Give the following compounds there IUPAC name? Thank you in advance!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Give the following compounds there IUPAC name? Thank you in advance! e. (CH2CH2)3CCH(CH3)CH2CH2CH3 f. CH2CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)2CH3 g....
Give the IUPAC name for the compound alkanes: f. CH2CH2-C-CH2CH2 CH3 CH CHỤCH-CH2-C-CH3 CHg
Be sure to answer all parts. Give the IUPAC name for the following compound. CH3CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)3CH3
Practice: Give IUPAC names for the following compounds. a. (CH3)3CCH2CH(CH2CH3)2 C. CH3(CH2)2CH(CH2CH2CH3)CH(CH3)2
How do I name the following? Thank you! 2. Name the following compounds: CH3 CH CH2 CH CH CH CH O-CH-CHs CH3 CH厂CH厂CH2-O-CH-CH2-CH3 Cl CH3 CH3-CH-CH-CH-O-CH2CH2CH3 CH3
Give IUPAC names for the following compounds. CH2CH2CH3 CH3CH=CCH=CH2 HC CH3
IUPAC Nomenclature 4.39 Give the IUPAC name for each compound. h. tyn my 1. -CH(CH2CH3)2 i. a. CH3CH2CHCH2CHCH2CH2CH3 CH3 CH2CH3 CH2CH3 CH3 b. CH3CH2CCH_CH2CHCHCH2CH2CH3 CH2CH3 CH2CH3 C. CH3CH,CH,C(CH3)2C(CH3)2CH2CH3 d. CH3CH2C(CH2CH3)2CH(CH3)CH(CH2CH2CH3)2 e. (CH3CH2),CCH(CH3)CH2CH2CH3 f. CH3CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)3CH3 g. (CH2CH2CH2)4C more on mo .
Give the IUPAC name of the following compounds. COZH CH3 OH wolltartoon 50 asso COOH Br CH; CH,-CH2-CH-CH2-CH-CH-CN
CH3 6. Assign IUPAC names for each of the following compounds: d) CHS-C-CH3 CH₂CH3 CH2CH2 C H2CH2CH3 CH3-CH2-CH2-C-CH2-CH2-C-CH3 H2 CH₂ CH₂ H CH2CH3
4.) Name the following compounds All please!! Thank you in advance f. CH2CH3 CH2CH=CHCHCH CH2-CH 8. CH-CH2-CH-CH-C-CH-CH, CH2-CHE h. CH,CH CH CH CH CH CHCHCH_CH, ts i. CH CH.CH.CH.CECCH. CH2-CH CH3 -CH-CH2-CH-CH2-CH-CH,
1) Name the following compounds, according to IUPAC rules: (20 pts.) a) b) CH3-CH2 CEC-CH-CH2-CH-CHs d) CH3 CH-CH-CH2-CH2-CH сH, CH3 e) CH3 CH3-C C-CH2-CH-CH2- CH3 f) CH3 -CH2-CH2-CH3 CH3-CH CH-CH-CH2 g) CH3 н - c-c CH-CH2-CH2 CH3 CH3 н i) -CHз CI Hас CH3-C CH2-CH3 CI j) CH2-CH3 "CH,—сн, CH2 CH3