Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
12. (a) (20 pts) Thiosulfate, S20}", is just like sulfate, except that one oxygen atom in...
need both questions thank you 12. (a) (20 pts) Thiosulfate, S, 0%, is just like sulfate,...
need both questions thank you
12. (a) (20 pts) Thiosulfate, S, 0%, is just like sulfate, except that one oxygen atom in sulfate has been substituted by sulfur. Draw one correct Lewis structure for thiosulfate, showing all lone pairs and all formal charges, if different than zero. (b) (10 pts) Keeping in mind our stated ideas about how to optimize Lewis structures for atoms like P, S, As etc. that do not have to follow the octet rule, how many...
11. (10 pts) An electron beam, for cancer therapy, was configured by accelerating the electrons to...
11. (10 pts) An electron beam, for cancer therapy, was configured by accelerating the electrons to 1.00 x 105 ev kinetic energy. What is the de Broglie wavelength of these electrons, in meters, to three sig. figs.? 12. W/m (a) (20 pts) Thiosulfate, S203-, is just like sulfate, except that one oxygen atom in sulfate has been substituted by sulfur. Draw one correct Lewis structure for thiosulfate, showing all lone pairs and all formal charges, if different than zero. (b)...
Thiosulfate, S2O32- is just like sulfate, except that one oxygen atom in sulfate has been substituted...
Thiosulfate, S2O32- is just like sulfate, except that one oxygen atom in sulfate has been substituted by sulfur. Draw one correct Lewis structure for thiosulfate, showing all lone pairs and all formal charges, if different than zero. Keeping in mind our stated ideas about how to optimize Lewis structures for atoms like P, S, As etc. that do not have to follow the octet rule, how many total resonance structures are there for thiosulfate?
(a) (20 pts) Thiosulfate, S203-, is just like sulfate, except that one oxygen atom in sulfate...
(a) (20 pts) Thiosulfate, S203-, is just like sulfate, except that one oxygen atom in sulfate has been substituted by sulfur. Draw one correct Lewis structure for thiosulfate, showing all lone pairs and all formal charges, if different than zero.
Refer to the following molecular formulas by their letter designations A-H when answering. If none of...
Refer to the following molecular formulas by their letter
designations A-H when answering. If none of the letters designating
a structure match the criteria, write “none”. Each answer could be
one or more letters (or “none”). “Orbital geometry” refers to
central atom in AX( type.
Lucky 13. Refer to the following molecular formulas by their letter designations A-H when answering. If none of the letters designating a structure match the criteria, write "none". Each answer could be one or more...
Lucky 13. Refer to the following molecular formulas by their letter designations A-H when answering. If...
Lucky 13. Refer to the following molecular formulas by their letter designations A-H when answering. If none of the letters designating a structure match the criteria, write “none”. Each answer could be one or more letters (or “none”). “Orbital geometry” refers to central atom in AXn type. NaCl KF SF6 XeF4 SO2 SO3 BF3 NO A B C D E F G H (a) (5 pts) Which one(s) have a high melting point? (b) (5 pts) Which one(s) have octahedral...
3. (cont).(c) (10 pts) Now consider the MO diagram below, which could be used to describe...
3. (cont).(c) (10 pts) Now consider the MO diagram below, which could be used to describe the bonding. Explain whether NO+ or NO- would have a stronger bond. 2po* 2p* 2prº P. 20.P. 2p. 2p 2pr 2pm 2pc 25 25 Which one is stronger? Why? 4. Stronger bond = (d) (10 pts) What bond order would you predict for neutral NO? BO = Consider the following terms used to describe molecular structure: linear, bent, trigonal planar, trigonal pyramidal, tetrahedral, and...
3. Which is the correct electron configuration for a nitrogen atom? A) 1s22s22p B) 1s22s22pl C)...
3. Which is the correct electron configuration for a nitrogen atom? A) 1s22s22p B) 1s22s22pl C) 1s22s22p4 D) 1s22s22p3 E) [He]2s22p5 4. Which is the correct electron configuration for an oxide ion? A) 1s22s22p3 B) 1s22s22pl C) 1s22s22p6 D) 1s22s23s2 E) 1s22s22p2 5. Every orbital in a subshell is singly occupied with one electron before an doubly occupied, and all electrons in singly occupied orbitals have the sam describes A) Planck's constant B) Heisenberg Uncertainty Principle C) Pauli Exclusion Principle...
1. Use what you've learned about Lewis structures and formal charges to predict which of the...
1. Use what you've learned about Lewis structures and formal charges to predict which of the following selenium-containing molecule(s) would be least likely to exist 2 In which of the folowing molecules is the carbon-oxygen bond predicted to be longest? 3 Which of the following molecules or ions does not exhibit a tetrahedral molecular geometry 4. All of the following are see-saw except 5. Consider the following species wth tetrahedral electron-pair geometries and select the species (1) SeO (2) Seo...
please I need help with the data sheet INTRODUCTION The chemical and physical properties of substances...
please I need help with the data sheet
INTRODUCTION The chemical and physical properties of substances are influenced by the way in which valence electrons are distributed and by the three-dimensional shape of the molecule or ion. X- ray and neutron diffraction, infrared, Raman and microwave absorption spectroscopy, as well as dipole moment measurements are used to ascertain the three-dimensional structure of a substance. Thus, techniques are available which can identify the geometry of substances. Results of these measurements generally...
need both questions thank you
12. (a) (20 pts) Thiosulfate, S, 0%, is just like sulfate, except that one oxygen atom in sulfate has been substituted by sulfur. Draw one correct Lewis structure for thiosulfate, showing all lone pairs and all formal charges, if different than zero. (b) (10 pts) Keeping in mind our stated ideas about how to optimize Lewis structures for atoms like P, S, As etc. that do not have to follow the octet rule, how many...
11. (10 pts) An electron beam, for cancer therapy, was configured by accelerating the electrons to 1.00 x 105 ev kinetic energy. What is the de Broglie wavelength of these electrons, in meters, to three sig. figs.? 12. W/m (a) (20 pts) Thiosulfate, S203-, is just like sulfate, except that one oxygen atom in sulfate has been substituted by sulfur. Draw one correct Lewis structure for thiosulfate, showing all lone pairs and all formal charges, if different than zero. (b)...
(a) (20 pts) Thiosulfate, S203-, is just like sulfate, except that one oxygen atom in sulfate has been substituted by sulfur. Draw one correct Lewis structure for thiosulfate, showing all lone pairs and all formal charges, if different than zero.
Refer to the following molecular formulas by their letter
designations A-H when answering. If none of the letters designating
a structure match the criteria, write “none”. Each answer could be
one or more letters (or “none”). “Orbital geometry” refers to
central atom in AX( type.
Lucky 13. Refer to the following molecular formulas by their letter designations A-H when answering. If none of the letters designating a structure match the criteria, write "none". Each answer could be one or more...
Lucky 13. Refer to the following molecular formulas by their letter designations A-H when answering. If none of the letters designating a structure match the criteria, write “none”. Each answer could be one or more letters (or “none”). “Orbital geometry” refers to central atom in AXn type. NaCl KF SF6 XeF4 SO2 SO3 BF3 NO A B C D E F G H (a) (5 pts) Which one(s) have a high melting point? (b) (5 pts) Which one(s) have octahedral...
3. (cont).(c) (10 pts) Now consider the MO diagram below, which could be used to describe the bonding. Explain whether NO+ or NO- would have a stronger bond. 2po* 2p* 2prº P. 20.P. 2p. 2p 2pr 2pm 2pc 25 25 Which one is stronger? Why? 4. Stronger bond = (d) (10 pts) What bond order would you predict for neutral NO? BO = Consider the following terms used to describe molecular structure: linear, bent, trigonal planar, trigonal pyramidal, tetrahedral, and...
3. Which is the correct electron configuration for a nitrogen atom? A) 1s22s22p B) 1s22s22pl C) 1s22s22p4 D) 1s22s22p3 E) [He]2s22p5 4. Which is the correct electron configuration for an oxide ion? A) 1s22s22p3 B) 1s22s22pl C) 1s22s22p6 D) 1s22s23s2 E) 1s22s22p2 5. Every orbital in a subshell is singly occupied with one electron before an doubly occupied, and all electrons in singly occupied orbitals have the sam describes A) Planck's constant B) Heisenberg Uncertainty Principle C) Pauli Exclusion Principle...
1. Use what you've learned about Lewis structures and formal charges to predict which of the following selenium-containing molecule(s) would be least likely to exist 2 In which of the folowing molecules is the carbon-oxygen bond predicted to be longest? 3 Which of the following molecules or ions does not exhibit a tetrahedral molecular geometry 4. All of the following are see-saw except 5. Consider the following species wth tetrahedral electron-pair geometries and select the species (1) SeO (2) Seo...
please I need help with the data sheet
INTRODUCTION The chemical and physical properties of substances are influenced by the way in which valence electrons are distributed and by the three-dimensional shape of the molecule or ion. X- ray and neutron diffraction, infrared, Raman and microwave absorption spectroscopy, as well as dipole moment measurements are used to ascertain the three-dimensional structure of a substance. Thus, techniques are available which can identify the geometry of substances. Results of these measurements generally...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago