Determine the [H30+] for a solution that has a pH of 7.45. A solution contains [OH-]...
Determine the [H30+] for a solution that has a pH of 7.45.
A solution contains [OH-] = 4.88 x 10-6 M. What is the pH of the solution?
20. Write down the name, molecular formula, condensed structural formula as well as a line-angel structural formula for an alkene that contain SIX carbons and a double bond between carbon 3 and 4
Homework Answers
![7.45 = U PH - log [H3ot] [ 42 ot] antilog (-7.45] = 3.54x100 m ₂ [Ort] = 4.88x10fm [H₂ot 1x1014 0.20x108 -6 4.88810 7 2.0xlö](http://img.homeworklib.com/questions/3d415600-0b37-11eb-a6c9-5b9848abaaf0.png?x-oss-process=image/resize,w_560)
Add Answer to:
Determine the [H30+] for a solution that has a pH of 7.45.
A solution contains [OH-]...
Write down the name of the following molecule: (submit your answer via a link on the blackboard)
Write down the name of the following molecule: (submit your answer via a link on the blackboard) Write down the IUPAC name for the following 2 compounds: (submit your answer via a link on blackboard) Determine the [H3O+] for a solution that has a pH of 7.45. A solution contains [OH-] = 4.88 x 10-6 M. What is the pH of the solution? 20. Write down the name, molecular formula, condensed structural formula as well as a line- angel structural formula for an alkene...
Write down the name, molecular formula, condensed structural formula as well as a line-angel structural formula...
Write down the name, molecular formula, condensed structural
formula as well as a line-angel structural formula for an alkene
that contain SIX carbons and a double bond between carbon 3 and
4
Question 10 A solution contains [OH-] = 4.88 x 10-6 M. What is the pH of the solution? (su Question 13 Assign the correct labels to the following (1) reactant and (II) product. (SELECT TWO OPTIONS) Donates Ht Conjugated acid 0 Base Acid Conjugated base Question 15 Which...
Determine the [H30+]for a solution that has a pH of 7.45.
Determine the [H30+]for a solution that has a pH of 7.45. Write down the name of the following molecule (submit your answer via a link on the blackboard)
QUESTION 30 In a solution that has a pH = 7.0: [H3O+] = [OH) [H30+1 <[OH]...
QUESTION 30 In a solution that has a pH = 7.0: [H3O+] = [OH) [H30+1 <[OH] [H30+] > [OH) [H30+1 + [OH] = Kw none of the above
A solution contains (OH) = 4.88 x 10-6 M. What is the pH of the solution?...
A solution contains (OH) = 4.88 x 10-6 M. What is the pH of the solution? answer via a link on blackboard)
Calculating pH, POH, (OH) and (H30*] 2) A solution of HC2H302 has a concentration of 0.00045...
Calculating pH, POH, (OH) and (H30*] 2) A solution of HC2H302 has a concentration of 0.00045 M H what is the pH of the solution? (show your work). PH 3) If a solution has a concentration of 1.23x10-6 MH* what is the concentration of OH? (show your work). (OH) 4) An unknown solution of HNO3 (aq) has a pH of 2.96. What is the concentration of H* (aq) in solution? (show your work). 5) A solution is 0.000037 M in...
please help!! thank you Calculating pH, POH, (OH) and (H30*] 2) A solution of HC2H2O2 has...
please help!! thank you
Calculating pH, POH, (OH) and (H30*] 2) A solution of HC2H2O2 has a concentration of 0.00045 M H what is the pH of the solution? (show your work). PH 3) If a solution has a concentration of 1.23x106 MH* what is the concentration of OH? (show your work). (OH) 4) An unknown solution of HNO3(aq) has a pH of 2.96. What is the concentration of H* (aq) in solution? (show your work). [H30*)
Calculating pH, POH, (OH) and (H30*] 2) A solution of HC2H2O2 has a concentration of 0.00045...
Calculating pH, POH, (OH) and (H30*] 2) A solution of HC2H2O2 has a concentration of 0.00045 MH* what is the pH of the solution? (show your work). -log[H! Tog 10,00045m 3.35 PH
Calculating pH, POH, (OH) and (H30*] 2) A solution of HC2H302 has a concentration of 0.00045...
Calculating pH, POH, (OH) and (H30*] 2) A solution of HC2H302 has a concentration of 0.00045 M H what is the pH of the solution? (show your work). pH 3) If a solution has a concentration of 1.23x106 M H what is the concentration of OH? (show your work). rolul brenovadonismo loob [OH-] vor of 4) An unknown solution of HNO3(aq) has a pH of 2.96. What is the concentration of H (aq) in solution? (show your work). [H3O*) 9
Using line structure, draw a hydrocarbon molecule that has: at least 5 carbons in the parent...
Using line structure, draw a hydrocarbon molecule that has: at least 5 carbons in the parent chain at least 1 carbon-carbon multiple bond at least 2 branches Write the correct molecular formula for your molecule (CxHy). Write the correct name for your molecule.
Write down the name, molecular formula, condensed structural
formula as well as a line-angel structural formula for an alkene
that contain SIX carbons and a double bond between carbon 3 and
4
Question 10 A solution contains [OH-] = 4.88 x 10-6 M. What is the pH of the solution? (su Question 13 Assign the correct labels to the following (1) reactant and (II) product. (SELECT TWO OPTIONS) Donates Ht Conjugated acid 0 Base Acid Conjugated base Question 15 Which...
QUESTION 30 In a solution that has a pH = 7.0: [H3O+] = [OH) [H30+1 <[OH] [H30+] > [OH) [H30+1 + [OH] = Kw none of the above
A solution contains (OH) = 4.88 x 10-6 M. What is the pH of the solution? answer via a link on blackboard)
Calculating pH, POH, (OH) and (H30*] 2) A solution of HC2H302 has a concentration of 0.00045 M H what is the pH of the solution? (show your work). PH 3) If a solution has a concentration of 1.23x10-6 MH* what is the concentration of OH? (show your work). (OH) 4) An unknown solution of HNO3 (aq) has a pH of 2.96. What is the concentration of H* (aq) in solution? (show your work). 5) A solution is 0.000037 M in...
please help!! thank you
Calculating pH, POH, (OH) and (H30*] 2) A solution of HC2H2O2 has a concentration of 0.00045 M H what is the pH of the solution? (show your work). PH 3) If a solution has a concentration of 1.23x106 MH* what is the concentration of OH? (show your work). (OH) 4) An unknown solution of HNO3(aq) has a pH of 2.96. What is the concentration of H* (aq) in solution? (show your work). [H30*)
Calculating pH, POH, (OH) and (H30*] 2) A solution of HC2H2O2 has a concentration of 0.00045 MH* what is the pH of the solution? (show your work). -log[H! Tog 10,00045m 3.35 PH
Calculating pH, POH, (OH) and (H30*] 2) A solution of HC2H302 has a concentration of 0.00045 M H what is the pH of the solution? (show your work). pH 3) If a solution has a concentration of 1.23x106 M H what is the concentration of OH? (show your work). rolul brenovadonismo loob [OH-] vor of 4) An unknown solution of HNO3(aq) has a pH of 2.96. What is the concentration of H (aq) in solution? (show your work). [H3O*) 9
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 3 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 34 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago