Homework Answers
Non-metals of group 15 are: Nitrogen and Phosphorus
Metaloids of group 15 are: Arsenic and Antimony
Metal of group 15 is : Bismuth
Therefore, 2 non-metals ,2 metaloids and 1 metal
Add Answer to:
Of the naturally occurring elements in group 15, how many are nonmetals, metalloids, and metals? O...
location of elements (check all that apply) electron configuration of atoms blocks metals or nonmetals? metals...
location of elements (check all that apply) electron configuration of atoms blocks metals or nonmetals? metals S p [GJanp nonmetals dnf metallolds metals Sp [GJas md10np nonmetals metalloids metals [G]n. md' nonmetals d nf metalloids metals 2 , 10 пр [G]ns m d np nonmetals metalloids
stands for a noble-gas core and n, m, or o stand for integer numbers like 1, 2, 3 Some patterns of electron configurati...
stands for a noble-gas core and n, m, or o stand for integer numbers like 1, 2, 3 Some patterns of electron configuration are listed below. In each case, G and so on. Think about the chemical elements made of atoms with an electron configuration that matches each pattern. In what block or blocks of the Periodic Table would these elements lie? Would they be metals, nonmetals, metalloids, some of each? Use your answers to these questions to complete the...
Some patterns of electron configuration are listed below. In each case, LG stands for a noble-gas...
Some patterns of electron configuration are listed below. In each case, LG stands for a noble-gas core and n, m, or o stand for integer numbers like 1, 2,.3 and so on Think about the chemical elements made of atoms with an electron configuration that matches each pattern. In what block or blocks of the Periodic Table would these elements lie? Would they be metals, nonmetals, metalloids, some of each? Use your answers to these questions to complete the table...
Some patterns of electron configuration are listed below. In each case, Gstands for a noble-gas core...
Some patterns of electron configuration are listed below. In each case, Gstands for a noble-gas core and n, m, or o stand for integer numbers like 1, 2, 3 and so on. Think about the chemical elements made of atoms with an electron configuration that matches each pattern. In what block or blocks of the Periodic Table would these elements lie? Would they be metals, non metals, metalloids, some of each? Use your answers to these questions to complete the...
Categorize each of the period 2 elements according to their metallic character. CRAC 2017 2018 1...
Categorize each of the period 2 elements according to their metallic character. CRAC 2017 2018 1 4 5 0309care ne 4A(14) 5) N O 3) Ne Metals Metalloids Nonmetals
For the main group elements, atomic size increases down the group. For the transition metals, how...
For the main group elements, atomic size increases down the
group. For the transition metals, how does the atomic size change
from the 4d series to 5d series? What is the factor that causes the
difference between these two types of elements?
(h) For the main group elements, atomic size increases down the group. For the transition metals, how does the atomic size change from the 4d series to 5d series? What is the factor that causes the difference between...
3. Describe the location (group and period) of the following metals and nonmetals on the periodic...
3. Describe the location (group and period) of the following metals and nonmetals on the periodic table. Element Group Period Kr Fr 4. Write the complete chemical symbol (including the mass number, atomic number, and charge if any) of the element that corresponds to the following subatomic particles: a) p =1, e = 1, and nº = 0 b)pt = 36, e = 36, and nº = 48 c)pt = 26, e- = 23, and nº = 30 d) p...
Using the terms bonding, energy and stability, explain occurring compounds, but only 90 naturally occurring elements....
Using the terms bonding, energy and stability, explain occurring compounds, but only 90 naturally occurring elements. why there are millions of naturally Who Gives a Darn? I Do! In completing this activity, you have explored why hydrogen atoms combine to form diatomic hydrogen, and why helium atoms do not combine to form diatomic helium. In the Star Trek universe, star ships are propelled with dilithium crystals. Dilithium is possible to prepare, however, it is only known to exist in the...
1: In a Uranium atom, which is the heaviest element naturally occurring on earth, how many...
1: In a Uranium atom, which is the heaviest element naturally occurring on earth, how many atomic electrons are there? Write down the complete electron configuration of the ground state of Uranium.
complete the sentences regarding alkaline earth metals The Group 2A(2) elements are called alkaline earth metals bec...
complete the sentences regarding alkaline earth
metals
The Group 2A(2) elements are called alkaline earth metals because their oxides give (alkaline) solutions and melt at such temperatures that they remained as solids ("earths") in the alchemists fires. denser low for 2A metals than larger lower The melting and boiling points are much for the corresponding 1A metals. ences smaller oxidizing Compared to corresponding Group 1A(1) elements, Group 2A(2) elements have metallic bonding and atomic sizes which makes them harder and...
location of elements (check all that apply) electron configuration of atoms blocks metals or nonmetals? metals S p [GJanp nonmetals dnf metallolds metals Sp [GJas md10np nonmetals metalloids metals [G]n. md' nonmetals d nf metalloids metals 2 , 10 пр [G]ns m d np nonmetals metalloids
stands for a noble-gas core and n, m, or o stand for integer numbers like 1, 2, 3 Some patterns of electron configuration are listed below. In each case, G and so on. Think about the chemical elements made of atoms with an electron configuration that matches each pattern. In what block or blocks of the Periodic Table would these elements lie? Would they be metals, nonmetals, metalloids, some of each? Use your answers to these questions to complete the...
Some patterns of electron configuration are listed below. In each case, LG stands for a noble-gas core and n, m, or o stand for integer numbers like 1, 2,.3 and so on Think about the chemical elements made of atoms with an electron configuration that matches each pattern. In what block or blocks of the Periodic Table would these elements lie? Would they be metals, nonmetals, metalloids, some of each? Use your answers to these questions to complete the table...
Some patterns of electron configuration are listed below. In each case, Gstands for a noble-gas core and n, m, or o stand for integer numbers like 1, 2, 3 and so on. Think about the chemical elements made of atoms with an electron configuration that matches each pattern. In what block or blocks of the Periodic Table would these elements lie? Would they be metals, non metals, metalloids, some of each? Use your answers to these questions to complete the...
Categorize each of the period 2 elements according to their metallic character. CRAC 2017 2018 1 4 5 0309care ne 4A(14) 5) N O 3) Ne Metals Metalloids Nonmetals
For the main group elements, atomic size increases down the
group. For the transition metals, how does the atomic size change
from the 4d series to 5d series? What is the factor that causes the
difference between these two types of elements?
(h) For the main group elements, atomic size increases down the group. For the transition metals, how does the atomic size change from the 4d series to 5d series? What is the factor that causes the difference between...
3. Describe the location (group and period) of the following metals and nonmetals on the periodic table. Element Group Period Kr Fr 4. Write the complete chemical symbol (including the mass number, atomic number, and charge if any) of the element that corresponds to the following subatomic particles: a) p =1, e = 1, and nº = 0 b)pt = 36, e = 36, and nº = 48 c)pt = 26, e- = 23, and nº = 30 d) p...
Using the terms bonding, energy and stability, explain occurring compounds, but only 90 naturally occurring elements. why there are millions of naturally Who Gives a Darn? I Do! In completing this activity, you have explored why hydrogen atoms combine to form diatomic hydrogen, and why helium atoms do not combine to form diatomic helium. In the Star Trek universe, star ships are propelled with dilithium crystals. Dilithium is possible to prepare, however, it is only known to exist in the...
complete the sentences regarding alkaline earth
metals
The Group 2A(2) elements are called alkaline earth metals because their oxides give (alkaline) solutions and melt at such temperatures that they remained as solids ("earths") in the alchemists fires. denser low for 2A metals than larger lower The melting and boiling points are much for the corresponding 1A metals. ences smaller oxidizing Compared to corresponding Group 1A(1) elements, Group 2A(2) elements have metallic bonding and atomic sizes which makes them harder and...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 12 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago