If a reduction potential was measured at 0.345 V relative to a saturated silver/silver chloride electrode,...
If a reduction potential was measured at 0.345 V relative to a saturated silver/silver chloride electrode, what is the potential relative to the Saturated Calomel Electrode? (Please show work)
Homework Answers
Reduction Potential: The tendency of electrode in a cell (electrolytic or electrochemical) to act as a cathode or an anode is governed by its capability to favour reduction and oxidation respectively. Potential difference across such electrodes is known as electrode potential.
The reduction potential value of saturated silver-silver chloride electrode against standard hydrogen electrode is 0.230 V.
The reduction potential value of saturated calomel electrode against standard hydrogen electrode is 0.244 V.
Therefore, reduction potential value of saturatedcalomel electrode with respect to saturated silver-silver chloride electrode is (0.244-0.230) V = 0.014 V.
Given value of reduction potential value against saturated silver-silver chloride electrode is 0.345 V.
Reduction potential relative to saturated calomel electrode is (0.345 + 0.014) = 0.359 V.
Therefore, the calculated value of reduction potential relative to saturated calomel electrode is 0.359 V.
Add Answer to:
If a reduction potential was measured at 0.345 V relative to a
saturated silver/silver chloride electrode,...
Write the half-reaction for the silver-silver chloride reference electrode. Include physical stat...
Write the half-reaction for the silver-silver chloride reference electrode. Include physical states. half-reaction: - Write the half-reaction for the saturated calomel reference electrode. Include physical states half-reaction: What is the potential of the cell silver-silver chloride electrode || saturated calomel electrode given that the potential for the AglAgCI electrode in a saturated KCl solution is +0.197 V and the potential for a saturated calomel electrode is +0.241 V?
Write the half-reaction for the silver-silver chloride reference electrode. Include physical states....
Convert each of the potentials. The silver-silver chloride and calomel reference electrodes are saturated with KCl,...
Convert each of the potentials. The silver-silver chloride and calomel reference electrodes are saturated with KCl, resulting in cell potentials of +0.197 V and +0.241 V with respect to the standard hydrogen electrode (S.H.E.), respectively If an electrode has a potential of 0.695 V with respect to a standard hydrogen electrode (S.H.E.), what is the potential with respect to a silver-silver chloride electrode? E= V If an electrode has a potential of-0.131 V with respect to a silver-silver chloride electrode,...
1. Write the half‑reaction for the silver-silver chloride reference electrode. Include physical states. 2. Write the...
1. Write the half‑reaction for the silver-silver chloride reference electrode. Include physical states. 2. Write the half‑reaction for the saturated calomel reference electrode. Include physical states. 3. What is the potential of the cell: silver–silver chloride electrode || saturated calomel electrode given that the potential for the Ag∣∣AgCl electrode in a saturated KCl solution is +0.197 V and the potential for a saturated calomel electrode is +0.241 V?
Convert each of the potentials. The silver-silver chloride and calomel reference electrodes are saturated with KCl,...
Convert each of the potentials. The silver-silver chloride and calomel reference electrodes are saturated with KCl, resulting in cell potentials of +0.197 V and +0.241 V with respect to the standard hydrogen electrode (S.H.E.), respectively. If an electrode has a potential of 0.496 V with respect to a standard hydrogen electrode (S.H.E.), what is the potential with respect to a silver–silver chloride electrode? If an electrode has a potential of −0.147 V with respect to a silver–silver chloride electrode, what...
Convert each of the potentials. The silver–silver chloride and calomel reference electrodes are saturated with KCl,...
Convert each of the potentials. The silver–silver chloride and calomel reference electrodes are saturated with KCl, resulting in cell potentials of +0.197 V and +0.241 V with respect to the standard hydrogen electrode (S.H.E.), respectively. If an electrode has a potential of 0.686 V with respect to a standard hydrogen electrode (S.H.E.), what is the potential with respect to a silver–silver chloride electrode? E= If an electrode has a potential of −0.118 V with respect to a silver–silver chloride electrode,...
Write the half-reaction for the silver-silver chloride reference electrode. Include physical states. half-reaction: Write the half-reaction...
Write the half-reaction for the silver-silver chloride reference electrode. Include physical states. half-reaction: Write the half-reaction for the saturated calomel reference electrode. Include physical states. half-reaction: What is the potential of the cell silver-silver chloride electrode || saturated calomel electrode given that the potential for the Ag AgCl electrode in a saturated KCl solution is +0.197 V and the potential for a saturated calomel electrode is +0.241 V? E=
Convert the following voltages Assume the silver-siIver chloride and calomel reference electrodes are saturated with KCl,...
Convert the following voltages Assume the silver-siIver chloride and calomel reference electrodes are saturated with KCl, giving cell potentials of +0.197 V and +0 241 respective y If an electrode has a potential of 0.337 V with respect to a standard hydrogen electrode (S H E ), what is the potential with respect to a silver-silver chloride electrode? If an electrode has a potential of -0 088 V with respect to a silver-silver chloride electrode, what is the potential with...
The given potentials are observed for a calomel electrode: E° = 0.268 V and E (saturated...
The given potentials are observed for a calomel electrode: E° = 0.268 V and E (saturated KCI) = 0.241 V. Use this information to predict the value of E for a silver-silver chloride electrode saturated with KCl. For the silver-silver chloride electrode, E* = 0.222 V. E =
1A. A voltage of 2.35 V was measured using a Ag/AgCl reference electrode with saturated KCl....
1A. A voltage of 2.35 V was measured using a Ag/AgCl reference electrode with saturated KCl. What would this potential be if it were measured using a standard hydrogen electrode? 1B. What would the potential be if it were measured using a saturated calomel electrode? 2. At 25o C for an "ideal" pH electrode, what is the change in voltage between a pH 2.00 solution and a pH 7.00 solution? Place your answer in units of mV.
The potential of a silver electrode is measured relative to an Ag-AgCl electrode for the titration of 100.0 mL of 0.100 M Cl- with 0.100 M Ag+. What is the potential after 75.00 mL of titrant is added...
The potential of a silver electrode is measured relative to an Ag-AgCl electrode for the titration of 100.0 mL of 0.100 M Cl- with 0.100 M Ag+. What is the potential after 75.00 mL of titrant is added. Eo = 0.799 V for Ag+, E = 0.197 V for the Ag-AgCl electrode and Ksp = 1.8 × 10−10. A) 0.493 V B) 1.070 V C) 0.521 V D) 1.267 V E) 0.134 V Answer is E, can someone show me...
Write the half-reaction for the silver-silver chloride reference electrode. Include physical states. half-reaction: - Write the half-reaction for the saturated calomel reference electrode. Include physical states half-reaction: What is the potential of the cell silver-silver chloride electrode || saturated calomel electrode given that the potential for the AglAgCI electrode in a saturated KCl solution is +0.197 V and the potential for a saturated calomel electrode is +0.241 V?
Write the half-reaction for the silver-silver chloride reference electrode. Include physical states....
Convert each of the potentials. The silver-silver chloride and calomel reference electrodes are saturated with KCl, resulting in cell potentials of +0.197 V and +0.241 V with respect to the standard hydrogen electrode (S.H.E.), respectively If an electrode has a potential of 0.695 V with respect to a standard hydrogen electrode (S.H.E.), what is the potential with respect to a silver-silver chloride electrode? E= V If an electrode has a potential of-0.131 V with respect to a silver-silver chloride electrode,...
Write the half-reaction for the silver-silver chloride reference electrode. Include physical states. half-reaction: Write the half-reaction for the saturated calomel reference electrode. Include physical states. half-reaction: What is the potential of the cell silver-silver chloride electrode || saturated calomel electrode given that the potential for the Ag AgCl electrode in a saturated KCl solution is +0.197 V and the potential for a saturated calomel electrode is +0.241 V? E=
Convert the following voltages Assume the silver-siIver chloride and calomel reference electrodes are saturated with KCl, giving cell potentials of +0.197 V and +0 241 respective y If an electrode has a potential of 0.337 V with respect to a standard hydrogen electrode (S H E ), what is the potential with respect to a silver-silver chloride electrode? If an electrode has a potential of -0 088 V with respect to a silver-silver chloride electrode, what is the potential with...
The given potentials are observed for a calomel electrode: E° = 0.268 V and E (saturated KCI) = 0.241 V. Use this information to predict the value of E for a silver-silver chloride electrode saturated with KCl. For the silver-silver chloride electrode, E* = 0.222 V. E =
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 9 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 59 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago