please reasond asapHomework Answers
Add Answer to:
please reasond asap
Problem 2 (22 points): Consider the overall balanced redox reaction: 2V0;(aq) + 4H+...
For a voltaic cell based on the reaction below, which statement is correct? Zn(s)+2H+(aq)→Zn2+(aq)+H2(g) Zn2+(aq) is...
For a voltaic cell based on the reaction below, which statement is correct? Zn(s)+2H+(aq)→Zn2+(aq)+H2(g) Zn2+(aq) is oxidized at the anode. H+(aq) is reduced at the cathode. Zn2+(aq) is reduced at the anode. H2(g) is the oxidizing agent.
4. The following balanced redox reaction occurs in voltaic cell at 25°C H2 (g) + 2Ag+...
4. The following balanced redox reaction occurs in voltaic cell at 25°C H2 (g) + 2Ag+ (aq) → 2H* (aq) + 2 Ag (s) 2H+ + 2e → H2 (g) EⓇ = 0.00V Ag (aq) + le → Ag(s) E = +0.80V a. Write the two half-reactions (oxidation and reduction) occurring in the cell. Clearly indicate which reaction shows oxidation and which shows reduction. Clearly indicate which reaction occurs at the anode and which reaction occurs at the cathode. (4...
A galvanic cell is powered by the following redox reaction: 02(9) + 4H+ (aq) + 4...
A galvanic cell is powered by the following redox reaction: 02(9) + 4H+ (aq) + 4 Fe2+ (aq) → 2H2O(1) + 4 Fe3+ (aq) Answer the following questions about this cell. If you need any electrochemical data, be sure you get it from the ALEKS Data tab. ローロー Write a balanced equation for the half-reaction that takes place at the cathode. e $ Write a balanced equation for the half-reaction that takes place at the anode. 0 ? Calculate the...
Eqation: 2I^-(aq) + 2NO2^-(aq) + 4H^+(aq) ---> I2(aq) + 2NO(aq) + 2H2O(l) 1. MI*V1 - M2*V2...
Eqation: 2I^-(aq) + 2NO2^-(aq) + 4H^+(aq) ---> I2(aq) + 2NO(aq)
+ 2H2O(l)
1. MI*V1 - M2*V2 V2 - 10ml VI = 2ml 4.5. 2 - M2 * 10 M2 - 0.9mM 2. Ksp - [Pb 2+][-]^2 Ksp - 1.401008 1.4*10^-8 - [Pb 2+1 (1.1 10.47 2 [Pb 2+] - 1.16M 3. Examine Eq. 3, above. Is this a redox reaction? If so, which element is being oxidized? Which element is being reduced? Explain your answer(s) by using the appropriate oxidation...
Part A Consider a voltaic cell that is set up as follows: Anode contains an Zn(s) electrode and 1M Zn2+(aq) Cathode cont...
Part A Consider a voltaic cell that is set up as follows: Anode contains an Zn(s) electrode and 1M Zn2+(aq) Cathode contains a Pt(s) electrode and 1M MnO4–(aq),Mn2+(aq), and H+(aq) Which of the following statements match the cathode? Select all that apply. Group of answer choices The electrode increases in mass Oxidation occurs at this half-cell Electrons enter the half-cell The electrode is inactive Cations from the salt-bridge move to this half-cell The electrode is negative Part B Which of...
Consider the voltaic cell and reduction half potentials: Zn(s) | Zn 2+(aq) (0.100 M) || Ni2+(aq)...
Consider the voltaic cell and reduction half potentials: Zn(s) | Zn 2+(aq) (0.100 M) || Ni2+(aq) (1.50 M) | Ni(s) Zn 2+ (aq)/Zn (s) E o = - 0.760 V Ni2+ (aq)/Ni (s) E o = - 0.230 V a) Sketch the voltaic cell represented with the above line notation. Label the anode and cathode and indicate the half-reactions occurring at each electrode and the species present in each solution. Also indicate the direction of electron flow (3 marks). b)...
A galvanic cell is powered by the following redox reaction: NO2 (aq) + 4H+ (aq) +...
A galvanic cell is powered by the following redox reaction: NO2 (aq) + 4H+ (aq) + 3 Cu* (aq) NO(g) + 2 H2O(l) + 3 Cu²+ (aq) Answer the following questions about this cell. If you need any electrochemical data, be sure you get it from the ALEKS Data tab. 0-0 O. Write a balanced equation for the half-reaction that takes place at the cathode. x Ś ? Write a balanced equation for the half-reaction that takes place at the...
Please complete both! 1. When the following equation is balanced properly under acidic conditions, what are...
Please complete both!
1. When the following equation is balanced properly under acidic
conditions, what are the coefficients of the species shown?
____MnO2 + ____H3AsO3 --------_____Mn2+ +_____ H3AsO4
Water appears in the balanced equation as a_____ (reactant,
product, neither) with a coefficient of _____. (Enter 0 for
neither.) How many electrons are transferred in this
reaction?______
2.
A voltaic cell is constructed in which the anode is a Zn/Zn2+ half cell and the cathode is a Ag|Agt half cell. The...
Consider the redox reaction S(s) + HNO3(aq) => H2SO3(aq) + N2O(g), which occurs in acidic solution,...
Consider the redox reaction S(s) + HNO3(aq) => H2SO3(aq) + N2O(g), which occurs in acidic solution, and answer the questions below. 1. Once properly balanced, what are the coefficients of: a. S ______________ b. HNO3 ______________ c. H2SO3 ______________ d. N2O ______________ 2. What is the value of n for this reaction?_____________ 3. What is the oxidation state of sulfur in the compound H2SO3?______________ 4. Is the elemental sulfur being oxidized or reduced?________________ 5. At which electrode (cathode or anode)...
The answer for last 2 parts should be either (from and to) or (to and from)...
The answer for last 2 parts should
be either (from and to) or (to and from)
A voltaic cell is constructed in which the anode is a Zn Zn²+ half cell and the cathode is a H, H+ half cell. The half-cell compartments are connected by a salt bridge. (Use the lowest possible coefficients. Use the pull-down boxes to specify states such as (aq) or (s). If a box is not needed, leave it blank.) The anode reaction is: The...
4. The following balanced redox reaction occurs in voltaic cell at 25°C H2 (g) + 2Ag+ (aq) → 2H* (aq) + 2 Ag (s) 2H+ + 2e → H2 (g) EⓇ = 0.00V Ag (aq) + le → Ag(s) E = +0.80V a. Write the two half-reactions (oxidation and reduction) occurring in the cell. Clearly indicate which reaction shows oxidation and which shows reduction. Clearly indicate which reaction occurs at the anode and which reaction occurs at the cathode. (4...
A galvanic cell is powered by the following redox reaction: 02(9) + 4H+ (aq) + 4 Fe2+ (aq) → 2H2O(1) + 4 Fe3+ (aq) Answer the following questions about this cell. If you need any electrochemical data, be sure you get it from the ALEKS Data tab. ローロー Write a balanced equation for the half-reaction that takes place at the cathode. e $ Write a balanced equation for the half-reaction that takes place at the anode. 0 ? Calculate the...
Eqation: 2I^-(aq) + 2NO2^-(aq) + 4H^+(aq) ---> I2(aq) + 2NO(aq)
+ 2H2O(l)
1. MI*V1 - M2*V2 V2 - 10ml VI = 2ml 4.5. 2 - M2 * 10 M2 - 0.9mM 2. Ksp - [Pb 2+][-]^2 Ksp - 1.401008 1.4*10^-8 - [Pb 2+1 (1.1 10.47 2 [Pb 2+] - 1.16M 3. Examine Eq. 3, above. Is this a redox reaction? If so, which element is being oxidized? Which element is being reduced? Explain your answer(s) by using the appropriate oxidation...
A galvanic cell is powered by the following redox reaction: NO2 (aq) + 4H+ (aq) + 3 Cu* (aq) NO(g) + 2 H2O(l) + 3 Cu²+ (aq) Answer the following questions about this cell. If you need any electrochemical data, be sure you get it from the ALEKS Data tab. 0-0 O. Write a balanced equation for the half-reaction that takes place at the cathode. x Ś ? Write a balanced equation for the half-reaction that takes place at the...
Please complete both!
1. When the following equation is balanced properly under acidic
conditions, what are the coefficients of the species shown?
____MnO2 + ____H3AsO3 --------_____Mn2+ +_____ H3AsO4
Water appears in the balanced equation as a_____ (reactant,
product, neither) with a coefficient of _____. (Enter 0 for
neither.) How many electrons are transferred in this
reaction?______
2.
A voltaic cell is constructed in which the anode is a Zn/Zn2+ half cell and the cathode is a Ag|Agt half cell. The...
The answer for last 2 parts should
be either (from and to) or (to and from)
A voltaic cell is constructed in which the anode is a Zn Zn²+ half cell and the cathode is a H, H+ half cell. The half-cell compartments are connected by a salt bridge. (Use the lowest possible coefficients. Use the pull-down boxes to specify states such as (aq) or (s). If a box is not needed, leave it blank.) The anode reaction is: The...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago