Which of the following assumes that gas molecules are in constant motion? 1. the law of...
Which of the following assumes that gas molecules are in constant motion?
1. the law of conservation of mass
2. the law of conservation of energy
3. the kinetic molecular theory
4. all of the above
Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
Which of the following assumes that gas molecules are in
constant motion?
1. the law of...
Decide which of the following statements are true and which are false. True Real gas molecules...
Decide which of the following statements are true and which are false. True Real gas molecules have a volume and exert attractive forces on one another. False As temperature increases, the average kinetic energy of a sample of gas molecules decreases. False In order for two separate 1.0 L samples of O2(g) and H2(g) to have the same average velocity, the O2(g) sample must be at a higher temperature than the H2(g) sample. False At constant temperature, the lighter the...
Which of the following is not part of the kinetic-molecular theory? a) The volume occupied by all of the gas molecules...
Which of the following is not part of the kinetic-molecular theory? a) The volume occupied by all of the gas molecules in a container is negligible compared to the volume of the container. b) Collisions between gas molecules do not result in the loss of energy. c) Attractive and repulsive forces between gas molecules are negligible. d) Gases consist of molecules in continuous, random motion. Atoms are neither created nor destroyed by ordinary chemical reactions
1. Which law does the equation PV=constant represent? a.Avogadro's Law b. Boyle's Law c. Charle's Law...
1. Which law does the equation PV=constant represent? a.Avogadro's Law b. Boyle's Law c. Charle's Law d. Graham's Law 2. Which postulate from the kinetic molecular theory is most relevant to explain rms speeds? a. the average kinetic energy is proportional to the temperature b. collisions of gas particles are elastic c. the volume of the particles is negligible comapred to the volume of the gas d. gas particles move in random straight line motion 3. Which of the follow...
*SHOW YOUR WORK* (Boyle's Law): 1. What is the final volume (in mL) or argon gas...
*SHOW YOUR WORK* (Boyle's Law): 1. What is the final volume (in mL) or argon gas is 50.0 mL at 705 torr is compressed to a pressure of 2.75 atm, at constant temperature? (Lewis Dot Structures): 2. Draw Lewis structures for the following molecules. Include partial charges, AXE designation, (example: AX2 E2), Electron-pair geometry and geometric-molecular shapes. Is it Polar or Non-Polar? CH2Cl2 SO2 3. Which of the following explains why the pressure of a gas increases when the temperature...
Which of the following statements about the kinetic molecular theory are not correct? O Attractive and...
Which of the following statements about the kinetic molecular theory are not correct? O Attractive and repulsive forces between gas molecules are negligible The average kinetic energy of the molecules is not related to the absolute temperature Gases consist of molecules that are in continuous, random motion The combined volume of all the molecules of the gas is negligible relative to the total volume in which the gas is contained
QUESTION 16 Which of the following is NOT an assumption made by the kinetic molecular theory?...
QUESTION 16 Which of the following is NOT an assumption made by the kinetic molecular theory? A gas is a collection of particles (molecules or atoms) in constant motion. This motion is straight-line motion The average kinetic energy (energy due to motion) of the gas particles is proportional to the temperature measured in kelvin. As temperature increases, the particles move faster and have more energy There is no attraction or repulsion between the gas particles, another wards, they not interact....
According to the kinetic-molecular theory, gas molecules have: O A very strong interactions between gas molecules...
According to the kinetic-molecular theory, gas molecules have: O A very strong interactions between gas molecules OB. none of these are correct o less kinetic energy with increasing temperature OD no substantial interactions between gas molecules O E little distance between molecules compared to the size of the gas molecules
some context Problem 3: Use simple kinetic theory of gases discussed in section 1.3.2 as well...
some context
Problem 3: Use simple kinetic theory of gases discussed in section 1.3.2 as well as Fourer's law of condustion to prove: 2 R373 D11 = 3113/202pm Dal We were unable to transcribe this imageof a nes. the xed the led negligible The following assumptions about the structure of the cases are made in order to investigate the statistical rules of the random motion of the molecules: The size of the gas molecules is negligible compared with the distance...
Part A Which of the following is NOT part of the Kinetic Molecular Theory? The average...
Part A Which of the following is NOT part of the Kinetic Molecular Theory? The average energy of the particles is dependent on the molecular mass of the particle. The size of the actual gas particles is small compared to the volume of the whole gas. There is a large distance between gas particles as compared to their relative size Gas particles do not repel each other, All of the above statements are part of the Kinetic Molecular Theory Submit...
According to the kinetic molecular theory, which of the following is NOT true this is the...
According to the kinetic molecular theory, which of the following
is NOT true
this is the question options
n it any temperature the vapor pressure of acetic acid is lower than that of water. (O) Acetic acid is more volatile than water. ( Both A and B are correct. O Neither A nor B is correct. n Gas particles are in constant random motion and move in straight lines until they collide with another gas particle. The volume of gas...
Decide which of the following statements are true and which are false. True Real gas molecules have a volume and exert attractive forces on one another. False As temperature increases, the average kinetic energy of a sample of gas molecules decreases. False In order for two separate 1.0 L samples of O2(g) and H2(g) to have the same average velocity, the O2(g) sample must be at a higher temperature than the H2(g) sample. False At constant temperature, the lighter the...
Which of the following statements about the kinetic molecular theory are not correct? O Attractive and repulsive forces between gas molecules are negligible The average kinetic energy of the molecules is not related to the absolute temperature Gases consist of molecules that are in continuous, random motion The combined volume of all the molecules of the gas is negligible relative to the total volume in which the gas is contained
QUESTION 16 Which of the following is NOT an assumption made by the kinetic molecular theory? A gas is a collection of particles (molecules or atoms) in constant motion. This motion is straight-line motion The average kinetic energy (energy due to motion) of the gas particles is proportional to the temperature measured in kelvin. As temperature increases, the particles move faster and have more energy There is no attraction or repulsion between the gas particles, another wards, they not interact....
According to the kinetic-molecular theory, gas molecules have: O A very strong interactions between gas molecules OB. none of these are correct o less kinetic energy with increasing temperature OD no substantial interactions between gas molecules O E little distance between molecules compared to the size of the gas molecules
some context
Problem 3: Use simple kinetic theory of gases discussed in section 1.3.2 as well as Fourer's law of condustion to prove: 2 R373 D11 = 3113/202pm Dal We were unable to transcribe this imageof a nes. the xed the led negligible The following assumptions about the structure of the cases are made in order to investigate the statistical rules of the random motion of the molecules: The size of the gas molecules is negligible compared with the distance...
Part A Which of the following is NOT part of the Kinetic Molecular Theory? The average energy of the particles is dependent on the molecular mass of the particle. The size of the actual gas particles is small compared to the volume of the whole gas. There is a large distance between gas particles as compared to their relative size Gas particles do not repel each other, All of the above statements are part of the Kinetic Molecular Theory Submit...
According to the kinetic molecular theory, which of the following
is NOT true
this is the question options
n it any temperature the vapor pressure of acetic acid is lower than that of water. (O) Acetic acid is more volatile than water. ( Both A and B are correct. O Neither A nor B is correct. n Gas particles are in constant random motion and move in straight lines until they collide with another gas particle. The volume of gas...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 15 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago