Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
please help! will give rating. thank you!
L. 1.CH,Br 2. H,0 M. NaBH CH, OH 0....
Determine the reagents necessary to carry out each of the following transformations. The reagent choices are...
Determine the reagents necessary to carry out each of the following transformations. The reagent choices are listed in the text box above this question (reagents L-U). You will type in one letter choice for each reaction from the list above. No reagent set will be used more than once, but not every reagent set will be used. 7 OH Br 8 OE Br NH2 NH 10 OH 11 Но, 12 NH2 O. Bra L. 1. CH,Br 2. HO M. NaBH...
Determine the reagents necessary to carry out each of the following transformations. The reagent choices are...
Determine the reagents necessary to carry out each of the following transformations. The reagent choices are listed in the text box above this question (reagents A-K). You will type in ONE letter choice for each reaction from the list above. No reagent set will be used more than once, but not every reagent set will be used. NH2 CN o Br OH Br 5 OH 6 Reaction 1: Reaction 2: Reaction 3: Reaction 4: Reaction 5: Reaction 6: Below is...
80 & NH 10 OH 11 12 og NH, Reaction 7: Reaction 8: Reaction 9: Reaction...
80 & NH 10 OH 11 12 og NH, Reaction 7: Reaction 8: Reaction 9: Reaction 10: Reaction 11: Reaction 12: Below is a list of reagents that will be used for the following question (reactions 7-12). L. 1.CH,Br 2. Ho P. Hz, Pd M. NaBH CHOH N 1 KCN 2. LAIH 3. H20 o. Brz o OH Q. NaOH, Br S. NH T. NHS U. 1. CHgMgBr 2. HO, mild H. NaĚH CN R. 1, KCN 2. HCI 3....
urgent will rate Below is a list of reagents that will be used for the following...
urgent will rate
Below is a list of reagents that will be used for the following question (reactions 7-12) L 1.CH,Br 2. HO M. NABHA CH,OH O. BE P.H.Pd N 1 CN 2. LIAM 3. HO OH Q. NaOH, BE | | KCN 2. HCI 3. cat NaOH Ho S.NH mi L NH. Nabh CN U. 1. CH MOB 2. H.O." Question 12 12 pts Determine the reagents necessary to carry out each of the following transformations. The reagent choices...
Determine the reagents heressary to carry out each of the following transformation. Iholo CHaBr 10. Bra...
Determine the reagents heressary to carry out each of the following transformation. Iholo CHaBr 10. Bra M. NaBH4 CH3OH 2.H20 N. l. KCN 2. LAIH& 3, H2O lo OH P. H2i Pq |Q. NaOH, Bra k lika S. NH3 2. Ha mildHt T. NH₂ NaB Hz CN 2. cat NaOH H2O U. l. Cha Mg Br 2. H2O, H+ P & Bor los hot -NH2 10 ŅH CH HO į NHC
Hi I need help predicting the products for these reactions OEt NaOCH.CH CH,CH OH b. H,...
Hi I need help predicting the products for these
reactions
OEt NaOCH.CH CH,CH OH b. H, O/H,0 a. NaOCH.CH CH,CH,OH b. Br c. NaOHH O, beat d. H2O*/H2O 1. NaCN, DMSO 2. CH,MgBr, Eto 3. H.O/H,O EN 2. NaH, CH,Br chemoselective 1. a. NaOet, EtOH Br b. 2. a. NaOH/H,O, heat b. H30+/H20 CY.NECEN cy OH b. then add HC-NH2 a. NaCN, DMSO b. HO*/H,0
Determine the product of the following reaction. 1 L CHOCH "CH Br no reaction H DH...
Determine the product of the following reaction. 1 L CHOCH "CH Br no reaction H DH (D) 8. Which reagent(s) is needed to facilitate the following reaction: (A) H20, (B) 1. Hg(OAc)2 in H2O 2. NaBH4 (C) 1. Hg(OAc), in CH,OH (D) 1.BH; THE 2. NaBH4 2. H2O2, NaOH (E) all of the above would work 9. Which of the following compounds is the final product of the reaction below: CI (A) (B) CHA + 2 mol Cl, in cct...
Can you please help me with both of these question. 4. Which set of reagents would yield butanal, CH3CH;CH;CH=O from 1-b...
Can you please help me with both of these question.
4. Which set of reagents would yield butanal, CH3CH;CH;CH=O from 1-butyne CH CH2CECH? a. 1) Hg(OAc)2, H2O; 2) NABH b. 1)9-BBN; 2) NaOH, H2O2 CH.C CH c. HgSO4, H2O, H;SO d. acid-catalyzed hydration butyne, 5. Which set of reagents would lead to the transformation depicted below? Hso, HO, S0 d calyzed hyration I 2 teanito mation Br Br a. 1) t-BuOK/t-BuOH; 2) Bra/H2O b. 1) NaOMe/MeOH; 2) Br2/CCl c. 1)...
U Below is a list of reagents that will be used for the following question (reactions...
U Below is a list of reagents that will be used for the following question (reactions 1-6). A 1, KCN 2. H, H2O, A B. 1. NaNO2, HCI 2. CuCN c. 1. Mg 2. CO2 3. H2O D. 1. Nah 2. Br E. 1. Mg 2. 3. H, H20 F. PCC G. KMnO H2O, HO H. 1. Mg J. 1. Mg 2 K. AICI 3. H2O 4. PCC ia 3. H', H2O 4. PCC CI Question 11 12 pts Determine...
1) + NaOH J) PCC OH CHCI K) H CH OH L) 1. Mg, ether Br...
1) + NaOH J) PCC OH CHCI K) H CH OH L) 1. Mg, ether Br 2. 3. H2O M) OH I Na Cr2O7 H2SO4
Determine the reagents necessary to carry out each of the following transformations. The reagent choices are listed in the text box above this question (reagents L-U). You will type in one letter choice for each reaction from the list above. No reagent set will be used more than once, but not every reagent set will be used. 7 OH Br 8 OE Br NH2 NH 10 OH 11 Но, 12 NH2 O. Bra L. 1. CH,Br 2. HO M. NaBH...
Determine the reagents necessary to carry out each of the following transformations. The reagent choices are listed in the text box above this question (reagents A-K). You will type in ONE letter choice for each reaction from the list above. No reagent set will be used more than once, but not every reagent set will be used. NH2 CN o Br OH Br 5 OH 6 Reaction 1: Reaction 2: Reaction 3: Reaction 4: Reaction 5: Reaction 6: Below is...
80 & NH 10 OH 11 12 og NH, Reaction 7: Reaction 8: Reaction 9: Reaction 10: Reaction 11: Reaction 12: Below is a list of reagents that will be used for the following question (reactions 7-12). L. 1.CH,Br 2. Ho P. Hz, Pd M. NaBH CHOH N 1 KCN 2. LAIH 3. H20 o. Brz o OH Q. NaOH, Br S. NH T. NHS U. 1. CHgMgBr 2. HO, mild H. NaĚH CN R. 1, KCN 2. HCI 3....
urgent will rate
Below is a list of reagents that will be used for the following question (reactions 7-12) L 1.CH,Br 2. HO M. NABHA CH,OH O. BE P.H.Pd N 1 CN 2. LIAM 3. HO OH Q. NaOH, BE | | KCN 2. HCI 3. cat NaOH Ho S.NH mi L NH. Nabh CN U. 1. CH MOB 2. H.O." Question 12 12 pts Determine the reagents necessary to carry out each of the following transformations. The reagent choices...
Determine the reagents heressary to carry out each of the following transformation. Iholo CHaBr 10. Bra M. NaBH4 CH3OH 2.H20 N. l. KCN 2. LAIH& 3, H2O lo OH P. H2i Pq |Q. NaOH, Bra k lika S. NH3 2. Ha mildHt T. NH₂ NaB Hz CN 2. cat NaOH H2O U. l. Cha Mg Br 2. H2O, H+ P & Bor los hot -NH2 10 ŅH CH HO į NHC
Hi I need help predicting the products for these
reactions
OEt NaOCH.CH CH,CH OH b. H, O/H,0 a. NaOCH.CH CH,CH,OH b. Br c. NaOHH O, beat d. H2O*/H2O 1. NaCN, DMSO 2. CH,MgBr, Eto 3. H.O/H,O EN 2. NaH, CH,Br chemoselective 1. a. NaOet, EtOH Br b. 2. a. NaOH/H,O, heat b. H30+/H20 CY.NECEN cy OH b. then add HC-NH2 a. NaCN, DMSO b. HO*/H,0
Determine the product of the following reaction. 1 L CHOCH "CH Br no reaction H DH (D) 8. Which reagent(s) is needed to facilitate the following reaction: (A) H20, (B) 1. Hg(OAc)2 in H2O 2. NaBH4 (C) 1. Hg(OAc), in CH,OH (D) 1.BH; THE 2. NaBH4 2. H2O2, NaOH (E) all of the above would work 9. Which of the following compounds is the final product of the reaction below: CI (A) (B) CHA + 2 mol Cl, in cct...
Can you please help me with both of these question.
4. Which set of reagents would yield butanal, CH3CH;CH;CH=O from 1-butyne CH CH2CECH? a. 1) Hg(OAc)2, H2O; 2) NABH b. 1)9-BBN; 2) NaOH, H2O2 CH.C CH c. HgSO4, H2O, H;SO d. acid-catalyzed hydration butyne, 5. Which set of reagents would lead to the transformation depicted below? Hso, HO, S0 d calyzed hyration I 2 teanito mation Br Br a. 1) t-BuOK/t-BuOH; 2) Bra/H2O b. 1) NaOMe/MeOH; 2) Br2/CCl c. 1)...
U Below is a list of reagents that will be used for the following question (reactions 1-6). A 1, KCN 2. H, H2O, A B. 1. NaNO2, HCI 2. CuCN c. 1. Mg 2. CO2 3. H2O D. 1. Nah 2. Br E. 1. Mg 2. 3. H, H20 F. PCC G. KMnO H2O, HO H. 1. Mg J. 1. Mg 2 K. AICI 3. H2O 4. PCC ia 3. H', H2O 4. PCC CI Question 11 12 pts Determine...
1) + NaOH J) PCC OH CHCI K) H CH OH L) 1. Mg, ether Br 2. 3. H2O M) OH I Na Cr2O7 H2SO4
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 37 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago