Homework Answers
Answer:
The three useful organic compounds used for non stick coatings for cooking given below:
1. PTFE (polytetrafluoroethylene) which is a well known by a brand called Teflon.
2. Ceramics
3.PFOA is a chemical compound used in the manufacturing of nonstick coating.
Add Answer to:
Questions: 1. Use the internet to identify 3 useful organic compounds (e.g., non-stick coatings for cookware).
Need help on these questions 1) Draw condensed structural formulas for the following organic compounds Organic...
Need help on these questions
1) Draw condensed structural formulas for the following organic compounds Organic Name Condensed Structural Formula 1,1,1-trichloroethane (2) 2,3-dibromo-1-fluoro-2,4,5- trimethylhexane (4) 2,2-dimethylpropane (2) 2) Draw the line structural formulas for the following organic compounds Organic Name Line Structural Formula 3-isopropylhexane (2) 1,1,2-tribromopropane (2) 2,3,5,5-tetramethyloctane (2) 5) For the following organic molecule put circles around primary carbons squares around secondary carbons, triangles around tertiary carbons.(3) CH3 CHз I CH2-C I -CH— сHз CH2 CH3 I CHз 6)...
Qualitative Analysis of Organic Compounds: Pre lab questions (5 pts) 1. (1 point) Identify the functional...
Qualitative Analysis of Organic Compounds: Pre lab questions (5 pts) 1. (1 point) Identify the functional groups based on color / odor a. Dark yellow to red color indicates that the functional group could possibly be------------- b. Fruity / Floral odor indicates that the functional group could possibly be------------- c. Fishy odor indicates that the functional group could possibly be------------- d. Sharp, biting odor indicates that the functional group could possibly be------------- 2. (0.5 pts) If a liquid is soluble...
Question 1: Circle all the classes of organic compounds present in this molecule and identify them....
Question 1: Circle all the classes of organic compounds present in this molecule and identify them. HN
? Most organisms contain ? ? 1) organic compounds, only 2) inorganic compounds, only 3) both...
? Most organisms contain ? ? 1) organic compounds, only 2) inorganic compounds, only 3) both organic and inorganic compounds 4) neither organic nor inorganic compounds
1. Why are melting point measurements used only to identify organic compounds and not to measure...
1. Why are melting point measurements used only to identify organic compounds and not to measure inorganic chemicals? 2. What is Freezing point? Can you give an example in your daily life? What happens when sugar is continuously added into a cup of water? What is the difference if the saturated sugar cup of water is heated? 3.
Second Academic Assignment Student's Name: 1. Identify formulas of organic compounds. KCI _CaH10 _H2SO4 CaCl2 C3H7C1...
Second Academic Assignment Student's Name: 1. Identify formulas of organic compounds. KCI _CaH10 _H2SO4 CaCl2 C3H7C1 2. Identify the properties more typical of an organic compound. Lis soluble in water _has a low boiling point contains carbon and hydrogen contains ionic bonds contains Li and F _contains covalent bonds produces ions in water 3. Draw the condensed, expanded, and skeletal formulas for the following alkanes. a. methane b.ethane c. pentane d.cyclopropane
Organic compounds: Types, Nomenclature, Properties 1. Identify the classes of molecules indicated by the pictures or...
Organic compounds: Types, Nomenclature, Properties 1. Identify the classes of molecules indicated by the pictures or chemical formulas below. Solid lines indicate carbon atoms. For simplicity, hydrogen atoms attached to the carbon atoms are sometimes not shown. a) 유 b) RR OH CH d) (CH3)3C-NH2 2. Provide the class of organic molecule given the names below a) butanol b) methyl ethanoate c) propanal d) diethyl ether
3) Identify the reagents that you would use to produce the following compounds using a Claisen...
3) Identify the reagents that you would use to produce the
following compounds using a Claisen condensation.
4) For the following reaction, predict the major product and
propose a mechanism for its formation.
3. Identify the reagents that you would use to produce the following compounds using a Claisen condensation. 4. For each of the following reactions, predict the major product and propose a mechanism for its formation. 1) LDA. 2) CHal
Name the compounds Name the following organic compounds. 2. CHa 3 01 1 CHs-CH CH-C-CH-CH Name the following organi...
Name the compounds
Name the following organic compounds. 2. CHa 3 01 1 CHs-CH CH-C-CH-CH
Name the following organic compounds. 2. CHa 3 01 1 CHs-CH CH-C-CH-CH
Classify the following compounds as potential fuels and non-fuels. 3) (1) classify the following compounds as...
Classify the following compounds as potential fuels and non-fuels.
3) (1) classify the following compounds as potential fuels and non-fuels. A) H2 B) CO2 C) C3Hg D) CCl4 E) H20 F) HCI G) C H) CoH120 ID C&His Answer: Answer: Answer: Answer Answer: Answer: Answer: Answer: Answer:
Need help on these questions
1) Draw condensed structural formulas for the following organic compounds Organic Name Condensed Structural Formula 1,1,1-trichloroethane (2) 2,3-dibromo-1-fluoro-2,4,5- trimethylhexane (4) 2,2-dimethylpropane (2) 2) Draw the line structural formulas for the following organic compounds Organic Name Line Structural Formula 3-isopropylhexane (2) 1,1,2-tribromopropane (2) 2,3,5,5-tetramethyloctane (2) 5) For the following organic molecule put circles around primary carbons squares around secondary carbons, triangles around tertiary carbons.(3) CH3 CHз I CH2-C I -CH— сHз CH2 CH3 I CHз 6)...
Question 1: Circle all the classes of organic compounds present in this molecule and identify them. HN
1. Why are melting point measurements used only to identify organic compounds and not to measure inorganic chemicals? 2. What is Freezing point? Can you give an example in your daily life? What happens when sugar is continuously added into a cup of water? What is the difference if the saturated sugar cup of water is heated? 3.
Second Academic Assignment Student's Name: 1. Identify formulas of organic compounds. KCI _CaH10 _H2SO4 CaCl2 C3H7C1 2. Identify the properties more typical of an organic compound. Lis soluble in water _has a low boiling point contains carbon and hydrogen contains ionic bonds contains Li and F _contains covalent bonds produces ions in water 3. Draw the condensed, expanded, and skeletal formulas for the following alkanes. a. methane b.ethane c. pentane d.cyclopropane
Organic compounds: Types, Nomenclature, Properties 1. Identify the classes of molecules indicated by the pictures or chemical formulas below. Solid lines indicate carbon atoms. For simplicity, hydrogen atoms attached to the carbon atoms are sometimes not shown. a) 유 b) RR OH CH d) (CH3)3C-NH2 2. Provide the class of organic molecule given the names below a) butanol b) methyl ethanoate c) propanal d) diethyl ether
3) Identify the reagents that you would use to produce the
following compounds using a Claisen condensation.
4) For the following reaction, predict the major product and
propose a mechanism for its formation.
3. Identify the reagents that you would use to produce the following compounds using a Claisen condensation. 4. For each of the following reactions, predict the major product and propose a mechanism for its formation. 1) LDA. 2) CHal
Name the compounds
Name the following organic compounds. 2. CHa 3 01 1 CHs-CH CH-C-CH-CH
Name the following organic compounds. 2. CHa 3 01 1 CHs-CH CH-C-CH-CH
Classify the following compounds as potential fuels and non-fuels.
3) (1) classify the following compounds as potential fuels and non-fuels. A) H2 B) CO2 C) C3Hg D) CCl4 E) H20 F) HCI G) C H) CoH120 ID C&His Answer: Answer: Answer: Answer Answer: Answer: Answer: Answer: Answer:
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 2 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 52 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago