Homework Answers
Add Answer to:
13) Write the chemical equation and determine if the following double displacement reactions will occur. (4...
Write the formula, total ionic, and net ionic equations for reactions 1-21 listed below. When no...
Write the formula, total ionic,
and net ionic equations for reactions 1-21 listed below. When no
reaction is expected, write NAR for no apparent reaction.
Write answer such that for
example:
1a) formula for #1
1b) total ionic for #1
1c) net ionic for #1
1. sulfuric acid + potassium phosphate 2. sulfuric acid + lithium sulfate 3. sulfuric acid + magnesium nitrate 4. sulfuric acid + sodium carbonate 5. sulfuric acid + sodium hydroxide 6. sulfuric acid + strontium...
Practice Problem 7. Write a balanced chemical reaction for each of the following double replacement reactions....
Practice Problem 7. Write a balanced chemical reaction for each of the following double replacement reactions. (a) Silver Nitrate and Hydrochloric Acid (b) Sodium Carbonate and Hydrochloric Acid (c) Sodium Hydroxide and Nitric Acid (d) Calcium Chloride and Sulfuric Acid (e) Sodium Carbonate and Barium Chloride (f) Copper (II) Sulfate and Barium Chloride (8) Iron (III) Chloride and Sodium Hydroxide Write the formula of the following double replacement reactions.
Post Laboratory Questions 1. Write the equation for the decomposition of sulfurous acid. Usingl 2. Using...
Post Laboratory Questions 1. Write the equation for the decomposition of sulfurous acid. Usingl 2. Using the three criteria for double displacement reactions, and the solubility table. predict whether a double displacement reaction will occur for each of the following. If the reaction will occur, balance the reaction write conventional, total ionic and net ionic equations. Box the net ionic equation. Be sure to include the proper phase labels. If no reaction will occur. write "no reaction". All reactants are...
Identify each of the following reactions as synthesis, decomposition, combustion, single replacement, or double replacement. If...
Identify each of the following reactions as synthesis, decomposition, combustion, single replacement, or double replacement. If the reaction is a single or double replacement reaction, tell if the reaction occurs spontaneously. If the reaction does not occur spontaneously, write "No Reaction." If the reaction does occur spontaneously for single and double replacement write a balanced molecular, total ionic, and net ionic equation. For the other types of reactions, write a balanced chemical equation. 2. Water and dinitrogen trioxide gas 3....
CuCu) Translate Each Word Equation Into a Balanced Chemical Equation A. Combination Reactions 1. magnesium metale)+...
CuCu) Translate Each Word Equation Into a Balanced Chemical Equation A. Combination Reactions 1. magnesium metale)+ oxygene magnesium oxidea) Mg(s) O219) H93g0 249ois) Azine sulfidea) 2. zine metala) + sulfur) erylit CUSON B. Decomposition Reactions copper(I) sulfate) + watere) 1. copper(II) sulfate pentahydrate) 2. sodium hydrogen carbonate sodium carbonate)+ watere) + carbon dioxide() C. Replacement Reactions copper(II) nitrate(ag)+ silver metal) 1. copper metal(s) + silver nitrate(aq) magnesium chloride(aq) + hydrogen() 2. magnesium metal) + hydrochloric acid(ag) 3. calcium metal) +watere)calcium...
Chemical Reactions For each reaction you observed, the names of the reactants and products are given...
Chemical Reactions For each reaction you observed, the names of the reactants and products are given below. You must: 1. Write the correct formula for each reactant and product. Balance each equation. 2. A. Combination reactions magnesium oxide 1. Magnesium + oxygen (unbalanced) Mg+ O, MgO sulfur dioxide 2. Sulfur + oxygen B. Analysis of the Copper Content of a Penny po zinc chloride + hydrogen zinc + hydrochloric acid HCI ZnCl, 1. (unbalanced) н, Zn + C. Single Replacement...
For which of the following pairs of reactants would a precipitation reaction occur? 1.Lithium hydroxide and...
For which of the following pairs of reactants would a precipitation reaction occur? 1.Lithium hydroxide and potassium carbonate 2.Silver and calcium carbonate 3. Sodium chloride and Sodium nitrate 4.Zinc chloride and Silver nitrate 5.Magnesium and copper(II) sulfate
Please write a word equation for this reaction and briefly describe the reactant and products. Write...
Please write a word equation for this reaction and briefly describe the reactant and products. Write the balanced chemical equation for all of the reactions. D. Double Displacement Reactions Reaction of sodium bicarbonate and hydrochloric acid Reaction of sodium carbonate and calcium chloride Reaction of potassium hydroxide and nickel chloride Reaction of silver nitrate and potassium chloride
Name: Lab Partner's name Lab 11 Reactions and Equations: Double Displacement Reactions AUN A. OBSERVATIONS / QUES...
Name: Lab Partner's name Lab 11 Reactions and Equations: Double Displacement Reactions AUN A. OBSERVATIONS / QUESTIONS: 1. For each of the following reactions, record the evidence you observe that indicates a chemical change has occurred and provide a balanced molecular equation, complete ionic equation and net ionic equation a) Silver nitrate + Sodium chloride Evidence of chemical change: Souly Turning into a solida turned white and cloudly Slowly disoiving Shrunk into one bail Molecular Equation: AgNO3 + NaCl ->...
please help! 151 Expt 8 - Chemical Properties PreLab Questions: Write balanced chemical equations for the...
please help!
151 Expt 8 - Chemical Properties PreLab Questions: Write balanced chemical equations for the following double displacement reactions. CIRCLE any precipitates that form. If a precipitate or liquid forms, also write a net ionic equation. 1) potassium iodide + silver nitrate Equation: Net ionic equation, if precipitate forms: 2) sodium carbonate + silver nitrate Equation: Net ionic equation, if precipitate forms: 3) ammonium chloride + silver nitrate Equation: Net ionic equation, if precipitate forms: 4) hydrochloric acid +...
Write the formula, total ionic,
and net ionic equations for reactions 1-21 listed below. When no
reaction is expected, write NAR for no apparent reaction.
Write answer such that for
example:
1a) formula for #1
1b) total ionic for #1
1c) net ionic for #1
1. sulfuric acid + potassium phosphate 2. sulfuric acid + lithium sulfate 3. sulfuric acid + magnesium nitrate 4. sulfuric acid + sodium carbonate 5. sulfuric acid + sodium hydroxide 6. sulfuric acid + strontium...
Practice Problem 7. Write a balanced chemical reaction for each of the following double replacement reactions. (a) Silver Nitrate and Hydrochloric Acid (b) Sodium Carbonate and Hydrochloric Acid (c) Sodium Hydroxide and Nitric Acid (d) Calcium Chloride and Sulfuric Acid (e) Sodium Carbonate and Barium Chloride (f) Copper (II) Sulfate and Barium Chloride (8) Iron (III) Chloride and Sodium Hydroxide Write the formula of the following double replacement reactions.
Post Laboratory Questions 1. Write the equation for the decomposition of sulfurous acid. Usingl 2. Using the three criteria for double displacement reactions, and the solubility table. predict whether a double displacement reaction will occur for each of the following. If the reaction will occur, balance the reaction write conventional, total ionic and net ionic equations. Box the net ionic equation. Be sure to include the proper phase labels. If no reaction will occur. write "no reaction". All reactants are...
Identify each of the following reactions as synthesis, decomposition, combustion, single replacement, or double replacement. If the reaction is a single or double replacement reaction, tell if the reaction occurs spontaneously. If the reaction does not occur spontaneously, write "No Reaction." If the reaction does occur spontaneously for single and double replacement write a balanced molecular, total ionic, and net ionic equation. For the other types of reactions, write a balanced chemical equation. 2. Water and dinitrogen trioxide gas 3....
CuCu) Translate Each Word Equation Into a Balanced Chemical Equation A. Combination Reactions 1. magnesium metale)+ oxygene magnesium oxidea) Mg(s) O219) H93g0 249ois) Azine sulfidea) 2. zine metala) + sulfur) erylit CUSON B. Decomposition Reactions copper(I) sulfate) + watere) 1. copper(II) sulfate pentahydrate) 2. sodium hydrogen carbonate sodium carbonate)+ watere) + carbon dioxide() C. Replacement Reactions copper(II) nitrate(ag)+ silver metal) 1. copper metal(s) + silver nitrate(aq) magnesium chloride(aq) + hydrogen() 2. magnesium metal) + hydrochloric acid(ag) 3. calcium metal) +watere)calcium...
Chemical Reactions For each reaction you observed, the names of the reactants and products are given below. You must: 1. Write the correct formula for each reactant and product. Balance each equation. 2. A. Combination reactions magnesium oxide 1. Magnesium + oxygen (unbalanced) Mg+ O, MgO sulfur dioxide 2. Sulfur + oxygen B. Analysis of the Copper Content of a Penny po zinc chloride + hydrogen zinc + hydrochloric acid HCI ZnCl, 1. (unbalanced) н, Zn + C. Single Replacement...
Name: Lab Partner's name Lab 11 Reactions and Equations: Double Displacement Reactions AUN A. OBSERVATIONS / QUESTIONS: 1. For each of the following reactions, record the evidence you observe that indicates a chemical change has occurred and provide a balanced molecular equation, complete ionic equation and net ionic equation a) Silver nitrate + Sodium chloride Evidence of chemical change: Souly Turning into a solida turned white and cloudly Slowly disoiving Shrunk into one bail Molecular Equation: AgNO3 + NaCl ->...
please help!
151 Expt 8 - Chemical Properties PreLab Questions: Write balanced chemical equations for the following double displacement reactions. CIRCLE any precipitates that form. If a precipitate or liquid forms, also write a net ionic equation. 1) potassium iodide + silver nitrate Equation: Net ionic equation, if precipitate forms: 2) sodium carbonate + silver nitrate Equation: Net ionic equation, if precipitate forms: 3) ammonium chloride + silver nitrate Equation: Net ionic equation, if precipitate forms: 4) hydrochloric acid +...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 36 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago