Homework Answers
The Left one is the structure of 2-pentyne. I've drawn it to show you that 3-nitro-2-pentyne can't exist, as you can see that Substitution at 2 and 3 Position is impossible.
Hence, the Question is wrong. However, the Compound 3-nitro-2-pentene is possible, and I've drawn the structure of this Compound, on the Right Side.
Show how you would prepare compounds B-D starting with 1-pentyne.
Show how you would prepare compounds B-D starting with 1-pentyne.
5) The IUPAC name for CH3-CH2-C = C-CH3 is A) 3-pentyne B) 2-pentyne C) pentyne D)...
5) The IUPAC name for CH3-CH2-C = C-CH3 is A) 3-pentyne B) 2-pentyne C) pentyne D) 1-methylbutyne. 6) What is the name of the compound shown below? H CHCH CEC H3CH A) 2-pentene B) trans-2-pentene C) trans-3-pentene D) cis-2-pentene 9) What is the name of the compound below? CH3 ΟΙ A) 1-chlorotoluene C) 3-chlorotoluene B) 2-chlorotoluene D) 4-chlorotoluene 17) What is the product when this compound undergoes oxidation? CH3 CH3 -C- CH2 - CH2-OH CH3 A) hexanal B) 2,2-dimethylbutanal C)...
Draw the structural formula for 3-ethyl-3-methyl-1-pentyne.
Draw the structural formula for 3-ethyl-3-methyl-1-pentyne. Click the "draw structure" button to launch the drawing utility.
Draw the structure of the following compounds (2 pts ca.) 5. 2-pentyne 72,5-diethyl-3-octyne 6. 3-ethyl-4,6-dimethyl-1-heptyne 8....
Draw the structure of the following compounds (2 pts ca.) 5. 2-pentyne 72,5-diethyl-3-octyne 6. 3-ethyl-4,6-dimethyl-1-heptyne 8. 3.4.4-trimethyl-1-pentyne
If you were to react p-nitro-phenol with bromine, you major product would be: O p-bromo,p-nitro-phenol Om-bromo,...
If you were to react p-nitro-phenol with bromine, you major product would be: p-bromo,p-nitro-phenol m-bromo, p-nitro-phenol o-bromo, p-nitro-phenol reaction would not occur due to steric hindrance
draw structures for the following compounds 1. 3-hexene 2. 2-pentyne 3. trans-3-hexene 4. cyclobutane 5. 3-ethyl-1-methylcyclohexene
draw structures for the following compounds 1. 3-hexene 2. 2-pentyne 3. trans-3-hexene 4. cyclobutane 5. 3-ethyl-1-methylcyclohexene
_________________________________________________________________________________________________________________________________ d. Prepare octane from 1-pentyne, indicate each needed reagents. e. Synthesize cis-2-hexene from 1-pentyne and...
_________________________________________________________________________________________________________________________________
d. Prepare octane from 1-pentyne, indicate each needed
reagents.
e. Synthesize cis-2-hexene from 1-pentyne and an alkyl
halide.
f. Synthesize trans-2-hexene from 1-pentyne and an alkyl
halide.
Synthesize each compound from acetylene. You may use any other organic or inorganic reagents. a.
26) Give the IUPAC name for the following compound. A) S-4-bromo-1-pentyne C) R-3-bromo-5-pentyne B) R-4-bromo-1-pentyne D)...
26) Give the IUPAC name for the following compound. A) S-4-bromo-1-pentyne C) R-3-bromo-5-pentyne B) R-4-bromo-1-pentyne D) S-3-bromo-5-pentyne 27) What is the major product of the following reaction? 1. BH, 2. H,O, HO A) I B) II C) III D) IV 28) What is the correct classification of the following reaction? Lot OH A) Oxidation reaction C) Substitution reaction B) Elimination reaction D) Reduction reaction 29) Which of the following classes of organic compounds cannot undergo reduction ea. B) Alkenes
Draw the product of the reaction between 1-pentyne and Li in liquid NH3, then H30*. You...
Draw the product of the reaction between 1-pentyne and Li in liquid NH3, then H30*. You do not have to consider stereochemistry • You do not have to explicitly draw H atoms.
Draw the product of the reaction between 1-pentyne and Li in liquid NH3, then H30*. You...
Draw the product of the reaction between 1-pentyne and Li in liquid NH3, then H30*. You do not have to consider stereochemistry • You do not have to explicitly draw H atoms.
Show how you would prepare compounds B-D starting with 1-pentyne.
5) The IUPAC name for CH3-CH2-C = C-CH3 is A) 3-pentyne B) 2-pentyne C) pentyne D) 1-methylbutyne. 6) What is the name of the compound shown below? H CHCH CEC H3CH A) 2-pentene B) trans-2-pentene C) trans-3-pentene D) cis-2-pentene 9) What is the name of the compound below? CH3 ΟΙ A) 1-chlorotoluene C) 3-chlorotoluene B) 2-chlorotoluene D) 4-chlorotoluene 17) What is the product when this compound undergoes oxidation? CH3 CH3 -C- CH2 - CH2-OH CH3 A) hexanal B) 2,2-dimethylbutanal C)...
Draw the structure of the following compounds (2 pts ca.) 5. 2-pentyne 72,5-diethyl-3-octyne 6. 3-ethyl-4,6-dimethyl-1-heptyne 8. 3.4.4-trimethyl-1-pentyne
If you were to react p-nitro-phenol with bromine, you major product would be: p-bromo,p-nitro-phenol m-bromo, p-nitro-phenol o-bromo, p-nitro-phenol reaction would not occur due to steric hindrance
_________________________________________________________________________________________________________________________________
d. Prepare octane from 1-pentyne, indicate each needed
reagents.
e. Synthesize cis-2-hexene from 1-pentyne and an alkyl
halide.
f. Synthesize trans-2-hexene from 1-pentyne and an alkyl
halide.
Synthesize each compound from acetylene. You may use any other organic or inorganic reagents. a.
26) Give the IUPAC name for the following compound. A) S-4-bromo-1-pentyne C) R-3-bromo-5-pentyne B) R-4-bromo-1-pentyne D) S-3-bromo-5-pentyne 27) What is the major product of the following reaction? 1. BH, 2. H,O, HO A) I B) II C) III D) IV 28) What is the correct classification of the following reaction? Lot OH A) Oxidation reaction C) Substitution reaction B) Elimination reaction D) Reduction reaction 29) Which of the following classes of organic compounds cannot undergo reduction ea. B) Alkenes
Draw the product of the reaction between 1-pentyne and Li in liquid NH3, then H30*. You do not have to consider stereochemistry • You do not have to explicitly draw H atoms.
Draw the product of the reaction between 1-pentyne and Li in liquid NH3, then H30*. You do not have to consider stereochemistry • You do not have to explicitly draw H atoms.
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago