Homework Answers
The given amine first reacts with exccess of methyl iodide to give quarternary ammonium salt which inturn reacts with Ag2O, H2O to give amine and alkene product as mentioned below.
Add Answer to:
Question 30 (4 points) Which one is the major product of the following reaction sequence? -NH2...
Question 22 (4 points) Which one is the major product of the following reaction sequence? 1....
Question 22 (4 points) Which one is the major product of the following reaction sequence? 1. excess CH1 2. Ag,0, H20 heat NH2 Question 23 (4 points) Which aldehyde or ketone AND amine reactants are needed to complete the following reaction? HN NaBH;CN C=0 Amine dil. H:07 NHẠCH, NH(CH3)2 (CH3)2NCH.CH NHẠCH
Which one is the major product of the following reaction sequence? -NH2 1. excess CH31 2....
Which one is the major product of the following reaction sequence? -NH2 1. excess CH31 2. Ag20. HO heat
Predict the major product for the following reaction. 1. excess CH1 NH2 2. Ag20, H20 heat...
Predict the major product for the following reaction.
1. excess CH1 NH2 2. Ag20, H20 heat 1. KOH 2. CH3CH2CH2CH,Br 3. H30 d. NH &
Question 30 (4 points) Which one is the major product of the following reaction sequence? NH...
Question 30 (4 points) Which one is the major product of the following reaction sequence? NH 1. excess CHI 2. Ag,0,H0 haat a o (CHсності ОН
Which one is the major product of the following reaction sequence? -NH2 1. excess CH31 2....
Which one is the major product of the following reaction sequence? -NH2 1. excess CH31 2. Ag,0, H 0 heat
39. Predict the major organic product of the following reaction 1. excess CHal NH2 2.Ag20. H2O,...
39. Predict the major organic product of the following reaction 1. excess CHal NH2 2.Ag20. H2O, heat N(CH3)2 ?? IV
2. Predict the product. CH,CH NH2 NH 1. LiAlH 2. H20 Br H30 KOH 1. excess...
2. Predict the product. CH,CH NH2 NH 1. LiAlH 2. H20 Br H30 KOH 1. excess CH1 2. Ag20, H20 heat
Provide the major product for the following sequence of reactions. 1. CH31 (excess) 2. Ag20, H20...
Provide the major product for the following sequence of reactions. 1. CH31 (excess) 2. Ag20, H20 3. heat
Predict the major product of the following reaction sequence: 7. 1. excess NH3, H20 2. dilute HCI, cold HN NH2 d NH2 b...
Predict the major product of the following reaction sequence: 7. 1. excess NH3, H20 2. dilute HCI, cold HN NH2 d NH2 b НО CH2N а. е. НО НО HO
help Which one is the major product of the following reaction sequence? 1. excess CHI 2....
help
Which one is the major product of the following reaction sequence? 1. excess CHI 2. Ag,0,H,O heat NH2 о What happens in the first step of this reaction? не OH + H2O OH The carbonyl carbon becomes protonated The water becomes protonated The sp oxygen of the ester becomes protonated The carbonyl oxygen becomes protonated
Question 22 (4 points) Which one is the major product of the following reaction sequence? 1. excess CH1 2. Ag,0, H20 heat NH2 Question 23 (4 points) Which aldehyde or ketone AND amine reactants are needed to complete the following reaction? HN NaBH;CN C=0 Amine dil. H:07 NHẠCH, NH(CH3)2 (CH3)2NCH.CH NHẠCH
Which one is the major product of the following reaction sequence? -NH2 1. excess CH31 2. Ag20. HO heat
Predict the major product for the following reaction.
1. excess CH1 NH2 2. Ag20, H20 heat 1. KOH 2. CH3CH2CH2CH,Br 3. H30 d. NH &
Question 30 (4 points) Which one is the major product of the following reaction sequence? NH 1. excess CHI 2. Ag,0,H0 haat a o (CHсності ОН
Which one is the major product of the following reaction sequence? -NH2 1. excess CH31 2. Ag,0, H 0 heat
39. Predict the major organic product of the following reaction 1. excess CHal NH2 2.Ag20. H2O, heat N(CH3)2 ?? IV
2. Predict the product. CH,CH NH2 NH 1. LiAlH 2. H20 Br H30 KOH 1. excess CH1 2. Ag20, H20 heat
Provide the major product for the following sequence of reactions. 1. CH31 (excess) 2. Ag20, H20 3. heat
Predict the major product of the following reaction sequence: 7. 1. excess NH3, H20 2. dilute HCI, cold HN NH2 d NH2 b НО CH2N а. е. НО НО HO
help
Which one is the major product of the following reaction sequence? 1. excess CHI 2. Ag,0,H,O heat NH2 о What happens in the first step of this reaction? не OH + H2O OH The carbonyl carbon becomes protonated The water becomes protonated The sp oxygen of the ester becomes protonated The carbonyl oxygen becomes protonated
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 23 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago