Homework Answers
Hope you and your family are well in this pandemic. The question
asked by you is to convert an alkene to a diol.
The reaction can be generally thought as-
Now, here the stereochemistry is also important as the the reactant is a cyclohexene derivative. What you suppose to know and have to verify from the mechanism is that the stereochemistry of the diol in the product is syn.
Why is is syn ?
This is evident from the mechanism.
The five memberred Transition state formed has to be cis w.r.t the
double bond. A five memberred trans geometry is not possible. This
is true for any reaction you will encounter. A trans five memberred
ring is either not possible or very very unstable.
So, the correct answer here is 'c' as the two OH groups are syn
w.r.t each other (both above or both below).
Add Answer to:
Oso (CH),COOH (CH3)-COH, NaOH Н он + enantiomer ОН ОН + enantiomer ОН ОН + enantiomer...
Predict the product of the following reaction. OsO4. (CH3),COOH (CH3)3COH, NaOH OH 0 ОН "OH +...
Predict the product of the following reaction. OsO4. (CH3),COOH (CH3)3COH, NaOH OH 0 ОН "OH + enantiomer o H OH + enantiomer OH OH + enantiomer
3.16 Draw mirror images for these molecules. Are they different from the original molecule? COOH он...
3.16 Draw mirror images for these molecules. Are they different from the original molecule? COOH он Cно OH (b) Н- С-Он (d) (c) H2N CH (a) H C COOH Н CH2OH CH3 Н CH, Он Он н. OH (f) (h) он Н ОН CH CH CH,
please answer all. thank you! Predict the product of the following reaction. OsO4, (CH3),COOH (CH3)3COH, NaOH...
please answer all. thank you!
Predict the product of the following reaction. OsO4, (CH3),COOH (CH3)3COH, NaOH ЕН ОН + enantiomer Орон ОН ОН + enantiomer ОН ОН + enantiomer НО НО PhP Predict the product of the following reaction. 1. MgBr 2. H3O+ o OH + enantiomer O OH + enantiomer OH + enantiomer OH + enantiomer
+ C) NH H2N CO2H 2 moles NaOH NH3 н. D) CH,CH(CH3)2 ОН H2N Show transcribed...
+ C) NH H2N CO2H 2 moles NaOH NH3 н. D) CH,CH(CH3)2 ОН H2N
+ C) NH H2N CO2H 2 moles NaOH NH3 н. D) CH,CH(CH3)2 ОН H2N Show transcribed...
+ C) NH H2N CO2H 2 moles NaOH NH3 н. D) CH,CH(CH3)2 ОН H2N
? What is the IUPAC name for the compound? Н,С— СН,—CH—CH, ОН CH3 IUPAC name:
?
What is the IUPAC name for the compound? Н,С— СН,—CH—CH, ОН CH3 IUPAC name:
14. (1 pt each) Name the following molecules. CH3 CH3 нно н н-с-с-с-NA ті Hн н,с...
14. (1 pt each) Name the following molecules. CH3 CH3 нно н н-с-с-с-NA ті Hн н,с Сн, Н CH,CH нс H 15. (3 pts each) Give the product(s) for the following reactions, and name all reactants and products. CH, он ОН н,с + нэс- сн - сн 3 нус. NH2 ОН Hн ІІ ОН + н-с-с-о-н НО P н Н ОН
Give the name for the peptide. CH, CH3 ОН CH CH3 ОН CH, CH3 CH2 CH2...
Give the name for the peptide.
CH, CH3 ОН CH CH3 ОН CH, CH3 CH2 CH2 HCOH CH CH2 H2N-C-CONH-C-CONH-C-CONH-C-CONH-C-000 H H H Н Н 1 1
elimination/substitution reactions TsO. он 1. TsCl, pyr 2. NaN Ph н. CH3 NaOH Н,с E2 Only...
elimination/substitution reactions
TsO. он 1. TsCl, pyr 2. NaN Ph н. CH3 NaOH Н,с E2 Only CH2CH он. Br LDA но Он HSO Нeat Ring expansion H2SO Нeat он 5. Identify each position where an SN1, or SN2 reaction is likely to occur. If there is the potential for both, state SN1 or SN2 TsO. Br NH2 NO
Н,о" CH3 H ОН ОН Но HCI Hасо оснз НСI CH,он TSOH CH,сH,он осн TSOH Он...
Н,о" CH3 H ОН ОН Но HCI Hасо оснз НСI CH,он TSOH CH,сH,он осн TSOH Он CH,он Hао" о о-
Predict the product of the following reaction. OsO4. (CH3),COOH (CH3)3COH, NaOH OH 0 ОН "OH + enantiomer o H OH + enantiomer OH OH + enantiomer
3.16 Draw mirror images for these molecules. Are they different from the original molecule? COOH он Cно OH (b) Н- С-Он (d) (c) H2N CH (a) H C COOH Н CH2OH CH3 Н CH, Он Он н. OH (f) (h) он Н ОН CH CH CH,
please answer all. thank you!
Predict the product of the following reaction. OsO4, (CH3),COOH (CH3)3COH, NaOH ЕН ОН + enantiomer Орон ОН ОН + enantiomer ОН ОН + enantiomer НО НО PhP Predict the product of the following reaction. 1. MgBr 2. H3O+ o OH + enantiomer O OH + enantiomer OH + enantiomer OH + enantiomer
+ C) NH H2N CO2H 2 moles NaOH NH3 н. D) CH,CH(CH3)2 ОН H2N
+ C) NH H2N CO2H 2 moles NaOH NH3 н. D) CH,CH(CH3)2 ОН H2N
?
What is the IUPAC name for the compound? Н,С— СН,—CH—CH, ОН CH3 IUPAC name:
14. (1 pt each) Name the following molecules. CH3 CH3 нно н н-с-с-с-NA ті Hн н,с Сн, Н CH,CH нс H 15. (3 pts each) Give the product(s) for the following reactions, and name all reactants and products. CH, он ОН н,с + нэс- сн - сн 3 нус. NH2 ОН Hн ІІ ОН + н-с-с-о-н НО P н Н ОН
Give the name for the peptide.
CH, CH3 ОН CH CH3 ОН CH, CH3 CH2 CH2 HCOH CH CH2 H2N-C-CONH-C-CONH-C-CONH-C-CONH-C-000 H H H Н Н 1 1
elimination/substitution reactions
TsO. он 1. TsCl, pyr 2. NaN Ph н. CH3 NaOH Н,с E2 Only CH2CH он. Br LDA но Он HSO Нeat Ring expansion H2SO Нeat он 5. Identify each position where an SN1, or SN2 reaction is likely to occur. If there is the potential for both, state SN1 or SN2 TsO. Br NH2 NO
Н,о" CH3 H ОН ОН Но HCI Hасо оснз НСI CH,он TSOH CH,сH,он осн TSOH Он CH,он Hао" о о-
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 8 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 39 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago