Why is the answer I chose incorrect?
Homework Answers
Add Answer to:
Why is the answer I chose incorrect?
x 17. For what value of c will the...
17&18. And why you chose that answer. . 17. What is (are) the major products(s) of...
17&18.
And why you chose that answer.
. 17. What is (are) the major products(s) of the following reaction using the heavy isotope of hydrogen (D) chloride for labeling purposes? DCI A. L. II and III B. Only I and II Only III D.Only II 18. Hydration of conjugated alkene will also do an electrophilic addition with H20 and H2SO4 as a catalyst (hydration reaction.) What is (are) the product(s) of the following reaction (not including stereoisomers)? H2O/H2SO4 80°C A...
Why would the answer be a and b? I just chose a. What is it about...
Why would the answer be a and b? I just chose a. What is it
about b that also makes it correct?
9. In the human genome, CpG dinucleotides are often methylated. When exposed to deaminating agents, 5-methylcytosine becomes thymine. Which of the following mutations are can be explained by deamination of methylated CpG? a. 5'-TATCGAGA-3' to 5' -TATTGAGA-3' b. 5' -TATCGAGA-3' to 5'-TATCAAGA-3' c. 5' -TATGCAGA-3' to 5'-TATGTAGA-3' d. all of the above e. a and b only
Hello can you answer the incorrect question ? X Incorrect 1) What group does the Benedict's...
Hello can you answer the incorrect question ?
X Incorrect 1) What group does the Benedict's test oxidize? A. A ketone B. More than one of these C. An ether D. An aldehyde X (Your Answer) X Incorrect 3) If you have a polysaccharide, what color is it when mixed with lodina? A. Deep brown X (Your Answer) B. Deep violet C. Light Brown D. Prussian red X Incorrect 4) What sugar was negative to the Benedict's test? A. Fructose...
What causes the “end replication problem?” whats the correct answer and why? I chose B, why...
What causes the “end replication problem?” whats the correct
answer and why? I chose B, why am i Wrong?
A) The removal of RNA primer sequence.
B) Termination sequences occur prior to the end of the
chromosome.
C) A difference in the relative sequence positions of the
polymerases at the replication fork.
D) A & B
E) A & C
Also: Interpret the graph.
A) The available quantity of Cdk1 fluctuates through the cell
cycle.
B) The available quantity of...
c) 1-20) Choose the correct answer 1) If x=3 then xe...... b) =) d) 0.3) 2)...
c) 1-20) Choose the correct answer 1) If x=3 then xe...... b) =) d) 0.3) 2) The inequality notation for (-25) is...... a) -2s155 b ) 3<355 c) 155 c) (4) 3) If 2x+123 then xe... a) (2) b) =) d) L) 4)If -5<2x+1=3 then a) -3,1) b)-30 d) -66) 5) The solutions for * -5x+6- a) {1,-1) b) {1,1) c)(-6,41 c) {2, 6) The solutions for a) (-2,13 {2,-1) d) {1,1) 7) If a c then b) (2,1) 8)...
x Incorrect. What is the present value of $8,000 received in 7 years at 8% interest?...
x Incorrect. What is the present value of $8,000 received in 7 years at 8% interest? (Round answer to O decimal places.) Present value x] Incorrect. Bonnie Lee buys a savings bond for $125. The bond pays 5% and matures in 10 years. What amount will Bonnie receive when she redeems the bond? (Round answer to 2 decimal places.) Future value x Incorrect. Erik Peterson needs to have $10,000 at the end of 5 years to purchase a second car....
x Incorrect. What is the present value of $8,000 received in 7 years at 8% interest?...
x Incorrect. What is the present value of $8,000 received in 7 years at 8% interest? (Round answer to O decimal places.) Present value x] Incorrect. Bonnie Lee buys a savings bond for $125. The bond pays 5% and matures in 10 years. What amount will Bonnie receive when she redeems the bond? (Round answer to 2 decimal places.) Future value x Incorrect. Erik Peterson needs to have $10,000 at the end of 5 years to purchase a second car....
For each incorrect answer choice, explain exactly why it is an incorrect answer to the question....
For each incorrect answer choice, explain exactly why it is an incorrect answer to the question. (2-3 sentences explain why its wrong) Question: In Atkinson’s approach to achievement motivation (Ts = Ms x Ps x Is), incentive value for a particular achievement is smallest when: WRONG A.) the chances of success are moderate CORRECT B.) the chances of success are very large WRONG C.) the chances of success are very small WRONG D.) the achievement task is not related to an individual’s personal goals
please give a brief explanation to why you chose the answer 11. If A is a...
please give a brief explanation to why you chose the
answer
11. If A is a 3 × 5 matrix, then the transpose of A is O A. A number (possibly non-zero). O B. Zero. OC. A 3 x 5 matrix. O D. A subspace of R3 ○ E. Undefined F. A subspace of R5. O G. A 5 x 3 matrix.
16. the answer is incorrect 17. the answer is incorrect 24. the answer is incorrect 28....
16.
the answer is incorrect
17. the answer is incorrect
24. the answer is incorrect
28. the answer is incorrect
Question 16 Which of the following pairs don't match? A. Sulfamethoxazole (SXT) - a dye and an inhibitor B. CNA - general purpose medium C. Optochin - antibiotic D. A and B mismatch Question 17 Suppose you mix a loopful of colony with a drop of hydrogen peroxide on a glass slide and bubbles are formed. This suggests bacterium is:...
17&18.
And why you chose that answer.
. 17. What is (are) the major products(s) of the following reaction using the heavy isotope of hydrogen (D) chloride for labeling purposes? DCI A. L. II and III B. Only I and II Only III D.Only II 18. Hydration of conjugated alkene will also do an electrophilic addition with H20 and H2SO4 as a catalyst (hydration reaction.) What is (are) the product(s) of the following reaction (not including stereoisomers)? H2O/H2SO4 80°C A...
Why would the answer be a and b? I just chose a. What is it
about b that also makes it correct?
9. In the human genome, CpG dinucleotides are often methylated. When exposed to deaminating agents, 5-methylcytosine becomes thymine. Which of the following mutations are can be explained by deamination of methylated CpG? a. 5'-TATCGAGA-3' to 5' -TATTGAGA-3' b. 5' -TATCGAGA-3' to 5'-TATCAAGA-3' c. 5' -TATGCAGA-3' to 5'-TATGTAGA-3' d. all of the above e. a and b only
Hello can you answer the incorrect question ?
X Incorrect 1) What group does the Benedict's test oxidize? A. A ketone B. More than one of these C. An ether D. An aldehyde X (Your Answer) X Incorrect 3) If you have a polysaccharide, what color is it when mixed with lodina? A. Deep brown X (Your Answer) B. Deep violet C. Light Brown D. Prussian red X Incorrect 4) What sugar was negative to the Benedict's test? A. Fructose...
What causes the “end replication problem?” whats the correct
answer and why? I chose B, why am i Wrong?
A) The removal of RNA primer sequence.
B) Termination sequences occur prior to the end of the
chromosome.
C) A difference in the relative sequence positions of the
polymerases at the replication fork.
D) A & B
E) A & C
Also: Interpret the graph.
A) The available quantity of Cdk1 fluctuates through the cell
cycle.
B) The available quantity of...
c) 1-20) Choose the correct answer 1) If x=3 then xe...... b) =) d) 0.3) 2) The inequality notation for (-25) is...... a) -2s155 b ) 3<355 c) 155 c) (4) 3) If 2x+123 then xe... a) (2) b) =) d) L) 4)If -5<2x+1=3 then a) -3,1) b)-30 d) -66) 5) The solutions for * -5x+6- a) {1,-1) b) {1,1) c)(-6,41 c) {2, 6) The solutions for a) (-2,13 {2,-1) d) {1,1) 7) If a c then b) (2,1) 8)...
x Incorrect. What is the present value of $8,000 received in 7 years at 8% interest? (Round answer to O decimal places.) Present value x] Incorrect. Bonnie Lee buys a savings bond for $125. The bond pays 5% and matures in 10 years. What amount will Bonnie receive when she redeems the bond? (Round answer to 2 decimal places.) Future value x Incorrect. Erik Peterson needs to have $10,000 at the end of 5 years to purchase a second car....
x Incorrect. What is the present value of $8,000 received in 7 years at 8% interest? (Round answer to O decimal places.) Present value x] Incorrect. Bonnie Lee buys a savings bond for $125. The bond pays 5% and matures in 10 years. What amount will Bonnie receive when she redeems the bond? (Round answer to 2 decimal places.) Future value x Incorrect. Erik Peterson needs to have $10,000 at the end of 5 years to purchase a second car....
please give a brief explanation to why you chose the
answer
11. If A is a 3 × 5 matrix, then the transpose of A is O A. A number (possibly non-zero). O B. Zero. OC. A 3 x 5 matrix. O D. A subspace of R3 ○ E. Undefined F. A subspace of R5. O G. A 5 x 3 matrix.
16.
the answer is incorrect
17. the answer is incorrect
24. the answer is incorrect
28. the answer is incorrect
Question 16 Which of the following pairs don't match? A. Sulfamethoxazole (SXT) - a dye and an inhibitor B. CNA - general purpose medium C. Optochin - antibiotic D. A and B mismatch Question 17 Suppose you mix a loopful of colony with a drop of hydrogen peroxide on a glass slide and bubbles are formed. This suggests bacterium is:...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 9 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago