Can you explain the correct answer and explain why the other answers are incorrect
Homework Answers
Add Answer to:
Can you explain the correct answer and explain why the other
answers are incorrect
Q 14.11:...
Can you please explain why D is correct and other answers are incorrect? Thank you Which...
Can you please explain why D is correct and other answers are
incorrect? Thank you
Which alcohol will undergo acid-catalyzed dehydration under the mildest conditions? 56. (A) CH CH,CH,CH,OH (B) CH,CH2CH OH)CH3 (C) (CH)CHCHOH ( (CH),COH
can you give me the answer and explain why?also can you explain why A is incorrect....
can you give me the answer and explain why?also can you explain
why A is incorrect. thx
27. What statement(s) is/are correct concerning the Income Statement? The net income reported on the Income Statement usually equals the same net amount of operating cash flow for the period if the company uses the accrual basis of accounting The Income Statement must be prepared first in order to include the net income for the period when updating the retained earnings account at...
Can you please solve questions 4 and 6 and explain why they are the correct answers?...
Can you please solve questions 4 and 6 and explain why they
are the correct answers?
Thank you!
D 4 There are two epuations of sae van der Waals oquation, both shown in the table beow A sal at 273 K A student is using these two s the major factor that accounts for most of the diflerence in the two values e. Diatomic nature of shlorine a. Volume of the chlorine particles Chlorine is a halogen b. Forces of...
Can you explain the steps for me please Problem 13.50 Constants Periodic Table Part A A7.5-cm-diameter...
Can you explain the steps for me please
Problem 13.50 Constants Periodic Table Part A A7.5-cm-diameter horizontal pipe gradually narrows to 4.5 em. When water flows through this pipe at a certain rate, the auge pressure in these two sections is 33.0 kPa and 24.0 Pa, respectively What is the volume rate of flow? Express your answer using two significant figures. -4.6 Submit Previous Answers Request Answer Incorrect: Try Again: 3 attempts remaining
can you give me the answer and explain why?also can you explain why B is incorrect....
can you give me the answer and explain why?also can you explain
why B is incorrect. thx
21. Which of the following is an attribute of the corporate form of business ownership? Unlimited liability. Higher tax rates. Limited resources. Difficulty in transferring ownership. None of the choices are correct.
the answers i circled are incorrect. can you give me the correct answers and explain why?...
the answers i circled are incorrect. can you give me the
correct answers and explain why?
For each structure. (1) starany asymmetric carbon atom cture as chilor achiraland (4) label any mes structure (2) label enchan asymmetric carbon as Ros tre cabos ) label the CH3 н H- — Br OH Chiral ₂ CH₂Br oH f Br achiral @ CH Bro 24) Give the solvolysis product expected when each compound is heated in ethanol. 25) Predict the reaction product CHCH...
Fluid Mechanics. Please answer as many as you can. Short answer questions 1) Explain the physical...
Fluid Mechanics. Please answer as many as you can.
Short answer questions 1) Explain the physical meaning of the acceleration term uVu, where u is the velocity vector in a fluid. 2) Name the two equations that are required to describe the flow of an inertial jet in an incompressible, unstratified fluid. 3) What is the “Continuum Hypothesis”? 4) Describe how a viscous boundary layer adjacent to a solid surface results in transfer of momentum to/from that surface. 5) What...
can you give me the answer and explain why?also can you explain why A is incorrect....
can you give me the answer and explain why?also can you explain
why A is incorrect. thx
24. A Company recorded the following cash transactions for the year: Paid $90,000 for salaries. Paid $40,000 to purchase office equipment. Paid $10,000 for utilities. Paid $4,000 in dividends. Collected $140,000 from customers. Recorded $3,000 in depreciation expense. What was the net cash provided by operating activities? $37,000. $0. ($3,000). $50,000. None of the choices are correct.
I have the answer to all of these, so can you just explain why those are...
I have the answer to all of these, so can you just explain why
those are the correct answers?
4. Which of the following does NOT necessarily affect the theoretical effusion) speed of a gas? A. Temperature C. Molar mass D. Kinetic Energy E. Effusion speeds are always the same 5. Which of the following will constant)? ncrease the pressure the most (assume all other varilables remain pressure A. Cutting the volume to a quarter (V4) C. Tripling the temperature...
Can you explain in detail for me why the answer a) is correct? thank you so...
Can you explain in detail for
me why the answer a) is correct? thank you so much!!
10 Rank the demand curves A, B and C in the figure below in order of lowest to greatest elasticity at the quantity Q. A) ← -A, B, C. B) C) D) E) C, A, B. C, B, A They have equal elasticity at Q* More information is needed
Can you please explain why D is correct and other answers are
incorrect? Thank you
Which alcohol will undergo acid-catalyzed dehydration under the mildest conditions? 56. (A) CH CH,CH,CH,OH (B) CH,CH2CH OH)CH3 (C) (CH)CHCHOH ( (CH),COH
can you give me the answer and explain why?also can you explain
why A is incorrect. thx
27. What statement(s) is/are correct concerning the Income Statement? The net income reported on the Income Statement usually equals the same net amount of operating cash flow for the period if the company uses the accrual basis of accounting The Income Statement must be prepared first in order to include the net income for the period when updating the retained earnings account at...
Can you please solve questions 4 and 6 and explain why they
are the correct answers?
Thank you!
D 4 There are two epuations of sae van der Waals oquation, both shown in the table beow A sal at 273 K A student is using these two s the major factor that accounts for most of the diflerence in the two values e. Diatomic nature of shlorine a. Volume of the chlorine particles Chlorine is a halogen b. Forces of...
Can you explain the steps for me please
Problem 13.50 Constants Periodic Table Part A A7.5-cm-diameter horizontal pipe gradually narrows to 4.5 em. When water flows through this pipe at a certain rate, the auge pressure in these two sections is 33.0 kPa and 24.0 Pa, respectively What is the volume rate of flow? Express your answer using two significant figures. -4.6 Submit Previous Answers Request Answer Incorrect: Try Again: 3 attempts remaining
can you give me the answer and explain why?also can you explain
why B is incorrect. thx
21. Which of the following is an attribute of the corporate form of business ownership? Unlimited liability. Higher tax rates. Limited resources. Difficulty in transferring ownership. None of the choices are correct.
the answers i circled are incorrect. can you give me the
correct answers and explain why?
For each structure. (1) starany asymmetric carbon atom cture as chilor achiraland (4) label any mes structure (2) label enchan asymmetric carbon as Ros tre cabos ) label the CH3 н H- — Br OH Chiral ₂ CH₂Br oH f Br achiral @ CH Bro 24) Give the solvolysis product expected when each compound is heated in ethanol. 25) Predict the reaction product CHCH...
Fluid Mechanics. Please answer as many as you can.
Short answer questions 1) Explain the physical meaning of the acceleration term uVu, where u is the velocity vector in a fluid. 2) Name the two equations that are required to describe the flow of an inertial jet in an incompressible, unstratified fluid. 3) What is the “Continuum Hypothesis”? 4) Describe how a viscous boundary layer adjacent to a solid surface results in transfer of momentum to/from that surface. 5) What...
can you give me the answer and explain why?also can you explain
why A is incorrect. thx
24. A Company recorded the following cash transactions for the year: Paid $90,000 for salaries. Paid $40,000 to purchase office equipment. Paid $10,000 for utilities. Paid $4,000 in dividends. Collected $140,000 from customers. Recorded $3,000 in depreciation expense. What was the net cash provided by operating activities? $37,000. $0. ($3,000). $50,000. None of the choices are correct.
I have the answer to all of these, so can you just explain why
those are the correct answers?
4. Which of the following does NOT necessarily affect the theoretical effusion) speed of a gas? A. Temperature C. Molar mass D. Kinetic Energy E. Effusion speeds are always the same 5. Which of the following will constant)? ncrease the pressure the most (assume all other varilables remain pressure A. Cutting the volume to a quarter (V4) C. Tripling the temperature...
Can you explain in detail for
me why the answer a) is correct? thank you so much!!
10 Rank the demand curves A, B and C in the figure below in order of lowest to greatest elasticity at the quantity Q. A) ← -A, B, C. B) C) D) E) C, A, B. C, B, A They have equal elasticity at Q* More information is needed
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 37 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago