need explanation to each thank you!
Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
need explanation to each thank you!
12.09 g of Az reacts with 96.00 g of B2...
6. Calcium oxide reacts with nitric acid to produce calcium nitrate and water. How many grams...
6. Calcium oxide reacts with nitric acid to produce calcium nitrate and water. How many grams of calcium oxide are required for complete reaction with 30.0 mL of 0.587 M nitric acid? The molar mass of calcium oxide is 56.077 g/mol. (Hint: start by writing the balanced equation for the reaction.) 7. A sample contains an unknown amount of succinic acid, H2CHO. If 0.3540 g of the sample requires 42.70 mL of 0.1000 M NaOH to neutralize the H2C,H404 completely,...
Page 149 QUESTIONS FOR CHEMICAL REACTONS NAME Write balanced chemical equations for each of the following...
Page 149 QUESTIONS FOR CHEMICAL REACTONS NAME Write balanced chemical equations for each of the following reactions: 1. The decomposition of difodine pentoxide to form iodine and oxygen. 2. Silver nitrate reacting with potassium sulfate in a double replacement reaction 3. The combination of lithium and nitrogen to form lithium nitride. 4. The decomposition of potassium carbonate to form potassium oxide and carbon dioxide. 5. A single replacement reaction in which sodium metal reacts with aluminum oxide and replaces the...
i only need g, h and I please Classifying Chemical Reactions continued Classifying Chemical Reactions continued...
i
only need g, h and I please
Classifying Chemical Reactions continued Classifying Chemical Reactions continued 3. Write a balanced chemical equation for each reaction and classify the reaction. a. Copper metal heated with oxygen gives solid copper(II)oxide. 4 cu +02 → 2420 (5) combination reachon b. Mixing ammonium nitrate and sodium hydroxide solutions gives aqueous sodium nitrate, ammonia gas, and water. NHL NO2+ NaOH -> Na NO₃(aq) + NH₃ (9)+H₂O (e) double replacement c. Mercury(II) nitrate solution reacts with...
B. Write a balanced chemical reaction for the following word equations. (7 points) a. Potassium chlorate decompose...
B. Write a balanced chemical reaction for the following word equations. (7 points) a. Potassium chlorate decomposes to form potassium chloride and oxygen. b. Aqueous solutions of copper (II) nitrate and sodium hydroxide react to form solid copper (II) hydroxide and a solution of sodium nitrate. b. Aqueous solutions of copper (II) nitrate and sodium hydroxide react to form solid copper (II) hydroxide and a solution of sodium nitrate. c. Diphosphorous tetrabromide reacts with fluorine gas to produce diphosphorous tetrafluoride...
9.16 Calcium cyanamide, CaCN2, reacts with water to form calcium carbonate and ammonia. CaCO3(s) +2NH3(g) CaCN2(s)...
9.16 Calcium cyanamide, CaCN2, reacts with water to form calcium carbonate and ammonia. CaCO3(s) +2NH3(g) CaCN2(s) +3H20() a. How many grams of H2O are needed to react with 75.0 g of CaCN2? b. How many grams of NH3 are produced from 5.24 g of CaCN2? c. How many grams of CaCO3 form if 155 g of H2O reacts? 9.18 When the gases dihydrogen sulfide and oxygen react, they form the gases sulfur dioxide and water vapor. a. Write the balanced...
3.) a.) For each of the following pairs of formulas, predict whether the substances they represent...
3.) a.) For each of the following pairs of formulas, predict whether the substances they represent would react in a precipitation reaction. If there is no reaction, write, "NONE". If there is a reaction, write the complete equation for the reaction. (Use the lowest possible whole number coefficients. Include states-of-matter in your answer.) (a1) NH4Cl(aq) + CaSO3(aq) (a2) NaCl(aq) + Pb(NO3)2(aq) (a3) NaOH(aq) + Zn(NO3)2(aq) b.) When the following solutions are mixed together, what precipitate (if any) will form? (If...
Calcium oxide (lime) reacts with carbon dioxide to form calcium carbonate (chalk). CaO(s) + CO2(g) →...
Calcium oxide (lime) reacts with carbon dioxide to form calcium carbonate (chalk). CaO(s) + CO2(g) → CaCO3(s) ∆H = –178.4 kJ How many kilojoules of heat are evolved in the reaction of 0.500 kg CaO(s) (molar mass 56.08 g/mol) with an excess of carbon dioxide?
may you please provide details on how you recieved the answer thank you. 3 pages. Chem...
may
you please provide details on how you recieved the answer thank
you.
3 pages.
Chem 143 - Lab Pre-lab Exercise Show the details of each calculation to get full credit 1. Magnesium oxide, a white powdery substance can often be made by heating magnesium metal in presence of oxygen. a. Write the balanced chemical equation for this reaction (including the state symbols such as (s) () or (aq)] b. When 10.1 g magnesium is allowed to react with 10.5g...
Give the balanced equation for each of the following (Use the lowest possible coefficients. Use the...
Give the balanced equation for each of the following (Use the lowest possible coefficients. Use the pull-down boxes to specify states such as (aq) or (s) If a box is not needed, leave it blank.) a. The combustion of propanol (C,H,OH) forms carbon dioxide and water vapor. A combustion reaction refers to a reaction of a substance with oxygen b. Aqueous solutions of cadmium(II) nitrate and potassium phosphate are mixed, resulting in the precipitate formation of cadmium(IT) phosphate with aqueous...
I need help with Questions 14, 17, and 18. Please show work! of 6 + ......
I need help with Questions 14, 17, and 18. Please show
work!
of 6 + ... JE SAZ 14) What mass of gaseous carbon dioxide can be absorbed by 1.00 kg of lithium hydroxide (according to the unbalanced equation below)? LiOH(s) + CO2(g) → LiCO, (s) + H2O (1) a. 920.8 b. 1.00 kg c. 1840 g d. 2.00 kg 15) Aspartame in as artificial sweetener that is 160 times sweeter than sucrose (table sugar) when dissolved in water. It...
6. Calcium oxide reacts with nitric acid to produce calcium nitrate and water. How many grams of calcium oxide are required for complete reaction with 30.0 mL of 0.587 M nitric acid? The molar mass of calcium oxide is 56.077 g/mol. (Hint: start by writing the balanced equation for the reaction.) 7. A sample contains an unknown amount of succinic acid, H2CHO. If 0.3540 g of the sample requires 42.70 mL of 0.1000 M NaOH to neutralize the H2C,H404 completely,...
Page 149 QUESTIONS FOR CHEMICAL REACTONS NAME Write balanced chemical equations for each of the following reactions: 1. The decomposition of difodine pentoxide to form iodine and oxygen. 2. Silver nitrate reacting with potassium sulfate in a double replacement reaction 3. The combination of lithium and nitrogen to form lithium nitride. 4. The decomposition of potassium carbonate to form potassium oxide and carbon dioxide. 5. A single replacement reaction in which sodium metal reacts with aluminum oxide and replaces the...
i
only need g, h and I please
Classifying Chemical Reactions continued Classifying Chemical Reactions continued 3. Write a balanced chemical equation for each reaction and classify the reaction. a. Copper metal heated with oxygen gives solid copper(II)oxide. 4 cu +02 → 2420 (5) combination reachon b. Mixing ammonium nitrate and sodium hydroxide solutions gives aqueous sodium nitrate, ammonia gas, and water. NHL NO2+ NaOH -> Na NO₃(aq) + NH₃ (9)+H₂O (e) double replacement c. Mercury(II) nitrate solution reacts with...
B. Write a balanced chemical reaction for the following word equations. (7 points) a. Potassium chlorate decomposes to form potassium chloride and oxygen. b. Aqueous solutions of copper (II) nitrate and sodium hydroxide react to form solid copper (II) hydroxide and a solution of sodium nitrate. b. Aqueous solutions of copper (II) nitrate and sodium hydroxide react to form solid copper (II) hydroxide and a solution of sodium nitrate. c. Diphosphorous tetrabromide reacts with fluorine gas to produce diphosphorous tetrafluoride...
9.16 Calcium cyanamide, CaCN2, reacts with water to form calcium carbonate and ammonia. CaCO3(s) +2NH3(g) CaCN2(s) +3H20() a. How many grams of H2O are needed to react with 75.0 g of CaCN2? b. How many grams of NH3 are produced from 5.24 g of CaCN2? c. How many grams of CaCO3 form if 155 g of H2O reacts? 9.18 When the gases dihydrogen sulfide and oxygen react, they form the gases sulfur dioxide and water vapor. a. Write the balanced...
may
you please provide details on how you recieved the answer thank
you.
3 pages.
Chem 143 - Lab Pre-lab Exercise Show the details of each calculation to get full credit 1. Magnesium oxide, a white powdery substance can often be made by heating magnesium metal in presence of oxygen. a. Write the balanced chemical equation for this reaction (including the state symbols such as (s) () or (aq)] b. When 10.1 g magnesium is allowed to react with 10.5g...
Give the balanced equation for each of the following (Use the lowest possible coefficients. Use the pull-down boxes to specify states such as (aq) or (s) If a box is not needed, leave it blank.) a. The combustion of propanol (C,H,OH) forms carbon dioxide and water vapor. A combustion reaction refers to a reaction of a substance with oxygen b. Aqueous solutions of cadmium(II) nitrate and potassium phosphate are mixed, resulting in the precipitate formation of cadmium(IT) phosphate with aqueous...
I need help with Questions 14, 17, and 18. Please show
work!
of 6 + ... JE SAZ 14) What mass of gaseous carbon dioxide can be absorbed by 1.00 kg of lithium hydroxide (according to the unbalanced equation below)? LiOH(s) + CO2(g) → LiCO, (s) + H2O (1) a. 920.8 b. 1.00 kg c. 1840 g d. 2.00 kg 15) Aspartame in as artificial sweetener that is 160 times sweeter than sucrose (table sugar) when dissolved in water. It...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 15 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago