Homework Answers
Add Answer to:
2. Complete the following oxidation-reaction: (3 points) 1+ CH2 1H 3. Label each of the following...
OH inctional group as an alcohol, ether, acetal, or 16.72 Label each functional group as an...
OH inctional group as an alcohol, ether, acetal, or 16.72 Label each functional group as an hemiacetal. осна OCH OCH CH2CH3 ОН b. CH3-C-OCH,CH,CH3 CHE 16.73 What acetal is formed when each aldehyde or ketone is
D-Glucose RC +HO-R = H----OH HOP! H -OH нон CH, OH "CH, OH OH HOROR R-C-OR...
D-Glucose RC +HO-R = H----OH HOP! H -OH нон CH, OH "CH, OH OH HOROR R-C-OR R -C-OR + HOH H HO-R Hemiacetal Acetal Aldehyde Alcohol OR 3-436- OHHO- --OR = R'--0 + HO- R R RC-OR + HOH HOR Ketone Alcohol Hemiketal Ketal ch Wired Company CH, OH Сен,он 5. Label the functional group as acetal, ketal, hemiacetal or hemiketal. KOH OH нон a-D-Glucopyranose B-D-Glucopyranose
Slide appropriate reactants into the boxes to conduct the following synthetic transformation. You don't need to...
Slide appropriate reactants into the boxes to conduct the following synthetic transformation. You don't need to necessarily fill all the boxes, but if you don't use them all, fill from the top down. Unused boxes can be left empty. Br CH3CH2CH2Li 1. BH3-THF; 2. NaOH, H2O2, H2o Hg2+, H2O, H+ KCN, HCN H20, H+ CH3OH, H+ NaOH, H2O 1. (Sia 2BH; 2. NaOH, H2O2, H2O PhLi HOCH2CH2OH, H+ Nothing Needed PCC PhMgBr CH3CH2NH2, H+ H2Cr04 KCN NaBH4, MeOH (CH3CH2CH2)2Culi CH3CH2MgBr...
Which is the correct name for 1 a-3-iodopentan-2-al b-2-Iodopentan-3-one c-3-lodopentan-2-one 0-2-lodopentan-3-al Which is the correct name...
Which is the correct name for 1 a-3-iodopentan-2-al b-2-Iodopentan-3-one c-3-lodopentan-2-one 0-2-lodopentan-3-al Which is the correct name for a. 2-iodobutan-3-al b-3-jodobutan-2-one c-2-iodobutan-3-one d-3-iodobutan-2-al Which is the correct name for? a d-methylpropanal ethylpropanalb-propanone o-butanone 9. Which is the correct name for CH3CH2COCH2CH32 a diethyl ketone b-pentan-4-one c-pentan-3-ald-pentan-3-one e-pentan-2-one '' Which is the correct name for CH3CHO, a. Ethone b-ethanol c-vinger d-ketanal e-ethanal 11 ICH 2 -CH2-C-CH2-CH3 Which is the correct name for a. 5-jodopentan-2-one b- 1-iodopentan-2-one c-1-iodopentan-3-one d-5-iodopentan-3-one 12-Which of the following...
Which is the correct name for 2-3-iedopentan-2-alb-2-ledopeatan-3-one .B.Iodopentan-2-one 4-2-iodopentanal FLED THIS Which is the correct name...
Which is the correct name for 2-3-iedopentan-2-alb-2-ledopeatan-3-one .B.Iodopentan-2-one 4-2-iodopentanal FLED THIS Which is the correct name for a 2-lodobutan-3-al b-3-lodobutan-2-one c-2-lodobutan-3-one d-3-lodobutan-2-al Which is the correct name for? -butanone d-methylpropanal a ethylpropanalb-propanone 9. Which is the correct name for CH3CH2COCH2CH32 diethyl ketone b-pentan-4-one c-pentan-3-al d-pentan-3-one c.pentan-2-one 10 Which is the correct name for - CH3CH03 -ethanal a. Ethone b-ethanol c-vinger d-ketanal ICH-CH2-C-CH2-CH3 Which is the correct name for a. 5-iodopentan-2-one b. 1-iodopentan-2-one c-1-iodopentan-3-one d-5-iodopentan-3-one 12. Which of the following properly...
Question 13 Match each of the following organic compounds with its name A. CH3 -CH2--0--CH3 A....
Question 13 Match each of the following organic compounds with its name A. CH3 -CH2--0--CH3 A. ethyl methyl ether B. propanal 0 11 CH3 CH2 C-H CI 0 C. 3-chloro-2 butanone D. ethanol CH3 CH--C--CH3 CH3-CH2-OH Question 18 CH3-CH2-O- CH2 - CH3 Which of the following active groups is present in the organic structure above A. aldehyde B. alcohol C. acid D. ketone E. ether
15. llemlacetals are? produced on the oxidation of carboxylic acid b.result of the reaction between an...
15. llemlacetals are? produced on the oxidation of carboxylic acid b.result of the reaction between an sidchyde and a ketone are produced when an ether reacts with a kotone d composed from Ether and OH group care produced when an alcohol reacts with sketone 16. To what class of compounds does plucose belong cyclic ketoneb. cyclic aldehyde sydliehamiacetald . 17. The correct IUPAC same for this compound is OCH, CH, & in-cw con 3-methyl-4-diopetanal e-3-methyl-4-oxopentanol b. 3-methyl-4-oxopentanone d. 3-methyl-4-oxopentanal 18.Which...
match each structure with type of compound listed si •OCH3 Phenol Thiol Amine Amide ③ CH...
match each structure with type of compound listed si •OCH3 Phenol Thiol Amine Amide ③ CH ₃ CH 2 OCH 3 4 CH ₃ CHA SH Ether OH Alcohol Aldehyde Na © Ester Ketone (7) CH₃ CH₂ COH Carboxylic Acid 0 ③ chacha CH₃CH2 CH @ "NH3 00 H 7 What is the hybridization of the oxygen labeled 1? OH ② Sp3 Bs © SP OS Wherkkelsetele How many stereogenic Centers are in this molecule Ispa OH 12 ①1 ①0...
1. write how many hydrogens are present around each indicated atom OH 2. Identify the type...
1. write how many hydrogens are present around each indicated atom OH 2. Identify the type of organic molecule. Options: ALKANE, ALKENE, ALKYNE, AROMATIC, ETHER, ESTER, ALCOHOL, ALDEHYDE KETONE, THOL, AMIDE, AMINE, CARBOXYLIC ACID a. CH3 H3C-CH2-c-0CH3 CH3 b. 3. Name the organic compound a. Br CH2CH3 CH-CH-CH-CH-04-04-CH, 4.Draw the complete balanced chemical equation for the halogenation reaction of 1-pentene by bromine gas, Br2(g).
Name Worksheet Alcohols, Aldehydes, Ketons 1. Circle the molecule which will have the highest boiling point:...
Name Worksheet Alcohols, Aldehydes, Ketons 1. Circle the molecule which will have the highest boiling point: CH,CH2CH3 CH2=CHCH, CH,CH2-OH 2. Classify these alcohols as 1º,2º, or 30: OH CH3CH2CHCHCH2CH2-OH: C1 CH) 4-choloro 3-hexene HH OHH H-C-C-C-C-H Η Η H H-C-H CH3CHCH OH 2-propanol H 3. Name each of these alcohols: CH,CH2CHCHCH2CH2-OH CH CH3CH2-OH Ethyl alcohol HH OHH H-C-C-C--H Η Η H H-CH CH,CHCH OH H Aldehydes and Ketons nonsolo 4. Give the IUPAC names for the following aldehydes: OH O...
OH inctional group as an alcohol, ether, acetal, or 16.72 Label each functional group as an hemiacetal. осна OCH OCH CH2CH3 ОН b. CH3-C-OCH,CH,CH3 CHE 16.73 What acetal is formed when each aldehyde or ketone is
D-Glucose RC +HO-R = H----OH HOP! H -OH нон CH, OH "CH, OH OH HOROR R-C-OR R -C-OR + HOH H HO-R Hemiacetal Acetal Aldehyde Alcohol OR 3-436- OHHO- --OR = R'--0 + HO- R R RC-OR + HOH HOR Ketone Alcohol Hemiketal Ketal ch Wired Company CH, OH Сен,он 5. Label the functional group as acetal, ketal, hemiacetal or hemiketal. KOH OH нон a-D-Glucopyranose B-D-Glucopyranose
Slide appropriate reactants into the boxes to conduct the following synthetic transformation. You don't need to necessarily fill all the boxes, but if you don't use them all, fill from the top down. Unused boxes can be left empty. Br CH3CH2CH2Li 1. BH3-THF; 2. NaOH, H2O2, H2o Hg2+, H2O, H+ KCN, HCN H20, H+ CH3OH, H+ NaOH, H2O 1. (Sia 2BH; 2. NaOH, H2O2, H2O PhLi HOCH2CH2OH, H+ Nothing Needed PCC PhMgBr CH3CH2NH2, H+ H2Cr04 KCN NaBH4, MeOH (CH3CH2CH2)2Culi CH3CH2MgBr...
Which is the correct name for 1 a-3-iodopentan-2-al b-2-Iodopentan-3-one c-3-lodopentan-2-one 0-2-lodopentan-3-al Which is the correct name for a. 2-iodobutan-3-al b-3-jodobutan-2-one c-2-iodobutan-3-one d-3-iodobutan-2-al Which is the correct name for? a d-methylpropanal ethylpropanalb-propanone o-butanone 9. Which is the correct name for CH3CH2COCH2CH32 a diethyl ketone b-pentan-4-one c-pentan-3-ald-pentan-3-one e-pentan-2-one '' Which is the correct name for CH3CHO, a. Ethone b-ethanol c-vinger d-ketanal e-ethanal 11 ICH 2 -CH2-C-CH2-CH3 Which is the correct name for a. 5-jodopentan-2-one b- 1-iodopentan-2-one c-1-iodopentan-3-one d-5-iodopentan-3-one 12-Which of the following...
Which is the correct name for 2-3-iedopentan-2-alb-2-ledopeatan-3-one .B.Iodopentan-2-one 4-2-iodopentanal FLED THIS Which is the correct name for a 2-lodobutan-3-al b-3-lodobutan-2-one c-2-lodobutan-3-one d-3-lodobutan-2-al Which is the correct name for? -butanone d-methylpropanal a ethylpropanalb-propanone 9. Which is the correct name for CH3CH2COCH2CH32 diethyl ketone b-pentan-4-one c-pentan-3-al d-pentan-3-one c.pentan-2-one 10 Which is the correct name for - CH3CH03 -ethanal a. Ethone b-ethanol c-vinger d-ketanal ICH-CH2-C-CH2-CH3 Which is the correct name for a. 5-iodopentan-2-one b. 1-iodopentan-2-one c-1-iodopentan-3-one d-5-iodopentan-3-one 12. Which of the following properly...
Question 13 Match each of the following organic compounds with its name A. CH3 -CH2--0--CH3 A. ethyl methyl ether B. propanal 0 11 CH3 CH2 C-H CI 0 C. 3-chloro-2 butanone D. ethanol CH3 CH--C--CH3 CH3-CH2-OH Question 18 CH3-CH2-O- CH2 - CH3 Which of the following active groups is present in the organic structure above A. aldehyde B. alcohol C. acid D. ketone E. ether
15. llemlacetals are? produced on the oxidation of carboxylic acid b.result of the reaction between an sidchyde and a ketone are produced when an ether reacts with a kotone d composed from Ether and OH group care produced when an alcohol reacts with sketone 16. To what class of compounds does plucose belong cyclic ketoneb. cyclic aldehyde sydliehamiacetald . 17. The correct IUPAC same for this compound is OCH, CH, & in-cw con 3-methyl-4-diopetanal e-3-methyl-4-oxopentanol b. 3-methyl-4-oxopentanone d. 3-methyl-4-oxopentanal 18.Which...
match each structure with type of compound listed si •OCH3 Phenol Thiol Amine Amide ③ CH ₃ CH 2 OCH 3 4 CH ₃ CHA SH Ether OH Alcohol Aldehyde Na © Ester Ketone (7) CH₃ CH₂ COH Carboxylic Acid 0 ③ chacha CH₃CH2 CH @ "NH3 00 H 7 What is the hybridization of the oxygen labeled 1? OH ② Sp3 Bs © SP OS Wherkkelsetele How many stereogenic Centers are in this molecule Ispa OH 12 ①1 ①0...
1. write how many hydrogens are present around each indicated atom OH 2. Identify the type of organic molecule. Options: ALKANE, ALKENE, ALKYNE, AROMATIC, ETHER, ESTER, ALCOHOL, ALDEHYDE KETONE, THOL, AMIDE, AMINE, CARBOXYLIC ACID a. CH3 H3C-CH2-c-0CH3 CH3 b. 3. Name the organic compound a. Br CH2CH3 CH-CH-CH-CH-04-04-CH, 4.Draw the complete balanced chemical equation for the halogenation reaction of 1-pentene by bromine gas, Br2(g).
Name Worksheet Alcohols, Aldehydes, Ketons 1. Circle the molecule which will have the highest boiling point: CH,CH2CH3 CH2=CHCH, CH,CH2-OH 2. Classify these alcohols as 1º,2º, or 30: OH CH3CH2CHCHCH2CH2-OH: C1 CH) 4-choloro 3-hexene HH OHH H-C-C-C-C-H Η Η H H-C-H CH3CHCH OH 2-propanol H 3. Name each of these alcohols: CH,CH2CHCHCH2CH2-OH CH CH3CH2-OH Ethyl alcohol HH OHH H-C-C-C--H Η Η H H-CH CH,CHCH OH H Aldehydes and Ketons nonsolo 4. Give the IUPAC names for the following aldehydes: OH O...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 30 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago