Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
Chapter 25: Reactions & Linkages Name: 1. If D-ribose underwent the Kiliani-Fischer synthesis (chain lengthening), what...
CHAPTER 25 2. If D-arabinose underwent the Wohl Degradation (chain shortening), what new sugar would be...
CHAPTER 25 2. If D-arabinose underwent the Wohl Degradation (chain shortening), what new sugar would be produced. Draw the Fischer projection of the new sugar. CHO HO -H Wohl H ОН Degradation H OH CH OH D-Arabinose
CARBOHYDRATES POST-LAB QUESTIONS [52] 19. Review the Fischer structures of D-galactose, D-glucose, and D-mannose Identify each...
CARBOHYDRATES POST-LAB QUESTIONS [52] 19. Review the Fischer structures of D-galactose, D-glucose, and D-mannose Identify each structure. [12 pts) CHO CHO CHO Н. -OH HO -H H -OH HO -H HO H HO -H Н. OH H OH HO -H H -OH H ОН Н. ОН CH2OH CH2OH CH2OH D-Glucose D-Mannose TD-Galactose 20. Would either D-galactose or D-mannose form an osazone identical to the glucose osazone? [5 pts] 21. Explain: [5 pts) [5 pts] 22. What structural feature do all...
11.a) Draw the open chain (Fischer) structure of D-altrose. (1pt) (b) How many chiral centers are...
11.a) Draw the open chain (Fischer) structure of D-altrose.
(1pt)
(b) How many chiral centers are in D-altrose? ______ (1pt)
(c) What is the maximum number of possible stereoisomers whch
can exist for D-altrose? _____ (1pt)
(d) Draw L-altrose in open chain form (use Fischer projection) –
you may use the space above. (1pt)
(e) Use the information above to draw a Haworth projection for
alpha-D-altropyranose. (2pt)
Ruff degradation on a monosaccharide causes C1 to be lost as
carbon dioxide,...
Carbohydrates homework 1. Identify the sugars as aldose or ketose, Lor D, and determine the number...
Carbohydrates homework 1. Identify the sugars as aldose or ketose, Lor D, and determine the number of Chiral centers. Сон CHO к он СКО КО- { ой -Н НО Н и о ко ги но И. н 애 CHROM ch, Сон и D Сн оя ь, о H он и к ой ho И 10. И и — ой ch 20h CH₂oh 2. Identify the relation between the structures in each of the following pairs. СКО СКО Си0 Cheon И...
Carbohydrates homework 1. Identify the sugars as aldose or ketose, Lor D, and determine the number...
Carbohydrates homework 1. Identify the sugars as aldose or ketose, Lor D, and determine the number of Chiral centers. cv.ok CHO к D ско 1 н- 4 ko ho- M "Т, oly CH₂OH ChooH Chaok И CH₂OH H ой k он ой н ho И no и ой си, ch 20h 2. Identify the relation between the structures in each of the following pairs. с СО со Chow но -И h он lko НЕ OM -v с Р oh -...
Culhydrates 1. Complete th Complete the table by classifying each sugar sugar (A, B, C, D)...
Culhydrates 1. Complete th Complete the table by classifying each sugar sugar (A, B, C, D) below based on carbonyl group and number of carbons (c.8. aldohexose, ketotriose, etc.). Classify them as an antiomer. Indicate the number of chiral carbons for each sugar. Sugar Classification based on carbonyl group and number of carbons Lor D enantiomer Number of chiral carbons н-с-он HO-6-H. н-с-он ін,он CH,OH C=0 HO-C-H н-с-он HO-C-H. ён,он снон c=0 | HO-C-H ін,он H-C-OH CH, OH CD 2....
T. How many stereoisomers of beta-D-glucopyranose exist (including itself)? a. 4 e. too many to consider...
T. How many stereoisomers of beta-D-glucopyranose exist (including itself)? a. 4 e. too many to consider b. 8 с. 16 d. 32 onsider the following Fischer projections and answer the questions: CHO H OH HO H H OH H O ČH2OH glucose CHO CHO H OH Но- СНО н H- OH HO OH HO -н -н H- OH H HO -H HO н- H OH ČH2OH H OH CH2OH OH CH OH allose galactose talose 2. Which pair are not...
need help! 21. The following sugars condense to form an α(1-4) glyosidic bond. Using the Haworth...
need help!
21. The following sugars condense to form an α(1-4) glyosidic bond. Using the Haworth templates below, neatly number the carbons and draw in the new glycosidic bond OH он но H OH H OH 22. When fructose cyclizes, it forms a hemiacetal. Complete the structure for the a-fructose anomer CH2OH HO OH он CH2OH D-fructose Chem 1050 Exam 2 review problems 23. What are the products when the following two molecules undergo a condensation? 24. What are the...
Part D Glucose can be classified as an aldohexose. Name the following monosaccharide to indicate its...
Part D Glucose can be classified as an aldohexose. Name the following monosaccharide to indicate its carbonyl group and the number of carbon atoms. но он он н -C- C-C-C-C OH HHHH Spell out the name of the monosaccharide, including the carbonyl group and the number of carbon atoms. View Available Hint(s) (3R 4R)-1,3,4,5-tetrahydroxyponta Submit Previous Answers X Incorrect; Try Again; 3 attempts remaining Part B Indicate the chiral carbon(s). Identify the appropriate atom by selecting each atom and assigning...
1. Draw an L ketopentose and a D-aldotetrose using the Fischer Projection. 2. Draw an a...
1. Draw an L ketopentose and a D-aldotetrose using the Fischer Projection. 2. Draw an a then B isomerfor the Haworth Structure. CHон Cнон -O OH H H H H OH H OH H. OH H OH H 4. Describe and draw an example of a Chiral 3. What is mutarotation all about??? molecule. 5. Fill in the table with the information required. Monosaccharide #1 Monosaccharide # 2 Monosaccharide #3 Name Major functional group Molecular formula Other fact Disaccharide #3:...
CHAPTER 25 2. If D-arabinose underwent the Wohl Degradation (chain shortening), what new sugar would be produced. Draw the Fischer projection of the new sugar. CHO HO -H Wohl H ОН Degradation H OH CH OH D-Arabinose
CARBOHYDRATES POST-LAB QUESTIONS [52] 19. Review the Fischer structures of D-galactose, D-glucose, and D-mannose Identify each structure. [12 pts) CHO CHO CHO Н. -OH HO -H H -OH HO -H HO H HO -H Н. OH H OH HO -H H -OH H ОН Н. ОН CH2OH CH2OH CH2OH D-Glucose D-Mannose TD-Galactose 20. Would either D-galactose or D-mannose form an osazone identical to the glucose osazone? [5 pts] 21. Explain: [5 pts) [5 pts] 22. What structural feature do all...
11.a) Draw the open chain (Fischer) structure of D-altrose.
(1pt)
(b) How many chiral centers are in D-altrose? ______ (1pt)
(c) What is the maximum number of possible stereoisomers whch
can exist for D-altrose? _____ (1pt)
(d) Draw L-altrose in open chain form (use Fischer projection) –
you may use the space above. (1pt)
(e) Use the information above to draw a Haworth projection for
alpha-D-altropyranose. (2pt)
Ruff degradation on a monosaccharide causes C1 to be lost as
carbon dioxide,...
Carbohydrates homework 1. Identify the sugars as aldose or ketose, Lor D, and determine the number of Chiral centers. Сон CHO к он СКО КО- { ой -Н НО Н и о ко ги но И. н 애 CHROM ch, Сон и D Сн оя ь, о H он и к ой ho И 10. И и — ой ch 20h CH₂oh 2. Identify the relation between the structures in each of the following pairs. СКО СКО Си0 Cheon И...
Carbohydrates homework 1. Identify the sugars as aldose or ketose, Lor D, and determine the number of Chiral centers. cv.ok CHO к D ско 1 н- 4 ko ho- M "Т, oly CH₂OH ChooH Chaok И CH₂OH H ой k он ой н ho И no и ой си, ch 20h 2. Identify the relation between the structures in each of the following pairs. с СО со Chow но -И h он lko НЕ OM -v с Р oh -...
Culhydrates 1. Complete th Complete the table by classifying each sugar sugar (A, B, C, D) below based on carbonyl group and number of carbons (c.8. aldohexose, ketotriose, etc.). Classify them as an antiomer. Indicate the number of chiral carbons for each sugar. Sugar Classification based on carbonyl group and number of carbons Lor D enantiomer Number of chiral carbons н-с-он HO-6-H. н-с-он ін,он CH,OH C=0 HO-C-H н-с-он HO-C-H. ён,он снон c=0 | HO-C-H ін,он H-C-OH CH, OH CD 2....
T. How many stereoisomers of beta-D-glucopyranose exist (including itself)? a. 4 e. too many to consider b. 8 с. 16 d. 32 onsider the following Fischer projections and answer the questions: CHO H OH HO H H OH H O ČH2OH glucose CHO CHO H OH Но- СНО н H- OH HO OH HO -н -н H- OH H HO -H HO н- H OH ČH2OH H OH CH2OH OH CH OH allose galactose talose 2. Which pair are not...
need help!
21. The following sugars condense to form an α(1-4) glyosidic bond. Using the Haworth templates below, neatly number the carbons and draw in the new glycosidic bond OH он но H OH H OH 22. When fructose cyclizes, it forms a hemiacetal. Complete the structure for the a-fructose anomer CH2OH HO OH он CH2OH D-fructose Chem 1050 Exam 2 review problems 23. What are the products when the following two molecules undergo a condensation? 24. What are the...
Part D Glucose can be classified as an aldohexose. Name the following monosaccharide to indicate its carbonyl group and the number of carbon atoms. но он он н -C- C-C-C-C OH HHHH Spell out the name of the monosaccharide, including the carbonyl group and the number of carbon atoms. View Available Hint(s) (3R 4R)-1,3,4,5-tetrahydroxyponta Submit Previous Answers X Incorrect; Try Again; 3 attempts remaining Part B Indicate the chiral carbon(s). Identify the appropriate atom by selecting each atom and assigning...
1. Draw an L ketopentose and a D-aldotetrose using the Fischer Projection. 2. Draw an a then B isomerfor the Haworth Structure. CHон Cнон -O OH H H H H OH H OH H. OH H OH H 4. Describe and draw an example of a Chiral 3. What is mutarotation all about??? molecule. 5. Fill in the table with the information required. Monosaccharide #1 Monosaccharide # 2 Monosaccharide #3 Name Major functional group Molecular formula Other fact Disaccharide #3:...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 59 seconds from now -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 48 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago