The correct IUPAC name of the given compound is
3,4-dimethyl-3-hexene
CH3 Нас CH3 CHE Pu CH3 H₂C. CH3 CH3 3,4-dimethyl-3-hexene 3,4-dimethylhexane dimethyldiethyl-1-butene 1.2-dimethyl-3-hexene 3-methyl-4-methyl-3-hexene 1.2-dimethyl-1-hexene 2,3-diethyl-2-butene...
Which of the following compounds can have cis and trans isomers? 2-Methyl-2-butene Propene 0 1-Butene 1,2-Dichloro-1-Bu What is the correct molecular formula of 2,4-Diethyltouleno OCHA 0 C₂ H₂2 G H C:oH20 18 Which of the following compounds can have cis and trans isomers? 1-Butene 2-Methyl-2-butene 1,2-Dichloro-1-Butene Propene CH3CHBr2 is obtained from O Reaction of ethyne with one mole of HBr O Reaction of ethyne with one mole of Br2 Reaction of ethyne with two moles of Br2 Reaction of ethyne...
Question 4 The correct IUPAC name for the following compound is A. 2,3-Dimethyl-4-propyl-5-hexene 4,5-Dimethyl-3-propyl-1-hexene c. 2,3-Dimethyl-4-isopropyl-5-hexene D. 4,5-Dimethyl-3-propyl-2-hexene
Leto 1. 2-methyl-1-butene memome IUPAC Nomenclature Practice 2. 2-methyl-3-heptyne 3. (z)-3-ethyl-4-methyl-2-hexene Iy-01 001 9pocz o00'1- 4. 2-propохурепtane ent & Uni S. 4-methylhexanoic acid P7 wnuuny Jod 0. (E)-2,3-dichloro-4-ethyl -2 -hexene 7. 3-ethyl-2,3-dimethyl -2 - pentanol etration Pov racterized lecay (phor 8. 5-chloro-4-methyl-3 -heptanone ) eaap decay (ene Fission Fusion 9. 3-phenyl-1-propyne dioac Туре HI t Trans 10.2-methylcyclopentanol 11. (Z)-3-methoxy-2-pentene 12.3-bromobutanoic acid
is this correct? Data Table Part A. Drawing Formulas and Naming Hydrocarbons. Name: 3-methylpentane Name: 2,3-dimethylhexane 5-pentand 6-an CH3 Name: 11-dimethylcyclohexane CHE Name: 3-cloro 2-methylpe CI CHE - CH₃ CH3-CH2=CH-CH-C 2-methyl Name: 3-methylcyclopentene Name: 2,3-dibromo-1-butene Br Name: Name: 3-methyl-1-butyne CH,CHCH= CHCH,CH3 CH3 Name: 4-bromo-3-chloro-1-heptyne Name: CH, CH,-cácc=CH-C CH3 CH3
What is the IUPAC name for CH3CH2CHC(CH3)CH2CH3 isopentene 3-methyl-2-pentene O 3-methyl-3-hexene 2-methyl-3-hexene O 1,1-dimethyl-2-hexene
Please provide a structure for each of the following names. 1-Bromo-3-methylcyclohexene 3-Ethyl-2-pentene cis-3-Octene (Z)-3-Methyl-2-hexene Vinylcycloheptane (Z)-1,3,5-Tribromo-2-pentene 1,2-Diethyl-cyclopentene Vinybromide 2,3-Dimethyl-2-butene 3,7,7-Trimethyl-4-octene 4-lsopropyl-1-nonene (E)-3-Methyl-2-heptene
Question 12 (0.5 points) Which of the following is not a valid IUPAC name? 2,3-dimethyl-3-hexene 4-pentene 1-pentene 2-pentene Question 13 (0.5 points) Which of the following is a correct IUPAC name for a compound? 2-butene 3-butene 4-butene All of these are correct IUPAC names
ter 5 HW Assignment ter 5 Reading Question 2 Part A 2,5-Diethyl-2-hexene is an incorrect IUPAC name for the following. CH3CH2CH(CH3)CH2CH=C(CH3)CH2CH3 The correct IUPAC name would be View Available Hint(s) 3-ethyl-5-methyl-4-octene 3,5-diethyl-4-hexene 3-methyl-5-ethyl-3-octene 3.5-dimethyl-3-octene Subm
IZDI 4) What is the major organic product of the following reaction? NaOCH_CH: A) 2,3-dimethyl-2-hexene B) (E)-2,3-dimethyl-3-hexene C) (2)-2,3-dimethyl-3-hexene D) 2-isopropyl-1-pentene E) 2,3-dimethyl-1-hexene ila nf the following statements correctly describe(s) E1 reactions of
26) Name the following compound. CH3 H2C=CH-CH2CHCH: A) 1,1-dimethyl-3-butane B) 4-methyl-1-pentene C) hexene D) 2-methyl-4-pentene E) 2-methylpentene 27) Name the following compound. CI A) 2,3,5-trichlorobenzene B) trichlorostyrene C) 1,3,4-trichlorobenzene D) 1,3,4-trichlorohexene E) 1,2,4-trichlorobenzene 28) Identify the formula for an alkene. A) CnH2n+4 B) CnH2n+2 C) CnH2n D) CnH2n-4 E) CnH2n-2 29) Name the following compound. A) 1,4-bromocyclohexene B) 1,4-dibromobenzene C) 3,6-dibromobenzene D) 2,5-dibromobenzene E) 2,5-dibromocyclohexene 30) Name the following compound. CECH CH,CH,CHCH A) 2-ethynebutane B) 3-methyl-1-pentyne C) 3-methyl-4-pentyne D) 3-ethyl-1-butyne...