![Part 4 contains the following questions... 11.Name the molecules shown below [4 marks] H 12. Use the reaction mechanism below](http://img.homeworklib.com/questions/d87ce340-fca5-11ea-8a53-c73d37427f85.png?x-oss-process=image/resize,w_560)
Homework Answers
Add Answer to:
Part 4 contains the following questions... 11.Name the molecules shown below [4 marks] H 12. Use...
Please answer each part with work shown. Thank you. 6. The following three mechanisms have been proposed for a particular reaction. Mechanism II Mechanism III Mechanisml H2 +NO-H2O+N (slow) N +...
Please answer each part with work shown. Thank you.
6. The following three mechanisms have been proposed for a particular reaction. Mechanism II Mechanism III Mechanisml H2 +NO-H2O+N (slow) N +NON2+0 (fast) O+H2-> H2O (fast) 2 NO-N202 (fast equilibrium) H2-N202-H20+ N3O (slow) H2+N20-H2O+N2 (fast) H2 + 2 NO- H2O+N2O (slow) N20+ H2N2+ H2O (fast) a) What is the overall reaction that each proposed mechanism supports? b) Calculate the ΔΗ'm for the overall reaction. c) For each mechanism, draw an energy...
2) A proposed reaction mechanism for nitric oxide, NO, produced in hydrogen fueled jet engines 1s...
2) A proposed reaction mechanism for nitric oxide, NO, produced in hydrogen fueled jet engines 1s 2 NO(g) N202(g) N202(g) + H2(g) H20(g) +N20(g) N20(g) +H2(g) N2(g) + H20(g) fast slow fast a) Write a balanced equation for the overall chemical reaction (1/2 mark) b) Determine the theoretical rate law. (1 mark) c) Using the blank reaction progress diagram below sketch the energy profile of this exothermic reaction mechanism, labeling the positions of NO. H2,N 02, N2O, H2O, N2. (3...
3. Use the proposed reaction mechanism to answer the following questions; Elementary 1: 2NO2Cl <---> ClO2...
3. Use the proposed reaction mechanism to answer the following questions; Elementary 1: 2NO2Cl <---> ClO2 + N2O + ClO Elementary 2: N2O + ClO2 <---> NO2 + NOCl Elementary 3: NOCl + ClO ---> NO2 + Cl2 a) What is the overall (reduced) reaction? b) Identify any intermediates. c) Determine the rate law expression for each elementary reaction. (fast) (fast) (slow)
7. Given the following data for the reaction: NOrg) Expt.TAIIM +1/2 CHE)-NOCU8 BIM 0273 0.819 0.273...
7. Given the following data for the reaction: NOrg) Expt.TAIIM +1/2 CHE)-NOCU8 BIM 0273 0.819 0.273 0.273 0.763 1526 0.763 0.400 0400 0.800 3.0 9.0 12.0 (a) Calculate the order with respect to each reactant. Om, n.p) 6.0 (b) Calculate k. (3 pts) (c) Write the rate law. (3 pts) 8. The reaction of NO with H2 is thought to occur in three elementary steps: NO + H2N+H2O (slow) N+NO N20 N20 +H2N2+H20 (fast) (a) Identify the reaction intermediate )....
1) 2) 3) A proposed mechanism for the reaction 2NO(g) +2H2(g) → N2(g) + 2H2O(g): Step...
1)
2)
3)
A proposed mechanism for the reaction 2NO(g) +2H2(g) → N2(g) + 2H2O(g): Step 1: 2NO(g) + N2O2(g) (very fast, reversible) Step 2: N2O2(g) + H2(g) N20(g) + H20(g) (slow) Step 3: N2O(g) + H2(g) →N2(g) +H2O(g) (fast) What is the rate law for the overall reaction? Ok[NO2 Ok[NO]2[H212 O k[NO]2[H2] Ok[N20][H2] k[NO]1/2[H2] 2NO(g) +Cl2 (g) → NOCI (8) Experiment concentration of NO (M) 0.09 0.045 0.045 concentration of Cl2(M) Rate (M/s) 0.01 3.40 x 10-4 8.50 x...
#13 Interpreting Mechanisms 1. Consider the following mechanism: Step 1 Br2  
#13 Interpreting Mechanisms 1. Consider the following mechanism: Step 1 Br2 2Br fast Step 2 Br + H2 H2Br fast Step 3 H2Br + Br 2HBr slow a. What is the overall equation? b. Identify the intermediate(s) if any. c. What is the molecularity and the rate law for each step including any reversible steps? d. What is the predicted rate law expression for this reaction. Be sure to only list reactants from the overall equation and...
4. (22 pts) Consider the following exothermic reaction: H2O2 +2t + 2H' → 12 + 2H20...
4. (22 pts) Consider the following exothermic reaction: H2O2 +2t + 2H' → 12 + 2H20 Consider the following mechanism for this reaction H,02 + r-* Hol + OH' Hol + r- 12 + он. 20H 2H2 H20 slow fast fast a) What species are intermediates in the above mechanism? Any catalysts? b) Sketch an energy versus reaction progress plot for the three step mechanism and clearly label the rate determining step in your diagram. c) What rate law would...
Use the generic elementary steps shown to below to answer the following questions. A + BC...
Use the generic elementary steps shown to below to answer the following questions. A + BC + D Elementary Step 1 (slow) A + DC + E Elementary Step 2 (fast) a. Based on the provided elementary steps, but is the net reaction? Select] [Select] 2A+B+D -> 2C+D+E 2A+B --> 2C+E termediates in this reaction? [Select] 2A +B+D -> 2C+E 2A + B --> 2C+D+E C. If step 115 the slow step, what should be the rate law for this...
y courses CHEM 1C-A-M20 Week 6 Cumulative Exa ered 5.00 Consider the following reaction mechanism: 2...
y courses CHEM 1C-A-M20 Week 6 Cumulative Exa ered 5.00 Consider the following reaction mechanism: 2 NO,CI = clo, + N2O + Clo fast N20 + clo, = NO2 + NOCI fast NOCI + ClO – NO, + Cl2 slow tion What is the rate law for this reaction mechanism? Select one: a. rate = k [N,0] [C10,] (CIO) [No,j' b. rate = k [Noci) [NO_ch? (cio,' [N,01" c. none of the listed answer choices d. rate = k [NO_ch?(no,j?...
what is the name of the enzyme that catalyzes the reaction shown below? 14.) (4 pts)...
what is the name of the enzyme that catalyzes the reaction shown
below?
14.) (4 pts) What is the name of the enzyme that catalyzes the reaction shown below? Glyceraldehyde 3-P + Sedoheptulose 7-P. Xylulose 5-P + Ribose 5-P. This enzyme requires the following coenzyme. What is it? Draw the mechanism of this reaction converting reactants into products. Draw the structure of any relevant intermediates. You may use B-H and B: for the general acid / base groups. PUSH ARROWS!...
Please answer each part with work shown. Thank you.
6. The following three mechanisms have been proposed for a particular reaction. Mechanism II Mechanism III Mechanisml H2 +NO-H2O+N (slow) N +NON2+0 (fast) O+H2-> H2O (fast) 2 NO-N202 (fast equilibrium) H2-N202-H20+ N3O (slow) H2+N20-H2O+N2 (fast) H2 + 2 NO- H2O+N2O (slow) N20+ H2N2+ H2O (fast) a) What is the overall reaction that each proposed mechanism supports? b) Calculate the ΔΗ'm for the overall reaction. c) For each mechanism, draw an energy...
2) A proposed reaction mechanism for nitric oxide, NO, produced in hydrogen fueled jet engines 1s 2 NO(g) N202(g) N202(g) + H2(g) H20(g) +N20(g) N20(g) +H2(g) N2(g) + H20(g) fast slow fast a) Write a balanced equation for the overall chemical reaction (1/2 mark) b) Determine the theoretical rate law. (1 mark) c) Using the blank reaction progress diagram below sketch the energy profile of this exothermic reaction mechanism, labeling the positions of NO. H2,N 02, N2O, H2O, N2. (3...
7. Given the following data for the reaction: NOrg) Expt.TAIIM +1/2 CHE)-NOCU8 BIM 0273 0.819 0.273 0.273 0.763 1526 0.763 0.400 0400 0.800 3.0 9.0 12.0 (a) Calculate the order with respect to each reactant. Om, n.p) 6.0 (b) Calculate k. (3 pts) (c) Write the rate law. (3 pts) 8. The reaction of NO with H2 is thought to occur in three elementary steps: NO + H2N+H2O (slow) N+NO N20 N20 +H2N2+H20 (fast) (a) Identify the reaction intermediate )....
1)
2)
3)
A proposed mechanism for the reaction 2NO(g) +2H2(g) → N2(g) + 2H2O(g): Step 1: 2NO(g) + N2O2(g) (very fast, reversible) Step 2: N2O2(g) + H2(g) N20(g) + H20(g) (slow) Step 3: N2O(g) + H2(g) →N2(g) +H2O(g) (fast) What is the rate law for the overall reaction? Ok[NO2 Ok[NO]2[H212 O k[NO]2[H2] Ok[N20][H2] k[NO]1/2[H2] 2NO(g) +Cl2 (g) → NOCI (8) Experiment concentration of NO (M) 0.09 0.045 0.045 concentration of Cl2(M) Rate (M/s) 0.01 3.40 x 10-4 8.50 x...
4. (22 pts) Consider the following exothermic reaction: H2O2 +2t + 2H' → 12 + 2H20 Consider the following mechanism for this reaction H,02 + r-* Hol + OH' Hol + r- 12 + он. 20H 2H2 H20 slow fast fast a) What species are intermediates in the above mechanism? Any catalysts? b) Sketch an energy versus reaction progress plot for the three step mechanism and clearly label the rate determining step in your diagram. c) What rate law would...
Use the generic elementary steps shown to below to answer the following questions. A + BC + D Elementary Step 1 (slow) A + DC + E Elementary Step 2 (fast) a. Based on the provided elementary steps, but is the net reaction? Select] [Select] 2A+B+D -> 2C+D+E 2A+B --> 2C+E termediates in this reaction? [Select] 2A +B+D -> 2C+E 2A + B --> 2C+D+E C. If step 115 the slow step, what should be the rate law for this...
y courses CHEM 1C-A-M20 Week 6 Cumulative Exa ered 5.00 Consider the following reaction mechanism: 2 NO,CI = clo, + N2O + Clo fast N20 + clo, = NO2 + NOCI fast NOCI + ClO – NO, + Cl2 slow tion What is the rate law for this reaction mechanism? Select one: a. rate = k [N,0] [C10,] (CIO) [No,j' b. rate = k [Noci) [NO_ch? (cio,' [N,01" c. none of the listed answer choices d. rate = k [NO_ch?(no,j?...
what is the name of the enzyme that catalyzes the reaction shown
below?
14.) (4 pts) What is the name of the enzyme that catalyzes the reaction shown below? Glyceraldehyde 3-P + Sedoheptulose 7-P. Xylulose 5-P + Ribose 5-P. This enzyme requires the following coenzyme. What is it? Draw the mechanism of this reaction converting reactants into products. Draw the structure of any relevant intermediates. You may use B-H and B: for the general acid / base groups. PUSH ARROWS!...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 52 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago