Homework Answers
Add Answer to:
Q2 a) Why the volume of gas decreased when pressure increased in closed containers. (6 Marks)...
Why does the pressure of a gas sample increase when the temperature is increased? Assume the...
Why does the pressure of a gas sample increase when the
temperature is increased? Assume the volume remains constant.
Select all that apply.
Why does the pressure of a gas sample increase when the temperature is increased? Assume the volume remains constant. Select all that apply. Choose one or more: O A. The average kinetic energy of the gas increases as the temperature increases, causing more energetic collisions with the walls. O B. As the temperature of the gas increases,...
U DUDUB DOOD 1. What causes increased gas pressure? A) Reduce volume while keeping temperature constant....
U DUDUB DOOD 1. What causes increased gas pressure? A) Reduce volume while keeping temperature constant. B) Reduce the number of moles and temperature while keeping the volume constant. C) Increase volume with temperature constant. D) Decrease the temperature while keeping the volume and number of moles constant. 2.The volume of the amount of gas is equal to 10L at 30C" and 760torr., The temperature needed to make the volume equal to 9L with its constant pressure equal to (in...
6. Use the kinetic molecular theory of gases to predict what would happen to a closed...
6. Use the kinetic molecular theory of gases to predict what would happen to a closed sample of a gas whose temperature increased while its volume decreased. A) Its pressure would decrease. B) Its pressure would increase. C) Its pressure would hold constant. D) The number of moles of the gas would decrease. E) The average kinetic energy of the molecules of the gas would decrease.
1. A sample of gas with an initial volume of 28.4 L at a pressure of...
1. A sample of gas with an initial volume of 28.4 L at a pressure of 735 mmHg and a temperature of 309 K is compressed to a volume of 14.5 L and warmed to a temperature of 377 K .What is the final pressure of the gas? 2. A cylinder with a moveable piston contains 216 mL of nitrogen gas at a pressure of 1.29 atm and a temperature of 292 K .What must the final volume be for...
Please answer & explain 22-25 22. Pressure is created when a gas is compressed and the...
Please answer & explain 22-25
22. Pressure is created when a gas is compressed and the temperature is decreased proportionally b) gas particles collide with the sides of their container more gas particles are added and the volume is increased proportionally gas particles are removed and the volume stays the same 23. because In response to Boyle's law, the pressure of a gas increases as the volume a) decreases; the gas particles strike the walls of the container more often...
The initial volume of a gas at a pressure of 3.2 atm is 2.9 L
GAS LAWS 1. The initial volume of a gas at a pressure of 3.2 atm is 2.9 L What will the volume be if the pressure is increased to 4.0 atm? 2. A balloon is filled with 35 O L of helium in the morning when the temperature is 20.00. By noon the temperature has risen to 45.00. What is the new volume of the balloon? 3. A helium balloon with an internal pressure of 1.00 atm and a volume of 4.50 L...
A gas cylinder containing carbon dioxide, CO2, 85% by volume, and nitrogen, N2, 15% by volume...
A gas cylinder containing carbon dioxide, CO2, 85% by volume, and nitrogen, N2, 15% by volume has a volume of 2.2 m and is kept at a temperature of 20°C. You may assume the gas mixture is ideal. 0 Calculate the pressure in kPa in the cylinder when it contains 50 kg of gas. [2 marks] After a certain amount of gas has been used, the pressure decreases by 150 kPa. Calculate the mass of gas used. [2 marks] (b)...
Let us first examine the behavior of an ideal gas when we force the volume to...
Let us first examine the behavior of an ideal gas when we force the volume to be a value of our choosing. We can examine how changes to the absolute temperature and number of moles affect the pressure of the gas particles (by selecting pressure with Rspd such that pressure cannot be controlled). Assume that 0.03 mol of helium at a temperature of 275.00 K occupy a volume of 1.40 L. Use the Run Experiment tool in the Simulation to...
A spray can containing a propellant gas at twice atmospheric pressure (202 kPa) and having a...
A spray can containing a propellant gas at twice atmospheric pressure (202 kPa) and having a volume of 119.00 cm is at 27°C. It is then tossed into an open fire. (Warning: Do not do this experiment; it is very dangerous.) When the temperature of the gas in the can reaches 195°C, what is the pressure inside the can? Assume any change in the volume of the can is negligible. SOLUTION Conceptualize Intuitively, you should expect that the pressure of the gas...
_______ Q2) 2) An automobile tire is filled to a gauge pressure of 196 kPa when...
_______
Q2)
2) An automobile tire is filled to a gauge pressure of 196 kPa
when its temperature is 20°C. (Gauge pressure is the difference
between the actual pressure and atmospheric pressure.) After the
car has been driven at high speeds, the tire temperature increases
to 51°C.
(a) Assuming that the volume of the tire does not change, and
that air behaves as an ideal gas, find the gauge pressure of the
air in the tire.
(b) Calculate the gauge...
Why does the pressure of a gas sample increase when the
temperature is increased? Assume the volume remains constant.
Select all that apply.
Why does the pressure of a gas sample increase when the temperature is increased? Assume the volume remains constant. Select all that apply. Choose one or more: O A. The average kinetic energy of the gas increases as the temperature increases, causing more energetic collisions with the walls. O B. As the temperature of the gas increases,...
U DUDUB DOOD 1. What causes increased gas pressure? A) Reduce volume while keeping temperature constant. B) Reduce the number of moles and temperature while keeping the volume constant. C) Increase volume with temperature constant. D) Decrease the temperature while keeping the volume and number of moles constant. 2.The volume of the amount of gas is equal to 10L at 30C" and 760torr., The temperature needed to make the volume equal to 9L with its constant pressure equal to (in...
6. Use the kinetic molecular theory of gases to predict what would happen to a closed sample of a gas whose temperature increased while its volume decreased. A) Its pressure would decrease. B) Its pressure would increase. C) Its pressure would hold constant. D) The number of moles of the gas would decrease. E) The average kinetic energy of the molecules of the gas would decrease.
Please answer & explain 22-25
22. Pressure is created when a gas is compressed and the temperature is decreased proportionally b) gas particles collide with the sides of their container more gas particles are added and the volume is increased proportionally gas particles are removed and the volume stays the same 23. because In response to Boyle's law, the pressure of a gas increases as the volume a) decreases; the gas particles strike the walls of the container more often...
A gas cylinder containing carbon dioxide, CO2, 85% by volume, and nitrogen, N2, 15% by volume has a volume of 2.2 m and is kept at a temperature of 20°C. You may assume the gas mixture is ideal. 0 Calculate the pressure in kPa in the cylinder when it contains 50 kg of gas. [2 marks] After a certain amount of gas has been used, the pressure decreases by 150 kPa. Calculate the mass of gas used. [2 marks] (b)...
Let us first examine the behavior of an ideal gas when we force the volume to be a value of our choosing. We can examine how changes to the absolute temperature and number of moles affect the pressure of the gas particles (by selecting pressure with Rspd such that pressure cannot be controlled). Assume that 0.03 mol of helium at a temperature of 275.00 K occupy a volume of 1.40 L. Use the Run Experiment tool in the Simulation to...
A spray can containing a propellant gas at twice atmospheric pressure (202 kPa) and having a volume of 119.00 cm is at 27°C. It is then tossed into an open fire. (Warning: Do not do this experiment; it is very dangerous.) When the temperature of the gas in the can reaches 195°C, what is the pressure inside the can? Assume any change in the volume of the can is negligible. SOLUTION Conceptualize Intuitively, you should expect that the pressure of the gas...
_______
Q2)
2) An automobile tire is filled to a gauge pressure of 196 kPa
when its temperature is 20°C. (Gauge pressure is the difference
between the actual pressure and atmospheric pressure.) After the
car has been driven at high speeds, the tire temperature increases
to 51°C.
(a) Assuming that the volume of the tire does not change, and
that air behaves as an ideal gas, find the gauge pressure of the
air in the tire.
(b) Calculate the gauge...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 55 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago