Please answer both question
thank you
Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
Please answer both question
thank you
1. (3pts.) Complete and balance the nuclear equation in +...
1. (3pts.) Complete and balance the nuclear equation in+U - Br+3n+ 2. The equilibrium constant for...
1. (3pts.) Complete and balance the nuclear equation in+U - Br+3n+ 2. The equilibrium constant for the dissociation of As.CO, (s) + 2 Ag+CO, isk=8.1 10-at 25°C. a) Calculate AG for the reaction when Agtl -1.0 x 102 M and CO, 9-10 x 10 M. (4pts) Ans: b) (pt) is the reaction spontaneous or onspontaneous at these concentrations? Ans: 3. (4pts) Nitrosyl chloride (NOCI) decomposes at elevated temperatures according to the equation below; INOCHE 2NO(g) + Calculate K, for this...
1. (3pts.) Complete and balance the nuclear equation n+ 235 92 U → 87 35 Br...
1. (3pts.) Complete and balance the nuclear equation n+ 235 92 U → 87 35 Br +3n+
please do these questions all of them first. thank you so much. DOCX - 151 KB...
please do these questions all of them first. thank you
so much.
DOCX - 151 KB your final answer!) Show work: 1. (3pts.) Complete and balance the nuclear equation n+ U Br +31+ 2. The equilibrium constant for the dissociation of Ag.CO,($) + 2 Ag+CO, 'Is K.-8.1 * 10" at 25°C. *) Calculate AG for the reaction when Ag 1 = 10 X 10M and CO, ' -1010 M (4pts) Ans: b) (pt) is the reaction spontaneous or nonspontaneous at...
answer all 1.3pts.) Complete and balance the nuclear equation in + PU - Br+3)n + 2....
answer all
1.3pts.) Complete and balance the nuclear equation in + PU - Br+3)n + 2. The equilibrium constant for the discutir of ACO,19-2A.CO.K.X25C. .) Calculate for the reactie wbre Ar-10.10.-10-30 (4pts) Ans: b) (pt) is the reaction spintaneous or menspontaneous at these concentratiesAs 3. (dpts) Nitroxyl chloride (NOC) decomposes at elevated temperatures according to the equation below 2NOCRONO Calculate for the reactie at 227C. (AP-31.3AS-1352m. Ans: 4. (4pts) Campit and lalar tallalara matha raadi MOCOMCO)
a and b please 2. The equilibrium constant for the dissociation of Ag,CO, (s) + 2...
a and b please
2. The equilibrium constant for the dissociation of Ag,CO, (s) + 2 Ag+ + CO; ? is K.-8.1 x 10-12 at 25°C. a) Calculate AG for the reaction when (Agt) = 1.0 x 102 M and [CO, ) = 1.0 X 10M. (4pts) Ans: Ans: b) (1pt) Is the reaction spontaneous or nonspontaneous at these concentrations?
2. The equilibrium constant for the dissociation of Ag,CO, (s) + 2 Ag+ + CO, is...
2. The equilibrium constant for the dissociation of Ag,CO, (s) + 2 Ag+ + CO, is Kp -8.1 10-12 at 25°C. a) Calculate AG for the reaction when [Ag'] = 1.0 x 10 2M and CO, +1 = 1.0 x 10- M. (4pts) Ans: b) (Ipt) Is the reaction spontaneous or nonspontaneous at these concentrations? Ans: 3. (4pts) Nitrosyl chloride (NOCI) decomposes at elevated temperatures according to the equation below; 2NOCI(g) 2NO(g) + Cl2(g) Calculate K, for this reaction at...
Muyuulin (1JJ. Part III: Determination of a Solubility Product In Part Ill you will prepare a...
Muyuulin (1JJ. Part III: Determination of a Solubility Product In Part Ill you will prepare a saturated solution of silver carbonate (Ag2CO3) and deten solubility product constant of Ag2CO3. Ag2CO3(s) = 2 Agt(aq) + CO32-(aq) (17) In making the solution, 1.0 mL of 0.10 mol/L AgNO3 will be added to specified volume mol/L Na2CO3. The limiting reagent in this reaction will be the silver ions. Use of an excess an of anion allows for a relatively simple calculation of the...
3. Use the provided experimental data to calculate the equilibrium constant, Ke, for the reaction given...
3. Use the provided experimental data to calculate the equilibrium constant, Ke, for the reaction given below. (7) Co3(ag)SCN (ag)CoSCN (ag) Ke-? initial concentration of Co», 1.0 × 10-3 M initial concentration of SCN: 5.0 x 10-4 M absorbance of the equilibrium mixture at 491 nm: 0.167 trendline equation for the [CoSCN2+] calibration curve: y (4.2 x 103)x +0.0074 What, if anything, will happen to saturated PbBr2 solution if more Br ions are added to the solution? Explain your answer....
Need help with question 14 and 15 please: 14.6.5 pts.) A lump of silver carbonate, Ag2CO3,...
Need help with question 14 and 15 please:
14.6.5 pts.) A lump of silver carbonate, Ag2CO3, was placed in 450.0 mL of pure water. The Ksp for the dissolution of Ag2CO3.is 8.46 x 10-12 M3 and is described by: Ag2CO3 (s) + 2 Ag+ (aq) + CO32- (aq) After a length of time the equilibrium concentration of Ag+ ion in this solution would be: (a) 1.30 x 10-3 M (belwel7 x 10-3 M (c) 1.30 x 10-4 M (d) 2.57...
Answer the followings: (Nuclear energy, total points 20) What are different types of nuclear reactions there?0)1)2...
Answer the followings: (Nuclear energy, total points 20) What are different types of nuclear reactions there?0)1)2 )3 a. b. Typical purity uranium in nuclear fuel pellet is () 15% (l) 25. (w c. Typical purity uranium in nuclear bomb is ( ) 100% (ii) 20%( d. In nuclear reaction electron/proton/neutron hit the e. A nuclear power plant has name plate capacity of 1 there? (i, 1 (92 01) 3 (W) 4 fv) 5 (point 1) nucleus of an atom? (Point...
1. (3pts.) Complete and balance the nuclear equation in+U - Br+3n+ 2. The equilibrium constant for the dissociation of As.CO, (s) + 2 Ag+CO, isk=8.1 10-at 25°C. a) Calculate AG for the reaction when Agtl -1.0 x 102 M and CO, 9-10 x 10 M. (4pts) Ans: b) (pt) is the reaction spontaneous or onspontaneous at these concentrations? Ans: 3. (4pts) Nitrosyl chloride (NOCI) decomposes at elevated temperatures according to the equation below; INOCHE 2NO(g) + Calculate K, for this...
1. (3pts.) Complete and balance the nuclear equation n+ 235 92 U → 87 35 Br +3n+
please do these questions all of them first. thank you
so much.
DOCX - 151 KB your final answer!) Show work: 1. (3pts.) Complete and balance the nuclear equation n+ U Br +31+ 2. The equilibrium constant for the dissociation of Ag.CO,($) + 2 Ag+CO, 'Is K.-8.1 * 10" at 25°C. *) Calculate AG for the reaction when Ag 1 = 10 X 10M and CO, ' -1010 M (4pts) Ans: b) (pt) is the reaction spontaneous or nonspontaneous at...
answer all
1.3pts.) Complete and balance the nuclear equation in + PU - Br+3)n + 2. The equilibrium constant for the discutir of ACO,19-2A.CO.K.X25C. .) Calculate for the reactie wbre Ar-10.10.-10-30 (4pts) Ans: b) (pt) is the reaction spintaneous or menspontaneous at these concentratiesAs 3. (dpts) Nitroxyl chloride (NOC) decomposes at elevated temperatures according to the equation below 2NOCRONO Calculate for the reactie at 227C. (AP-31.3AS-1352m. Ans: 4. (4pts) Campit and lalar tallalara matha raadi MOCOMCO)
a and b please
2. The equilibrium constant for the dissociation of Ag,CO, (s) + 2 Ag+ + CO; ? is K.-8.1 x 10-12 at 25°C. a) Calculate AG for the reaction when (Agt) = 1.0 x 102 M and [CO, ) = 1.0 X 10M. (4pts) Ans: Ans: b) (1pt) Is the reaction spontaneous or nonspontaneous at these concentrations?
2. The equilibrium constant for the dissociation of Ag,CO, (s) + 2 Ag+ + CO, is Kp -8.1 10-12 at 25°C. a) Calculate AG for the reaction when [Ag'] = 1.0 x 10 2M and CO, +1 = 1.0 x 10- M. (4pts) Ans: b) (Ipt) Is the reaction spontaneous or nonspontaneous at these concentrations? Ans: 3. (4pts) Nitrosyl chloride (NOCI) decomposes at elevated temperatures according to the equation below; 2NOCI(g) 2NO(g) + Cl2(g) Calculate K, for this reaction at...
Muyuulin (1JJ. Part III: Determination of a Solubility Product In Part Ill you will prepare a saturated solution of silver carbonate (Ag2CO3) and deten solubility product constant of Ag2CO3. Ag2CO3(s) = 2 Agt(aq) + CO32-(aq) (17) In making the solution, 1.0 mL of 0.10 mol/L AgNO3 will be added to specified volume mol/L Na2CO3. The limiting reagent in this reaction will be the silver ions. Use of an excess an of anion allows for a relatively simple calculation of the...
3. Use the provided experimental data to calculate the equilibrium constant, Ke, for the reaction given below. (7) Co3(ag)SCN (ag)CoSCN (ag) Ke-? initial concentration of Co», 1.0 × 10-3 M initial concentration of SCN: 5.0 x 10-4 M absorbance of the equilibrium mixture at 491 nm: 0.167 trendline equation for the [CoSCN2+] calibration curve: y (4.2 x 103)x +0.0074 What, if anything, will happen to saturated PbBr2 solution if more Br ions are added to the solution? Explain your answer....
Need help with question 14 and 15 please:
14.6.5 pts.) A lump of silver carbonate, Ag2CO3, was placed in 450.0 mL of pure water. The Ksp for the dissolution of Ag2CO3.is 8.46 x 10-12 M3 and is described by: Ag2CO3 (s) + 2 Ag+ (aq) + CO32- (aq) After a length of time the equilibrium concentration of Ag+ ion in this solution would be: (a) 1.30 x 10-3 M (belwel7 x 10-3 M (c) 1.30 x 10-4 M (d) 2.57...
Answer the followings: (Nuclear energy, total points 20) What are different types of nuclear reactions there?0)1)2 )3 a. b. Typical purity uranium in nuclear fuel pellet is () 15% (l) 25. (w c. Typical purity uranium in nuclear bomb is ( ) 100% (ii) 20%( d. In nuclear reaction electron/proton/neutron hit the e. A nuclear power plant has name plate capacity of 1 there? (i, 1 (92 01) 3 (W) 4 fv) 5 (point 1) nucleus of an atom? (Point...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago