Which compound would have the highest boiling point? CH3CH2CH2CH2–OH CH3CH2–O–CH2CH3 CH3-O–CH2CH2CH3 он CH3CH2-CH-OH

Question

Question

Which compound would have the highest boiling point?

CH₃CH₂CH₂CH₂–OH

CH₃CH₂–O–CH₂CH₃

CH₃-O–CH₂CH₂CH₃

Answer 1

Answer #1

CH₂ CH₂ - CHon has highest boiling point as it has highest no. [olegree of — он аrоuр Bo more Hydrogen bonding form. Hence, h

Answer 2

Similar Homework Help Questions

Which of the following is a tertiary alcohol? CH3CH2-CH-CH2CH2CH3 CH2CH2CH2OH CH3CH2-CH-CH3 OH CH2CH2CH3 CH3 CH2-C-CH2CH3 OH...

Which of the following is a tertiary alcohol? CH3CH2-CH-CH2CH2CH3 CH2CH2CH2OH CH3CH2-CH-CH3 OH CH2CH2CH3 CH3 CH2-C-CH2CH3 OH LOH CH2CH3 Reset Selection Type here to search
1) Which of the following is a secondary alcohol? A) CH3CH2-CH-CH2CH2CH3 CH2CH2CH2OH он - CH₂ CH3...

1) Which of the following is a secondary alcohol? A) CH3CH2-CH-CH2CH2CH3 CH2CH2CH2OH он - CH₂ CH3 CH2-CH-CH3 он CH2CH3 CH2CH2CH3 CH3CH2-C-CH2CH3 OH 2) The substance that precipitates in a positive Benedict test is: A) Cuo B) Cu2o C) Ag D) none of these 3) Galactose is called a(n): A) ketohexose B) aldopentose C) aldohexose D) ketopentose 4) Identify all the disaccharides from the following list: i) Lactose ii) Glucose iii) Ribose iv) Maltose A) iii B) iii + iv C)i...
Problem 47. 'rovide proper IUPAC names for each compound. CH2CH2CH3 CH2CHCH2CHCHCH; CH2CH3 CH3 48. Provide a...

Problem 47. 'rovide proper IUPAC names for each compound. CH2CH2CH3 CH2CHCH2CHCHCH; CH2CH3 CH3 48. Provide a name for the structure below. (IUPAC) CH3 419. Provide a name for the compound below. ĆUPAC) CH; CH,CECCHCH,CH2CH3 50. Provide the correct IUPAC name for the following compound. NOZ G CH 57. Give an acceptable name for the following substance. I UPAC HOCH,CH,OH S. Provide the IUPAC name for the structure below. H NO2 1. 53. Provide the IUPAC name for the following structure....

which of the following will have the highest boiling point Which of the following will have...

which of the following will have the highest boiling point Which of the following will have the highest boiling point? Select one: o a. CH3CH2OH o b. CH2CH3 O C.HOCH-CH2OH d. CH,OCH
IUPAC Nomenclature 4.39 Give the IUPAC name for each compound. h. tyn my 1. -CH(CH2CH3)2 i....

IUPAC Nomenclature 4.39 Give the IUPAC name for each compound. h. tyn my 1. -CH(CH2CH3)2 i. a. CH3CH2CHCH2CHCH2CH2CH3 CH3 CH2CH3 CH2CH3 CH3 b. CH3CH2CCH_CH2CHCHCH2CH2CH3 CH2CH3 CH2CH3 C. CH3CH,CH,C(CH3)2C(CH3)2CH2CH3 d. CH3CH2C(CH2CH3)2CH(CH3)CH(CH2CH2CH3)2 e. (CH3CH2),CCH(CH3)CH2CH2CH3 f. CH3CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)3CH3 g. (CH2CH2CH2)4C more on mo .
7. (6 points) Which compound in each pair has the highest boiling point? CH3OCH2CH3 or CH3CH(OH)CH3...

7. (6 points) Which compound in each pair has the highest boiling point? CH3OCH2CH3 or CH3CH(OH)CH3 CH3CH2CH2CH2CH3 or CH3CH2CH2CH3 (CH3)2CHCH3 or CH3CH2CH2CH3

which substance below would you predict to have the highest boiling point Question 11 1 pts...

which substance below would you predict to have the highest boiling point Question 11 1 pts Which substance below would you predict to have the highest boiling point? O CH3-CH2-CH2-OH O CH3-CH2-CH3 CH3-CH2-CH2-CHE e CH3-CO-CH3
4. Which compound will have the highest boiling point? Why? OH voi 5. Arrange the following...

4. Which compound will have the highest boiling point? Why? OH voi 5. Arrange the following compounds in order according to their acidity (the strongest first). OH 6. Indicate those ortho/para director(s) and those meta director(s) for EAS reactions: CH3 -C₂H5 - NOZ - CH3 - Br
Which compound should have the highest boiling point? (a) CH3-Br (b) CH3-Cl (c) CH3-F (d) CH3-I

Which compound should have the highest boiling point? (a) CH3-Br (b) CH3-Cl (c) CH3-F (d) CH3-I

15. Consider the information here: Compound a) CH3-CH2-O-CH2-CH3 b) CH3CH2CH2CH2-OH c) CH3CH2COOH Molar mass 74 g/mol...

15. Consider the information here: Compound a) CH3-CH2-O-CH2-CH3 b) CH3CH2CH2CH2-OH c) CH3CH2COOH Molar mass 74 g/mol 74 g/mol 74 g/mol Normal boiling point (deg C) 34.6 117.7 141.2 Explain the trend in boiling points for compounds a, b and c using the intermolecular forces important in each liquid.