![What is the order and the rate constant for the reaction: C2H40 (g) CH4 (g) + CO (g) given the data: (C2H40] t(min) 0.0860 0](http://img.homeworklib.com/questions/90c1e420-042c-11eb-8264-4159518f5c02.png?x-oss-process=image/resize,w_560)
Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
What is the order and the rate constant for the reaction: C2H40 (g) CH4 (g) +...
The table bellow gives the concentrations of C2H4O (g) as a function of time at 690K...
The table bellow gives the concentrations of C2H4O (g) as a function of time at 690K for the following reaction equation: C2H4O (g) -------> CH4 (g) + CO (g) [C2H4O]/ M t/min 0.0860 0 0.0465 52 0.0355 75 0.0274 97 0.0174 135 Verify that this is a first order reaction by plotting 1n ([C2H40]/M versus time and determine the value of the rate constant.
1a. Hydrogen iodide decomposes when heated, forming H2 (g) and I2 (g). The rate law for...
1a. Hydrogen iodide decomposes when heated, forming H2 (g) and I2 (g). The rate law for this reaction is -delta[HI]/delta t = k[HI]^2. At 443 °C, k=30.L/molxmin. If the initial HI (g) concentration is 5.5x10^-2 mol/L, what concentration of HI (g) will remain after 10. minutes? Concentration = ____ mol/L 1b. The decomposition of SO2Cl2 SO2Cl2 (g) ----> SO2 (g) + Cl2 (g) is first-order in SO2Cl2, and the reaction has a half-life of 245 minutes at 600 K. If...
A certain first-order reaction has a rate constant of 1.65 min-1 at 20°C. What is the...
A certain first-order reaction has a rate constant of 1.65 min-1 at 20°C. What is the value of the rate constant at 60°C if the activation energy is 75.5 kJ/mol? The rate constant is 105 times bigger at 300 K than at 200K. Explain why reaction rate increases with temperature? At 227°C, the reaction: SO2Cl2(g) SO2(g) + Cl2(g), has an equilibrium constant of KC = 2.99×10-7. If a reaction mixture initially contains 0.175 M SO2Cl2, what is the equilibrium concentration...
10. (4 pts) The reaction: SO2Cl2(g)- SO2(g ) + Cl (g) is first order with respect...
10. (4 pts) The reaction: SO2Cl2(g)- SO2(g ) + Cl (g) is first order with respect to SO,Cl2. This reaction was run at a temperature at which the rate constant was 1.3 x 10 /s. In an experiment, a sample of SO;Cl2 at a concentration of 0.03 1 6 mol/L was allowed to decompose by the reaction above. What was the concentration of SO2CI 5.75 hours after the start of the reaction? A) 0.002 mol/L B) 0.014 mol/L C) 0.024...
Chloromethane forms by the reaction CH4(g) + Cl2(g) ⇌ CH3Cl(g) + HCl(g) at 1500K, Kp =...
Chloromethane forms by the reaction CH4(g) + Cl2(g) ⇌ CH3Cl(g) + HCl(g) at 1500K, Kp = 1.6 x 104 . In the reaction mixture, PCH4 = 0.13 atm, PCl2 = 0.035 atm, PCH3Cl = 0.24 atm, and PHCl = 0.47 atm. Is CH3Cl or CH4 forming?
Under what conditions will the following reaction be spontaneous? SO2(g) + Cl2(g) → SO2Cl2(g) The following...
Under what conditions will the following reaction be spontaneous? SO2(g) + Cl2(g) → SO2Cl2(g) The following information may be important: ΔHºf SO2(g) = -296.8 kJ/mol, ΔHºf SO2Cl2(g) = 364.0 kJ/mol low temperatures high temperatures always spontaneous never spontaneous
The first order reaction, SO2Cl2 -> SO2 + Cl2, has a rate constant of 0.17 h^-1....
The first order reaction, SO2Cl2 -> SO2 + Cl2, has a rate constant of 0.17 h^-1. If the initial concentration of SO2Cl2 is 1.25 x 10^-3 M, how many seconds does it take for the concentration to drop to 0.31 x 10^-3 M?
The gas phase reaction: SO2Cl2(g) → Cl2(g) + SO2(g) is first order in SO2Cl2(g) and has...
The gas phase reaction: SO2Cl2(g) → Cl2(g) + SO2(g) is first order in SO2Cl2(g) and has a first order rate constant of 0.0462 min-1. How long will it take for [SO2Cl2] to decrease from 0.500 M to 0.0100 M? 84.7 min 1.70 min 38.8 min 2.35 min
The reaction SO2Cl2(g)→SO2(g)+Cl2(g) is first order in SO2Cl2. Using the following kinetic data, determine the magnitude...
The reaction SO2Cl2(g)→SO2(g)+Cl2(g) is first order in SO2Cl2. Using the following kinetic data, determine the magnitude of the first-order rate constant: Time (s) Pressure SO2Cl2(atm) 0 1.000 2500 0.947 5000 0.895 7500 0.848 10000 0.803 k= s−1
The reaction SO2Cl2(g)----->SO2(g) + Cl2(g) is first order inSO2Cl2. Using the following kineticdata, determine the magnitude...
The reaction SO2Cl2(g)----->SO2(g) + Cl2(g) is first order inSO2Cl2. Using the following kineticdata, determine the magnitude of the first-order rateconstant? Time(s) Pressure SO2Cl2 (atm) 0 1.00 2,500 0.947 5,000 0.895 7,500 0.848 10,000 0.803
10. (4 pts) The reaction: SO2Cl2(g)- SO2(g ) + Cl (g) is first order with respect to SO,Cl2. This reaction was run at a temperature at which the rate constant was 1.3 x 10 /s. In an experiment, a sample of SO;Cl2 at a concentration of 0.03 1 6 mol/L was allowed to decompose by the reaction above. What was the concentration of SO2CI 5.75 hours after the start of the reaction? A) 0.002 mol/L B) 0.014 mol/L C) 0.024...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 minute ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 51 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago