Homework Answers
16.
Reaction of Acid and Base to form salt and water is called Neutralization reaction.
Salt and water formed as a product in option B only.
So correct option :- B
17)
Weak acid + Conjugated base formes buffer.
HF + NaF formed buffer.
18)
Saturated hydrocarbon consists of single bond only.
Unsaturated hydrocarbon consist of single as well as double bonds.
19)
Given structure have 7 carbon long chain
So it is heptane
20)
Same molecular formula but different arrangements are called isomers.
Add Answer to:
(16) 16. Which of the following is a neutralization reaction? (A) KCl (ag) + NaNO3(ag) -...
A) H20 c) нсоз- E) H2CO3 DOH. 22) Which of the following statements correctly describes the...
A) H20 c) нсоз- E) H2CO3 DOH. 22) Which of the following statements correctly describes the hydronium-hydroxide balance in the given solution? A) In acids, [OH-] is greater than [H3O* B) In bases, [OH-]- [H3o*]. C) In neutral solutions, [H3O"] = [H20]. D) In bases, [OH-] is greater than [H3o*]. E) In bases, [OH-] is less than [H30*]. 23) Which of the following is a buffer system? A) NaCl(aq) and NaNO3(aq) C) H2CO3(aq) and KHCO3 (aq) E) H20(0) and HCl(aq)...
9. Identify the Brønsted-Lowry acid in the following reaction. H20(1) + CO32- (aq) + HCO3 (aq)...
9. Identify the Brønsted-Lowry acid in the following reaction. H20(1) + CO32- (aq) + HCO3 (aq) + OH-(aq) 10. The [H3O+] of a solution with pH = 8.7 is 11. Which of the following is a neutralization reaction? A) KCl (aq) + NaNO3(aq) → KNO3(aq) + NaCl(aq) B) HNO3(aq) + KOH(aq) → H20 (1) + KNO3(aq) C) H20(1) + SO3(g) → H2SO4 (aq) D) 4Na(s) + O2(g) → 2Na2O(s) E) 2NO2(g) → 2NO(g) + O2(g)
11. The reaction of butane with oxygen is called (21.) (A) substitution (B) combustion (C) neutralization...
11. The reaction of butane with oxygen is called (21.) (A) substitution (B) combustion (C) neutralization (D) addition (E) titration 22. Organic compounds with carbon-carbon double or triple bonds are classified (22) (A) unsaturated compounds (B) saturated compounds (C) dilute solutions (D) concentrated solutions (E) substituted compounds as 23. Which of the following compounds is an alkene? (23.) (A) CH3-CH2-CH3 (B) C3H8 (C) CH3 -CH2-C=CH (D) H2C-CH-CH3 (E) cyclopentane 24. The reaction of an alkene and water in the presence...
19. Which of the following are redox reactions? For those that are, identify the oxidizing agent...
19. Which of the following are redox reactions? For those that are, identify the oxidizing agent and the reducing agent: A. Sn²+ (aq) + Br+ (aq) Sn4+(aq) + 2 Br(aq) B. 2 F2 (g) + 2 H20 (1) ► 4 HF (aq) + O2 (8) C. NaHCO3 (aq) + HCl (aq) → NaCl (aq) + CO2 (g) + H20 (1)
16) Write a balanced net ionic equation for the reaction of H2SO4iag) with Ba(OH)2(g) A) Ba2+(ag)...
16) Write a balanced net ionic equation for the reaction of H2SO4iag) with Ba(OH)2(g) A) Ba2+(ag) + SO42-(a)- BaSO4) B) 2 H+(aq) SO42-(a) Ba2 (ag) +2 OH-(a)-BaSO4(0 2 H20) C) H2SO4(a) + Ba(OH)2(e) - BaSO40) 2 H20() D) H (ag) OH(ag)--H2O) 16) 17) Write a balanced net ionic equation for the reaction of Pb(NO3)2(ag) with Nal(ag). A) Pb2 (ag)+2 NO3-(4g) +2 Na+ (ag) +2 1-(a4)-- Pb2+(ag)+ 2 1-(a4)+ 2 Na (a) +2 NO3-(a) B) Pb2+(ag) 2 NO3-(a) + 2 Na...
1. Determine if each of the following reactions is a redox reaction, or is not a...
1. Determine if each of the following reactions is a redox reaction, or is not a redox reaction. a. C4H8 (g) + O2 + H20 (g) + CO2 (g) b. HCl (aq) + NaOH (aq) → H20 (1) + NaCl (aq) c. Fe2O3 + H2 → Fe + H2O d. Cu (s) + HNO3 (aq) → Cu(NO3)2 (aq) + NO2 (g) + H20 (1) e. CzHe(g) + 5 O2 (g) → 3 CO2 (g) + 4 H20 (g)
10) 16) Cis-platin is a chlorine-containing chemotherapy agent with the formula Pt(NH3)2Cl2. What is the mass...
10) 16) Cis-platin is a chlorine-containing chemotherapy agent with the formula Pt(NH3)2Cl2. What is the mass of one mole of cis-platin? A) 488.91 g/mol B) 300.06 g/mol C) 492.37 g/mol D) 283.02 g/mol E) 286.05 g/mol 17) 17) The chemical equation below is not balanced. What is the coefficient of iron when the equation is balanced with smallest whole number coefficients? Fe(s) + O2(8) - Fe2O3(3) A) 8 B) 2 E) 4 D) 1 C) 3 18) 18) When solutions...
6 Which of the following chemical equations is an example of an acid-base reaction? ed Select...
6 Which of the following chemical equations is an example of an acid-base reaction? ed Select one: a. 2 HCl (aq) +Po(NO)2 (aq) PbC2 (s)+2 HNOs (aq) b. HF (aq) NH3 (ag) NH&F (aq) c. 2 HCl (aq) + Zn (s) → H2 (g) + ZnCl2 (aq) d. Ba(OH)2 (aa) + K2S04 (aq) → Baso, (s) + 2 KOH (aq) e. 3 NaOH (aq) + AIClg (aa)-Al(OH)3 (s) + 3 NaCl (aq) out of ag ion
a Choose the balanced equation for the following half-reaction, which takes place in acidic solution НВFO,(ag)...
a Choose the balanced equation for the following half-reaction, which takes place in acidic solution НВFO,(ag) —> Вr (aq) 4 8e7H (aq) + HBr04 (aq) -> Br (aq) + 4H20(1) 8e H (aq)HBrO4 (aq) -> Br (aq)4H20() Se + 7H* (ag) + HBFO, (ag) — 2Br (аq) + 4H20() Зе + 7H* (ад) + HBFO4(ag) — Br (aq) + 4H20() b Choose the balanced equation for the following half-reaction, which takes place in acidic solution NO3 (ag) > NО2(9) 3e2H...
CH,OH)02 [CO2]2(H20] c. Qc 19. A is a proton donor. a. Bronsted Base b. Bronsted Acid...
CH,OH)02 [CO2]2(H20] c. Qc 19. A is a proton donor. a. Bronsted Base b. Bronsted Acid c. Conjugate base d. Polymor 20. In order for a substance to act as a Bronst a. at least one double bond. b. at least one H* to donate. C. at least one single bond. d. at least one lone pair of electrons. 16. The Gibhbs energy for the reaction beiow is CH ( 50(p-3C0p-4no a. 0 b. -2108 kJmol c. -608.1 kmol d....
A) H20 c) нсоз- E) H2CO3 DOH. 22) Which of the following statements correctly describes the hydronium-hydroxide balance in the given solution? A) In acids, [OH-] is greater than [H3O* B) In bases, [OH-]- [H3o*]. C) In neutral solutions, [H3O"] = [H20]. D) In bases, [OH-] is greater than [H3o*]. E) In bases, [OH-] is less than [H30*]. 23) Which of the following is a buffer system? A) NaCl(aq) and NaNO3(aq) C) H2CO3(aq) and KHCO3 (aq) E) H20(0) and HCl(aq)...
9. Identify the Brønsted-Lowry acid in the following reaction. H20(1) + CO32- (aq) + HCO3 (aq) + OH-(aq) 10. The [H3O+] of a solution with pH = 8.7 is 11. Which of the following is a neutralization reaction? A) KCl (aq) + NaNO3(aq) → KNO3(aq) + NaCl(aq) B) HNO3(aq) + KOH(aq) → H20 (1) + KNO3(aq) C) H20(1) + SO3(g) → H2SO4 (aq) D) 4Na(s) + O2(g) → 2Na2O(s) E) 2NO2(g) → 2NO(g) + O2(g)
11. The reaction of butane with oxygen is called (21.) (A) substitution (B) combustion (C) neutralization (D) addition (E) titration 22. Organic compounds with carbon-carbon double or triple bonds are classified (22) (A) unsaturated compounds (B) saturated compounds (C) dilute solutions (D) concentrated solutions (E) substituted compounds as 23. Which of the following compounds is an alkene? (23.) (A) CH3-CH2-CH3 (B) C3H8 (C) CH3 -CH2-C=CH (D) H2C-CH-CH3 (E) cyclopentane 24. The reaction of an alkene and water in the presence...
19. Which of the following are redox reactions? For those that are, identify the oxidizing agent and the reducing agent: A. Sn²+ (aq) + Br+ (aq) Sn4+(aq) + 2 Br(aq) B. 2 F2 (g) + 2 H20 (1) ► 4 HF (aq) + O2 (8) C. NaHCO3 (aq) + HCl (aq) → NaCl (aq) + CO2 (g) + H20 (1)
16) Write a balanced net ionic equation for the reaction of H2SO4iag) with Ba(OH)2(g) A) Ba2+(ag) + SO42-(a)- BaSO4) B) 2 H+(aq) SO42-(a) Ba2 (ag) +2 OH-(a)-BaSO4(0 2 H20) C) H2SO4(a) + Ba(OH)2(e) - BaSO40) 2 H20() D) H (ag) OH(ag)--H2O) 16) 17) Write a balanced net ionic equation for the reaction of Pb(NO3)2(ag) with Nal(ag). A) Pb2 (ag)+2 NO3-(4g) +2 Na+ (ag) +2 1-(a4)-- Pb2+(ag)+ 2 1-(a4)+ 2 Na (a) +2 NO3-(a) B) Pb2+(ag) 2 NO3-(a) + 2 Na...
1. Determine if each of the following reactions is a redox reaction, or is not a redox reaction. a. C4H8 (g) + O2 + H20 (g) + CO2 (g) b. HCl (aq) + NaOH (aq) → H20 (1) + NaCl (aq) c. Fe2O3 + H2 → Fe + H2O d. Cu (s) + HNO3 (aq) → Cu(NO3)2 (aq) + NO2 (g) + H20 (1) e. CzHe(g) + 5 O2 (g) → 3 CO2 (g) + 4 H20 (g)
10) 16) Cis-platin is a chlorine-containing chemotherapy agent with the formula Pt(NH3)2Cl2. What is the mass of one mole of cis-platin? A) 488.91 g/mol B) 300.06 g/mol C) 492.37 g/mol D) 283.02 g/mol E) 286.05 g/mol 17) 17) The chemical equation below is not balanced. What is the coefficient of iron when the equation is balanced with smallest whole number coefficients? Fe(s) + O2(8) - Fe2O3(3) A) 8 B) 2 E) 4 D) 1 C) 3 18) 18) When solutions...
6 Which of the following chemical equations is an example of an acid-base reaction? ed Select one: a. 2 HCl (aq) +Po(NO)2 (aq) PbC2 (s)+2 HNOs (aq) b. HF (aq) NH3 (ag) NH&F (aq) c. 2 HCl (aq) + Zn (s) → H2 (g) + ZnCl2 (aq) d. Ba(OH)2 (aa) + K2S04 (aq) → Baso, (s) + 2 KOH (aq) e. 3 NaOH (aq) + AIClg (aa)-Al(OH)3 (s) + 3 NaCl (aq) out of ag ion
a Choose the balanced equation for the following half-reaction, which takes place in acidic solution НВFO,(ag) —> Вr (aq) 4 8e7H (aq) + HBr04 (aq) -> Br (aq) + 4H20(1) 8e H (aq)HBrO4 (aq) -> Br (aq)4H20() Se + 7H* (ag) + HBFO, (ag) — 2Br (аq) + 4H20() Зе + 7H* (ад) + HBFO4(ag) — Br (aq) + 4H20() b Choose the balanced equation for the following half-reaction, which takes place in acidic solution NO3 (ag) > NО2(9) 3e2H...
CH,OH)02 [CO2]2(H20] c. Qc 19. A is a proton donor. a. Bronsted Base b. Bronsted Acid c. Conjugate base d. Polymor 20. In order for a substance to act as a Bronst a. at least one double bond. b. at least one H* to donate. C. at least one single bond. d. at least one lone pair of electrons. 16. The Gibhbs energy for the reaction beiow is CH ( 50(p-3C0p-4no a. 0 b. -2108 kJmol c. -608.1 kmol d....
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 minute ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 50 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago