1. What atom has the +1 formal charge for the NO+ ion？
2.Now consider the MO diagram below, which could be used to describe the bonding. Explain whether NO+ or NO－ would have a stronger bond.
Which one is stronger? Why?
Stronger bond = _________
3. What bond order would you predict for neutral NO?
BO = __________
Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
1.
What
atom has the +1 formal charge for the NO+ ion？
2.Now consider
the MO...
3. (cont).(C) (10 pts) Now consider the MO diagram below, which could be used to describe...
3. (cont).(C) (10 pts) Now consider the MO diagram below, which could be used to describe the bonding. Explain whether Not or NO- would have a stronger bond. 2po* 2pr* 2pr* P2 2pp 2px.py 2p2 2pT 2pr 2po 2so* 2s 2s 2so Which one is stronger? Why? Stronger bond = (d) (10 pts) What bond order would you predict for neutral NO? BO =
(cont).(c) (10 pts) Now consider the MO diagram below, which could be used to describe the...
(cont).(c) (10 pts) Now consider the MO diagram below, which could be used to describe the bonding. Explain whether Not or NO would have a stronger bond. 2po 2px 2pr* 2px 2prt 2po Which one is stronger? Why? Stronger bond = (10 pts) What bond order would you predict for neutral NO? BO =
3. (cont).(c) (10 pts) Now consider the MO diagram below, which could be used to describe...
3. (cont).(c) (10 pts) Now consider the MO diagram below, which could be used to describe the bonding. Explain whether NO+ or NO- would have a stronger bond. 2po* 2p* 2prº P. 20.P. 2p. 2p 2pr 2pm 2pc 25 25 Which one is stronger? Why? 4. Stronger bond = (d) (10 pts) What bond order would you predict for neutral NO? BO = Consider the following terms used to describe molecular structure: linear, bent, trigonal planar, trigonal pyramidal, tetrahedral, and...
Which of these best descibe formal charge? Select all that apply. The charge that an atom in a molecule or ion w...
Which of these best descibe formal charge? Select all that apply. The charge that an atom in a molecule or ion would have if all atoms had the same electronegativity Can be used to help determine the most reasonable distribution of electrons in a molecule or ion The diference between the number of electrons around an atom in the free state and the number of electrons assigned to the atom in the Lewis structure an atom in a chemical compound...
Dow lewis electron-dot structures for the following compounds and calculate the formal charge on each atom....
Dow lewis electron-dot structures for the following compounds and calculate the formal charge on each atom. (15 pts) b. Brod d. XeO3 2. Predict the molecular shapes and geometries for the compounds in problem 1. (10 pts) 3. What hybrid orbitals would be used by the central atom for o-bonding in each compound in problem 1. (10 pts) 4. Consider a molecule with a formula of ABe, that has a trigonal prism geometry. Using the Dan character table, determine the...
Please add explanation if you can Q1) What is the formal charge on each atom in...
Please add explanation if you can Q1) What is the formal charge on each atom in dichloromethane, CH2Cl2? a. C atom = 0, each H atom = 0, and each Cl atom = 0 b. C atom = –2, each H atom = +1, and two Cl atoms = 0 c. C atom = +4, each H = –1, and each Cl atom = –1 d. C atom = +4, each H = +1, and each Cl atom = –1...
question 1 2 3 4 5 6 Which are correct? In molecular orbital (MO) energy level...
question 1 2 3 4 5 6
Which are correct? In molecular orbital (MO) energy level diagram for cyanide ion? The MO shows: (a) bond order = 2 (b) bonder order =3 ) cyanide ion is paramagnetic ) cyanide ion is! diamagnetic (e) HOMO is nu HOMO is og (6%) (2) Write down the diatomic molecules 2p orbitals for (a), (b), (6%) (3) What is the bond order of (a) OF(b) to which atom ( O or F ) the...
(cont).(c) describe the bonding. Explain whether NO or NO would have a stronger bond. (10 pts)...
(cont).(c) describe the bonding. Explain whether NO or NO would have a stronger bond. (10 pts) Now consider the MO diagram below, which could be used to 2pg 2px" 2pm 2px 2p 2p0 Which one is stronger? Why? (d) Stronger bond = (10 pts) What bond order would you predict for neutral NO? 4. (a) (b) BO = Consider the following terms used to describe molecular structure: linear, bent, trigonal planar, trigonal pyramidal, tetrahedral, and octahedral. For each of the...
Which charge(s) on an O2 ion would give a bond order of 2.5? (consider MO theory)...
Which charge(s) on an O2 ion would give a bond order of 2.5? (consider MO theory) O-1 O +1 O two of these 0 -2 Which of the following species has a trigonal bipyramid structure? O NH3 O IFs O none of these OPCI O 13
b) Is CO paramagnetic or diamagnetic? What is the bond order of CO? c) Draw a Lewis structure...
Draw an energy-level diagram for the valence molecular orbitals of CO. Include the relevant atomic orbitals in your diagram. Clearly label each molecular orbital (e.gs2s, p2p, etc.) and fill in the appropriate number of electrons. Use the same energy order as the neutral O2 molecule.b) Is CO paramagnetic or diamagnetic? What is the bond order of CO? c) Draw a Lewis structure for CO. Does this match the predicted bond order? d) CO can react withOH– to form the formate...
3. (cont).(C) (10 pts) Now consider the MO diagram below, which could be used to describe the bonding. Explain whether Not or NO- would have a stronger bond. 2po* 2pr* 2pr* P2 2pp 2px.py 2p2 2pT 2pr 2po 2so* 2s 2s 2so Which one is stronger? Why? Stronger bond = (d) (10 pts) What bond order would you predict for neutral NO? BO =
(cont).(c) (10 pts) Now consider the MO diagram below, which could be used to describe the bonding. Explain whether Not or NO would have a stronger bond. 2po 2px 2pr* 2px 2prt 2po Which one is stronger? Why? Stronger bond = (10 pts) What bond order would you predict for neutral NO? BO =
3. (cont).(c) (10 pts) Now consider the MO diagram below, which could be used to describe the bonding. Explain whether NO+ or NO- would have a stronger bond. 2po* 2p* 2prº P. 20.P. 2p. 2p 2pr 2pm 2pc 25 25 Which one is stronger? Why? 4. Stronger bond = (d) (10 pts) What bond order would you predict for neutral NO? BO = Consider the following terms used to describe molecular structure: linear, bent, trigonal planar, trigonal pyramidal, tetrahedral, and...
Which of these best descibe formal charge? Select all that apply. The charge that an atom in a molecule or ion would have if all atoms had the same electronegativity Can be used to help determine the most reasonable distribution of electrons in a molecule or ion The diference between the number of electrons around an atom in the free state and the number of electrons assigned to the atom in the Lewis structure an atom in a chemical compound...
Dow lewis electron-dot structures for the following compounds and calculate the formal charge on each atom. (15 pts) b. Brod d. XeO3 2. Predict the molecular shapes and geometries for the compounds in problem 1. (10 pts) 3. What hybrid orbitals would be used by the central atom for o-bonding in each compound in problem 1. (10 pts) 4. Consider a molecule with a formula of ABe, that has a trigonal prism geometry. Using the Dan character table, determine the...
question 1 2 3 4 5 6
Which are correct? In molecular orbital (MO) energy level diagram for cyanide ion? The MO shows: (a) bond order = 2 (b) bonder order =3 ) cyanide ion is paramagnetic ) cyanide ion is! diamagnetic (e) HOMO is nu HOMO is og (6%) (2) Write down the diatomic molecules 2p orbitals for (a), (b), (6%) (3) What is the bond order of (a) OF(b) to which atom ( O or F ) the...
(cont).(c) describe the bonding. Explain whether NO or NO would have a stronger bond. (10 pts) Now consider the MO diagram below, which could be used to 2pg 2px" 2pm 2px 2p 2p0 Which one is stronger? Why? (d) Stronger bond = (10 pts) What bond order would you predict for neutral NO? 4. (a) (b) BO = Consider the following terms used to describe molecular structure: linear, bent, trigonal planar, trigonal pyramidal, tetrahedral, and octahedral. For each of the...
Which charge(s) on an O2 ion would give a bond order of 2.5? (consider MO theory) O-1 O +1 O two of these 0 -2 Which of the following species has a trigonal bipyramid structure? O NH3 O IFs O none of these OPCI O 13
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago