Homework Answers
1) II
2) 4-methyl-5-oxohexanal
Add Answer to:
What is the TUPAC name of the product of the citive devage reaction of 15-dimethylcych with...
What is the name of the product of the reaction? (please explain, show work) a. 1,1-dibromo-5-methylhexane...
What is the name of the product of the reaction?
(please explain, show work)
a. 1,1-dibromo-5-methylhexane
b. 1,2-dibromo-5-methylhexane
c. 1,2-dibromo-5-methyl-1-hexene
d. 2,2-dibromo-5-methylhexane
e. 1,1,2,2-tetrabromo-5-methylhexane
2 equivalents F it HBr is
QUESTION 3 Which compound will have a singlet around 2.17 cyclohexanone cyclopentanone 3-pentanone 2-pentanone QUESTION 4...
QUESTION 3 Which compound will have a singlet around 2.17 cyclohexanone cyclopentanone 3-pentanone 2-pentanone QUESTION 4 QUESTION 5 What is the most likely product of the reaction below? 1. THF-BH, 2. HOA NaOH secondary alcohol tertiary alcohol geminal diol vicinal diol QUESTION 6 What would be the most likely product of the following reaction? H2 Pt cyclohexane (1 R2R)-1,2-dimethylcyclohexane (15,25)-1,2-dimethylcyclohexane meso-1,2-dimethylcyclohexane QUESTION 7 Which set of reagents/condition would favor the following transformation? ? Br HBr, heat PBr3 Br2, H20 NBS,...
12. A student added one equivalent of 3,4-epoxy-4-methylcyclohexanol to a solution of methylmagnesium bromide in diethyl...
12. A student added one equivalent of 3,4-epoxy-4-methylcyclohexanol to a solution of methylmagnesium bromide in diethyl ether, and then added dilute hydrochloric acid. He expected that the product would be 1,2-dimethylcyclohexane-1,4-diol. He did not get this expected product. Draw the structures of 3,4-epoxy-4-methylcyclohexanol, methylmagnesium bromide, and 1,2- dimethylcyclohexane-1,4-diol. Explain why the student did not get his expected product. What organic product(s) did he get? Show all reaction steps for better yet, show the reaction mechanisms). CH, MgBr CH4 att HOH
103 25 What is the IUPAC name of the product formed in the following reaction? AICI:...
103 25 What is the IUPAC name of the product formed in the following reaction? AICI: 4-methyl-1-phenylpentanone 1-phenyl-4-methylpentanone 3-isopropyl-1-phenylpropanone 5-methyl-5-phenylpentan-2-one on 4 25 What is the IUPAC name of the product of the following reaction? KMnO4 H307 3,4-dimethyl-6-oxoheptanoic acid 3,4,6-trimethyl-6-oxohexanoic acid 6-oxo-3,4-dimethylheptanoic acid 3,4-dimethylhept-6-one-anoic acid
What is the IUPAC name of the product formed in the following reaction? o chy alebo...
What is the IUPAC name of the product formed in the following reaction? o chy alebo AICI: 4-methyl-1-phenylpentanone 1-phenyl-4-methylpentanone 3-isopropyl-1-phenylpropanone 5-methyl-5-phenylpentan-2-one
1. (1R, 2R)-1-bromo-1,2-dimethylcyclohexane is heated in the presence of potassium tert-butoxide (KO-tert-Bu). Name mino...
1. (1R, 2R)-1-bromo-1,2-dimethylcyclohexane is heated in the presence of potassium tert-butoxide (KO-tert-Bu). Name minor product/s only 2. 2-iodo-1,1,2,3,3-pentamethylcyclohexane is heated in the presence of sodium ethoxide in ethanol, don’t name the product/s of the reaction 3. ,2,2-trimethylcyclohexan-1-ol is heated in aqueous sulfuric acid 4. (3S)-2-methyl-3-pentanol is heated in aqueous sulfuric acid
9. What is the IUPAC name of the product obtained by hydration reaction of the following...
9. What is the IUPAC name of the product obtained by hydration reaction of the following alkene: Name Date tert two Husein ?? A. 2,3-Dimethyl-3-hexanol B. 2,3-Dimethyl-4-sulfatehexene C. 2,3-Dimethi-4-hydroxyhexane D. 2,3-Dimethyl-4-hexanol E. Alkenes do not show hydration reaction revious 7. Write the IUPAC name of following alkane. 8. What is the IUPAC name of the compound below? ce fach OH A. 2-Chloro-6-methylphenol B. 2-Chloro-6-methyl-1-phenol C. 3-Chloro-2-hydroxy-1-toluene D. 1-Chloro-5-methyl-1-hydroxybenzene E. Ortho-Chloro hydroxymethyl benzene
Help if you can, don’t worry about # 4 Questions Which of the two conformations is...
Help if you can, don’t worry about # 4
Questions Which of the two conformations is favored at equilibrium? a. trans-1,2-dimethylcyclohexane (a/aor b. cis-1,3-dimethylcyclohexane (a/a)or 1. (ele) (ele) 2. How many gauche interactions are present in the trans 1.2-dimethylcyclohexane (a/a) conformer between the methyl groups and between the methy)l groups and the a. b. 2 c. 3 d. 4 e. None 3. How many gauche interactions are present in the trans-1,2-dimethylcyclohexane (e/e) conformer between the methyl groups and between the...
Write the reaction of hydration of 2-methyl-1-butene. What is the IUPAC name of the reaction product?...
Write the reaction of hydration of 2-methyl-1-butene. What is the IUPAC name of the reaction product? What is the IUPAC name for the compound below? Write the dehydration reaction of this compound. What is the name of the major product? CH3 OH || CH3 - CH - CH – CH3
What is the name of the product of the reaction of 1-pentyne with one equivalent of...
What is the name of the product of the reaction of 1-pentyne with one equivalent of Br2? (that means that there is one mole of Br2 for each mole of 1-pentyne) I've tried 1,2-dibromo-1-pentene and 1,2-dibromopentene but neither seem to be right. Is there E, Z nomenclature or am I missing something else?
What is the name of the product of the reaction?
(please explain, show work)
a. 1,1-dibromo-5-methylhexane
b. 1,2-dibromo-5-methylhexane
c. 1,2-dibromo-5-methyl-1-hexene
d. 2,2-dibromo-5-methylhexane
e. 1,1,2,2-tetrabromo-5-methylhexane
2 equivalents F it HBr is
QUESTION 3 Which compound will have a singlet around 2.17 cyclohexanone cyclopentanone 3-pentanone 2-pentanone QUESTION 4 QUESTION 5 What is the most likely product of the reaction below? 1. THF-BH, 2. HOA NaOH secondary alcohol tertiary alcohol geminal diol vicinal diol QUESTION 6 What would be the most likely product of the following reaction? H2 Pt cyclohexane (1 R2R)-1,2-dimethylcyclohexane (15,25)-1,2-dimethylcyclohexane meso-1,2-dimethylcyclohexane QUESTION 7 Which set of reagents/condition would favor the following transformation? ? Br HBr, heat PBr3 Br2, H20 NBS,...
12. A student added one equivalent of 3,4-epoxy-4-methylcyclohexanol to a solution of methylmagnesium bromide in diethyl ether, and then added dilute hydrochloric acid. He expected that the product would be 1,2-dimethylcyclohexane-1,4-diol. He did not get this expected product. Draw the structures of 3,4-epoxy-4-methylcyclohexanol, methylmagnesium bromide, and 1,2- dimethylcyclohexane-1,4-diol. Explain why the student did not get his expected product. What organic product(s) did he get? Show all reaction steps for better yet, show the reaction mechanisms). CH, MgBr CH4 att HOH
103 25 What is the IUPAC name of the product formed in the following reaction? AICI: 4-methyl-1-phenylpentanone 1-phenyl-4-methylpentanone 3-isopropyl-1-phenylpropanone 5-methyl-5-phenylpentan-2-one on 4 25 What is the IUPAC name of the product of the following reaction? KMnO4 H307 3,4-dimethyl-6-oxoheptanoic acid 3,4,6-trimethyl-6-oxohexanoic acid 6-oxo-3,4-dimethylheptanoic acid 3,4-dimethylhept-6-one-anoic acid
What is the IUPAC name of the product formed in the following reaction? o chy alebo AICI: 4-methyl-1-phenylpentanone 1-phenyl-4-methylpentanone 3-isopropyl-1-phenylpropanone 5-methyl-5-phenylpentan-2-one
9. What is the IUPAC name of the product obtained by hydration reaction of the following alkene: Name Date tert two Husein ?? A. 2,3-Dimethyl-3-hexanol B. 2,3-Dimethyl-4-sulfatehexene C. 2,3-Dimethi-4-hydroxyhexane D. 2,3-Dimethyl-4-hexanol E. Alkenes do not show hydration reaction revious 7. Write the IUPAC name of following alkane. 8. What is the IUPAC name of the compound below? ce fach OH A. 2-Chloro-6-methylphenol B. 2-Chloro-6-methyl-1-phenol C. 3-Chloro-2-hydroxy-1-toluene D. 1-Chloro-5-methyl-1-hydroxybenzene E. Ortho-Chloro hydroxymethyl benzene
Help if you can, don’t worry about # 4
Questions Which of the two conformations is favored at equilibrium? a. trans-1,2-dimethylcyclohexane (a/aor b. cis-1,3-dimethylcyclohexane (a/a)or 1. (ele) (ele) 2. How many gauche interactions are present in the trans 1.2-dimethylcyclohexane (a/a) conformer between the methyl groups and between the methy)l groups and the a. b. 2 c. 3 d. 4 e. None 3. How many gauche interactions are present in the trans-1,2-dimethylcyclohexane (e/e) conformer between the methyl groups and between the...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 49 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago