We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Question 3 5 pts Identify the compound from the following IR. CH 0 M 1000 Ethane...
Question #2: Predict the compound that matches the following IR spectrum (10 pts): r you i 0.8 CH,0 08 HO 0.6 0.6 CI a. W would reaction ed with s 04 0.2+ 02 3000 2000 Wavnumber icm-1) 1000 3000 2000 Wavnumber en 1) 1000
Question 3 5 pts Identify the class of lipid to which the following molecule belongs. CH2-0-C-(CH)6- (CH2-CH=CH2-CH2) -CH, CH-0-C-(CH2),CH=CH-(CH2)7 – CH3 CH2 –0-C-(CH), –(CH2 -CH=CH), –CH2 –CH; phospholipid fatty acid wax triglyceride Identify the class of lipid to which the following molecule belongs.. CH2 -0-C-(CH2) 16CH; CH-0-C-(CH)-CH=CH(CH2)-CH, O = CH,-o-P-0-(CH)-N(CH) triglyceride fatty acid wax phospholipid We were unable to transcribe this imageQuestion 13 5 pts A saturated fatty acid is a fatty acid chain in which a carbon chain has...
Identify the following ir spectrum 100 Transmittance *T D 0 4000 3000 1300 1000 100 2000 wavenumber om ethyl vinyl ether 2-butanone 2-methylpropanal 2-methyl-2-propen-1-ol Identify the following ir spectrum Transmittance T E 4000 1000 1500 1000 300 1000 wavenumber cm 2-methylpropanal 2-methyl-2-propen-1-ol ethyl vinyl ether 2-butanone Identify the following ir spectrum 100 mm Transmittance ** ly B 500 1000 1100 1000 1000 1000 wavenumber em: O2-methyl-2-propen-1-ol 2-methylpropanal 2-butanone ethyl vinyl ether Identify the following ir spectrum 100 พา Transmittance NT...
7. Consider the IR, 'H-NMR and C-NMR spectra of the compound with MF:C,H, 0. 4 pts Identify the structure of the unknown compound. MF C7H140 MW 114 $C 73.6 SH 12.4 Mass Spec. D m/ sbund. 27 35 relativ 114 11 Popyright © 1994 1.0 PPM 3.0 Proton NMA TTTTTTTTTTTTTTTTTTTTTTTTTTTTTT 200 180 160 140 Carbon 13 NMR T 120 TTTTTTTTTTTTTTTTTTTTTTTTTTTTTT 100 80 60 40 20 PPM O en og and 8. Consider the IR, 'H-NMR and C-NMR spectra of the...
27. An organic compound is 38 compound? 15 pts C, 97% and 5161 W 26. How many molecules of ethane (CH) are present in 0.822 g of CHA T 29 Calculate the mass of NaCl in grams required to prepare 5.00 x 10 ml of 20 M
D Question 3 4 pts Identify which molecule below (a-1) corresponds to the following IR spectra: 0.9 0.75F Relative Transmittance 0.45 3000 2000 Wavenumber icm-1) 1000 alon aia ir B c D Н OA Ос OD OF OG ОН OI Ouestion 4
Identify the following ir spectrum 3 6 1 2 ✓ ເຂົ້າມາມຮນສາມ M ong 12 15 B 1000 18 2-butanone 21 2-methyl-2-propen-1-ol 24 ethyl vinyl ether 2-methylpropanal a Question 20 (2.5 points) ✓ Saved Give the major product of the following sequence of reactions 9 1) HNOJH SO acetophenone 12 2) HyPa Op-aminoethylbenzene 15 ✓ m-aminoethylbenzene 18 m-aminoacetophenone 21 m-nitroacetophenone Question 12 (2.5 points) What is the major product of the following reaction? 1 2 3 4 2-butanone 5 6 (PL);P-CHCH...
• Experiment 9 7. From the IR of the compound shown below, identify the major peaks corresponding to the functional groups present. 100- Transmittance 0- 1000 500 4000 3000 2000 1500 Wavenumber (cm-')
c. The following structure is given for compound A HN 0 N Compound A i. Identify the splitting pattern expected from the 1H NMR. (2 pts). ii. What type of functional group confirmation you can expect from the IR spectrum? (2 pts). iii. How many different types of carbon you can expect from this compound in 13C NMR? (2 pts)
5. Identify the following compound based on the molecular formula and given spectra 32. CH, 202 3 total 2 3 Ppm
5. Identify the following compound based on the molecular formula and given spectra 32. CH, 202 3 total 2 3 Ppm