![For questions 6 and 7 consider the reaction: 2 HI (g)H (g)+(g) 6. If the reaction is second order with respect to [HI] a plot](http://img.homeworklib.com/questions/658694c0-1d6d-11eb-8bcd-6da81dbe558f.png?x-oss-process=image/resize,w_560)
Homework Answers
6)For Second order rate is:
Rate = k*[HI]2 = -1/2 d[HI]/dt
1/[HI]=1/[HI]initial + kt
So t vs 1/[HI] will give straight line.
Option C
7) 1st Half life (2nd order) = 1/k*[HI]initial = 20sec
So,
2nd Half life (2nd order) = 2*1/k*[HI]initial
3rd Half life (2nd order) = 4*1/k*[HI]initial = 4*20sec = 80 seconds (Answer)
Add Answer to:
please solve as soon as possible
For questions 6 and 7 consider the reaction: 2 HI...
question 6, please! 5. Consider the following gas phase reaction and data to answer the next...
question 6, please!
5. Consider the following gas phase reaction and data to answer the next five questions. NO2 (g)CO (g) NO (g) +CO2 (g) Experiment [NO2, M [CO], MInitial Rate (M/sec) 0.10 0.10 0.0050 0.40 0.10 0.080 2 3 0.100.200.0050 What is the rate law for this reaction? A) Rate KNO22 B) Rate KINO2lICO]2 C) Rate = 서NO2][CO] D) Rate KNO21Co12 E) Rate KNO212co] 6. What is the numerical value for the rate constant, k of the reaction above?...
Please show the full reaction mechanism from products 5 -> 6 -> 7. Only use the...
Please show the full reaction mechanism from products 5
-> 6 -> 7. Only use the given reagents/reaction conditions
shown.
Scheme 1. Synthetic Route toward Compound1 Bno OM NHBz NHBz NH но. OH "Reagents and ditions: (a) NaH TBAL B Dr, dry THF, 78 °C to rt Sh 62%; (b) DAST, dry Pyri İne, dry C40,-20 ℃ to t 18 h, 56%, (c) 50% T FA HO re to rt 4 h, 100% (d) Ac O dry Py dine, 0...
Consider the reaction below: N2O4 (g) → 2 NO2 (g) Which of the following techniques be...
Consider the reaction below: N2O4 (g) → 2 NO2 (g) Which of the following techniques be used to determine the rate law is second order with respect to the concentration of dinitrogen tetroxide? O A graph of In([N204]) versus time will produce a straight line. A graph of [N204] versus time will produce a curved line. A graph of (N2O.) versus time will produce a straight line. The balanced chemical equation tells us that the reaction is first order with...
please help as soon as possible ergent Question 20 (1 point) What is the half-life of...
please help as soon as possible ergent
Question 20 (1 point) What is the half-life of the radioactive isotope from the first-order decay plot below? 0. 03 concentration 0.5 03 0.2 0.1 . 20 40 60 80 100 120 140 160 180 200 time (hours) 70 hours 35 hours 60 hours 140 hours We were unable to transcribe this imageQuestion 18 (1 point) On the phase diagram, point A denotes the and with an increase in pressure at a constant...
over the 11. In the reaction CLC) + 3F18) -- 2 CIF), if the average rate...
over the 11. In the reaction CLC) + 3F18) -- 2 CIF), if the average rate first 6.00 s, how much CIF, will form during this time S 2CFL the d ance of F, Fis 0250 -0.250 0.750 M b. 1.00 d. 2.00 M 1.50 M 3.00 M 12. Given the following data in the der of the reaction with respe 2 NO(g) ) - 2 NOCIS) Experiment INOT (M) 0.0300 0.0150 ICI (M) 0.0100 0.0100 0.0-400 Rate (M )...
Hi can You please solve [t-BuCl] remaining for my table the concentration of it remaining I only...
hi
can You please solve [t-BuCl] remaining for my table
the concentration of it remaining
I only used time trial attempt 1
heres my data with the table thats not filled in on the
picture:
for % t-BuCl remaining for trials 2-4:
I got 85 % trial 2, 90 % trial 3, and 95% trial 4
for trials 1-4 for time 1st attempt I got
87 seconds trial 1
72 seconds trial 2
35 seconds trial 3
7 seconds trial...
4. The rate constant for the reaction 3AAR is 250 x 10 molminHow long will it...
4. The rate constant for the reaction 3AAR is 250 x 10 molminHow long will it take the concentration of A to drop from 0.75 M to 0.50 M? (6 points) 5. The rate constant for the reaction 3A - 2B is 0.0447 5. What is the half-life of the reaction? (2 points) 6. Consider the reaction 3A C. If the reaction is second order with a half-life of 20.0 hrs Starting the reaction with an initial concentration of A...
need to solve number 20 - HI-POLYMER ERASER Pentue 2 Name: 20. An LTIC system is...
need to solve number 20
- HI-POLYMER ERASER Pentue 2 Name: 20. An LTIC system is given by the ABCD matrices A = (1 -] B = {. q} c = {11} D = bb a The input and initial conditions are x(t) = {41}} q(0) = {1} a) Find the ZIR for the system. b) Find the ZSR for the system. 21. Draw the amplitude Bode plot for the transfer function 22. Draw the amplitude Bode plot for the...
In a study of the decomposition of nitrosyl bromide at 10 °C NOBr—+NO+ Br2 the concentration...
In a study of the decomposition of nitrosyl bromide at 10 °C NOBr—+NO+ Br2 the concentration of NOBr was followed as a function of time. It was found that a graph of 1/[NOBr] versus time in seconds gave a straight line with a slope of 1.27 m?s and a y-intercept of 3.98 M? Based on this plot, the reaction is order in NOBr and the rate constant for the reaction is M?? In a study of the decomposition of hydrogen...
can you do the 6-12 number 8 is multiple choice 6. The initial rates listed in...
can
you do the 6-12 number 8 is multiple choice
6. The initial rates listed in the table below were determined for the reaction CO(g) + NO2(g) + CO2(g) + NO(g) at varied concentration of the reactants, CO and NO2. Determine the rate law of this reaction. Experiment Initial [CO] (mol/L) Initial [NO] (mol/L) Initial rate (mol/Ls) 5.0x10+ 3.5x10 3.4x10-8 5.0x10+ 7.0x10- 6.8x10-8 1.5x10 3.5x10 1.02x10-7 7. The half-life of the reaction C&H:(8) ► 2CH.g) at constant temperature is independent...
question 6, please!
5. Consider the following gas phase reaction and data to answer the next five questions. NO2 (g)CO (g) NO (g) +CO2 (g) Experiment [NO2, M [CO], MInitial Rate (M/sec) 0.10 0.10 0.0050 0.40 0.10 0.080 2 3 0.100.200.0050 What is the rate law for this reaction? A) Rate KNO22 B) Rate KINO2lICO]2 C) Rate = 서NO2][CO] D) Rate KNO21Co12 E) Rate KNO212co] 6. What is the numerical value for the rate constant, k of the reaction above?...
Please show the full reaction mechanism from products 5
-> 6 -> 7. Only use the given reagents/reaction conditions
shown.
Scheme 1. Synthetic Route toward Compound1 Bno OM NHBz NHBz NH но. OH "Reagents and ditions: (a) NaH TBAL B Dr, dry THF, 78 °C to rt Sh 62%; (b) DAST, dry Pyri İne, dry C40,-20 ℃ to t 18 h, 56%, (c) 50% T FA HO re to rt 4 h, 100% (d) Ac O dry Py dine, 0...
Consider the reaction below: N2O4 (g) → 2 NO2 (g) Which of the following techniques be used to determine the rate law is second order with respect to the concentration of dinitrogen tetroxide? O A graph of In([N204]) versus time will produce a straight line. A graph of [N204] versus time will produce a curved line. A graph of (N2O.) versus time will produce a straight line. The balanced chemical equation tells us that the reaction is first order with...
please help as soon as possible ergent
Question 20 (1 point) What is the half-life of the radioactive isotope from the first-order decay plot below? 0. 03 concentration 0.5 03 0.2 0.1 . 20 40 60 80 100 120 140 160 180 200 time (hours) 70 hours 35 hours 60 hours 140 hours We were unable to transcribe this imageQuestion 18 (1 point) On the phase diagram, point A denotes the and with an increase in pressure at a constant...
over the 11. In the reaction CLC) + 3F18) -- 2 CIF), if the average rate first 6.00 s, how much CIF, will form during this time S 2CFL the d ance of F, Fis 0250 -0.250 0.750 M b. 1.00 d. 2.00 M 1.50 M 3.00 M 12. Given the following data in the der of the reaction with respe 2 NO(g) ) - 2 NOCIS) Experiment INOT (M) 0.0300 0.0150 ICI (M) 0.0100 0.0100 0.0-400 Rate (M )...
hi
can You please solve [t-BuCl] remaining for my table
the concentration of it remaining
I only used time trial attempt 1
heres my data with the table thats not filled in on the
picture:
for % t-BuCl remaining for trials 2-4:
I got 85 % trial 2, 90 % trial 3, and 95% trial 4
for trials 1-4 for time 1st attempt I got
87 seconds trial 1
72 seconds trial 2
35 seconds trial 3
7 seconds trial...
4. The rate constant for the reaction 3AAR is 250 x 10 molminHow long will it take the concentration of A to drop from 0.75 M to 0.50 M? (6 points) 5. The rate constant for the reaction 3A - 2B is 0.0447 5. What is the half-life of the reaction? (2 points) 6. Consider the reaction 3A C. If the reaction is second order with a half-life of 20.0 hrs Starting the reaction with an initial concentration of A...
need to solve number 20
- HI-POLYMER ERASER Pentue 2 Name: 20. An LTIC system is given by the ABCD matrices A = (1 -] B = {. q} c = {11} D = bb a The input and initial conditions are x(t) = {41}} q(0) = {1} a) Find the ZIR for the system. b) Find the ZSR for the system. 21. Draw the amplitude Bode plot for the transfer function 22. Draw the amplitude Bode plot for the...
In a study of the decomposition of nitrosyl bromide at 10 °C NOBr—+NO+ Br2 the concentration of NOBr was followed as a function of time. It was found that a graph of 1/[NOBr] versus time in seconds gave a straight line with a slope of 1.27 m?s and a y-intercept of 3.98 M? Based on this plot, the reaction is order in NOBr and the rate constant for the reaction is M?? In a study of the decomposition of hydrogen...
can
you do the 6-12 number 8 is multiple choice
6. The initial rates listed in the table below were determined for the reaction CO(g) + NO2(g) + CO2(g) + NO(g) at varied concentration of the reactants, CO and NO2. Determine the rate law of this reaction. Experiment Initial [CO] (mol/L) Initial [NO] (mol/L) Initial rate (mol/Ls) 5.0x10+ 3.5x10 3.4x10-8 5.0x10+ 7.0x10- 6.8x10-8 1.5x10 3.5x10 1.02x10-7 7. The half-life of the reaction C&H:(8) ► 2CH.g) at constant temperature is independent...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 39 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 4 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 6 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 6 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago