Homework Answers
SOLUTION OF YOUR QUESTION IS IN IMAGE
If you want to discuss anything about this question then please comment, it will be my pleasure
Add Answer to:
what is the difference between these melting points?
The melting point of diamond, C. is >...
calculate the melting point in Celsius of a solution that is 4.37% benzene (C6H6 molar mass...
calculate the melting point in Celsius of a solution that is 4.37% benzene (C6H6 molar mass 78.108 g/mol) by mass in carbon tetrachloride. the normal melting point of CCl4 is -22.9 Celsius and Kf= 29.9 C/m thank you!
(c ) Explain the difference between the 227°C melting point of tin(ll) chloride and the -33°C...
(c ) Explain the difference between the 227°C melting point of tin(ll) chloride and the -33°C melting point of tin(IV)chloride. The 2270 melting point or tin I chlorid I means that it has a strunger Tonic bord which is T
estimate the difference between Cp and Cv for carbon tetrachloride at 25 C, for which cp...
estimate the difference between Cp and Cv for carbon tetrachloride at 25 C, for which cp = 132 j/mol k. At this temperature, CCl4 has a density of 1.59 g/cm3, its expansion coefficient is 1.24 x 10-3 K and its isothermal compressibility is 9.05 x 10 ^ -5 atm
A solution of 1.5 g benzoic acid (C6H5COOH; MW = 122.123 g/mol) in 100.0 g of...
A solution of 1.5 g benzoic acid (C6H5COOH; MW = 122.123 g/mol) in 100.0 g of carbon tetrachloride (CCl4; MW =153.822 g/mol) has a boiling point of 77.50°C. The boiling point of pure carbon tetrachloride is 76.72°C and the melting point is -22.92°C. Calculate the molecular weight of benzoic acid in the solution. Suggest a reason for the difference between the molar mass based on the formula (listed above) and the molar mass determined in part a.
Carbon tetrachloride CCl4 (a non polar molecule), has a normal boiling point of 76.7 C while...
Carbon tetrachloride CCl4 (a non polar molecule), has a normal boiling point of 76.7 C while methanol CH3OH (a very polar molecule), has a somewhat lower normal boiling point of 65 C. Offer a possible explanation for this difference in boiling points based on the different types of intermolecular forces present in the two liquids.
26. Melting Points of Lipids The melting points of a series of 18-carbon fatty acids are:...
26. Melting Points of Lipids The melting points of a series of 18-carbon fatty acids are: stearic acid, 69.6 °C, oleic acid, 13.4 °C; linoleic acid, -5 °C; and linolenic acid, -11 °C. (a) What structural aspect of these 18-carbon fatty acids can be correlated with the melting point? (b) Draw all the possible triacylglycerols that can be constructed from glycerol, palmitic acid, and oleic acid. Rank them in order of increasing melting point. (c) Branched-chain fatty acids are found...
Powder (shor sten FUNNELS Fitering (long stem 63 Chapter 4 Melting Points, Boiling Points, and Refractive Indices Q...
Powder (shor sten FUNNELS Fitering (long stem 63 Chapter 4 Melting Points, Boiling Points, and Refractive Indices Questions 1. What effect would poor circulation of the melting point bath liquid have on the observed melting point? 2. What is the effect of an insoluble impurity, such as sodium sulfate, on the observed melting point of a compound? 3. Three test tubes, labeled A, B, and C, contain substances with approxi- mately the same melting points. How could you prove the...
PART B MELTING POINTS OF SOME ORGANIC SUBSTANCES Circle the pair of substances of which you measured the melting point...
PART B MELTING POINTS OF SOME ORGANIC SUBSTANCES Circle the pair of substances of which you measured the melting point range 7 2-naphthol (A) and naphthalene (B) benzophenone (A) and benzil (B Complete the following table: [6 marks] Hint Molecules containing only Cand H can be assumed to be non-polar Present in Present in А Stronger in which substance? Why? Intermolecular Force В (yes or no) (yes or no) London Dispersion Dipole-Dipole Hydrogen Bonding Which of the two substances that...
Melting Point of p-dichlorobenzene 75.9 Melting Point of acetamide 53.2 degrees C Melting Point of solid...
Melting Point of p-dichlorobenzene 75.9 Melting Point of acetamide 53.2 degrees C Melting Point of solid mixture 53.8 degrees C Boiling Point of acetone 55.8 degrees C Boiling Point of ethyl alcohol 77.6 degrees C Boiling Point of acetone/ethyl alcohol mixture 72.7 What can you conclude about the melting points of pure and impure solids?
11.20 Explain the difference in the melting points of the following compounds: NO2 NO OH OH .p. 115°C m.p. 45°C m (Hint...
11.20 Explain the difference in the melting points of the following compounds: NO2 NO OH OH .p. 115°C m.p. 45°C m (Hint: Only one of the two can form intramolecular hydrogen bonds.)
(c ) Explain the difference between the 227°C melting point of tin(ll) chloride and the -33°C melting point of tin(IV)chloride. The 2270 melting point or tin I chlorid I means that it has a strunger Tonic bord which is T
26. Melting Points of Lipids The melting points of a series of 18-carbon fatty acids are: stearic acid, 69.6 °C, oleic acid, 13.4 °C; linoleic acid, -5 °C; and linolenic acid, -11 °C. (a) What structural aspect of these 18-carbon fatty acids can be correlated with the melting point? (b) Draw all the possible triacylglycerols that can be constructed from glycerol, palmitic acid, and oleic acid. Rank them in order of increasing melting point. (c) Branched-chain fatty acids are found...
Powder (shor sten FUNNELS Fitering (long stem 63 Chapter 4 Melting Points, Boiling Points, and Refractive Indices Questions 1. What effect would poor circulation of the melting point bath liquid have on the observed melting point? 2. What is the effect of an insoluble impurity, such as sodium sulfate, on the observed melting point of a compound? 3. Three test tubes, labeled A, B, and C, contain substances with approxi- mately the same melting points. How could you prove the...
PART B MELTING POINTS OF SOME ORGANIC SUBSTANCES Circle the pair of substances of which you measured the melting point range 7 2-naphthol (A) and naphthalene (B) benzophenone (A) and benzil (B Complete the following table: [6 marks] Hint Molecules containing only Cand H can be assumed to be non-polar Present in Present in А Stronger in which substance? Why? Intermolecular Force В (yes or no) (yes or no) London Dispersion Dipole-Dipole Hydrogen Bonding Which of the two substances that...
Melting Point of p-dichlorobenzene 75.9 Melting Point of acetamide 53.2 degrees C Melting Point of solid mixture 53.8 degrees C Boiling Point of acetone 55.8 degrees C Boiling Point of ethyl alcohol 77.6 degrees C Boiling Point of acetone/ethyl alcohol mixture 72.7 What can you conclude about the melting points of pure and impure solids?
11.20 Explain the difference in the melting points of the following compounds: NO2 NO OH OH .p. 115°C m.p. 45°C m (Hint: Only one of the two can form intramolecular hydrogen bonds.)
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 38 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago