are less metallic O As a trend, elements that are more electronegative are more metallic O As a trend, elements that are electronegative have increasing atomic radii O As a trend, elements that are electronegative have decreasing atomic radii O None of these are accurate Using the provided graph, calculate the average reaction rate between 4 and...
The following table has data of three trials. Which two trials
show the initial concentration of Y changing?
Then substitute values into equation 12-6 for the two trials
mentioned that will allow you to solve for b. Show the steps to
solve that equation. What whole nuber can “b” be rounded to? What
is the order of the reaction with respect to [X]?
Table 12-2 Sample Experiment Initial Concentrations and Rate Experiment # 2 [X] (M) 0.100 0.150 0.150 [Y](M)...
Name 3. O:o N-o он ONPG A scientist wants to measure if a test subject can digest lactose. This time, she uses 0.100 M ONPG (a harmless lactose alternative), which in the presence of constant (enzyme). forms a yellow product. You allow the reaction to proceed untif the yetlow product is vivid enough to observe, and vou calculate the initial rate. Data Initial rate (not average) 1.64 Mimin 3.66 M/min point ONPG 0200M 0.300 M 0.400 M 0500 м 0...
(1 pts) Concentration of standard HCl solution (M) Table view List view Trial 1 Trial 2 Initial burette reading (ml) Final burette reading (mL) Volume of HCl added (mL) Solution temperature (°C) (1pts) Average volume HCl added (mL) (2pts) Concentration of OH (M) (2pts) Concentration of Ca2+ (M) I (2pts) Value of Ksp for Ca(OH)2 An HCl solution has a concentration of 0.09714 M. Then 10.00 mL of this solution was then diluted to 250.00 mL in a volumetric flask....
6. A) A solution contains 0.002 M sodium chloride and 0.004 M calcium chloride. Calculate (a) the ionic strength of this solution and (b) the activity of sodium ion in the solution if the K value at the specified temperature is 0.51?
Problem 1 Consider a sequence of n+m independent Bernoulli trials with probability of success p in each trial. Let N be the number of successes in the first n trials and let M be the number of successes in the remaining m trials. (a) Find the joint PMF of N and M, and the marginal PMFs of N and AM (b) Find the PMF for the total number of successes in the n +m trials.
Problem 1 Consider a sequence...
Trial Using the given data, calculate the rate constant of this reaction. [B] (M) 0.300 [A] (M) 0.390 0.390 0.663 Rate (M/s) 0.0112 0.0645 0.0190 0.720 A+B +C+D 0.300 STRATEGY 1. Determine the rate law. 2. Solve the rate law for k and calculate the k value. Step 1: The rate law is rate = k[A][B] Step 2: What is the value of k? What are the units of k? k =
Write a rate law for the reaction. The graph below shows a plot of the rate of a reaction versus the concentration of the reactant A for the reaction A products (Figure 1). Rate = k Rate = k[A] Rate = k [A] Rate = k [A] Submit Previous Answers ✓ Correct Figure Part C < 1 of 1 > Estimate the value of k. 0.012 Express your answer using two significant figures. 0.01 0.008 10 AD O ? Rate...
due
ASAp. please help
1.
2.
3a.
3b.
Which statement accurately describes periodic trends? O As a trend, elements that are more electronegative are less metallic O As a trend, elements that are more electronegative are more metallic O As a trend, elements that are electronegative have increasing atomic radii O As a trend, elements that are electronegative have decreasing atomic radii O None of these are accurate Using the provided graph, calculate the average reaction rate between 4 and...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 21 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago